IL43712A - N-methyl-o-phenyl-carbamic acid esters their production and insecticidal compositions containing them - Google Patents
N-methyl-o-phenyl-carbamic acid esters their production and insecticidal compositions containing themInfo
- Publication number
- IL43712A IL43712A IL43712A IL4371273A IL43712A IL 43712 A IL43712 A IL 43712A IL 43712 A IL43712 A IL 43712A IL 4371273 A IL4371273 A IL 4371273A IL 43712 A IL43712 A IL 43712A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- methyl
- process according
- phenyl
- phosgene
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 13
- 230000000749 insecticidal effect Effects 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 52
- 238000000034 method Methods 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000003085 diluting agent Substances 0.000 claims description 12
- 241000238631 Hexapoda Species 0.000 claims description 10
- -1 chloroformic acid ester Chemical class 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 230000006378 damage Effects 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 6
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 5
- UZOXOBUYZGSAIW-UHFFFAOYSA-N methoxy(phenyl)carbamic acid Chemical class CON(C(O)=O)C1=CC=CC=C1 UZOXOBUYZGSAIW-UHFFFAOYSA-N 0.000 claims description 5
- 239000004480 active ingredient Substances 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 241000607479 Yersinia pestis Species 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000003995 emulsifying agent Substances 0.000 description 6
- 241001124076 Aphididae Species 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 241000254173 Coleoptera Species 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 241000721621 Myzus persicae Species 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241001425390 Aphis fabae Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000721623 Myzus Species 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- 241000500437 Plutella xylostella Species 0.000 description 3
- 241000254154 Sitophilus zeamais Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- 241001143309 Acanthoscelides obtectus Species 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 241000387321 Aspidiotus nerii Species 0.000 description 2
- 241001510109 Blaberus giganteus Species 0.000 description 2
- 241000238662 Blatta orientalis Species 0.000 description 2
- 241000238657 Blattella germanica Species 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 241001444260 Brassicogethes aeneus Species 0.000 description 2
- 241001664260 Byturus tomentosus Species 0.000 description 2
- 241001581006 Dysaphis plantaginea Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000483001 Euproctis chrysorrhoea Species 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 2
- 241000255685 Malacosoma neustria Species 0.000 description 2
- 241000254099 Melolontha melolontha Species 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 241000810465 Myzus cerasi cerasi Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001491877 Operophtera brumata Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- 241000255969 Pieris brassicae Species 0.000 description 2
- 241000722238 Pseudococcus maritimus Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241001509967 Reticulitermes flavipes Species 0.000 description 2
- 241000125162 Rhopalosiphum Species 0.000 description 2
- 241000125167 Rhopalosiphum padi Species 0.000 description 2
- 241000254179 Sitophilus granarius Species 0.000 description 2
- 241000256251 Spodoptera frugiperda Species 0.000 description 2
- 241001177161 Stegobium paniceum Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000254109 Tenebrio molitor Species 0.000 description 2
- 241001414989 Thysanoptera Species 0.000 description 2
- 241001238451 Tortrix viridana Species 0.000 description 2
- 241000267822 Trogoderma granarium Species 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229940086542 triethylamine Drugs 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- PMHBGORIEUVGTQ-UHFFFAOYSA-N 2-(ethylsulfonylmethyl)phenol Chemical compound CCS(=O)(=O)CC1=CC=CC=C1O PMHBGORIEUVGTQ-UHFFFAOYSA-N 0.000 description 1
- DMOAJIIEJSFMMM-UHFFFAOYSA-N 2-(methylsulfonylmethyl)phenol Chemical compound CS(=O)(=O)CC1=CC=CC=C1O DMOAJIIEJSFMMM-UHFFFAOYSA-N 0.000 description 1
- 241000238818 Acheta domesticus Species 0.000 description 1
- 241000253994 Acyrthosiphon pisum Species 0.000 description 1
- 241001136265 Agriotes Species 0.000 description 1
- 241001136249 Agriotes lineatus Species 0.000 description 1
- 241000218475 Agrotis segetum Species 0.000 description 1
- 241000449794 Alabama argillacea Species 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 241000238805 Blaberus Species 0.000 description 1
