ITMI20011688A1 - Catalizzatore e suo impiego nella sintesi di acqua ossigenata - Google Patents
Catalizzatore e suo impiego nella sintesi di acqua ossigenata Download PDFInfo
- Publication number
- ITMI20011688A1 ITMI20011688A1 IT2001MI001688A ITMI20011688A ITMI20011688A1 IT MI20011688 A1 ITMI20011688 A1 IT MI20011688A1 IT 2001MI001688 A IT2001MI001688 A IT 2001MI001688A IT MI20011688 A ITMI20011688 A IT MI20011688A IT MI20011688 A1 ITMI20011688 A1 IT MI20011688A1
- Authority
- IT
- Italy
- Prior art keywords
- process according
- catalyst
- weight
- reaction solvent
- comprised
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 68
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 title claims abstract description 12
- 239000001301 oxygen Substances 0.000 title claims abstract description 12
- 229910052760 oxygen Inorganic materials 0.000 title claims abstract description 12
- 230000015572 biosynthetic process Effects 0.000 title claims abstract description 11
- 238000003786 synthesis reaction Methods 0.000 title claims abstract description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 19
- 238000000034 method Methods 0.000 claims abstract description 87
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims abstract description 45
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 38
- 229920000098 polyolefin Polymers 0.000 claims abstract description 24
- 229910052751 metal Inorganic materials 0.000 claims abstract description 18
- 239000002184 metal Substances 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 17
- 150000002739 metals Chemical class 0.000 claims abstract description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 14
- 230000003647 oxidation Effects 0.000 claims abstract description 9
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 9
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000010936 titanium Substances 0.000 claims abstract description 3
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 42
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 41
- 239000007810 chemical reaction solvent Substances 0.000 claims description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 24
- 229910052763 palladium Inorganic materials 0.000 claims description 24
- 229910052697 platinum Inorganic materials 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 15
- 229930195733 hydrocarbon Natural products 0.000 claims description 15
- 150000002430 hydrocarbons Chemical class 0.000 claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 229920001577 copolymer Polymers 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 10
- -1 neptane Chemical compound 0.000 claims description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 8
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 8
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 claims description 8
- 229920001519 homopolymer Polymers 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 7
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical group COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 claims description 6
- 150000001336 alkenes Chemical class 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 6
- 239000012429 reaction media Substances 0.000 claims description 6
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- QEGNUYASOUJEHD-UHFFFAOYSA-N 1,1-dimethylcyclohexane Chemical compound CC1(C)CCCCC1 QEGNUYASOUJEHD-UHFFFAOYSA-N 0.000 claims description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 4
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 4
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052741 iridium Inorganic materials 0.000 claims description 4
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 claims description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 4
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052703 rhodium Inorganic materials 0.000 claims description 4
- 239000010948 rhodium Substances 0.000 claims description 4
