JP2017505299A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2017505299A5 JP2017505299A5 JP2016544671A JP2016544671A JP2017505299A5 JP 2017505299 A5 JP2017505299 A5 JP 2017505299A5 JP 2016544671 A JP2016544671 A JP 2016544671A JP 2016544671 A JP2016544671 A JP 2016544671A JP 2017505299 A5 JP2017505299 A5 JP 2017505299A5
- Authority
- JP
- Japan
- Prior art keywords
- substituted
- aryl
- acid ester
- alkyl
- acetic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 sticks Substances 0.000 claims description 66
- 125000001072 heteroaryl group Chemical group 0.000 claims description 58
- 125000003118 aryl group Chemical group 0.000 claims description 53
- 150000001875 compounds Chemical class 0.000 claims description 52
- 125000003107 substituted aryl group Chemical group 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 201000004624 Dermatitis Diseases 0.000 claims description 22
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 20
- 239000008194 pharmaceutical composition Substances 0.000 claims description 18
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 16
- 208000017520 skin disease Diseases 0.000 claims description 15
- 206010012438 Dermatitis atopic Diseases 0.000 claims description 11
- 201000008937 atopic dermatitis Diseases 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 210000003491 skin Anatomy 0.000 claims description 11
- 208000011219 Netherton syndrome Diseases 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 10
- 201000004681 Psoriasis Diseases 0.000 claims description 9
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 7
- 206010061218 Inflammation Diseases 0.000 claims description 6
- 208000003251 Pruritus Diseases 0.000 claims description 6
- 239000002537 cosmetic Substances 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 210000002615 epidermis Anatomy 0.000 claims description 6
- 230000004054 inflammatory process Effects 0.000 claims description 6
- 239000000843 powder Substances 0.000 claims description 6
- 208000002874 Acne Vulgaris Diseases 0.000 claims description 5
- 206010012442 Dermatitis contact Diseases 0.000 claims description 5
- 206010020649 Hyperkeratosis Diseases 0.000 claims description 5
- 206010000496 acne Diseases 0.000 claims description 5
- 208000010668 atopic eczema Diseases 0.000 claims description 5
- 208000010247 contact dermatitis Diseases 0.000 claims description 5
- 206010020718 hyperplasia Diseases 0.000 claims description 5
- RYWUMJHVVXOYQW-UHFFFAOYSA-N CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)OC Chemical compound CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)OC RYWUMJHVVXOYQW-UHFFFAOYSA-N 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 239000000344 soap Substances 0.000 claims description 4
- YWSFXRQJMSAMSU-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-methyl-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxobutanoic acid Chemical compound CC(C(C(O)=O)c1ccc(Cl)cc1)C(=O)Nc1cc(C)on1 YWSFXRQJMSAMSU-UHFFFAOYSA-N 0.000 claims description 3
- FUWOOTAXFYQPTH-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-(4-methoxyanilino)-3-methyl-4-oxobutanoic acid Chemical compound COc1ccc(NC(=O)C(C)C(C(O)=O)c2ccc(Cl)cc2)cc1 FUWOOTAXFYQPTH-UHFFFAOYSA-N 0.000 claims description 3
- QKOICGUUDFILRL-UHFFFAOYSA-N 2-(4-methoxyphenyl)-3-methyl-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxobutanoic acid Chemical compound COc1ccc(cc1)C(C(C)C(=O)Nc1cc(C)on1)C(O)=O QKOICGUUDFILRL-UHFFFAOYSA-N 0.000 claims description 3
- BYOAFCJGRTYQOT-UHFFFAOYSA-N 2-(4-methoxyphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxo-3-phenylbutanoic acid Chemical compound COc1ccc(cc1)C(C(C(=O)Nc1cc(C)on1)c1ccccc1)C(O)=O BYOAFCJGRTYQOT-UHFFFAOYSA-N 0.000 claims description 3
