IL45303A - Plant growth regulant compositions containing carboxyphosphonates and certain novel cargoxyphosphonates - Google Patents
Plant growth regulant compositions containing carboxyphosphonates and certain novel cargoxyphosphonatesInfo
- Publication number
- IL45303A IL45303A IL45303A IL4530374A IL45303A IL 45303 A IL45303 A IL 45303A IL 45303 A IL45303 A IL 45303A IL 4530374 A IL4530374 A IL 4530374A IL 45303 A IL45303 A IL 45303A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- carbon atoms
- sodium
- hydrogen
- alkyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 33
- 230000008635 plant growth Effects 0.000 title claims description 18
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical class OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 64
- 239000011734 sodium Substances 0.000 claims description 34
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 31
- 239000001257 hydrogen Substances 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 21
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 16
- 239000011593 sulfur Chemical group 0.000 claims description 16
- 229910052717 sulfur Chemical group 0.000 claims description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 150000002431 hydrogen Chemical class 0.000 claims description 15
- 229910052708 sodium Inorganic materials 0.000 claims description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 13
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 239000001301 oxygen Substances 0.000 claims description 13
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 12
- 229910052700 potassium Inorganic materials 0.000 claims description 12
- 239000011591 potassium Substances 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 8
- BGYPJLADNCZNGX-UHFFFAOYSA-N methoxycarbonylphosphonic acid Chemical compound COC(=O)P(O)(O)=O BGYPJLADNCZNGX-UHFFFAOYSA-N 0.000 claims description 8
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 8
- CROOPQURPKJTOH-UHFFFAOYSA-N COC(=O)P(O)(O)=O.C(C)[Na] Chemical compound COC(=O)P(O)(O)=O.C(C)[Na] CROOPQURPKJTOH-UHFFFAOYSA-N 0.000 claims description 7
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 229910052744 lithium Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical group N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- 229910052788 barium Inorganic materials 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- DFHAXXVZCFXGOQ-UHFFFAOYSA-K trisodium phosphonoformate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)P([O-])([O-])=O DFHAXXVZCFXGOQ-UHFFFAOYSA-K 0.000 claims description 6
- NOSMQIYCWDWLIL-UHFFFAOYSA-N COC(=O)P(O)(O)=O.C[Na] Chemical compound COC(=O)P(O)(O)=O.C[Na] NOSMQIYCWDWLIL-UHFFFAOYSA-N 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 5
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- YPJQMKNLYYYMOM-UHFFFAOYSA-N diazanium;methyl phosphonatoformate Chemical compound [NH4+].[NH4+].COC(=O)P([O-])([O-])=O YPJQMKNLYYYMOM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- ICSHUPSUGZYMFT-UHFFFAOYSA-L disodium;carboxy(ethoxy)phosphinate Chemical compound [Na+].[Na+].CCOP([O-])(=O)C(O)=O.CCOP([O-])(=O)C(O)=O ICSHUPSUGZYMFT-UHFFFAOYSA-L 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims 2
- CAQWNKXTMBFBGI-UHFFFAOYSA-N C.[Na] Chemical compound C.[Na] CAQWNKXTMBFBGI-UHFFFAOYSA-N 0.000 claims 1
- 229910021529 ammonia Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- ONCCWDRMOZMNSM-FBCQKBJTSA-N compound Z Chemical compound N1=C2C(=O)NC(N)=NC2=NC=C1C(=O)[C@H]1OP(O)(=O)OC[C@H]1O ONCCWDRMOZMNSM-FBCQKBJTSA-N 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 38
- 239000000243 solution Substances 0.000 description 22