- 241000238788 Blaberus craniifer Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 241000256593 Brachycaudus schwartzi Species 0.000 description 1
- 235000011303 Brassica alboglabra Nutrition 0.000 description 1
- 235000011302 Brassica oleracea Nutrition 0.000 description 1
- 241000907225 Bruchidius Species 0.000 description 1
- 241001414836 Cimex Species 0.000 description 1
- 241001327638 Cimex lectularius Species 0.000 description 1
- 241001415288 Coccidae Species 0.000 description 1
- 241001465977 Coccoidea Species 0.000 description 1
- 241001479447 Coccus hesperidum Species 0.000 description 1
- 241001094913 Cryptomyzus Species 0.000 description 1
- 241000254171 Curculionidae Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000289763 Dasygaster padockina Species 0.000 description 1
- 241001513837 Dermestes maculatus Species 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000408655 Dispar Species 0.000 description 1
- 241001425472 Dysdercus cingulatus Species 0.000 description 1
- 241000122098 Ephestia kuehniella Species 0.000 description 1
- 241000238821 Gryllus Species 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- 241000652697 Henschoutedenia flexivitta Species 0.000 description 1
- 241001659688 Hercinothrips femoralis Species 0.000 description 1
- 241001251958 Hyalopterus Species 0.000 description 1
- 241001251909 Hyalopterus pruni Species 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 241000256602 Isoptera Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000948337 Lasius niger Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000721715 Macrosiphum Species 0.000 description 1
- 241000721714 Macrosiphum euphorbiae Species 0.000 description 1
- 241000555303 Mamestra brassicae Species 0.000 description 1
- 241000961933 Nephotettix virescens Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241001548358 Parapiesma quadratum Species 0.000 description 1
- 241000238675 Periplaneta americana Species 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical class CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- 235000005805 Prunus cerasus Nutrition 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- 235000001537 Ribes X gardonianum Nutrition 0.000 description 1
- 235000001535 Ribes X utile Nutrition 0.000 description 1
- 235000016919 Ribes petraeum Nutrition 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 241000985245 Spodoptera litura Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000064240 Yponomeuta padellus Species 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- RCTFHBWTYQOVGJ-UHFFFAOYSA-N chloroform;dichloromethane Chemical compound ClCCl.ClC(Cl)Cl RCTFHBWTYQOVGJ-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229940096118 ella Drugs 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 208000007578 phototoxic dermatitis Diseases 0.000 description 1
- 231100000018 phototoxicity Toxicity 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- OOLLAFOLCSJHRE-ZHAKMVSLSA-N ulipristal acetate Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(OC(C)=O)C(C)=O)[C@]2(C)C1 OOLLAFOLCSJHRE-ZHAKMVSLSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722258805 DE2258805C3 (de) | 1972-12-01 | 1972-12-01 | N-Methyl-O-phenyl-carbaminsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Insekten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL43712A0 IL43712A0 (en) | 1974-03-14 |
| IL43712A true IL43712A (en) | 1977-04-29 |
Family
ID=5863204
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL43712A IL43712A (en) | 1972-12-01 | 1973-11-28 | N-methyl-o-phenyl-carbamic acid esters their production and insecticidal compositions containing them |
Country Status (25)
| Country | Link |
|---|---|
| JP (2) | JPS5636169B2 (enFirst) |
| AT (1) | AT328226B (enFirst) |
| AU (1) | AU473735B2 (enFirst) |
| BE (1) | BE807917A (enFirst) |
| BR (1) | BR7309411D0 (enFirst) |
| CA (1) | CA1012550A (enFirst) |
| CH (1) | CH585008A5 (enFirst) |
| CS (1) | CS181734B2 (enFirst) |
| DD (1) | DD112711A5 (enFirst) |
| DE (1) | DE2258805C3 (enFirst) |
| DK (1) | DK134908C (enFirst) |
| ES (1) | ES421007A1 (enFirst) |
| FR (1) | FR2208890B1 (enFirst) |
| GB (1) | GB1433557A (enFirst) |
| HU (1) | HU167709B (enFirst) |
| IE (1) | IE38558B1 (enFirst) |
| IL (1) | IL43712A (enFirst) |
| IT (1) | IT1048159B (enFirst) |
| LU (1) | LU68890A1 (enFirst) |
| NL (1) | NL7316288A (enFirst) |
| PL (1) | PL87094B1 (enFirst) |
| RO (1) | RO68555A (enFirst) |
| SU (1) | SU650477A3 (enFirst) |
| TR (1) | TR18028A (enFirst) |
| ZA (1) | ZA739115B (enFirst) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL258661A (enFirst) * | 1959-12-05 |
-
1972
- 1972-12-01 DE DE19722258805 patent/DE2258805C3/de not_active Expired
