IT983545B - Erbicida a base di eteri 4 tri fluorometil 4 nitrodifenilici - Google Patents
Erbicida a base di eteri 4 tri fluorometil 4 nitrodifeniliciInfo
- Publication number
- IT983545B IT983545B IT21605/73A IT2160573A IT983545B IT 983545 B IT983545 B IT 983545B IT 21605/73 A IT21605/73 A IT 21605/73A IT 2160573 A IT2160573 A IT 2160573A IT 983545 B IT983545 B IT 983545B
- Authority
- IT
- Italy
- Prior art keywords
- nitrodiphenyl
- ether
- tri fluoromethyl
- herbicide based
- herbicide
- Prior art date
Links
- BAJQRLZAPXASRD-UHFFFAOYSA-N 4-Nitrobiphenyl Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=CC=CC=C1 BAJQRLZAPXASRD-UHFFFAOYSA-N 0.000 title 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 title 1
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/24—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/38—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to a carbon atom of a six-membered aromatic ring, e.g. nitrodiphenyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C275/36—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with at least one of the oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. N-aryloxyphenylureas
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/62—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by introduction of halogen; by substitution of halogen atoms by other halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US23465172A | 1972-03-14 | 1972-03-14 | |
US234656A US3888932A (en) | 1972-03-14 | 1972-03-14 | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
US331719A US3928416A (en) | 1972-03-14 | 1973-02-12 | Herbicidal 4-trifluoromethyl-4{40 nitrodiphenyl ethers |
US05/331,947 US4076741A (en) | 1972-03-14 | 1973-02-12 | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
Publications (1)
Publication Number | Publication Date |
---|---|
IT983545B true IT983545B (it) | 1974-11-11 |
Family
ID=27499755
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
IT21605/73A IT983545B (it) | 1972-03-14 | 1973-03-14 | Erbicida a base di eteri 4 tri fluorometil 4 nitrodifenilici |
Country Status (21)
Country | Link |
---|---|
JP (1) | JPS5825641B2 (en, 2012) |
AR (1) | AR208495A1 (en, 2012) |
AU (1) | AU467605B2 (en, 2012) |
CH (1) | CH567359A5 (en, 2012) |
DK (1) | DK144561C (en, 2012) |
FR (1) | FR2175997B1 (en, 2012) |
GB (1) | GB1423376A (en, 2012) |
HU (1) | HU172709B (en, 2012) |
IE (1) | IE37575B1 (en, 2012) |
IL (1) | IL41766A (en, 2012) |
IN (1) | IN138701B (en, 2012) |
IT (1) | IT983545B (en, 2012) |
KE (1) | KE2734A (en, 2012) |
LU (1) | LU67204A1 (en, 2012) |
NL (1) | NL174825C (en, 2012) |
OA (1) | OA04348A (en, 2012) |
PH (1) | PH18682A (en, 2012) |
RO (1) | RO77037A (en, 2012) |
SE (1) | SE416544B (en, 2012) |
SU (1) | SU713520A3 (en, 2012) |
TR (1) | TR18291A (en, 2012) |
Families Citing this family (21)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USRE32216E (en) * | 1969-04-25 | 1986-07-29 | Rhone-Poulenc Agrochimie | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
USRE32243E (en) * | 1969-04-25 | 1986-09-09 | Rhone-Poulenc Agrochimie | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
USRE32215E (en) * | 1971-02-11 | 1986-07-22 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids compositions of the same and herbicidal use thereof |
JPS5436209B2 (en, 2012) * | 1972-10-24 | 1979-11-08 | ||
EG11593A (en) * | 1973-07-03 | 1980-07-31 | Bayer Ag | Halogenated 4-trifluiromethyl-4-cyano-diphenyl-ethers process for their preparation and their use as herbicides |
JPS5724761B2 (en, 2012) * | 1973-12-19 | 1982-05-26 | ||
JPS5068800U (en, 2012) * | 1973-10-22 | 1975-06-19 | ||
JPS50123824A (en, 2012) * | 1974-03-15 | 1975-09-29 | ||
JPS50132125A (en, 2012) * | 1974-04-12 | 1975-10-20 | ||
JPS5173126A (ja) * | 1974-12-23 | 1976-06-24 | Mitsui Toatsu Chemicals | Satsusozai |
JPS545033A (en) * | 1977-06-15 | 1979-01-16 | Mitsui Toatsu Chem Inc | Herbicides |
DE2938595A1 (de) * | 1979-09-24 | 1981-04-23 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Verfahren zur herstellung von diphenylaethern |
DE2942930A1 (de) * | 1979-10-24 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | Substituierte harnstoffe, deren herstellung und verwendung als herbizide |
DE3045805A1 (de) | 1980-12-05 | 1982-07-08 | Basf Ag, 6700 Ludwigshafen | Diphenylether, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
GB2105715B (en) * | 1981-08-07 | 1985-09-04 | Ciba Geigy Ag | Herbicidal phenoxyphenylamino acid derivatives |
JP2801181B2 (ja) * | 1983-01-10 | 1998-09-21 | キヤノン株式会社 | シート反転装置 |