- 150000003839 salts Chemical class 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 238000009472 formulation Methods 0.000 description 15
- -1 alkali metal salt Chemical class 0.000 description 13
- 230000012010 growth Effects 0.000 description 11
- 230000004044 response Effects 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 238000005342 ion exchange Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- 244000075634 Cyperus rotundus Species 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 241000894007 species Species 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 235000005853 Cyperus esculentus Nutrition 0.000 description 5
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 125000004414 alkyl thio group Chemical group 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 5
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 4
- 235000007320 Avena fatua Nutrition 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 4
- 206010053759 Growth retardation Diseases 0.000 description 4
- 235000014441 Prunus serotina Nutrition 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 241001506766 Xanthium Species 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 4
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- NTZRDKVFLPLTPU-UHFFFAOYSA-N CC[Na] Chemical compound CC[Na] NTZRDKVFLPLTPU-UHFFFAOYSA-N 0.000 description 3
- 101150065749 Churc1 gene Proteins 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 3
- 240000003176 Digitaria ciliaris Species 0.000 description 3
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 3
- 235000005476 Digitaria cruciata Nutrition 0.000 description 3
- 235000006830 Digitaria didactyla Nutrition 0.000 description 3
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 241000220225 Malus Species 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 102100038239 Protein Churchill Human genes 0.000 description 3
- 240000003829 Sorghum propinquum Species 0.000 description 3
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 3
- 208000027418 Wounds and injury Diseases 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 230000005094 fruit set Effects 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000007954 growth retardant Substances 0.000 description 3
- 208000014674 injury Diseases 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 240000008027 Akebia quinata Species 0.000 description 2
- 235000007756 Akebia quinata Nutrition 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 244000201986 Cassia tora Species 0.000 description 2
- 235000014552 Cassia tora Nutrition 0.000 description 2
- 244000037364 Cinnamomum aromaticum Species 0.000 description 2
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 2
- 241000192043 Echinochloa Species 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 240000001549 Ipomoea eriocarpa Species 0.000 description 2
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 2
- 241000735234 Ligustrum Species 0.000 description 2
- 241001300479 Macroptilium Species 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 240000008296 Prunus serotina Species 0.000 description 2
- 241001412173 Rubus canescens Species 0.000 description 2
- 241000124033 Salix Species 0.000 description 2
- 241000119565 Salix gooddingii Species 0.000 description 2
- 241000921305 Salix sp. Species 0.000 description 2
- FUKBGYXHGNWHFP-UHFFFAOYSA-L [Na+].[Na+].COP(O)(=O)C([O-])=O.COP(O)(=O)C([O-])=O Chemical compound [Na+].[Na+].COP(O)(=O)C([O-])=O.COP(O)(=O)C([O-])=O FUKBGYXHGNWHFP-UHFFFAOYSA-L 0.000 description 2