-
1973
- 1973-11-27 AU AU62933/73A patent/AU473735B2/en not_active Expired
- 1973-11-27 CS CS816773A patent/CS181734B2/cs unknown
- 1973-11-28 NL NL7316288A patent/NL7316288A/xx not_active Application Discontinuation
- 1973-11-28 BE BE138261A patent/BE807917A/xx unknown
- 1973-11-28 RO RO7376808A patent/RO68555A/ro unknown
- 1973-11-28 IL IL43712A patent/IL43712A/en unknown
- 1973-11-29 LU LU68890D patent/LU68890A1/xx unknown
- 1973-11-29 IT IT3191573A patent/IT1048159B/it active
- 1973-11-29 PL PL16693173A patent/PL87094B1/pl unknown
- 1973-11-29 DD DD17497273A patent/DD112711A5/xx unknown
- 1973-11-29 CH CH1678773A patent/CH585008A5/xx not_active IP Right Cessation
- 1973-11-29 SU SU731971735A patent/SU650477A3/ru active
- 1973-11-29 TR TR1802873A patent/TR18028A/xx unknown
- 1973-11-30 ZA ZA739115A patent/ZA739115B/xx unknown
- 1973-11-30 HU HUBA003002 patent/HU167709B/hu unknown
- 1973-11-30 FR FR7342746A patent/FR2208890B1/fr not_active Expired
- 1973-11-30 ES ES421007A patent/ES421007A1/es not_active Expired
- 1973-11-30 BR BR941173A patent/BR7309411D0/pt unknown
- 1973-11-30 DK DK648773A patent/DK134908C/da not_active IP Right Cessation
- 1973-11-30 IE IE217173A patent/IE38558B1/xx unknown
- 1973-11-30 GB GB5566973A patent/GB1433557A/en not_active Expired
- 1973-11-30 CA CA187,069A patent/CA1012550A/en not_active Expired
- 1973-12-01 JP JP13404473A patent/JPS5636169B2/ja not_active Expired
- 1973-12-01 JP JP13404373A patent/JPS5634587B2/ja not_active Expired
- 1973-12-03 AT AT1009673A patent/AT328226B/de not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4068002A (en) | 2,4-Dichloro-4-benzoylureido-diphenyl ethers | |
| IE43391B1 (en) | Novel-n-(substituted phenyl)-n'-benzoyl-ureas and their use as insecticides | |
| US4064267A (en) | 2',3,6'-Trichloro-4-cyano-4'-[N-(N'-(o-substituted-benzoyl))-ureido]-diphenyl ether insecticides | |
| IL46172A (en) | Pyrimidine-thionothiolphosphoric acid esters their preparation and their use as insecticides and acaricides | |
| IL43411A (en) | N,n-dimethyl-o-(3-alkylthio-1,2,4-triazol-5-yl)-carbamic acid esters,their preparation and insecticidal and acaricidal compositions containing them | |
| IL44235A (en) | N-sulphenylated n-methylcarbamidoximes of 2-oxoalkanenitriles their preparation and insecticidal acaricidal and fungicidal compositions containing them | |
| IL46687A (en) | N-sulphenylated oxime-carbamates their preparation and insecticidal acaricidal and nematicidal compositions containing them | |
| IL47958A (en) | Pyrimidinylthionophosphonic acid esters process for their preparation and insecticidal acaricidal and nematicidal compositions containing them | |
| US3996367A (en) | N,N-dimethyl-O-[1-methyl-3-N-methylcarbaminyl-methyl-pyrazol(5)yl]-carbamic acid ester | |
| US4001404A (en) | N-dithiophosphoryl-carbamic acid esters | |
| IL46198A (en) | Triazolothiazolyl-(thiono)-phosphoric (phosphonic)- acid esters their preparation and insecticidal and acaricidal compositions containing them | |
| US4006244A (en) | Benzo-1,3-dioxolan-4-yl N-methyl-N-phenylmercapto-carbamates | |
| IL45403A (en) | O-phenyl-thionophosphoric and-phosphonic acid ester-amide and ester-imide derivatives their preparation and their use as insecticides and acaricides | |
| US3988449A (en) | Trisalkyl tin 1,2,4-triazole insecticidal and acaricidal agents | |
| IL31318A (en) | Phosphoric,phosphonic or thionophosphoric(-phosphonic)acid esters of pyridazinediol,their preparation and pest control compositions containing them | |
| US3862268A (en) | O-alkyl-s-(carbamoyloxy-methyl)-(thiono) thiolphosphoric (phosphonic) acid esters | |
| US3786065A (en) | N,n-dimethyl-o-(-substituted-3,4-polymethylene-pyrazolyl-(5))-carbamic acid esters | |
| US4013794A (en) | O-alkyl-s-alkyl-o-phenyl phosphates and insecticidal and acaricidal method of use | |
| IL43712A (en) | N-methyl-o-phenyl-carbamic acid esters their production and insecticidal compositions containing them | |
| IL38701A (en) | Substituted pyrazol(3)yl-carbamic acid esters,their preparation and their use as insecticides or acaricides | |
| US4000268A (en) | N,N-dimethyl-N'-[O-phenyl-(thiono)-alkane-phosphonyl]-formamidines | |
| US3966920A (en) | O,S-Dialkyl-O-(2-cyanophenyl)-thionothiolphosphoric acid esters and insecticidal and acaricidal compositions and method | |
| IE41829B1 (en) | N-sulphenylated n-methyl-carbamates, process for their preparation, and their use as insecticides or acaricides | |
| IL45796A (en) | Triazolo-thiazole phosphoric phosphonic thionophosphoric and thionophosphonic acid esters their preparation and their use as insecticides and acaricides | |
| US3979512A (en) | S-(amidocarbonyl)-methyl-O-alkyl-monothiophosphoric acid ester amides |