- KSCJGKOKCZYEOG-UHFFFAOYSA-N 2-benzamido-3-methyl-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxo-2-phenylbutanoic acid Chemical compound CC(C(=O)Nc1cc(C)on1)C(NC(=O)c1ccccc1)(C(O)=O)c1ccccc1 KSCJGKOKCZYEOG-UHFFFAOYSA-N 0.000 claims description 3
- MPWVIXDTLUZMMZ-UHFFFAOYSA-N 2-benzamido-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxo-2-phenylbutanoic acid Chemical compound Cc1cc(NC(=O)CC(NC(=O)c2ccccc2)(C(O)=O)c2ccccc2)no1 MPWVIXDTLUZMMZ-UHFFFAOYSA-N 0.000 claims description 3
- DUVDFBMOUUZJDG-UHFFFAOYSA-N CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)Cl Chemical compound CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)Cl DUVDFBMOUUZJDG-UHFFFAOYSA-N 0.000 claims description 3
- HPDYJXRGNQGEGW-UHFFFAOYSA-N COC1=CC=C(C=C1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)Cl Chemical compound COC1=CC=C(C=C1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)Cl HPDYJXRGNQGEGW-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002671 adjuvant Substances 0.000 claims description 3
- 239000006071 cream Substances 0.000 claims description 3
- 239000000499 gel Substances 0.000 claims description 3
- 239000000865 liniment Substances 0.000 claims description 3
- 239000006210 lotion Substances 0.000 claims description 3
- 239000002674 ointment Substances 0.000 claims description 3
- 239000006072 paste Substances 0.000 claims description 3
- 239000002453 shampoo Substances 0.000 claims description 3
- 239000007921 spray Substances 0.000 claims description 3
- 238000011200 topical administration Methods 0.000 claims description 3
- XRMJQPQWXZLSHM-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-[(4-methoxyphenyl)carbamoyl]-4-methylpentanoic acid Chemical compound COc1ccc(NC(=O)C(C(C)C)C(C(O)=O)c2ccc(Cl)cc2)cc1 XRMJQPQWXZLSHM-UHFFFAOYSA-N 0.000 claims description 2
- UBFYBBOEFOUNBO-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxobutanoic acid Chemical compound Cc1cc(NC(=O)CC(C(O)=O)c2ccc(Cl)cc2)no1 UBFYBBOEFOUNBO-UHFFFAOYSA-N 0.000 claims description 2
- NWQNOVAXJRAJFA-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-methyl-3-(phenylcarbamoyl)pentanoic acid Chemical compound CC(C)C(C(C(O)=O)c1ccc(Cl)cc1)C(=O)Nc1ccccc1 NWQNOVAXJRAJFA-UHFFFAOYSA-N 0.000 claims description 2
- JQQFBGBWVZNMBC-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-methyl-3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]pentanoic acid Chemical compound CC(C)C(C(C(O)=O)c1ccc(Cl)cc1)C(=O)Nc1cc(C)on1 JQQFBGBWVZNMBC-UHFFFAOYSA-N 0.000 claims description 2
- TXILIAXAWMMBHD-UHFFFAOYSA-N 2-(4-chlorophenyl)pentanoic acid Chemical compound CCCC(C(O)=O)C1=CC=C(Cl)C=C1 TXILIAXAWMMBHD-UHFFFAOYSA-N 0.000 claims description 2
- MPPMFHKKKFILQQ-UHFFFAOYSA-N 2-(4-methoxyphenyl)-4-methyl-3-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]pentanoic acid Chemical compound COc1ccc(cc1)C(C(C(C)C)C(=O)Nc1cc(C)on1)C(O)=O MPPMFHKKKFILQQ-UHFFFAOYSA-N 0.000 claims description 2
- KAUOEQKBVBIDCW-UHFFFAOYSA-N 2-benzamido-3-[(4-fluorophenyl)carbamoyl]-4-methyl-2-phenylpentanoic acid Chemical compound CC(C)C(C(=O)Nc1ccc(F)cc1)C(NC(=O)c1ccccc1)(C(O)=O)c1ccccc1 KAUOEQKBVBIDCW-UHFFFAOYSA-N 0.000 claims description 2
- IVQPIUWYPNCTTF-UHFFFAOYSA-N 2-benzamido-4-(4-fluoroanilino)-4-oxo-2-phenylbutanoic acid Chemical compound OC(=O)C(CC(=O)Nc1ccc(F)cc1)(NC(=O)c1ccccc1)c1ccccc1 IVQPIUWYPNCTTF-UHFFFAOYSA-N 0.000 claims description 2
- GIXMRSKEDLNBOW-UHFFFAOYSA-N 2-benzamido-4-(4-methoxyanilino)-4-oxo-2-phenylbutanoic acid Chemical compound COc1ccc(NC(=O)CC(NC(=O)c2ccccc2)(C(O)=O)c2ccccc2)cc1 GIXMRSKEDLNBOW-UHFFFAOYSA-N 0.000 claims description 2
- XHPGWKKFSGUVIA-UHFFFAOYSA-N 2-benzamido-4-(benzylamino)-3-methyl-4-oxo-2-phenylbutanoic acid Chemical compound CC(C(=O)NCc1ccccc1)C(NC(=O)c1ccccc1)(C(O)=O)c1ccccc1 XHPGWKKFSGUVIA-UHFFFAOYSA-N 0.000 claims description 2
