IL40610A - 1,4-methano-and 1,4-ethano-tetrahydronaphthyloxy-propanols and process for their preparation - Google Patents
1,4-methano-and 1,4-ethano-tetrahydronaphthyloxy-propanols and process for their preparationInfo
- Publication number
- IL40610A IL40610A IL40610A IL4061072A IL40610A IL 40610 A IL40610 A IL 40610A IL 40610 A IL40610 A IL 40610A IL 4061072 A IL4061072 A IL 4061072A IL 40610 A IL40610 A IL 40610A
- Authority
- IL
- Israel
- Prior art keywords
- tetrahydronaphthyloxy
- propanols
- ethano
- methano
- preparation
- Prior art date
Links
- UQSQJBFGRYKKQF-UHFFFAOYSA-N 1-(9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyloxy)propan-1-ol Chemical class C12C(CC(C3=CC=CC=C13)CC2)OC(CC)O UQSQJBFGRYKKQF-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
- A61K31/138—Aryloxyalkylamines, e.g. propranolol, tamoxifen, phenoxybenzamine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/34—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/38—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring being part of a condensed ring system containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/52—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups or amino groups bound to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT3012471 | 1971-10-21 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL40610A0 IL40610A0 (en) | 1972-12-29 |
| IL40610A true IL40610A (en) | 1975-04-25 |
Family
ID=11229158
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL40610A IL40610A (en) | 1971-10-21 | 1972-10-18 | 1,4-methano-and 1,4-ethano-tetrahydronaphthyloxy-propanols and process for their preparation |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS515379B2 (enFirst) |
| AT (1) | AT318563B (enFirst) |
| AU (1) | AU471732B2 (enFirst) |
| BE (1) | BE790188R (enFirst) |
| CA (1) | CA992983A (enFirst) |
| CH (1) | CH565741A5 (enFirst) |
| CS (1) | CS161064B2 (enFirst) |
| DE (1) | DE2251095C3 (enFirst) |
| DK (1) | DK135576B (enFirst) |
| FR (1) | FR2157897B2 (enFirst) |
| GB (1) | GB1351557A (enFirst) |
| HK (1) | HK9377A (enFirst) |
| HU (1) | HU165185B (enFirst) |
| IL (1) | IL40610A (enFirst) |
| KE (1) | KE2693A (enFirst) |
| MY (1) | MY7700158A (enFirst) |
| NL (1) | NL153516B (enFirst) |
| NO (1) | NO130643C (enFirst) |
| SE (1) | SE389103B (enFirst) |
| SU (1) | SU496722A3 (enFirst) |
| ZA (1) | ZA727459B (enFirst) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1436860A (en) * | 1972-12-18 | 1976-05-26 | Syntex Inc | 5,8-dihydro-5,8-methanonaphthalene cardiovascular agents |
| JPS52120690A (en) * | 1976-04-02 | 1977-10-11 | Fujitsu Ltd | Radiation semi-conductor device |
-
0
- BE BE790188D patent/BE790188R/xx active
-
1972
- 1972-09-21 AT AT813372A patent/AT318563B/de not_active IP Right Cessation
- 1972-09-26 GB GB4447572A patent/GB1351557A/en not_active Expired
- 1972-09-26 AU AU47077/72A patent/AU471732B2/en not_active Expired
- 1972-10-09 CS CS6793A patent/CS161064B2/cs unknown
- 1972-10-11 NO NO3647/72A patent/NO130643C/no unknown
- 1972-10-18 IL IL40610A patent/IL40610A/xx unknown
- 1972-10-18 DE DE2251095A patent/DE2251095C3/de not_active Expired
- 1972-10-18 NL NL727214106A patent/NL153516B/xx unknown
- 1972-10-19 SU SU1839168A patent/SU496722A3/ru active
- 1972-10-19 DK DK515372AA patent/DK135576B/da unknown
- 1972-10-19 ZA ZA727459A patent/ZA727459B/xx unknown
- 1972-10-20 JP JP47105138A patent/JPS515379B2/ja not_active Expired
- 1972-10-20 CA CA154,342A patent/CA992983A/en not_active Expired
- 1972-10-20 SE SE7213548A patent/SE389103B/xx unknown
- 1972-10-20 HU HUEA113A patent/HU165185B/hu unknown
- 1972-10-20 FR FR7237226A patent/FR2157897B2/fr not_active Expired