- BKWIXPAEQDWSDE-UHFFFAOYSA-N [ethoxy(hydroxy)phosphoryl]formic acid Chemical compound CCOP(O)(=O)C(O)=O BKWIXPAEQDWSDE-UHFFFAOYSA-N 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- VNVRRNRPVIZREH-UHFFFAOYSA-N carbamoylphosphonic acid Chemical class NC(=O)P(O)(O)=O VNVRRNRPVIZREH-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000005059 dormancy Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- WPFOWCXICQQPTP-UHFFFAOYSA-N ethoxy(methylsulfanylcarbonyl)phosphinic acid Chemical compound CCOP(O)(=O)C(=O)SC WPFOWCXICQQPTP-UHFFFAOYSA-N 0.000 description 2
- 231100000001 growth retardation Toxicity 0.000 description 2
- 239000003906 humectant Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 208000006278 hypochromic anemia Diseases 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- 239000012053 oil suspension Substances 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 230000019612 pigmentation Effects 0.000 description 2
- 230000000979 retarding effect Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000009966 trimming Methods 0.000 description 2
- 239000004552 water soluble powder Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- SHMXLEJDTPYNBK-UHFFFAOYSA-N C(C1=CC=CC=C1)SC(=O)P(O)(O)=O.C[K] Chemical compound C(C1=CC=CC=C1)SC(=O)P(O)(O)=O.C[K] SHMXLEJDTPYNBK-UHFFFAOYSA-N 0.000 description 1
- RACPNRHEFWJTJX-UHFFFAOYSA-N CSC(=O)P(O)(O)=O.C(C)[Na] Chemical compound CSC(=O)P(O)(O)=O.C(C)[Na] RACPNRHEFWJTJX-UHFFFAOYSA-N 0.000 description 1
- 101100025824 Caenorhabditis elegans nas-3 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 235000016854 Cyperus rotundus Nutrition 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 241000220296 Malus sp. Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000208422 Rhododendron Species 0.000 description 1
- 241000218636 Thuja Species 0.000 description 1
- 240000003243 Thuja occidentalis Species 0.000 description 1
- 235000008109 Thuja occidentalis Nutrition 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- RKZXQQPEDGMHBJ-LIGJGSPWSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentakis[[(z)-octadec-9-enoyl]oxy]hexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC RKZXQQPEDGMHBJ-LIGJGSPWSA-N 0.000 description 1
- FNPKHPDBLPEYNU-UHFFFAOYSA-N [Ba]C Chemical compound [Ba]C FNPKHPDBLPEYNU-UHFFFAOYSA-N 0.000 description 1
- NIWVUSLHJTWEBE-UHFFFAOYSA-N [hydroxy(methoxy)phosphoryl]formic acid Chemical compound COP(O)(=O)C(O)=O NIWVUSLHJTWEBE-UHFFFAOYSA-N 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- UHURJXXAXXMMLW-UHFFFAOYSA-N but-3-en-1-yl radical Chemical compound [CH2]CC=C UHURJXXAXXMMLW-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 229930002875 chlorophyll Natural products 0.000 description 1
- 235000019804 chlorophyll Nutrition 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- NWVQNVFVBMFHHI-UHFFFAOYSA-N ethoxy(methoxycarbonyl)phosphinic acid Chemical compound CCOP(O)(=O)C(=O)OC NWVQNVFVBMFHHI-UHFFFAOYSA-N 0.000 description 1
- NOJFJZZMRDSOLM-UHFFFAOYSA-N ethyl diethoxyphosphorylformate Chemical compound CCOC(=O)P(=O)(OCC)OCC NOJFJZZMRDSOLM-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 230000036244 malformation Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- BHGADZKHWXCHKX-UHFFFAOYSA-N methane;potassium Chemical compound C.[K] BHGADZKHWXCHKX-UHFFFAOYSA-N 0.000 description 1
- MLJVWFGPQCOELH-UHFFFAOYSA-N methyl diethoxyphosphorylformate Chemical compound CCOP(=O)(OCC)C(=O)OC MLJVWFGPQCOELH-UHFFFAOYSA-N 0.000 description 1
- BMPFQUFNKSYHME-UHFFFAOYSA-N methyl diethoxyphosphorylmethanedithioate Chemical compound CCOP(=O)(OCC)C(=S)SC BMPFQUFNKSYHME-UHFFFAOYSA-N 0.000 description 1