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 4
- 229910052707 ruthenium Inorganic materials 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 229920002725 thermoplastic elastomer Polymers 0.000 claims description 4
- 239000004711 α-olefin Substances 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 229920001971 elastomer Polymers 0.000 claims description 3
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethylcyclohexane Chemical compound CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 238000005470 impregnation Methods 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000002243 precursor Substances 0.000 claims description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 3
- 239000005060 rubber Substances 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 2
- 229920002943 EPDM rubber Polymers 0.000 claims description 2
- VHOQXEIFYTTXJU-UHFFFAOYSA-N Isobutylene-isoprene copolymer Chemical compound CC(C)=C.CC(=C)C=C VHOQXEIFYTTXJU-UHFFFAOYSA-N 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052786 argon Inorganic materials 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- FACXGONDLDSNOE-UHFFFAOYSA-N buta-1,3-diene;styrene Chemical compound C=CC=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 FACXGONDLDSNOE-UHFFFAOYSA-N 0.000 claims description 2
- 229920005549 butyl rubber Polymers 0.000 claims description 2
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 2
- 150000001993 dienes Chemical class 0.000 claims description 2
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052737 gold Inorganic materials 0.000 claims description 2
- 239000010931 gold Substances 0.000 claims description 2
- 229910052734 helium Inorganic materials 0.000 claims description 2
- 239000001307 helium Substances 0.000 claims description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 claims description 2
- 150000007522 mineralic acids Chemical group 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 229920001155 polypropylene Polymers 0.000 claims description 2
- 229920005606 polypropylene copolymer Polymers 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 claims description 2
- 229920006132 styrene block copolymer Polymers 0.000 claims description 2
- 229920000468 styrene butadiene styrene block copolymer Polymers 0.000 claims description 2
- 229920003051 synthetic elastomer Polymers 0.000 claims description 2
- 239000005061 synthetic rubber Substances 0.000 claims description 2
- 229920001897 terpolymer Polymers 0.000 claims description 2
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 150000003738 xylenes Chemical class 0.000 claims description 2
- 239000010457 zeolite Substances 0.000 claims description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 150000001649 bromium compounds Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 229910017604 nitric acid Inorganic materials 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 17
- 229910018879 Pt—Pd Inorganic materials 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 10
- 239000012153 distilled water Substances 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 7
- 239000011521 glass Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- 239000002638 heterogeneous catalyst Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 229910003244 Na2PdCl4 Inorganic materials 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000002360 explosive Substances 0.000 description 2
- 239000008246 gaseous mixture Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- BVEIKFLZWBDLJG-UHFFFAOYSA-N 1-butylanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CCCC BVEIKFLZWBDLJG-UHFFFAOYSA-N 0.000 description 1
- HSKPJQYAHCKJQC-UHFFFAOYSA-N 1-ethylanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CC HSKPJQYAHCKJQC-UHFFFAOYSA-N 0.000 description 1