- LBVHMOPZRMECJA-UHFFFAOYSA-N 2-benzamido-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxo-2,3-diphenylbutanoic acid Chemical compound Cc1cc(NC(=O)C(c2ccccc2)C(NC(=O)c2ccccc2)(C(O)=O)c2ccccc2)no1 LBVHMOPZRMECJA-UHFFFAOYSA-N 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- INGBXGLPWDUGST-UHFFFAOYSA-N CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC(=C(C=C1)Cl)Cl Chemical compound CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC(=C(C=C1)Cl)Cl INGBXGLPWDUGST-UHFFFAOYSA-N 0.000 claims description 2
- IBFWYKABQPNMAJ-UHFFFAOYSA-N CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC(=C(C=C1)OC)OC Chemical compound CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC(=C(C=C1)OC)OC IBFWYKABQPNMAJ-UHFFFAOYSA-N 0.000 claims description 2
- JNHUWVCHRIDQEN-UHFFFAOYSA-N CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC2=C(OCO2)C=C1 Chemical compound CC1=CC(=NO1)NC(=O)C(CC)C(C(=O)O)C1=CC2=C(OCO2)C=C1 JNHUWVCHRIDQEN-UHFFFAOYSA-N 0.000 claims description 2
- BERGJRZHTHMQOD-UHFFFAOYSA-N CCC(C(C1=CC=C(C=C1)Cl)C(=O)O)C(=O)NC2=CC=CC=C2 Chemical compound CCC(C(C1=CC=C(C=C1)Cl)C(=O)O)C(=O)NC2=CC=CC=C2 BERGJRZHTHMQOD-UHFFFAOYSA-N 0.000 claims description 2
- RSBGCOBOOZQHND-UHFFFAOYSA-N N(C1=CC=CC=C1)C(C(C1=CC=CC=C1)C(C(=O)O)(C1=CC=CC=C1)NC(C1=CC=CC=C1)=O)=O Chemical compound N(C1=CC=CC=C1)C(C(C1=CC=CC=C1)C(C(=O)O)(C1=CC=CC=C1)NC(C1=CC=CC=C1)=O)=O RSBGCOBOOZQHND-UHFFFAOYSA-N 0.000 claims description 2
- BTJMDYPTNWUDOF-UHFFFAOYSA-N N(C1=CC=CC=C1)C(CC(C(=O)O)(C1=CC=CC=C1)NC(C1=CC=CC=C1)=O)=O Chemical compound N(C1=CC=CC=C1)C(CC(C(=O)O)(C1=CC=CC=C1)NC(C1=CC=CC=C1)=O)=O BTJMDYPTNWUDOF-UHFFFAOYSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 8
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 claims 1
- XTSGSBYVBKSIPE-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)NC(C(=O)OC(C(C)C)C(NC1=NOC(=C1)C)=O)C1=CC=CC=C1.C1(CCCC1)CCC(=O)OC(C(C)C)C(NC1=NOC(=C1)C)=O Chemical compound C(C1=CC=CC=C1)(=O)NC(C(=O)OC(C(C)C)C(NC1=NOC(=C1)C)=O)C1=CC=CC=C1.C1(CCCC1)CCC(=O)OC(C(C)C)C(NC1=NOC(=C1)C)=O XTSGSBYVBKSIPE-UHFFFAOYSA-N 0.000 claims 1
- YZWSAYJEGCLHJY-UHFFFAOYSA-N COC1=CC=C(NC(CC(C(=O)O)C2=CC=C(C=C2)OC)=O)C=C1.C1(CCCC1)CCC(=O)OC(C(=O)NCC1=CC=CC=C1)C1=CC=CC=C1 Chemical compound COC1=CC=C(NC(CC(C(=O)O)C2=CC=C(C=C2)OC)=O)C=C1.C1(CCCC1)CCC(=O)OC(C(=O)NCC1=CC=CC=C1)C1=CC=CC=C1 YZWSAYJEGCLHJY-UHFFFAOYSA-N 0.000 claims 1
- ZTAVVEXNVGBJIJ-UHFFFAOYSA-N [1-(4-methoxyanilino)-3-methyl-1-oxobutan-2-yl] 2-benzamido-2-phenylacetate Chemical compound COC1=CC=C(NC(=O)C(OC(=O)C(NC(=O)C2=CC=CC=C2)C2=CC=CC=C2)C(C)C)C=C1 ZTAVVEXNVGBJIJ-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims 1
- 230000002757 inflammatory effect Effects 0.000 claims 1
- 102100034867 Kallikrein-7 Human genes 0.000 description 43
- 101710176222 Kallikrein-7 Proteins 0.000 description 41
- 238000005160 1H NMR spectroscopy Methods 0.000 description 31
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 24
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 22
- 230000000694 effects Effects 0.000 description 18
- 239000003112 inhibitor Substances 0.000 description 18
- 102000004190 Enzymes Human genes 0.000 description 13
- 108090000790 Enzymes Proteins 0.000 description 13
- 229940088598 enzyme Drugs 0.000 description 13
- 210000000434 stratum corneum Anatomy 0.000 description 12
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 8
- 102000012479 Serine Proteases Human genes 0.000 description 7
- 108010022999 Serine Proteases Proteins 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- 230000002265 prevention Effects 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 101001091388 Homo sapiens Kallikrein-7 Proteins 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 238000007792 addition Methods 0.000 description 5
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 5
- 150000002632 lipids Chemical class 0.000 description 5
