IL48320A - Pyridyloureido and thioureido benzyl and cyclohexadienyl methyl penicillins and processes for their preparation - Google Patents
Pyridyloureido and thioureido benzyl and cyclohexadienyl methyl penicillins and processes for their preparationInfo
- Publication number
- IL48320A IL48320A IL48320A IL4832075A IL48320A IL 48320 A IL48320 A IL 48320A IL 48320 A IL48320 A IL 48320A IL 4832075 A IL4832075 A IL 4832075A IL 48320 A IL48320 A IL 48320A
- Authority
- IL
- Israel
- Prior art keywords
- pyridyloureido
- thioureido
- cyclohexadienyl
- penicillins
- benzyl
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 title 1
- -1 cyclohexadienyl methyl penicillins Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742450668 DE2450668A1 (de) | 1974-10-25 | 1974-10-25 | Ureidobenzylpenicilline und verfahren zu ihrer herstellung |
| DE19752535655 DE2535655A1 (de) | 1975-08-09 | 1975-08-09 | Penicilline und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL48320A0 IL48320A0 (en) | 1975-12-31 |
| IL48320A true IL48320A (en) | 1978-09-29 |
Family
ID=25767869
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL48320A IL48320A (en) | 1974-10-25 | 1975-10-20 | Pyridyloureido and thioureido benzyl and cyclohexadienyl methyl penicillins and processes for their preparation |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4031230A (cs) |
| JP (1) | JPS5176287A (cs) |
| AT (1) | AT346483B (cs) |
| CA (1) | CA1064911A (cs) |
| CH (1) | CH618176A5 (cs) |
| CS (1) | CS188973B2 (cs) |
| DD (1) | DD122544A5 (cs) |
| DK (1) | DK479475A (cs) |
| ES (1) | ES442057A1 (cs) |
| FR (1) | FR2288521A1 (cs) |
| GB (1) | GB1501958A (cs) |
| GR (1) | GR58290B (cs) |
| HU (1) | HU170859B (cs) |
| IE (1) | IE42057B1 (cs) |
| IL (1) | IL48320A (cs) |
| LU (1) | LU73640A1 (cs) |
| NL (1) | NL7512496A (cs) |
| SE (1) | SE7511931L (cs) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PT67170B (de) * | 1976-11-06 | 1979-03-21 | Merck Patent Gmbh | Lactame verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel |
| GB2060630B (en) * | 1977-08-12 | 1982-09-22 | Taisho Pharmaceutical Co Ltd | Pyrazinoquinoline derivatives |
| ES477520A1 (es) * | 1978-02-25 | 1979-06-01 | Thomae Gmbh Dr K | Procedimiento para la preparacion de nuevas penicilinas. |
| DE2910190A1 (de) * | 1979-03-15 | 1980-10-02 | Thomae Gmbh Dr K | Neue penicilline, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US4315858A (en) * | 1980-09-24 | 1982-02-16 | Warner-Lambert Company | Antibacterial amide compounds |
| US4315014A (en) * | 1980-09-24 | 1982-02-09 | Warner-Lambert Company | Antibacterial amide compounds and pharmaceutical composition containing the same |
| US6110929A (en) * | 1998-07-28 | 2000-08-29 | 3M Innovative Properties Company | Oxazolo, thiazolo and selenazolo [4,5-c]-quinolin-4-amines and analogs thereof |
| CA2572442A1 (fr) * | 2004-07-30 | 2006-03-09 | Palumed S.A. | Molecules hybrides qa ou q est une aminoquinoleine et a est un residu antibiotique, leur synthese et leurs utilisations en tant qu'agent antibacterien |
| BR112021009994A2 (pt) | 2018-11-28 | 2021-08-17 | Takeda Pharmaceutical Company Limited | composto, e, medicamento |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3720664A (en) * | 1969-11-17 | 1973-03-13 | Squibb & Sons Inc | Alpha-ureidocyclohexadienylalkylene-penicillins |
| US3951955A (en) * | 1970-12-29 | 1976-04-20 | Sumitomo Chemical Company, Limited | Penicillins substituted with heterocyclic groups |
| BE794886A (fr) * | 1972-02-22 | 1973-08-02 | Pfizer | Acides 6-(alpha-(omega-guanidinoalcanoylamino)acylamino)-penicillaniques |
| JPS5417754B2 (cs) * | 1972-12-15 | 1979-07-02 | ||
| JPS5751837B2 (cs) * | 1973-04-05 | 1982-11-04 | ||
| US3935189A (en) * | 1973-05-04 | 1976-01-27 | Beecham Group Limited | Penicillins |