- VITRIUYHBVKBDH-UHFFFAOYSA-N methyl dimethoxyphosphorylformate Chemical compound COC(=O)P(=O)(OC)OC VITRIUYHBVKBDH-UHFFFAOYSA-N 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000013138 pruning Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- ILRVASBWNRYBFD-UHFFFAOYSA-K trisodium phosphonoformate hexahydrate Chemical compound O.O.O.O.O.O.[Na+].[Na+].[Na+].[O-]C(=O)P([O-])([O-])=O ILRVASBWNRYBFD-UHFFFAOYSA-K 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4062—Esters of acids containing the structure -C(=X)-P(=X)(XR)2 or NC-P(=X)(XR)2, (X = O, S, Se)
- C07F9/4065—Esters of acids containing the structure -C(=X)-P(=X)(XR)2, (X = O, S, Se)
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38162073A | 1973-07-23 | 1973-07-23 | |
| US38161973A | 1973-07-23 | 1973-07-23 | |
| US39772373A | 1973-09-17 | 1973-09-17 | |
| US47453774A | 1974-05-30 | 1974-05-30 | |
| US05/474,536 US3943201A (en) | 1973-07-23 | 1974-05-30 | Alkoxy carboxycarbonylphosphonic acid esters |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL45303A0 IL45303A0 (en) | 1974-10-22 |
| IL45303A true IL45303A (en) | 1977-07-31 |
Family
ID=27541382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL45303A IL45303A (en) | 1973-07-23 | 1974-07-19 | Plant growth regulant compositions containing carboxyphosphonates and certain novel cargoxyphosphonates |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS5069236A (enExample) |
| AR (1) | AR214853A1 (enExample) |
| BE (1) | BE817918A (enExample) |
| BR (1) | BR7405998D0 (enExample) |
| CH (1) | CH591209A5 (enExample) |
| CS (1) | CS180016B2 (enExample) |
| DD (1) | DD111789A5 (enExample) |
| DE (1) | DE2435407A1 (enExample) |
| DK (1) | DK395274A (enExample) |
| FR (1) | FR2238432B1 (enExample) |
| GB (1) | GB1469136A (enExample) |
| HU (1) | HU171255B (enExample) |
| IE (1) | IE39635B1 (enExample) |
| IL (1) | IL45303A (enExample) |
| IT (1) | IT1049202B (enExample) |
| LU (1) | LU70581A1 (enExample) |
| MY (1) | MY8000218A (enExample) |
| NL (1) | NL7409943A (enExample) |
| NO (1) | NO742668L (enExample) |
| PL (1) | PL98264B1 (enExample) |
| SE (1) | SE422269B (enExample) |
| SU (1) | SU671704A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1144937A (en) * | 1977-12-22 | 1983-04-19 | Dke J.E. Helgstrand | Aromatic derivatives, pharmaceutical compositions and methods for combatting virus infections |
| DE3607445A1 (de) * | 1986-03-07 | 1987-09-10 | Hoechst Ag | Verfahren zur herstellung von alkali-phosphonoformiaten |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3033891A (en) * | 1959-11-27 | 1962-05-08 | Monsanto Chemicals | Mono salts of o-hydrocarbyl-carboalkylthiol phosphonic acids |
-
1974
- 1974-06-22 HU HU74DU00000226A patent/HU171255B/hu unknown
- 1974-06-22 BR BR5998/74A patent/BR7405998D0/pt unknown
- 1974-06-27 SE SE7408487A patent/SE422269B/xx unknown
- 1974-07-19 DD DD180007A patent/DD111789A5/xx unknown
- 1974-07-19 CS CS7400005165A patent/CS180016B2/cs unknown
- 1974-07-19 IL IL45303A patent/IL45303A/en unknown
- 1974-07-22 IT IT25437/74A patent/IT1049202B/it active
- 1974-07-22 NO NO742668A patent/NO742668L/no unknown
- 1974-07-22 AR AR254812A patent/AR214853A1/es active
- 1974-07-22 SU SU742044846A patent/SU671704A3/ru active
- 1974-07-22 GB GB3238374A patent/GB1469136A/en not_active Expired
- 1974-07-22 JP JP49083332A patent/JPS5069236A/ja active Pending
- 1974-07-22 LU LU70581A patent/LU70581A1/xx unknown
- 1974-07-22 FR FR7425333A patent/FR2238432B1/fr not_active Expired
- 1974-07-22 DK DK395274A patent/DK395274A/da unknown
- 1974-07-22 BE BE146790A patent/BE817918A/xx unknown
- 1974-07-23 IE IE1560/74A patent/IE39635B1/xx unknown
- 1974-07-23 NL NL7409943A patent/NL7409943A/xx unknown
- 1974-07-23 DE DE2435407A patent/DE2435407A1/de not_active Withdrawn