FR2549047B1 (fr) * | 1983-07-12 | 1986-03-21 | Rhone Poulenc Agrochimie | Nouveaux herbicides derives d'acides aryloxybenzenes carbonimides |
EP0161529B1 (en) * | 1984-05-18 | 1989-07-12 | Asahi Kasei Kogyo Kabushiki Kaisha | 2-nitro-5-(2'-chloro-4'trifluoromethylphenoxy)phenylacetic ester, thioester and amide, process for preparation therof, herbicidal composition, and method for destruction of undesirable weeds |
HU193466B (en) * | 1984-11-12 | 1987-10-28 | Budapesti Vegyimuevek | Fungicidal composition comprising 2-nitrobenzoic acid derivative as active substance |
JPS63157065U (en, 2012) * | 1987-04-02 | 1988-10-14 | ||
EP1013635B1 (en) * | 1998-12-23 | 2002-09-18 | Dow AgroSciences LLC | Preparation of diphenylethers |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
FR1602719A (en) * | 1968-11-22 | 1971-01-18 | Herbicidal diphenylether/pheny urea compos - ition |
-
1973
- 1973-02-27 SE SE7302765A patent/SE416544B/xx unknown
- 1973-03-13 AR AR247014A patent/AR208495A1/es active
- 1973-03-13 IL IL41766A patent/IL41766A/en unknown
- 1973-03-13 CH CH363173A patent/CH567359A5/xx not_active IP Right Cessation
- 1973-03-13 SU SU731898369A patent/SU713520A3/ru active
- 1973-03-13 OA OA54853A patent/OA04348A/xx unknown
- 1973-03-13 FR FR7308925A patent/FR2175997B1/fr not_active Expired
- 1973-03-13 HU HU73RO00000709A patent/HU172709B/hu unknown
- 1973-03-13 GB GB1195473A patent/GB1423376A/en not_active Expired
- 1973-03-13 LU LU67204A patent/LU67204A1/xx unknown
- 1973-03-13 DK DK136973A patent/DK144561C/da not_active IP Right Cessation
- 1973-03-13 PH PH14420A patent/PH18682A/en unknown
- 1973-03-14 TR TR18291A patent/TR18291A/xx unknown
- 1973-03-14 RO RO7374159A patent/RO77037A/ro unknown
- 1973-03-14 NL NLAANVRAGE7303590,A patent/NL174825C/xx not_active IP Right Cessation
- 1973-03-14 JP JP48029896A patent/JPS5825641B2/ja not_active Expired
- 1973-03-14 IE IE415/73A patent/IE37575B1/xx unknown
- 1973-03-14 IT IT21605/73A patent/IT983545B/it active
- 1973-03-14 AU AU53289/73A patent/AU467605B2/en not_active Expired
- 1973-03-16 IN IN598/CAL/73A patent/IN138701B/en unknown
-
1977
- 1977-05-11 KE KE2734A patent/KE2734A/xx unknown
Also Published As
Publication number | Publication date |
---|---|
NL174825B (nl) | 1984-03-16 |
JPS49236A (en, 2012) | 1974-01-05 |
NL7303590A (en, 2012) | 1973-09-18 |
AR208495A1 (es) | 1977-02-15 |
RO77037A (ro) | 1981-08-30 |
IE37575B1 (en) | 1977-08-31 |
NL174825C (nl) | 1984-08-16 |
CH567359A5 (en, 2012) | 1975-10-15 |
GB1423376A (en) | 1976-02-04 |
IL41766A (en) | 1977-04-29 |
IE37575L (en) | 1973-09-14 |
SE416544B (sv) | 1981-01-19 |
IN138701B (en, 2012) | 1976-03-20 |
FR2175997B1 (en, 2012) | 1977-02-04 |
AU5328973A (en) | 1974-09-19 |
DK144561B (da) | 1982-03-29 |
SU713520A3 (ru) | 1980-01-30 |
IL41766A0 (en) | 1973-05-31 |
AU467605B2 (en) | 1975-12-04 |
FR2175997A1 (en, 2012) | 1973-10-26 |
OA04348A (fr) | 1980-01-31 |
TR18291A (tr) | 1976-12-28 |
LU67204A1 (en, 2012) | 1973-09-14 |
KE2734A (en) | 1977-05-27 |
HU172709B (hu) | 1978-11-28 |
PH18682A (en) | 1985-08-29 |
JPS5825641B2 (ja) | 1983-05-28 |
DK144561C (da) | 1982-09-20 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
IT983545B (it) | Erbicida a base di eteri 4 tri fluorometil 4 nitrodifenilici | |
IT1000862B (it) | Procedimento di preparazione di lieri personalizzati utilizzante un calcolatore | |
NL7706575A (nl) | Mechanische uitzetinrichting. | |
IT7927894A0 (it) | Trasduttore magnetoresistivo identificatore di posizione. | |
AT322276B (de) | Herbizid | |
IT1066572B (it) | Dispositivo di accoppiamento a lamelle flessibili | |
AT327606B (de) | Herbizid | |
ATA273775A (de) | Herbizid | |
BE807779A (fr) | Ethers d'alpha-amindacyl-cephalosporine | |
BG22363A3 (bg) | Хербицидно средство | |
IT971763B (it) | Composizioni resinose a base di fluoruro di poliviniliden | |
AR199288A1 (es) | Dispositivo posicionador | |
AT344445B (de) | Herbizid | |
BE800034A (fr) | Ethers d'isocyanodiphenyle | |
SU503996A2 (ru) | Ороситель | |
BE808902A (fr) | Commande preponderante d'exposition | |
IT1123634B (it) | Composizioni stabilizzate a base di poli-vinil-cloruro | |
SU461807A1 (ru) | Устройство дл зачистки концов труб | |
SU462275A1 (ru) | Триггер | |
SU456705A1 (ru) | Устройство дл восстановлени деталей | |
AT324040B (de) | Herbizid | |
OA05128A (fr) | Appareil d'arrosage. | |
IT1049220B (it) | Mezzi erbicidi selettivi a base di diuretani | |
FR2279335A1 (fr) | Composition herbicide a base de diphenylether | |
IT986915B (it) | Erbicida combinato |