- 125000006413 ring segment Chemical group 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 102000035195 Peptidases Human genes 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- 108010005020 Serine Peptidase Inhibitor Kazal-Type 5 Proteins 0.000 description 4
- 102100025420 Serine protease inhibitor Kazal-type 5 Human genes 0.000 description 4
- 206010040844 Skin exfoliation Diseases 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- 230000035618 desquamation Effects 0.000 description 4
- 230000014509 gene expression Effects 0.000 description 4
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 108060005987 Kallikrein Proteins 0.000 description 3
- 102100034868 Kallikrein-5 Human genes 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- MZFHUFJGUSCBFL-UHFFFAOYSA-N [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 3-cyclopentylpropanoate Chemical compound CC(OC(=O)CCC1CCCC1)C(=O)NC1=NOC(C)=C1 MZFHUFJGUSCBFL-UHFFFAOYSA-N 0.000 description 3
- CUEBLILMAQDZAE-UHFFFAOYSA-N [2-(4-methoxyanilino)-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate Chemical compound C1(CCCC1)CCC(=O)OC(C(=O)NC1=CC=C(C=C1)OC)C1=CC=CC=C1 CUEBLILMAQDZAE-UHFFFAOYSA-N 0.000 description 3
- OBTOBGKTOSXRIN-UHFFFAOYSA-N [2-(benzylamino)-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate Chemical compound C1(CCCC1)CCC(=O)OC(C(=O)NCC1=CC=CC=C1)C1=CC=CC=C1 OBTOBGKTOSXRIN-UHFFFAOYSA-N 0.000 description 3
- LNOIDCJCIJSFBM-UHFFFAOYSA-N [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxo-1-phenylethyl] 3-cyclopentylpropanoate Chemical compound C1(CCCC1)CCC(=O)OC(C(=O)NC1=NOC(=C1)C)C1=CC=CC=C1 LNOIDCJCIJSFBM-UHFFFAOYSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000002068 genetic effect Effects 0.000 description 3
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 102000055383 human KLK7 Human genes 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 230000008591 skin barrier function Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- MJWATIFJASFXFU-UHFFFAOYSA-N (1-anilino-1-oxopropan-2-yl) 3-cyclopentylpropanoate Chemical compound C1(CCCC1)CCC(=O)OC(C(=O)NC1=CC=CC=C1)C MJWATIFJASFXFU-UHFFFAOYSA-N 0.000 description 2
- SOXFWCHWFGPACR-UHFFFAOYSA-N (1-anilino-3-methyl-1-oxobutan-2-yl) 2-benzamido-2-phenylacetate Chemical compound C(C1=CC=CC=C1)(=O)NC(C(=O)OC(C(C)C)C(NC1=CC=CC=C1)=O)C1=CC=CC=C1 SOXFWCHWFGPACR-UHFFFAOYSA-N 0.000 description 2
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 2
- HPEZLUSOFBNLEB-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-(4-methoxyanilino)-4-oxo-3-phenylbutanoic acid Chemical compound COc1ccc(NC(=O)C(C(C(O)=O)c2ccc(Cl)cc2)c2ccccc2)cc1 HPEZLUSOFBNLEB-UHFFFAOYSA-N 0.000 description 2
- WCPAJCJVRMATHO-UHFFFAOYSA-N 2-(4-methoxyphenyl)-4-methyl-3-(phenylcarbamoyl)pentanoic acid Chemical compound COc1ccc(cc1)C(C(C(C)C)C(=O)Nc1ccccc1)C(O)=O WCPAJCJVRMATHO-UHFFFAOYSA-N 0.000 description 2
- 108020005345 3' Untranslated Regions Proteins 0.000 description 2
- YPGKCBFHRGHNNV-UHFFFAOYSA-N 4-(4-methoxyanilino)-2-(4-methoxyphenyl)-3-methyl-4-oxobutanoic acid Chemical compound COc1ccc(NC(=O)C(C)C(C(O)=O)c2ccc(OC)cc2)cc1 YPGKCBFHRGHNNV-UHFFFAOYSA-N 0.000 description 2
- SOQAKRVNEBCKMM-UHFFFAOYSA-N 4-(4-methoxyanilino)-2-(4-methoxyphenyl)-4-oxo-3-phenylbutanoic acid Chemical compound COc1ccc(NC(=O)C(C(C(O)=O)c2ccc(OC)cc2)c2ccccc2)cc1 SOQAKRVNEBCKMM-UHFFFAOYSA-N 0.000 description 2
- FXTZAQSWAILGDX-UHFFFAOYSA-N CCC(C(C(O)=O)C(C=C1)=CC=C1OC)C(NC(C=C1)=CC=C1OC)=O Chemical compound CCC(C(C(O)=O)C(C=C1)=CC=C1OC)C(NC(C=C1)=CC=C1OC)=O FXTZAQSWAILGDX-UHFFFAOYSA-N 0.000 description 2
- UPWZQZFRJZCVDM-UHFFFAOYSA-N CCC(C(C1=CC=C(C=C1)OC)C(=O)O)C(=O)NC2=CC=C(C=C2)F Chemical compound CCC(C(C1=CC=C(C=C1)OC)C(=O)O)C(=O)NC2=CC=C(C=C2)F UPWZQZFRJZCVDM-UHFFFAOYSA-N 0.000 description 2
- 108090000317 Chymotrypsin Proteins 0.000 description 2