- 1972-10-20 CH CH1539372A patent/CH565741A5/xx not_active IP Right Cessation
-
1977
- 1977-01-25 KE KE2693A patent/KE2693A/xx unknown
- 1977-02-17 HK HK93/77A patent/HK9377A/xx unknown
- 1977-12-30 MY MY158/77A patent/MY7700158A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO130643C (enFirst) | 1975-01-15 |
| NL153516B (nl) | 1977-06-15 |
| IL40610A0 (en) | 1972-12-29 |
| DE2251095C3 (de) | 1976-01-02 |
| HU165185B (enFirst) | 1974-07-27 |
| JPS515379B2 (enFirst) | 1976-02-19 |
| SU496722A3 (ru) | 1975-12-25 |
| AU4707772A (en) | 1974-04-04 |
| CS161064B2 (enFirst) | 1975-05-04 |
| AT318563B (de) | 1974-10-25 |
| MY7700158A (en) | 1977-12-31 |
| JPS4849750A (enFirst) | 1973-07-13 |
| FR2157897B2 (enFirst) | 1975-06-20 |
| AU471732B2 (en) | 1976-04-29 |
| NO130643B (enFirst) | 1974-10-07 |
| HK9377A (en) | 1977-02-25 |
| FR2157897A2 (enFirst) | 1973-06-08 |
| GB1351557A (en) | 1974-05-01 |
| DE2251095B2 (de) | 1975-05-07 |
| SE389103B (sv) | 1976-10-25 |
| BE790188R (fr) | 1973-04-17 |
| NL7214106A (enFirst) | 1973-04-25 |
| ZA727459B (en) | 1974-05-29 |
| KE2693A (en) | 1977-02-11 |
| CA992983A (en) | 1976-07-13 |
| DE2251095A1 (de) | 1973-05-10 |
| DK135576C (enFirst) | 1977-10-31 |
| DK135576B (da) | 1977-05-23 |
| CH565741A5 (enFirst) | 1975-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU35131B (en) | Process for preparing phenyl-3-oxadiazole-1,3,4-one-2 | |
| IL40250A0 (en) | 3,4-dihydro-2h-isoquinoline-1-thiones and process for preparing them | |
| ZA725996B (en) | 3,4-dihydro-2h-isoquinoline-1-ones and process for preparing them | |
| GB1407478A (en) | 11beta-alkoxy-estra-1,3,5-10-trienes and processes for their preparation | |
| ZA728821B (en) | 8,12-diisoprostanoic acid derivatives and process for their preparation | |
| IL37854A0 (en) | Substituted 2,2'-biimidazoles and process for their preparation | |
| HK69576A (en) | Phenyl-pyridylallylamines, and a process for their preparation | |
| HK9377A (en) | 1,4-methano- and ethano-tetrahydronaphthyl-oxypropanols and process for their preparation | |
| IL38562A0 (en) | New rutin-complexes and process for the preparation thereof | |
| IL40133A0 (en) | Thiazolino-pyrimidin-5-one derivatives,process for their preparation and applications thereof | |
| IL40022A (en) | 17alpha-ethynyl-16,17-dihydroxy-13beta-alkyl gona-4,9,11-triene-3-ones and process for preparing them | |
| IL39945A0 (en) | 14,15beta-epoxycardenolide-and 14,15beta-epoxybufadienolideglycosides and process for their preparation | |
| ZA721523B (en) | 17a-ethynylestriols and process for preparing same | |
| CA862764A (en) | 3-cycloamino-1,2,8,9-tetraazaphenalenes and process for their preparation | |
| PH10379A (en) | Thioallophanimidate derivatives and process for the preparation thereof | |
| ZA712827B (en) | 2,3-alkylidene-rhamnopyranosides and process for preparing them | |
| IE36149B1 (en) | New pyrimidinyl-piperazines and processes for their preparation | |
| KR780000086B1 (en) | 1.2-dipheny-ethane derivatives and process for the preparation | |
| GB1403409A (en) | Substituted 3,4-dihydropyrimido-4-5-d- pyridazine derivatives and process for producing them | |
| ZA715628B (en) | Aminoacetylderivatives of 2,3-diphenylcyclopropylamine,and process for the preparation thereof | |
| CA866783A (en) | 22,25-epoxy-steroids and process for preparing them | |
| CA943951A (en) | 17.alpha.-PROPADIENYL-STEROIDS AND PROCESS FOR THEIR PREPARATION | |
| PH10152A (en) | Pyrazinoyalkylbenzenesulfonylureas and process for their preparation | |
| EG10547A (en) | Process for preparation of 1,5 benzodiazines | |
| CA862763A (en) | 3-amino-1,2,8,9-tetraazaphenalenes and process for their preparation |