- WECIKJKLCDCIMY-UHFFFAOYSA-N 2-chloro-n-(2-cyanoethyl)acetamide Chemical compound ClCC(=O)NCCC#N WECIKJKLCDCIMY-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 229910002621 H2PtCl6 Inorganic materials 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- GWESVXSMPKAFAS-UHFFFAOYSA-N Isopropylcyclohexane Natural products CC(C)C1CCCCC1 GWESVXSMPKAFAS-UHFFFAOYSA-N 0.000 description 1
- 241001236212 Pinus pinaster Species 0.000 description 1
- 235000005105 Pinus pinaster Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WAIPAZQMEIHHTJ-UHFFFAOYSA-N [Cr].[Co] Chemical compound [Cr].[Co] WAIPAZQMEIHHTJ-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000004534 cecum Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 239000003077 lignite Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/029—Preparation from hydrogen and oxygen
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J21/00—Catalysts comprising the elements, oxides, or hydroxides of magnesium, boron, aluminium, carbon, silicon, titanium, zirconium, or hafnium
- B01J21/18—Carbon
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/40—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals of the platinum group metals
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/40—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals of the platinum group metals
- B01J23/44—Palladium
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- B01J31/06—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing polymers
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/38—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals
- B01J23/40—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of noble metals of the platinum group metals
- B01J23/42—Platinum
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J27/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- B01J27/02—Sulfur, selenium or tellurium; Compounds thereof
- B01J27/053—Sulfates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2001MI001688A ITMI20011688A1 (it) | 2001-08-02 | 2001-08-02 | Catalizzatore e suo impiego nella sintesi di acqua ossigenata |
| AU2002331372A AU2002331372A1 (en) | 2001-08-02 | 2002-07-30 | Catalyst and its use in the synthesis of hydrogen peroxide |
| EP02767292A EP1412287B8 (en) | 2001-08-02 | 2002-07-30 | Catalyst and its use in the synthesis of hydrogen peroxide |
| RU2004102390/15A RU2268858C2 (ru) | 2001-08-02 | 2002-07-30 | Катализатор и его применение для синтеза пероксида водорода |
| DK02767292T DK1412287T3 (da) | 2001-08-02 | 2002-07-30 | Katalysator og dens anvendelse til syntese af hydrogenperoxid |
| JP2003518974A JP4334343B2 (ja) | 2001-08-02 | 2002-07-30 | 触媒及び過酸化水素の合成におけるその使用 |
| DE60208384T DE60208384T2 (de) | 2001-08-02 | 2002-07-30 | Katalysator und dessen verwendung zur herstellung von wasserstoffperoxid |
| US10/485,629 US7101526B2 (en) | 2001-08-02 | 2002-07-30 | Catalyst and its use in the synthesis of hydrogen peroxide |
| AT02767292T ATE314310T1 (de) | 2001-08-02 | 2002-07-30 | Katalysator und dessen verwendung zur herstellung von wasserstoffperoxid |
| CA2455335A CA2455335C (en) | 2001-08-02 | 2002-07-30 | Catalyst and its use in the synthesis of hydrogen peroxide |
| PCT/EP2002/008546 WO2003014014A2 (en) | 2001-08-02 | 2002-07-30 | Catalyst and its use in the synthesis of hydrogen peroxide |
| KR1020047001232A KR100584275B1 (ko) | 2001-08-02 | 2002-07-30 | 과산화수소 제조용 촉매 |
| TW091117179A TWI257373B (en) | 2001-08-02 | 2002-07-31 | Catalyst and its use in the synthesis of hydrogen peroxide |
| SA02230290A SA02230290B1 (ar) | 2001-08-02 | 2002-09-03 | مادة حفازة واستخدامها في تخليق بيروكسيد الهيدروجين hydrogen peroxide |
| NO20040435A NO326991B1 (no) | 2001-08-02 | 2004-01-30 | Katalysator for dens anvendelse i syntese av hydrogenperoksyd og fremgangsmate for fremstilling av hydrogenperoksyd. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2001MI001688A ITMI20011688A1 (it) | 2001-08-02 | 2001-08-02 | Catalizzatore e suo impiego nella sintesi di acqua ossigenata |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ITMI20011688A0 ITMI20011688A0 (it) | 2001-08-02 |