- 1974-07-23 PL PL1974172929A patent/PL98264B1/pl unknown
- 1974-07-23 CH CH1016174A patent/CH591209A5/xx not_active IP Right Cessation
-
1980
- 1980-12-30 MY MY218/80A patent/MY8000218A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE817918A (fr) | 1974-11-18 |
| AU7146674A (en) | 1976-01-22 |
| CS180016B2 (en) | 1977-12-30 |
| IL45303A0 (en) | 1974-10-22 |
| DD111789A5 (enExample) | 1975-03-12 |
| FR2238432B1 (enExample) | 1978-07-13 |
| IT1049202B (it) | 1981-01-20 |
| HU171255B (hu) | 1977-12-28 |
| AR214853A1 (es) | 1979-08-15 |
| IE39635B1 (en) | 1978-11-22 |
| SE422269B (sv) | 1982-03-01 |
| FR2238432A1 (enExample) | 1975-02-21 |
| PL98264B1 (pl) | 1978-04-29 |
| DK395274A (enExample) | 1975-03-10 |
| LU70581A1 (enExample) | 1974-11-28 |
| DE2435407A1 (de) | 1975-02-13 |
| IE39635L (en) | 1975-01-23 |
| BR7405998D0 (pt) | 1975-05-13 |
| MY8000218A (en) | 1980-12-31 |
| GB1469136A (en) | 1977-03-30 |
| NL7409943A (nl) | 1975-01-27 |
| NO742668L (enExample) | 1975-01-24 |
| SU671704A3 (ru) | 1979-06-30 |
| SE7408487L (enExample) | 1975-01-24 |
| CH591209A5 (enExample) | 1977-09-15 |
| JPS5069236A (enExample) | 1975-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4481026A (en) | Aluminum N-phosphonomethylglycine and its use as a herbicide | |
| US4315765A (en) | Trialkylsulfonium salts of n-phosphonomethylglycine and their use as plant growth regulators and herbicides | |
| HU185003B (en) | Herbicide compositions further process for preparing /3-amino-3-carboxy-propyl/-methane-phosphinic acid derivatives applied as active substances | |
| US4062669A (en) | N-Organo-N-phosphonomethylglycine-N-oxides and plant growth regulant and phytotoxicant compositions containing same | |
| US4233056A (en) | Novel glycylmethylphosphinic acid derivatives, process for their production and use thereof | |
| US4104051A (en) | Substituted bromo- or chloro-acetamide herbicides | |
| US4384880A (en) | Trialkylsulfonium salts of N-phosphonomethyl-glycine and their use as plant growth regulators and herbicides | |
| US4525202A (en) | Phosphonium salts of N-phosphonomethylglycine and their use as herbicides and plant growth regulants | |
| US3943201A (en) | Alkoxy carboxycarbonylphosphonic acid esters | |
| US4018854A (en) | Carboxyphosphonates | |
| US4341549A (en) | Phosphonium salts of N-phosphonomethylglycine and their use as herbicides and plant growth regulants | |
| US4191554A (en) | Herbicidal benzamides | |
| US4025331A (en) | N-[O-(β-Cyanoethyl)-phosphonomethyl]-glycines and derivatives | |
| US4063923A (en) | Carbamoylphosphonic acid brush control agents | |
| US4130412A (en) | N-Organo-N-phosphonomethylglycine-N-oxides and phytotoxicant compositions containing same | |
| IL45303A (en) | Plant growth regulant compositions containing carboxyphosphonates and certain novel cargoxyphosphonates | |
| US4108626A (en) | Alkoxycarbonylphosphonic acid derivative brush control agents | |
| EP0115176B1 (en) | Stannic n-phosphonomethylglycine compounds and their use as herbicides | |
| US4033749A (en) | Alkoxycarbonylphosphonic acid derivative brush control agents | |
| US4042650A (en) | Carboxyphosphonate brush control agents | |
| US4127403A (en) | Carboxyphosphonate brush control agents | |
| US3321516A (en) | Dialkylthiocarbamylphosphonic diamides | |
| EP0001331A1 (en) | Herbicidal phosphinates, their preparation and their use | |
| US4376644A (en) | Tri-mixed alkylsulfonium salts of N-phosphonomethylglycine and their use as plant growth regulators and herbicides | |
| US4421547A (en) | 4-Hydroxy-5-isopropyl-2-methylphenyl trimethylammonium, 1-piperidine carboxylate salt of N-phosphonomethylglycine and its use as a herbicide |