- 206010048768 Dermatosis Diseases 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 108010017544 Glucosylceramidase Proteins 0.000 description 2
- 102000004547 Glucosylceramidase Human genes 0.000 description 2
- 101001091379 Homo sapiens Kallikrein-5 Proteins 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241000699660 Mus musculus Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- GMTCVNHELUZUJJ-UHFFFAOYSA-N N(C1=CC=CC=C1)C(C(C1=CC=CC=C1)C(C(=O)O)C1=CC=C(C=C1)Cl)=O Chemical compound N(C1=CC=CC=C1)C(C(C1=CC=CC=C1)C(C(=O)O)C1=CC=C(C=C1)Cl)=O GMTCVNHELUZUJJ-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 108010061312 Sphingomyelin Phosphodiesterase Proteins 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- HHWBSAZZNWLOCS-UHFFFAOYSA-N [1-(4-methoxyanilino)-1-oxopropan-2-yl] 3-cyclopentylpropanoate Chemical compound C1(CCCC1)CCC(=O)OC(C(=O)NC1=CC=C(C=C1)OC)C HHWBSAZZNWLOCS-UHFFFAOYSA-N 0.000 description 2
- KZGRDOUIPAWVCK-UHFFFAOYSA-N [3-methyl-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 2-benzamido-2-phenylacetate Chemical compound C(C1=CC=CC=C1)(=O)NC(C(=O)OC(C(C)C)C(NC1=NOC(=C1)C)=O)C1=CC=CC=C1 KZGRDOUIPAWVCK-UHFFFAOYSA-N 0.000 description 2
- QPOHBZBUJFJVSK-UHFFFAOYSA-N [3-methyl-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 3-cyclopentylpropanoate Chemical compound C1(CCCC1)CCC(=O)OC(C(C)C)C(NC1=NOC(=C1)C)=O QPOHBZBUJFJVSK-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 102000010126 acid sphingomyelin phosphodiesterase activity proteins Human genes 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000008378 aryl ethers Chemical class 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000002018 overexpression Effects 0.000 description 2
- 125000004043 oxo group Chemical group O=* 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000000770 proinflammatory effect Effects 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 230000000306 recurrent effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 238000011830 transgenic mouse model Methods 0.000 description 2
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- ITOFPJRDSCGOSA-KZLRUDJFSA-N (2s)-2-[[(4r)-4-[(3r,5r,8r,9s,10s,13r,14s,17r)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H](CC[C@]13C)[C@@H]2[C@@H]3CC[C@@H]1[C@H](C)CCC(=O)N[C@H](C(O)=O)CC1=CNC2=CC=CC=C12 ITOFPJRDSCGOSA-KZLRUDJFSA-N 0.000 description 1
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 description 1
- 125000006711 (C2-C12) alkynyl group Chemical group 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- HBBJEIKISUZXLF-UHFFFAOYSA-N 2-(4-chlorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)amino]-4-oxo-3-phenylbutanoic acid Chemical compound Cc1cc(NC(=O)C(C(C(O)=O)c2ccc(Cl)cc2)c2ccccc2)no1 HBBJEIKISUZXLF-UHFFFAOYSA-N 0.000 description 1
- HIMJCQZLFNMLDP-UHFFFAOYSA-N 2-benzamido-3-[(4-methoxyphenyl)carbamoyl]-4-methyl-2-phenylpentanoic acid Chemical compound COc1ccc(NC(=O)C(C(C)C)C(NC(=O)c2ccccc2)(C(O)=O)c2ccccc2)cc1 HIMJCQZLFNMLDP-UHFFFAOYSA-N 0.000 description 1
- SUTPBJULORNZGP-UHFFFAOYSA-N 2-benzamido-4-(4-methoxyanilino)-3-methyl-4-oxo-2-phenylbutanoic acid Chemical compound COc1ccc(NC(=O)C(C)C(NC(=O)c2ccccc2)(C(O)=O)c2ccccc2)cc1 SUTPBJULORNZGP-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- IETLHFTYZGYEKF-UHFFFAOYSA-N 4-(4-methoxyanilino)-2-(4-methoxyphenyl)-4-oxobutanoic acid Chemical compound COc1ccc(NC(=O)CC(C(O)=O)c2ccc(OC)cc2)cc1 IETLHFTYZGYEKF-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101710189683 Alkaline protease 1 Proteins 0.000 description 1
- 101710154562 Alkaline proteinase Proteins 0.000 description 1
- 102100021253 Antileukoproteinase Human genes 0.000 description 1
- 101710170876 Antileukoproteinase Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101710112538 C-C motif chemokine 27 Proteins 0.000 description 1