| ITMI20011688A1 true ITMI20011688A1 (it) | 2003-02-02 |
Family
ID=11448213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT2001MI001688A ITMI20011688A1 (it) | 2001-08-02 | 2001-08-02 | Catalizzatore e suo impiego nella sintesi di acqua ossigenata |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US7101526B2 (https=) |
| EP (1) | EP1412287B8 (https=) |
| JP (1) | JP4334343B2 (https=) |
| KR (1) | KR100584275B1 (https=) |
| AT (1) | ATE314310T1 (https=) |
| AU (1) | AU2002331372A1 (https=) |
| CA (1) | CA2455335C (https=) |
| DE (1) | DE60208384T2 (https=) |
| DK (1) | DK1412287T3 (https=) |
| IT (1) | ITMI20011688A1 (https=) |
| NO (1) | NO326991B1 (https=) |
| RU (1) | RU2268858C2 (https=) |
| SA (1) | SA02230290B1 (https=) |
| TW (1) | TWI257373B (https=) |
| WO (1) | WO2003014014A2 (https=) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP3593317B2 (ja) * | 2001-03-05 | 2004-11-24 | 独立行政法人 科学技術振興機構 | マイクロカプセル化金属触媒 |
| JP2003308849A (ja) * | 2002-04-12 | 2003-10-31 | Tanaka Kikinzoku Kogyo Kk | 高分子固体電解質形燃料電池の燃料極用触媒 |
| US7067103B2 (en) | 2003-03-28 | 2006-06-27 | Headwaters Nanokinetix, Inc. | Direct hydrogen peroxide production using staged hydrogen addition |
| US7011807B2 (en) | 2003-07-14 | 2006-03-14 | Headwaters Nanokinetix, Inc. | Supported catalysts having a controlled coordination structure and methods for preparing such catalysts |
| US7045479B2 (en) * | 2003-07-14 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Intermediate precursor compositions used to make supported catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7655137B2 (en) | 2003-07-14 | 2010-02-02 | Headwaters Technology Innovation, Llc | Reforming catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7569508B2 (en) | 2004-11-17 | 2009-08-04 | Headwaters Technology Innovation, Llc | Reforming nanocatalysts and method of making and using such catalysts |
| US7144565B2 (en) * | 2003-07-29 | 2006-12-05 | Headwaters Nanokinetix, Inc. | Process for direct catalytic hydrogen peroxide production |
| US7030255B2 (en) | 2004-03-09 | 2006-04-18 | Lyondell Chemical Technology, L.P. | Oxidation process with in-situ H202 generation and polymer-encapsulated catalysts therefor |
| US20050201925A1 (en) * | 2004-03-09 | 2005-09-15 | Bi Le-Khac | Process for making hydrogen peroxide |
| US7276464B2 (en) | 2004-06-17 | 2007-10-02 | Lyondell Chemical Technology, L.P. | Titanium zeolite catalysts |
| US7632775B2 (en) | 2004-11-17 | 2009-12-15 | Headwaters Technology Innovation, Llc | Multicomponent nanoparticles formed using a dispersing agent |
| US7045481B1 (en) | 2005-04-12 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Nanocatalyst anchored onto acid functionalized solid support and methods of making and using same |
| US7326399B2 (en) * | 2005-04-15 | 2008-02-05 | Headwaters Technology Innovation, Llc | Titanium dioxide nanoparticles and nanoparticle suspensions and methods of making the same |
| GB0514075D0 (en) | 2005-07-11 | 2005-08-17 | Cardiff University | Improvements in catalysts |
| US7396795B2 (en) | 2005-08-31 | 2008-07-08 | Headwaters Technology Innovation, Llc | Low temperature preparation of supported nanoparticle catalysts having increased dispersion |
| US7718158B2 (en) * | 2005-10-13 | 2010-05-18 | Lyondell Chemical Technology, L.P. | Polymer-encapsulated ion-exchange resin |
| US7528269B2 (en) * | 2005-12-20 | 2009-05-05 | Lyondell Chemical Technology, L.P. | Process for oxidizing organic compounds |
| US7514476B2 (en) * | 2006-03-17 | 2009-04-07 | Headwaters Technology Innovation, Llc | Stable concentrated metal colloids and methods of making same |
| US7718710B2 (en) | 2006-03-17 | 2010-05-18 | Headwaters Technology Innovation, Llc | Stable concentrated metal colloids and methods of making same |
| US7632774B2 (en) | 2006-03-30 | 2009-12-15 | Headwaters Technology Innovation, Llc | Method for manufacturing supported nanocatalysts having an acid-functionalized support |
