IL45030A - Plant growth regulating compositions containing dithiane derivatives - Google Patents
Plant growth regulating compositions containing dithiane derivativesInfo
- Publication number
- IL45030A IL45030A IL7445030A IL4503074A IL45030A IL 45030 A IL45030 A IL 45030A IL 7445030 A IL7445030 A IL 7445030A IL 4503074 A IL4503074 A IL 4503074A IL 45030 A IL45030 A IL 45030A
- Authority
- IL
- Israel
- Prior art keywords
- admixture
- carrier
- compound
- growth
- active
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 26
- 230000001105 regulatory effect Effects 0.000 title claims description 7
- 230000008635 plant growth Effects 0.000 title claims description 6
- 150000004887 dithianes Chemical class 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 60
- 239000003085 diluting agent Substances 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 17
- 230000012010 growth Effects 0.000 claims description 16
- -1 methoxy, methylcarbonyl Chemical group 0.000 claims description 13
- 239000007787 solid Substances 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 10
- 239000004094 surface-active agent Substances 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 150000004890 1,4-dithianes Chemical class 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 13
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 239000003995 emulsifying agent Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- LOZWAPSEEHRYPG-UHFFFAOYSA-N 1,4-dithiane Chemical compound C1CSCCS1 LOZWAPSEEHRYPG-UHFFFAOYSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- 235000013399 edible fruits Nutrition 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 230000017066 negative regulation of growth Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000000969 carrier Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 230000009105 vegetative growth Effects 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000003630 growth substance Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229940035044 sorbitan monolaurate Drugs 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000005648 plant growth regulator Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000005070 ripening Effects 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- CXWGKAYMVASWDQ-UHFFFAOYSA-N 1,2-dithiane Chemical compound C1CCSSC1 CXWGKAYMVASWDQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 101100495531 Caenorhabditis elegans cgh-1 gene Proteins 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000003966 growth inhibitor Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical group CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- DWCSXQCXXITVKE-UHFFFAOYSA-N triethyloxidanium Chemical compound CC[O+](CC)CC DWCSXQCXXITVKE-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D339/00—Heterocyclic compounds containing rings having two sulfur atoms as the only ring hetero atoms
- C07D339/08—Six-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2331184A DE2331184A1 (de) | 1973-06-19 | 1973-06-19 | Mittel zur regulierung des pflanzenwachstums |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL45030A0 IL45030A0 (en) | 1974-09-10 |
| IL45030A true IL45030A (en) | 1977-08-31 |
Family
ID=5884448
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL7445030A IL45030A (en) | 1973-06-19 | 1974-06-14 | Plant growth regulating compositions containing dithiane derivatives |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5035329A (da) |
| AT (1) | AT334679B (da) |
| BE (1) | BE816435A (da) |
| BR (1) | BR7404955D0 (da) |
| CA (1) | CA1028521A (da) |
| CH (1) | CH588808A5 (da) |
| DD (1) | DD114488A5 (da) |
| DE (1) | DE2331184A1 (da) |
| DK (1) | DK136011C (da) |
| EG (1) | EG11232A (da) |
| ES (1) | ES427396A1 (da) |
| FR (1) | FR2233934A1 (da) |
| GB (1) | GB1424148A (da) |
| HU (1) | HU170375B (da) |
| IE (1) | IE39510B1 (da) |
| IL (1) | IL45030A (da) |
| LU (1) | LU70333A1 (da) |
| NL (1) | NL7408075A (da) |
| PL (1) | PL90370B1 (da) |
| SU (1) | SU564774A3 (da) |
| TR (1) | TR17616A (da) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN103370304A (zh) * | 2011-02-23 | 2013-10-23 | 巴斯夫欧洲公司 | 硫酸锍、其制备及用途 |
-
1973
- 1973-06-19 DE DE2331184A patent/DE2331184A1/de active Pending
-
1974
- 1974-06-08 EG EG213/74A patent/EG11232A/xx active
- 1974-06-14 IL IL7445030A patent/IL45030A/en unknown
- 1974-06-17 PL PL1974171979A patent/PL90370B1/pl unknown