- VZENJBNALDFUBA-UHFFFAOYSA-N C1(=CC=CC=C1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)OC Chemical compound C1(=CC=CC=C1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)OC VZENJBNALDFUBA-UHFFFAOYSA-N 0.000 description 1
- YDNKGFDKKRUKPY-JHOUSYSJSA-N C16 ceramide Natural products CCCCCCCCCCCCCCCC(=O)N[C@@H](CO)[C@H](O)C=CCCCCCCCCCCCCC YDNKGFDKKRUKPY-JHOUSYSJSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- SGHIUGUXKZDIOG-UHFFFAOYSA-N COC1=CC=C(NC(CC(C(=O)O)C2=CC=C(C=C2)Cl)=O)C=C1 Chemical compound COC1=CC=C(NC(CC(C(=O)O)C2=CC=C(C=C2)Cl)=O)C=C1 SGHIUGUXKZDIOG-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 235000008474 Cardamine pratensis Nutrition 0.000 description 1
- 240000000606 Cardamine pratensis Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- 108091005960 Citrine Proteins 0.000 description 1
- 102100031673 Corneodesmosin Human genes 0.000 description 1
- 101710139375 Corneodesmosin Proteins 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108010002156 Depsipeptides Proteins 0.000 description 1
- 102100021202 Desmocollin-1 Human genes 0.000 description 1
- 101710157876 Desmocollin-1 Proteins 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 102100023795 Elafin Human genes 0.000 description 1
- 108010015972 Elafin Proteins 0.000 description 1
- 108010062466 Enzyme Precursors Proteins 0.000 description 1
- 102000010911 Enzyme Precursors Human genes 0.000 description 1
- LFIRAODTOKYLDO-UHFFFAOYSA-N FC1=CC=C(C=C1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)Cl Chemical compound FC1=CC=C(C=C1)NC(=O)C(CC)C(C(=O)O)C1=CC=C(C=C1)Cl LFIRAODTOKYLDO-UHFFFAOYSA-N 0.000 description 1
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 102000008070 Interferon-gamma Human genes 0.000 description 1
- 108010074328 Interferon-gamma Proteins 0.000 description 1
- 101150023007 KLK7 gene Proteins 0.000 description 1
- 102000001399 Kallikrein Human genes 0.000 description 1
- 101710176223 Kallikrein-5 Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- JPJGUKGXKFANKY-UHFFFAOYSA-N N(C1=CC=CC=C1)C(C(C)C(C(=O)O)(C1=CC=CC=C1)NC(C1=CC=CC=C1)=O)=O Chemical compound N(C1=CC=CC=C1)C(C(C)C(C(=O)O)(C1=CC=CC=C1)NC(C1=CC=CC=C1)=O)=O JPJGUKGXKFANKY-UHFFFAOYSA-N 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- CRJGESKKUOMBCT-VQTJNVASSA-N N-acetylsphinganine Chemical compound CCCCCCCCCCCCCCC[C@@H](O)[C@H](CO)NC(C)=O CRJGESKKUOMBCT-VQTJNVASSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 101150049485 SPINK5 gene Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 108091036066 Three prime untranslated region Proteins 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 150000001717 carbocyclic compounds Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 229940106189 ceramide Drugs 0.000 description 1
- ZVEQCJWYRWKARO-UHFFFAOYSA-N ceramide Natural products CCCCCCCCCCCCCCC(O)C(=O)NC(CO)C(O)C=CCCC=C(C)CCCCCCCCC ZVEQCJWYRWKARO-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000037012 chymotrypsin-like activity Effects 0.000 description 1
- 239000011035 citrine Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125878 compound 36 Drugs 0.000 description 1
- 229940125807 compound 37 Drugs 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- MDCUNMLZLNGCQA-HWOAGHQOSA-N elafin Chemical compound N([C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H]1C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H]2CSSC[C@H]3C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N[C@@H](C)C(=O)N[C@@H](CSSC[C@H]4C(=O)N5CCC[C@H]5C(=O)NCC(=O)N[C@H](C(N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H]5N(CCC5)C(=O)[C@H]5N(CCC5)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCSC)NC(=O)[C@H](C)NC2=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(O)=O)C(=O)N4)C(=O)N[C@@H](CSSC1)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N3)=O)[C@@H](C)CC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(N)=O)C(O)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)C(C)C)C(C)C)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)N