| PH10309A (en) * | 1973-10-19 | 1976-11-17 | Yamanouchi Pharma Co Ltd | Penicillin derivatives |
-
1975
- 1975-10-16 FR FR7531677A patent/FR2288521A1/fr active Granted
- 1975-10-20 IL IL48320A patent/IL48320A/xx unknown
- 1975-10-21 CS CS757080A patent/CS188973B2/cs unknown
- 1975-10-22 US US05/624,763 patent/US4031230A/en not_active Expired - Lifetime
- 1975-10-22 GB GB43407/75A patent/GB1501958A/en not_active Expired
- 1975-10-23 CA CA238,194A patent/CA1064911A/en not_active Expired
- 1975-10-23 DD DD189018A patent/DD122544A5/xx unknown
- 1975-10-24 SE SE7511931A patent/SE7511931L/xx unknown
- 1975-10-24 HU HUME001912 patent/HU170859B/hu unknown
- 1975-10-24 LU LU73640A patent/LU73640A1/xx unknown
- 1975-10-24 CH CH1383775A patent/CH618176A5/de not_active IP Right Cessation
- 1975-10-24 IE IE2320/75A patent/IE42057B1/en unknown
- 1975-10-24 DK DK479475A patent/DK479475A/da unknown
- 1975-10-24 AT AT813475A patent/AT346483B/de active
- 1975-10-24 ES ES442057A patent/ES442057A1/es not_active Expired
- 1975-10-24 GR GR49201A patent/GR58290B/el unknown
- 1975-10-24 NL NL7512496A patent/NL7512496A/xx not_active Application Discontinuation
- 1975-10-25 JP JP50128805A patent/JPS5176287A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IE42057L (en) | 1976-04-25 |
| NL7512496A (nl) | 1976-04-27 |
| GR58290B (en) | 1977-09-20 |
| DD122544A5 (cs) | 1976-10-12 |
| JPS5176287A (cs) | 1976-07-01 |
| DK479475A (da) | 1976-04-26 |
| CS188973B2 (en) | 1979-03-30 |
| AT346483B (de) | 1978-11-10 |
| CA1064911A (en) | 1979-10-23 |
| ATA813475A (de) | 1978-03-15 |
| LU73640A1 (cs) | 1977-05-31 |
| IE42057B1 (en) | 1980-05-21 |
| FR2288521A1 (fr) | 1976-05-21 |
| HU170859B (hu) | 1977-09-28 |
| ES442057A1 (es) | 1977-07-01 |
| FR2288521B1 (cs) | 1980-05-30 |
| CH618176A5 (cs) | 1980-07-15 |
| AU8590175A (en) | 1977-04-28 |
| SE7511931L (sv) | 1976-04-26 |
| GB1501958A (en) | 1978-02-22 |
| US4031230A (en) | 1977-06-21 |
| IL48320A0 (en) | 1975-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH13053A (en) | Crotch-shaped diaper and method | |
| YU39941B (en) | Process for obtaining clavulanic acid | |
| AU8109175A (en) | Denture means and methods | |
| GB1519495A (en) | Azetidinone derivatives and process for preparation thereof | |
| IL48628A0 (en) | D-homo-20-keto-pregnanes and process for their manufactur | |
| PH12798A (en) | 8-hydroxyamino benzazocines and process | |
| IL48320A (en) | Pyridyloureido and thioureido benzyl and cyclohexadienyl methyl penicillins and processes for their preparation | |
| IL47775A (en) | N-alkyl-iminoalane oligomers and process for the preparation thereof | |
| IL48665A0 (en) | 3-fluorobenzodiazepines and processes for their preparation | |
| ZA755654B (en) | N-acylamino-alpha-arylacetamido cephalosporins | |
| ZA756705B (en) | Penicillins and processes for their preparation | |
| IL47257A0 (en) | Improvements in penicillins | |
| IL47348A0 (en) | Cephalosporin and penicillin derivatives | |
| JPS5133105A (en) | Hori aa hidorokishiakurirusannokinzokuen | |
| JPS5147949A (en) | Hori * uretannshoso * mitsupuzai | |
| IL47822A (en) | Racemization of (-)-allethrolone | |
| AU8451975A (en) | 3-heterothio-7-ureido cephalosporins | |
| JPS5155328A (en) | Hori arufua orefuinno setsuchakuhoho | |
| JPS5139630A (en) | Hori * n arukiruiminoaran * noseiho | |
| IL48065A0 (en) | Pgfbeta-prostaglandins and process for their preparation | |
| ZA757881B (en) | 3-fluorobenzodiazepines and processes for their preparation | |
| IL46635A0 (en) | New cephalosporin esters and their preparation | |
| ZA753621B (en) | Penicillins | |
| ZA755816B (en) | Thiamindisulphide-orotate and process for its preparation | |
| ZA746519B (en) | Penam derivatives and preparation thereof |