| US7541309B2 (en) | 2006-05-16 | 2009-06-02 | Headwaters Technology Innovation, Llc | Reforming nanocatalysts and methods of making and using such catalysts |
| US7563742B2 (en) | 2006-09-22 | 2009-07-21 | Headwaters Technology Innovation, Llc | Supported nickel catalysts having high nickel loading and high metal dispersion and methods of making same |
| US7601668B2 (en) * | 2006-09-29 | 2009-10-13 | Headwaters Technology Innovation, Llc | Methods for manufacturing bi-metallic catalysts having a controlled crystal face exposure |
| US7501532B1 (en) * | 2007-11-20 | 2009-03-10 | Lyondell Chemical Technology, L.P. | Process for producing hydrogen peroxide |
| CN101537366B (zh) * | 2008-03-19 | 2011-08-03 | 中国石油天然气股份有限公司 | 一种可改善结焦性能的改性分子筛 |
| CN102993130A (zh) * | 2012-12-14 | 2013-03-27 | 山东理工大学 | 苯乙烯直接氧化合成环氧苯乙烷的方法 |
| WO2016160686A1 (en) * | 2015-03-31 | 2016-10-06 | Rohm And Haas Company | Sulfonation process |
| CN105413745A (zh) * | 2015-12-28 | 2016-03-23 | 郑州大学 | 一种去除失活钛硅分子筛催化剂中积碳的方法 |
| KR20180065494A (ko) * | 2016-12-08 | 2018-06-18 | 고려대학교 산학협력단 | 음파 처리를 이용한 과산화수소 제조용 팔라듐 촉매의 제조방법 및 이를 이용한 과산화수소 제조방법 |
| US11883809B2 (en) * | 2018-09-13 | 2024-01-30 | Mitsubishi Gas Chemical Company, Inc. | Palladium-containing composition and hydrogen peroxide production method |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3277217A (en) * | 1963-04-24 | 1966-10-04 | Gen Aniline & Film Corp | Process for producing phosphate esters by oxidation of phosphites using hydrogen peroxide and organic peroxides as catalyst |
| BE756015A (fr) | 1969-09-10 | 1971-02-15 | Degussa | Procede pour la preparation de peroxyde d'hydrogene (e) |
| US4001385A (en) * | 1972-02-29 | 1977-01-04 | The Mead Corporation | Sulfur recovery system |
| US4336238A (en) * | 1980-10-10 | 1982-06-22 | Air Products And Chemicals, Inc. | Process for producing hydrogen peroxide |
| IT1152299B (it) | 1982-07-28 | 1986-12-31 | Anic Spa | Procedimento per l'espossidazione di composti olefinici |
| US4794198A (en) * | 1986-11-14 | 1988-12-27 | Montedipe S.P.A. | Catalytic process for the manufacture of oximes |
| US4772458A (en) * | 1986-11-19 | 1988-09-20 | E. I. Du Pont De Nemours And Company | Catalytic process for making hydrogen peroxide from hydrogen and oxygen employing a bromide promoter |
| US4832938A (en) | 1988-05-13 | 1989-05-23 | E. I. Du Pont De Nemours And Company | Hydrogen peroxide production method using platinum/palladium catalysts |
| US4889705A (en) * | 1988-05-13 | 1989-12-26 | E. I. Du Pont De Nemours And Company | Hydrogen peroxide method using optimized H+ and BR- concentrations |
| CA1317740C (en) * | 1988-10-24 | 1993-05-18 | Karl T. Chuang | Production of hydrogen peroxide |
| US5132099A (en) * | 1990-12-27 | 1992-07-21 | Mitsubishi Gas Chemical Company, Inc. | Method for producing hydrogen peroxide |
| JPH0532404A (ja) * | 1991-02-08 | 1993-02-09 | Mitsubishi Gas Chem Co Inc | 過酸化水素の製造方法 |
| IT1252047B (it) * | 1991-07-10 | 1995-05-29 | Enichem Anic | Processo catalitico diretto per la produzione di idrossilammina |
| US5527752A (en) * | 1995-03-29 | 1996-06-18 | Union Carbide Chemicals & Plastics Technology Corporation | Catalysts for the production of polyolefins |
| DE19642770A1 (de) * | 1996-10-16 | 1998-04-23 | Basf Ag | Verfahren zur Herstellung von Wasserstoffperoxid |
| WO1999002264A1 (en) * | 1997-07-11 | 1999-01-21 | The Dow Chemical Company | Membrane and method for synthesis of hydrogen peroxide |
| IT1295266B1 (it) * | 1997-10-03 | 1999-05-04 | Enichem Spa | Procedimento e catalizzatore per l'idrogenazione di composti olefinicamente insaturi |
| EP1042221B1 (en) * | 1997-12-22 | 2003-05-28 | Akzo Nobel N.V. | Process for production of hydrogen peroxide |
| IT1301999B1 (it) * | 1998-08-05 | 2000-07-20 | Enichem Spa | Catalizzatore, processo per la produzione di acqua ossigenata esuo impiego in processi di ossidazione. |
| US6500968B2 (en) * | 1998-08-26 | 2002-12-31 | Hydrocarbon Technologies, Inc. | Process for selective oxidation of organic feedstocks with hydrogen peroxide |