MDCUNMLZLNGCQA-HWOAGHQOSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 210000005175 epidermal keratinocyte Anatomy 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 210000001723 extracellular space Anatomy 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 150000002305 glucosylceramides Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229960003130 interferon gamma Drugs 0.000 description 1
- 108010052790 interleukin 1 precursor Proteins 0.000 description 1
- 238000000185 intracerebroventricular administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000013507 mapping Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VVGIYYKRAMHVLU-UHFFFAOYSA-N newbouldiamide Natural products CCCCCCCCCCCCCCCCCCCC(O)C(O)C(O)C(CO)NC(=O)CCCCCCCCCCCCCCCCC VVGIYYKRAMHVLU-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 102000054765 polymorphisms of proteins Human genes 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- RVEDFFORAVMBLV-UHFFFAOYSA-N pyrrolidine-1,2-dicarboxamide Chemical class NC(=O)C1CCCN1C(N)=O RVEDFFORAVMBLV-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000037204 skin physiology Effects 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000004426 substituted alkynyl group Chemical group 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000006168 tricyclic group Chemical group 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2019091722A JP6932386B2 (ja) | 2014-01-23 | 2019-05-14 | 新しいカリクレイン7阻害剤 |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE1430004-0 | 2014-01-23 | ||
| SE1430004 | 2014-01-23 | ||
| PCT/SE2015/050060 WO2015112079A1 (en) | 2014-01-23 | 2015-01-22 | New kallikrein 7 inhibitors |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2019091722A Division JP6932386B2 (ja) | 2014-01-23 | 2019-05-14 | 新しいカリクレイン7阻害剤 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2017505299A JP2017505299A (ja) | 2017-02-16 |
| JP2017505299A5 true JP2017505299A5 (enExample) | 2019-01-24 |
| JP6552010B2 JP6552010B2 (ja) | 2019-07-31 |
Family
ID=53681745
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2016544671A Active JP6552010B2 (ja) | 2014-01-23 | 2015-01-22 | 新しいカリクレイン7阻害剤 |
| JP2019091722A Active JP6932386B2 (ja) | 2014-01-23 | 2019-05-14 | 新しいカリクレイン7阻害剤 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2019091722A Active JP6932386B2 (ja) | 2014-01-23 | 2019-05-14 | 新しいカリクレイン7阻害剤 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US9744148B2 (enExample) |
| EP (1) | EP3097084B1 (enExample) |
| JP (2) | JP6552010B2 (enExample) |
| CN (1) | CN106132940B (enExample) |
| AU (1) | AU2015209759B2 (enExample) |
| CA (1) | CA2934024C (enExample) |
| CY (1) | CY1123707T1 (enExample) |
| DK (1) | DK3097084T3 (enExample) |
| ES (1) | ES2834851T3 (enExample) |
| HR (1) | HRP20201915T1 (enExample) |
| HU (1) | HUE052990T2 (enExample) |
| LT (1) | LT3097084T (enExample) |
| PL (1) | PL3097084T3 (enExample) |
| PT (1) | PT3097084T (enExample) |
| RS (1) | RS61142B1 (enExample) |
| SI (1) | SI3097084T1 (enExample) |
| SM (1) | SMT202000653T1 (enExample) |
| WO (1) | WO2015112079A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9744148B2 (en) * | 2014-01-23 | 2017-08-29 | Sixera Pharma Ab | Kallikrein 7 inhibitors |
| EP3305781A1 (en) * | 2016-10-07 | 2018-04-11 | Deutsches Krebsforschungszentrum | Chemical substances which inhibit the enzymatic activity of human kallikrein-related peptidase 6 (klk6) |
| US20200040103A1 (en) | 2018-03-14 | 2020-02-06 | Genentech, Inc. | Anti-klk5 antibodies and methods of use |
