IL35289A0 - Alpha-substituted indolizine acetic acids and their preparation - Google Patents
Alpha-substituted indolizine acetic acids and their preparationInfo
- Publication number
- IL35289A0 IL35289A0 IL35289A IL3528970A IL35289A0 IL 35289 A0 IL35289 A0 IL 35289A0 IL 35289 A IL35289 A IL 35289A IL 3528970 A IL3528970 A IL 3528970A IL 35289 A0 IL35289 A0 IL 35289A0
- Authority
- IL
- Israel
- Prior art keywords
- alpha
- preparation
- acetic acids
- substituted indolizine
- indolizine acetic
- Prior art date
Links
- IPDNBDOUHDYJAG-UHFFFAOYSA-N acetic acid;indolizine Chemical class CC(O)=O.C1=CC=CN2C=CC=C21 IPDNBDOUHDYJAG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB48856/69A GB1268424A (en) | 1969-10-04 | 1969-10-04 | Indolizine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL35289A0 true IL35289A0 (en) | 1970-11-30 |
Family
ID=10450175
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL35289A IL35289A0 (en) | 1969-10-04 | 1970-09-14 | Alpha-substituted indolizine acetic acids and their preparation |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS4910517B1 (de) |
| AT (1) | AT295513B (de) |
| AU (1) | AU1989470A (de) |
| BE (1) | BE756822A (de) |
| DE (1) | DE2046904A1 (de) |
| ES (1) | ES383992A1 (de) |
| FR (1) | FR2070109B1 (de) |
| GB (1) | GB1268424A (de) |
| IE (1) | IE34591B1 (de) |
| IL (1) | IL35289A0 (de) |
| NL (1) | NL7013584A (de) |
| ZA (1) | ZA706287B (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT376677B (de) * | 1979-12-06 | 1984-12-27 | Labaz Sanofi Nv | Verfahren zur herstellung von neuen indolizinderivaten und deren pharmazeutisch zulaessigen saeureadditionssalzen |
| AT376676B (de) * | 1979-12-06 | 1984-12-27 | Labaz Sanofi Nv | Verfahren zur herstellung von neuen indolizinderivaten und deren pharmazeutisch zulaessigen saeureadditionssalzen |
| US5334716A (en) * | 1991-06-17 | 1994-08-02 | Fujisawa Pharmaceutical Co., Ltd. | Heterocyclic derivatives |
| RU2120942C1 (ru) * | 1991-06-17 | 1998-10-27 | Фудзисава Фармасьютикал Ко., Лтд. | ПРОИЗВОДНЫЕ ИНДОЛИЗИНА, СПОСОБ ИХ ПОЛУЧЕНИЯ, ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ, СПОСОБ ИНГИБИРОВАНИЯ ТЕСТОСТЕРОН 5α-РЕДУКТАЗЫ |
| GB0512944D0 (en) * | 2005-06-24 | 2005-08-03 | Argenta Discovery Ltd | Indolizine compounds |
| EA200970590A1 (ru) * | 2006-12-21 | 2009-12-30 | Арджента Дискавери Лимитед | Антагонисты crth2 |
-
1969
- 1969-10-04 GB GB48856/69A patent/GB1268424A/en not_active Expired
-
1970
- 1970-09-09 IE IE1167/70A patent/IE34591B1/xx unknown
- 1970-09-14 IL IL35289A patent/IL35289A0/xx unknown
- 1970-09-14 AU AU19894/70A patent/AU1989470A/en not_active Expired
- 1970-09-14 NL NL7013584A patent/NL7013584A/xx unknown
- 1970-09-14 ZA ZA706287A patent/ZA706287B/xx unknown
- 1970-09-23 DE DE19702046904 patent/DE2046904A1/de active Pending
- 1970-09-25 ES ES383992A patent/ES383992A1/es not_active Expired
- 1970-09-29 BE BE70@@@@@@@@A patent/BE756822A/xx unknown
- 1970-09-29 AT AT877170A patent/AT295513B/de not_active IP Right Cessation
- 1970-10-01 FR FR7035477A patent/FR2070109B1/fr not_active Expired
- 1970-10-03 JP JP45087040A patent/JPS4910517B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ZA706287B (en) | 1971-06-30 |
| IE34591B1 (en) | 1975-06-25 |
| IE34591L (en) | 1971-04-04 |
| DE2046904A1 (de) | 1971-04-22 |
| ES383992A1 (es) | 1973-09-01 |
| FR2070109B1 (de) | 1974-02-01 |
| AT295513B (de) | 1972-01-10 |
| AU1989470A (en) | 1972-03-16 |
| FR2070109A1 (de) | 1971-09-10 |
| BE756822A (fr) | 1971-03-29 |
| NL7013584A (de) | 1971-04-06 |
| JPS4910517B1 (de) | 1974-03-11 |
| GB1268424A (en) | 1972-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL38378A (en) | 3 -hydroxy-androstane-17 -carboxylic acid 17 -carboxaldehyde and 17 -carboxamide derivatives and their preparation | |
| CA939666A (en) | Thiazolylacetic acids and salts thereof | |
| IL35289A0 (en) | Alpha-substituted indolizine acetic acids and their preparation | |
| CY731A (en) | Substituted indenylacetic acids and their derivatives | |
| IL39347A (en) | Benzamidoacetohydroxamic acids and their preparation | |
| PH10599A (en) | Fluorene-2-acetic acids and derivatives thereof | |
| IL35043A0 (en) | Substituted alkenoic acids and their preparation | |
| IL35579A (en) | Amidinophenyl propionic acids | |
| ZA739662B (en) | Sulfamylbenzoic acids and preparation thereof | |
| CA960227A (en) | Substituted phenylthiosalicylic acids and processes for their preparation | |
| IL30331A0 (en) | Penicillanic acids and their preparation | |
| IL34966A0 (en) | Nitrilotriacetic acid and nitrilotriacetic anhydride derivatives and their preparation | |
| IL29945A (en) | Beta-hydrazino carboxylic acids and processes for their preparation | |
| PH10552A (en) | 1h-tetrazole-l-acetate esters and acids | |
| CY710A (en) | Alpha-hydrazino acids | |
| CA963021A (en) | Biphenylene carboxylic acids and processes for their preparation | |
| ZA71329B (en) | Substituted phenylacetic acids and their preparation | |
| CA954877A (en) | Substituted phenoxysalicylic acids and derivatives thereof including processes for their preparation | |
| CA811163A (en) | Hydrocarboxylic acids derivatives thereof and their preparation | |
| AU450853B2 (en) | Substituted phenylacetic acids and their preparation | |
| CA829907A (en) | Long chain acids and their preparation | |
| CA801085A (en) | Diaminonaphthalene-4-sulfonic acids and their preparation | |
| CA816177A (en) | Polyfluorosulfonic acids and polyfluorosulfones | |
| AU447962B2 (en) | Substituted alkenoic acids and their preparation | |
| CY794A (en) | Propionic acid derivatives and manufacture thereof |