| DE19912733A1 (de) * | 1999-03-20 | 2000-09-21 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxid durch Direktsynthese |
| DE10009187A1 (de) * | 2000-02-26 | 2001-08-30 | Degussa | Verfahren zur Herstellung von Wasserstoffperoxid durch Direktsynthese und Edelmetallkatalysator hierfür |
| IT1318550B1 (it) * | 2000-06-01 | 2003-08-27 | Eni Spa | Catalizzatore e processo per la sintesi diretta di acqua ossigenata. |
| IT1318549B1 (it) * | 2000-06-01 | 2003-08-27 | Eni Spa | Processo per la produzioni in continuo di acqua ossigenata. |
| DE10048844A1 (de) * | 2000-10-02 | 2002-04-11 | Basf Ag | Verfahren zur Herstellung von Platinmetall-Katalysatoren |
| DE10118460A1 (de) * | 2001-04-12 | 2002-10-17 | Basf Ag | Verfahren zur Herstellung von organischen Wasserstoffperoxidlösungen |
-
2001
- 2001-08-02 IT IT2001MI001688A patent/ITMI20011688A1/it unknown
-
2002
- 2002-07-30 DK DK02767292T patent/DK1412287T3/da active
- 2002-07-30 AU AU2002331372A patent/AU2002331372A1/en not_active Abandoned
- 2002-07-30 US US10/485,629 patent/US7101526B2/en not_active Expired - Lifetime
- 2002-07-30 RU RU2004102390/15A patent/RU2268858C2/ru not_active IP Right Cessation
- 2002-07-30 KR KR1020047001232A patent/KR100584275B1/ko not_active Expired - Fee Related
- 2002-07-30 AT AT02767292T patent/ATE314310T1/de active
- 2002-07-30 WO PCT/EP2002/008546 patent/WO2003014014A2/en not_active Ceased
- 2002-07-30 EP EP02767292A patent/EP1412287B8/en not_active Expired - Lifetime
- 2002-07-30 JP JP2003518974A patent/JP4334343B2/ja not_active Expired - Fee Related
- 2002-07-30 CA CA2455335A patent/CA2455335C/en not_active Expired - Fee Related
- 2002-07-30 DE DE60208384T patent/DE60208384T2/de not_active Expired - Lifetime
- 2002-07-31 TW TW091117179A patent/TWI257373B/zh not_active IP Right Cessation
- 2002-09-03 SA SA02230290A patent/SA02230290B1/ar unknown
-
2004
- 2004-01-30 NO NO20040435A patent/NO326991B1/no not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE60208384T2 (de) | 2006-09-21 |
| AU2002331372A1 (en) | 2003-02-24 |
| CA2455335A1 (en) | 2003-02-20 |
| CA2455335C (en) | 2010-09-28 |
| WO2003014014A3 (en) | 2003-07-17 |
| WO2003014014A2 (en) | 2003-02-20 |
| KR20040019077A (ko) | 2004-03-04 |
| EP1412287B8 (en) | 2006-06-14 |
| KR100584275B1 (ko) | 2006-05-26 |
| US20040184983A1 (en) | 2004-09-23 |
| SA02230290B1 (ar) | 2007-04-03 |
| US7101526B2 (en) | 2006-09-05 |
| TWI257373B (en) | 2006-07-01 |
| NO20040435L (no) | 2004-04-02 |
| JP4334343B2 (ja) | 2009-09-30 |
| ATE314310T1 (de) | 2006-01-15 |
| JP2004537410A (ja) | 2004-12-16 |
| DE60208384D1 (de) | 2006-02-02 |
| DK1412287T3 (da) | 2006-05-22 |
| NO326991B1 (no) | 2009-03-30 |
| ITMI20011688A0 (it) | 2001-08-02 |
| EP1412287B1 (en) | 2005-12-28 |
| RU2004102390A (ru) | 2005-05-10 |
| RU2268858C2 (ru) | 2006-01-27 |
| EP1412287A2 (en) | 2004-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ITMI20011688A1 (it) | Catalizzatore e suo impiego nella sintesi di acqua ossigenata | |
| KR100425563B1 (ko) | 과산화수소의 연속 제조 방법 | |
| US7048905B2 (en) | Process for the production of hydrogen peroxide | |
| ITMI20011015A1 (it) | Sintesi diretta di acqua ossigenata in un sistema solvente multicomponente | |
| ITMI20001219A1 (it) | Catalizzatore e processo per la sintesi diretta di acqua ossigenata | |
| ITMI20001884A1 (it) | Procedimento integrato per la preparazione di ossidi olefinici | |
| ITMI981843A1 (it) | Nuovo catalizzatore processo per la produzione di acqua ossigenata e suo impiego in processi di ossidazione | |
| ITMI20011016A1 (it) | Sintesi diretta di acqua ossigenata in un nuovo sitema solvente multicomponente | |
| EP0526945A1 (en) | Process for producing olefin oxides | |
| ITMI20001883A1 (it) | Procedimento integrato per la preparazione di epossidi | |
| ITMI20010859A1 (it) | Procedimento integrato per la produzione di ossidi olefinici | |
| JPS61246160A (ja) | ジアリ−ルペルオキシド類の製造方法 |