| GB201809378D0 (en) * | 2018-06-07 | 2018-07-25 | Glaxosmithkline Ip Dev Ltd | Novel compounds |
| AR119997A1 (es) | 2019-09-18 | 2022-01-26 | Genentech Inc | Anticuerpos anti-klk7, anticuerpos anti-klk5, anticuerpos multiespecíficos anti-klk5 / klk7 y métodos de uso |
| CN117084936A (zh) * | 2023-09-22 | 2023-11-21 | 南京盛德生物科技研究院有限公司 | 多萜类化合物作为激肽释放酶抑制剂在化妆品中的应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2514355A1 (fr) * | 1981-10-14 | 1983-04-15 | Fabre Sa Pierre | Derives de biphenyl alcoyl carboxylates, leur procede de preparation et leur utilisation comme medicaments |
| WO2003101941A2 (en) | 2002-05-31 | 2003-12-11 | Genzyme Corporation | Alpha acyloxyacetamides for kallikrein and urokinase inhibition |
| DK1631295T3 (da) | 2003-06-06 | 2010-06-21 | Arexis Ab | Anvendelse af kondenserede heterocykliske forbindelser som SCCE-inhibitorer ved behandling af hudsygdomme |
| US8486863B2 (en) * | 2006-11-23 | 2013-07-16 | Vib Vzw | Activators of lateral root formation |
| JP2010532162A (ja) | 2007-06-28 | 2010-10-07 | ノバルティス アーゲー | カリクレイン7モジュレーター |
| ES2527298T3 (es) * | 2007-08-17 | 2015-01-22 | Novartis Ag | Uso de depsipéptidos cíclicos para inhibir calicreína 7 |
| CN103298827B (zh) | 2007-08-17 | 2017-05-31 | 诺华股份有限公司 | 环状酯肽 |
| US8143269B2 (en) | 2008-10-03 | 2012-03-27 | Calcimedica, Inc. | Inhibitors of store operated calcium release |
| EP2545916A1 (en) | 2011-07-15 | 2013-01-16 | Universite Pierre Et Marie Curie - Paris 6 | Use of coumarin derivatives for the preparation of drugs for treating skin diseases |
| US9744148B2 (en) * | 2014-01-23 | 2017-08-29 | Sixera Pharma Ab | Kallikrein 7 inhibitors |
-
2015
- 2015-01-22 US US15/113,658 patent/US9744148B2/en active Active
- 2015-01-22 CA CA2934024A patent/CA2934024C/en active Active
- 2015-01-22 EP EP15740983.0A patent/EP3097084B1/en active Active
- 2015-01-22 SM SM20200653T patent/SMT202000653T1/it unknown
- 2015-01-22 LT LTEP15740983.0T patent/LT3097084T/lt unknown
- 2015-01-22 ES ES15740983T patent/ES2834851T3/es active Active
- 2015-01-22 CN CN201580005402.3A patent/CN106132940B/zh active Active
- 2015-01-22 RS RS20201461A patent/RS61142B1/sr unknown
- 2015-01-22 WO PCT/SE2015/050060 patent/WO2015112079A1/en not_active Ceased
- 2015-01-22 JP JP2016544671A patent/JP6552010B2/ja active Active
- 2015-01-22 PL PL15740983.0T patent/PL3097084T3/pl unknown
- 2015-01-22 HR HRP20201915TT patent/HRP20201915T1/hr unknown
- 2015-01-22 AU AU2015209759A patent/AU2015209759B2/en not_active Ceased
- 2015-01-22 DK DK15740983.0T patent/DK3097084T3/da active
- 2015-01-22 SI SI201531440T patent/SI3097084T1/sl unknown
- 2015-01-22 PT PT157409830T patent/PT3097084T/pt unknown
- 2015-01-22 HU HUE15740983A patent/HUE052990T2/hu unknown
-
2019
- 2019-05-14 JP JP2019091722A patent/JP6932386B2/ja active Active
-
2020
- 2020-12-04 CY CY20201101150T patent/CY1123707T1/el unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6932386B2 (ja) | 新しいカリクレイン7阻害剤 | |
| JP6448651B2 (ja) | 皮膚病の処置のためのベンゾオキサジノン誘導体 | |
| JP6858286B2 (ja) | ライソゾーム蓄積症を治療するためのシクロデキストリン | |
| JP2017505299A5 (enExample) | ||
| Swarnakar et al. | Matrix metalloproteinases in health and disease: regulation by melatonin | |
| WO2014059306A1 (en) | Pyrimidine hydroxy amide compounds as protein deacetylase inhibitors and methods of use thereof | |
| KR101370670B1 (ko) | 플라본 화합물의 15-하이드록시프로스타글란딘 탈수소효소 활성의 억제 효능 및 그의 용도 | |
| AU2015374231B2 (en) | Methods and agents for treating disease | |
| EP3049077A2 (en) | Kynurenine-3-monooxygenase inhibitors, pharmaceutical compositions, and methods of use thereof | |
| HK1229791B (zh) | 新的激肽释放酶7抑制剂 | |
| HK1229791A1 (en) | New kallikrein 7 inhibitors | |
| JP7433625B2 (ja) | Mmp発現抑制剤 | |
| HK1229792A1 (en) | Benzoxazinone derivatives for treatment of skin diseases | |
| HK1229792B (en) | Benzoxazinone derivatives for treatment of skin diseases |