- 1974-06-17 DD DD179211A patent/DD114488A5/xx unknown
- 1974-06-17 NL NL7408075A patent/NL7408075A/xx unknown
- 1974-06-17 LU LU70333A patent/LU70333A1/xx unknown
- 1974-06-17 BE BE145511A patent/BE816435A/xx unknown
- 1974-06-17 AT AT498074A patent/AT334679B/de active
- 1974-06-17 CH CH826674A patent/CH588808A5/xx not_active IP Right Cessation
- 1974-06-17 TR TR17616A patent/TR17616A/xx unknown
- 1974-06-18 GB GB2694674A patent/GB1424148A/en not_active Expired
- 1974-06-18 DK DK325974A patent/DK136011C/da active
- 1974-06-18 ES ES427396A patent/ES427396A1/es not_active Expired
- 1974-06-18 SU SU7402035681A patent/SU564774A3/ru active
- 1974-06-18 HU HUBA3087A patent/HU170375B/hu unknown
- 1974-06-18 CA CA202,729A patent/CA1028521A/en not_active Expired
- 1974-06-18 IE IE1269/74A patent/IE39510B1/xx unknown
- 1974-06-18 BR BR4955/74A patent/BR7404955D0/pt unknown
- 1974-06-19 JP JP49069257A patent/JPS5035329A/ja active Pending
- 1974-06-19 FR FR7421237A patent/FR2233934A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| BE816435A (fr) | 1974-12-17 |
| LU70333A1 (da) | 1975-03-06 |
| CA1028521A (en) | 1978-03-28 |
| JPS5035329A (da) | 1975-04-04 |
| DD114488A5 (da) | 1975-08-12 |
| FR2233934A1 (da) | 1975-01-17 |
| DK136011B (da) | 1977-08-01 |
| IE39510B1 (en) | 1978-10-25 |
| DE2331184A1 (de) | 1975-01-16 |
| GB1424148A (en) | 1976-02-11 |
| AT334679B (de) | 1976-01-25 |
| IE39510L (en) | 1974-12-19 |
| HU170375B (da) | 1977-06-28 |
| EG11232A (en) | 1977-08-15 |
| DK136011C (da) | 1977-12-27 |
| SU564774A3 (ru) | 1977-07-05 |
| NL7408075A (da) | 1974-12-23 |
| CH588808A5 (da) | 1977-06-15 |
| TR17616A (tr) | 1975-07-23 |
| IL45030A0 (en) | 1974-09-10 |
| BR7404955D0 (pt) | 1975-01-07 |
| AU7015974A (en) | 1975-12-18 |
| ATA498074A (de) | 1976-05-15 |
| ES427396A1 (es) | 1976-07-16 |
| DK325974A (da) | 1975-02-10 |
| PL90370B1 (da) | 1977-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4554017A (en) | Method and compositions for regulating plant growth using cycloalkane-carboxylic acid compounds | |
| US4150967A (en) | Agents for regulating plant growth | |
| US4227918A (en) | Novel halogenoethyl sulphones and their use as plant growth regulators | |
| US3885951A (en) | Plant growth regulant compositions containing 2-haloethanesulphinic acid compounds | |
| US4327214A (en) | Substituted alkylammonium salts, the manufacture thereof, the use thereof for regulating plant growth, and agents therefor | |
| US4047923A (en) | Heterocyclic sulfonium salt containing plant-growth regulant compositions | |
| US3864115A (en) | 4-Substituted 1,2-methylene dioxybenzene compounds as plant growth regulants | |
| US3754001A (en) | 9-imidazolyl-fluorene-9-carboxylic acid compounds | |
| EP0009740B1 (de) | Beta-Triazolyloxime, diese enthaltende Mittel zur Beeinflussung des Pflanzenwachstums und ihre Anwendung | |
| US3963749A (en) | 1-Methyl-2,3-dihydro-1,4-dithiinium methosulfate | |
| US4140518A (en) | Agents for regulating plant growth | |
| US4319911A (en) | Triazolyl derivatives, their manufacture, and agents containing them for influencing plant growth | |
| CS212338B2 (en) | Means for regulation of the plant growth and fungicide means and method of making the active substance | |
| IL45030A (en) | Plant growth regulating compositions containing dithiane derivatives | |
| US4127401A (en) | Aminomethanephosphonic acid compounds containing plant-growth regulant compositions | |
| US4049418A (en) | Method of regulating plant growth | |
| US3895933A (en) | Plant growth regulants comprising 2-hydroxyethyl-1-pyridinium-(1) salts | |
| US3989525A (en) | H-isopropyl-2-chloroethane-(thiono)-phosphonic acid ester amide compounds and herbicidal compositions | |
| DD152467A5 (de) | Mittel zur regulierung des pflanzenwachstums | |
| US4067721A (en) | Imidazolidinedione compounds and plant growth influencing compositions | |
| US3979204A (en) | Plant growth regulant compositions comprising 2-cyano-bicyclo[2,2,1]heptane | |
| US4053296A (en) | Ferrocene derivative for supplying plants with iron | |
| EP0021076B1 (de) | Verfahren zur Regulierung des Pflanzenwachstums | |
| EP0007162B1 (en) | Novel n-substituted 2-oxo-3-benzothiazoline derivatives, their use as leguminous plant growth regulants, and plant growth regulating compositions containing said derivatives as the active ingredients | |
| US4350520A (en) | Plant growth regulant compositions |