IL38749A - Dihydrocodeine manufacture - Google Patents
Dihydrocodeine manufactureInfo
- Publication number
- IL38749A IL38749A IL38749A IL3874972A IL38749A IL 38749 A IL38749 A IL 38749A IL 38749 A IL38749 A IL 38749A IL 3874972 A IL3874972 A IL 3874972A IL 38749 A IL38749 A IL 38749A
- Authority
- IL
- Israel
- Prior art keywords
- dihydrocodeine
- manufacture
- dihydrocodeine manufacture
- Prior art date
Links
- RBOXVHNMENFORY-DNJOTXNNSA-N dihydrocodeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC RBOXVHNMENFORY-DNJOTXNNSA-N 0.000 title 1
- 229960000920 dihydrocodeine Drugs 0.000 title 1
- XYYVYLMBEZUESM-UHFFFAOYSA-N dihydrocodeine Natural products C1C(N(CCC234)C)C2C=CC(=O)C3OC2=C4C1=CC=C2OC XYYVYLMBEZUESM-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D489/00—Heterocyclic compounds containing 4aH-8, 9 c- Iminoethano-phenanthro [4, 5-b, c, d] furan ring systems, e.g. derivatives of [4, 5-epoxy]-morphinan of the formula:
- C07D489/02—Heterocyclic compounds containing 4aH-8, 9 c- Iminoethano-phenanthro [4, 5-b, c, d] furan ring systems, e.g. derivatives of [4, 5-epoxy]-morphinan of the formula: with oxygen atoms attached in positions 3 and 6, e.g. morphine, morphinone
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB508171A GB1366931A (en) | 1971-02-22 | 1971-02-22 | Dihydrocodeine manufacture |
| GB4024571 | 1971-08-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL38749A0 IL38749A0 (en) | 1972-04-27 |
| IL38749A true IL38749A (en) | 1974-11-29 |
Family
ID=26239609
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL38749A IL38749A (en) | 1971-02-22 | 1972-02-14 | Dihydrocodeine manufacture |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5614672B1 (cs) |
| BE (1) | BE779598A (cs) |
| CA (1) | CA987317A (cs) |
| CH (1) | CH561214A5 (cs) |
| CS (1) | CS167968B2 (cs) |
| DE (1) | DE2207516C2 (cs) |
| FR (1) | FR2126278B1 (cs) |
| GB (1) | GB1366931A (cs) |
| HU (1) | HU164284B (cs) |
| IL (1) | IL38749A (cs) |
| NL (1) | NL175062C (cs) |
| PL (1) | PL82275B1 (cs) |
| SE (1) | SE393616B (cs) |
| YU (2) | YU47272A (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2008276385B2 (en) * | 2007-07-17 | 2013-07-18 | SpecGx LLC | Preparation of N-alkylated opiates by reductive amination |
| GB0914338D0 (en) | 2009-08-17 | 2009-09-30 | Johnson Matthey Plc | Improved process |
| KR102691151B1 (ko) * | 2021-12-09 | 2024-08-05 | 박을준 | 카테터, 카테터 조작 방법 및 카테터 시스템 |
-
1971
- 1971-02-22 GB GB508171A patent/GB1366931A/en not_active Expired
-
1972
- 1972-02-14 IL IL38749A patent/IL38749A/xx unknown
- 1972-02-15 CA CA134,891A patent/CA987317A/en not_active Expired
- 1972-02-17 DE DE2207516A patent/DE2207516C2/de not_active Expired
- 1972-02-21 YU YU00472/72A patent/YU47272A/xx unknown
- 1972-02-21 JP JP1798972A patent/JPS5614672B1/ja active Pending
- 1972-02-21 BE BE779598A patent/BE779598A/xx not_active IP Right Cessation
- 1972-02-21 CS CS1102A patent/CS167968B2/cs unknown
- 1972-02-21 SE SE7202095A patent/SE393616B/xx unknown
- 1972-02-21 HU HUMA2325A patent/HU164284B/hu unknown
- 1972-02-21 YU YU427/72A patent/YU39579B/xx unknown
- 1972-02-22 NL NLAANVRAGE7202337,A patent/NL175062C/xx not_active IP Right Cessation
- 1972-02-22 FR FR7205914A patent/FR2126278B1/fr not_active Expired
- 1972-02-22 CH CH250672A patent/CH561214A5/xx not_active IP Right Cessation
- 1972-02-22 PL PL1972153613A patent/PL82275B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH561214A5 (cs) | 1975-04-30 |
| NL7202337A (cs) | 1972-08-24 |
| JPS5614672B1 (cs) | 1981-04-06 |
| SE393616B (sv) | 1977-05-16 |
| PL82275B1 (en) | 1975-10-31 |
| CA987317A (en) | 1976-04-13 |
| CS167968B2 (cs) | 1976-05-28 |
| YU47272A (en) | 1982-02-28 |
| DE2207516C2 (de) | 1985-08-22 |
| FR2126278B1 (cs) | 1975-06-13 |
| DE2207516A1 (de) | 1973-08-02 |
| YU39579B (en) | 1985-03-20 |
| FR2126278A1 (cs) | 1972-10-06 |
| NL175062B (nl) | 1984-04-16 |
| IL38749A0 (en) | 1972-04-27 |
| HU164284B (cs) | 1974-01-28 |
| BE779598A (fr) | 1972-08-21 |
| NL175062C (nl) | 1984-09-17 |
| GB1366931A (en) | 1974-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5154889A (en) | Shokubaisakutaino seiho | |
| CY861A (en) | Phenicillins | |
| JPS5173153A (en) | Ekijosutaataa narabini doseizoho | |
| ZA723721B (en) | Sweper | |
| GB1406623A (en) | Nitromethylcyclopentanones | |
| EG10585A (en) | Phenoxycarboxamides | |
| JPS5533475A (en) | Carbobenzoxydiglycyllllarginyll44methoxyy 22naphthylamide | |
| GB1404022A (en) | Dihydropyridazones | |
| AU4916772A (en) | Benzimidazolyl-2-aminoimidazolines | |
| CY988A (en) | Thienobenzazepines | |
| AU4209872A (en) | Container-agitator | |
| IE36289L (en) | Diamino-benzylpyrimidines | |
| GB1389829A (en) | Clawrings | |
| IL38749A0 (en) | Dihydrocodeine manufacture | |
| YU33380B (en) | Termostaticni ventili | |
| GB1400755A (en) | Benzodizepines | |
| GB1400602A (en) | 2-5-nitro-2-thazolyl-benzimidazoles | |
| IE36520L (en) | Pyrimidotriazines | |
| GB1401975A (en) | 3-trifluoromethyl-anilides | |
| CA34806S (en) | Vahicle | |
| CA34075S (en) | Sauceboat | |
| CA34072S (en) | Stewpan | |
| CA33516S (en) | Clamp-aroundammeter-voltmeter | |
| CA34069S (en) | Frypan | |
| CA34306S (en) | Conitainer |