IT949650B - Derivati della m trifluorometil fenilurea sostituiti - Google Patents
Derivati della m trifluorometil fenilurea sostituitiInfo
- Publication number
- IT949650B IT949650B IT47743/72A IT4774372A IT949650B IT 949650 B IT949650 B IT 949650B IT 47743/72 A IT47743/72 A IT 47743/72A IT 4774372 A IT4774372 A IT 4774372A IT 949650 B IT949650 B IT 949650B
- Authority
- IT
- Italy
- Prior art keywords
- trifluoromethyl
- substitute
- phenylurea derivatives
- phenylurea
- derivatives
- Prior art date
Links
- IFDZNBVEINMRLU-UHFFFAOYSA-N 1-phenyl-1-(trifluoromethyl)urea Chemical class NC(=O)N(C(F)(F)F)C1=CC=CC=C1 IFDZNBVEINMRLU-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712101698 DE2101698A1 (de) | 1971-01-15 | 1971-01-15 | Substituierte m-Trifluormethylphenylharnstoffderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT949650B true IT949650B (it) | 1973-06-11 |
Family
ID=5795929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT47743/72A IT949650B (it) | 1971-01-15 | 1972-01-14 | Derivati della m trifluorometil fenilurea sostituiti |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3847971A (index.php) |
| AT (1) | AT313633B (index.php) |
| BE (1) | BE778052A (index.php) |
| BR (1) | BR7200167D0 (index.php) |
| CA (1) | CA992982A (index.php) |
| CH (1) | CH561506A5 (index.php) |
| CS (1) | CS166795B2 (index.php) |
| DE (1) | DE2101698A1 (index.php) |
| FR (1) | FR2122248A5 (index.php) |
| GB (1) | GB1367968A (index.php) |
| HU (1) | HU163829B (index.php) |
| IL (1) | IL38504A (index.php) |
| IT (1) | IT949650B (index.php) |
| NL (1) | NL7118143A (index.php) |
| PL (1) | PL77353B1 (index.php) |
| SE (1) | SE367398B (index.php) |
| SU (1) | SU516331A3 (index.php) |
| ZA (1) | ZA72165B (index.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4046808A (en) * | 1972-08-24 | 1977-09-06 | American Cyanamid Company | (Alkenyloxy)-, (alkynyloxy) and (cyanoalkoxy) alkoxyphenyl ureas and their use as herbicides |
| DE2247310A1 (de) * | 1972-09-27 | 1974-04-04 | Bayer Ag | Tetrasubstituierte harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| US3978123A (en) * | 1973-07-12 | 1976-08-31 | Chevron Research Company | Herbicidal n-alkylsulfoxymethyl-and-n-alkylsulfonyl-methyl-n-aryl |
| US3916010A (en) * | 1973-08-03 | 1975-10-28 | Chevron Res | 1-Alkanoyloxy-haloethyl urea |
| PH13853A (en) * | 1975-01-13 | 1980-10-22 | Stauffer Chemical Co | Substituted thiomethylurea herbicides |
| US4227915A (en) * | 1978-05-18 | 1980-10-14 | Monsanto Company | N-Substituted oxobenzothiazoline and oxobenzoxazoline derivatives and their use as plant growth regulants |
-
1971
- 1971-01-15 DE DE19712101698 patent/DE2101698A1/de active Pending
- 1971-12-07 CH CH1782171A patent/CH561506A5/xx not_active IP Right Cessation
- 1971-12-29 CS CS9065A patent/CS166795B2/cs unknown
- 1971-12-30 NL NL7118143A patent/NL7118143A/xx unknown
-
1972
- 1972-01-04 IL IL38504A patent/IL38504A/xx unknown
- 1972-01-05 SE SE00109/72A patent/SE367398B/xx unknown
- 1972-01-05 US US00215664A patent/US3847971A/en not_active Expired - Lifetime
- 1972-01-11 ZA ZA720165A patent/ZA72165B/xx unknown
- 1972-01-12 BR BR167/72A patent/BR7200167D0/pt unknown
- 1972-01-14 FR FR7201258A patent/FR2122248A5/fr not_active Expired
- 1972-01-14 BE BE778052A patent/BE778052A/xx unknown
- 1972-01-14 AT AT31172A patent/AT313633B/de not_active IP Right Cessation
- 1972-01-14 HU HUBA2693A patent/HU163829B/hu unknown
- 1972-01-14 CA CA132,496A patent/CA992982A/en not_active Expired
- 1972-01-14 SU SU1737763A patent/SU516331A3/ru active
- 1972-01-14 IT IT47743/72A patent/IT949650B/it active
- 1972-01-14 PL PL1972152914A patent/PL77353B1/pl unknown
- 1972-01-14 GB GB178572A patent/GB1367968A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL38504A0 (en) | 1972-03-28 |
| GB1367968A (en) | 1974-09-25 |
| US3847971A (en) | 1974-11-12 |
| CH561506A5 (index.php) | 1975-05-15 |
| IL38504A (en) | 1974-11-29 |
| CS166795B2 (index.php) | 1976-03-29 |
| DE2101698A1 (de) | 1972-09-07 |
| FR2122248A5 (index.php) | 1972-08-25 |
| BE778052A (fr) | 1972-07-14 |
| HU163829B (index.php) | 1973-11-28 |
| BR7200167D0 (pt) | 1973-06-26 |
| CA992982A (en) | 1976-07-13 |
| ZA72165B (en) | 1972-10-25 |
| SE367398B (index.php) | 1974-05-27 |
| NL7118143A (index.php) | 1972-07-18 |
| AT313633B (de) | 1974-02-25 |
| PL77353B1 (index.php) | 1975-04-30 |
| SU516331A3 (ru) | 1976-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE396816B (sv) | Underkalibrig projektil | |
| FI54714C (fi) | Faergloes faergbildare foer anvaendning i tryckkaensliga kopieringssystem | |
| IT949650B (it) | Derivati della m trifluorometil fenilurea sostituiti | |
| FI55260C (fi) | Taendroer foer roterande projektil | |
| IT951068B (it) | Tiadiazolidindioni sostituiti | |
| SE380404B (sv) | Laser | |
| CH526865A (de) | Laser | |
| IT972783B (it) | Retroriflettore | |
| BE778213A (fr) | Derives acyles | |
| IT1048503B (it) | Derivati nitrobenzenici | |
| IT950089B (it) | Benzodiossan derivati | |
| IT946915B (it) | Difenilammine sostituite | |
| AR198079A1 (es) | Procedimiento para obtener tioacetilcefalosporinas | |
| CH540509A (de) | Uhrwerk | |
| AT335919B (de) | Stoppuhr | |
| FI55765C (fi) | Kosmetisk vaerdefulla i hudvaordsmedel anvaenda pyrrolidonkarboxylsyraalkylestrar | |
| CH539751A (fr) | Poutre | |
| AR199993A1 (es) | Procedimiento para producir derivados de aminofenilcetona | |
| CH537031A (fr) | Montre-bracelet | |
| BE791013A (fr) | Aminoalkyl-guanidines substituees | |
| BR7206331D0 (pt) | Acendedor piroforico | |
| IT955337B (it) | N ariluree | |
| AT322450B (de) | Uhrwerk | |
| BE780610A (fr) | Remede ferrugineux | |
| BE793108A (fr) | Derives polyeniques |