IL34741A - Basically substituted 2,4-(1h,3h)-quinazolinedione derivatives,their preparation and pharmaceutical compositions containing them - Google Patents
Basically substituted 2,4-(1h,3h)-quinazolinedione derivatives,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL34741A IL34741A IL34741A IL3474170A IL34741A IL 34741 A IL34741 A IL 34741A IL 34741 A IL34741 A IL 34741A IL 3474170 A IL3474170 A IL 3474170A IL 34741 A IL34741 A IL 34741A
- Authority
- IL
- Israel
- Prior art keywords
- general formula
- formula
- stands
- basically
- substituted
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 title description 2
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical class C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 title 1
- 238000000034 method Methods 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- -1 alkoxy benzoic acid Chemical compound 0.000 claims description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 241000575946 Ione Species 0.000 description 3
- LTXREWYXXSTFRX-QGZVFWFLSA-N Linagliptin Chemical compound N=1C=2N(C)C(=O)N(CC=3N=C4C=CC=CC4=C(C)N=3)C(=O)C=2N(CC#CC)C=1N1CCC[C@@H](N)C1 LTXREWYXXSTFRX-QGZVFWFLSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KDKGWGUUUVROTO-UHFFFAOYSA-N 1-hydroxypiperazine Chemical compound ON1CCNCC1 KDKGWGUUUVROTO-UHFFFAOYSA-N 0.000 description 1
- LPAGINTVAKHGHU-UHFFFAOYSA-N 3-propylbenzoyl chloride Chemical compound CCCC1=CC=CC(C(Cl)=O)=C1 LPAGINTVAKHGHU-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- DKOQGJHPHLTOJR-WHRDSVKCSA-N cefpirome Chemical compound N([C@@H]1C(N2C(=C(C[N+]=3C=4CCCC=4C=CC=3)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 DKOQGJHPHLTOJR-WHRDSVKCSA-N 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 150000008515 quinazolinediones Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
- C07D239/96—Two oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691934036 DE1934036A1 (de) | 1969-07-04 | 1969-07-04 | Basisch substituierte Derivate des 2,4-(1H,3H)-Chinazolindions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34741A0 IL34741A0 (en) | 1970-08-19 |
| IL34741A true IL34741A (en) | 1973-03-30 |
Family
ID=5738912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34741A IL34741A (en) | 1969-07-04 | 1970-06-17 | Basically substituted 2,4-(1h,3h)-quinazolinedione derivatives,their preparation and pharmaceutical compositions containing them |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3740398A (ro) |
| AT (2) | AT297711B (ro) |
| BE (1) | BE753009A (ro) |
| BG (2) | BG17572A3 (ro) |
| BR (1) | BR6915287D0 (ro) |
| CA (1) | CA949971A (ro) |
| CH (2) | CH551981A (ro) |
| CS (1) | CS167924B2 (ro) |
| DE (1) | DE1934036A1 (ro) |
| DK (1) | DK124683B (ro) |
| ES (2) | ES381403A1 (ro) |
| FR (1) | FR2059481B1 (ro) |
| GB (1) | GB1311543A (ro) |
| IE (1) | IE34309B1 (ro) |
| IL (1) | IL34741A (ro) |
| NL (1) | NL7009211A (ro) |
| NO (1) | NO127580B (ro) |
| PL (1) | PL72734B1 (ro) |
| RO (2) | RO57547A (ro) |
| ZA (1) | ZA704558B (ro) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1204071B (de) * | 1957-06-15 | 1965-10-28 | Dr Hans Thoma | Lagerung der Triebwelle einer Druckfluessigkeits-Axialkolbenmaschine |
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US4263220A (en) * | 1979-02-02 | 1981-04-21 | The Dow Chemical Company | Alkylene dicyanates |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3274194A (en) * | 1963-03-29 | 1966-09-20 | Miles Lab | Quinazolinedione derivatives |
-
1969
- 1969-07-04 DE DE19691934036 patent/DE1934036A1/de active Pending
- 1969-12-17 BR BR215287/69A patent/BR6915287D0/pt unknown
-
1970
- 1970-06-16 IE IE782/70A patent/IE34309B1/xx unknown
- 1970-06-17 IL IL34741A patent/IL34741A/en unknown
- 1970-06-23 BG BG016572A patent/BG17572A3/xx unknown
- 1970-06-23 BG BG014998A patent/BG17777A3/xx unknown
- 1970-06-23 NL NL7009211A patent/NL7009211A/xx unknown
- 1970-06-25 DK DK331670AA patent/DK124683B/da unknown
- 1970-06-25 US US00049923A patent/US3740398A/en not_active Expired - Lifetime
- 1970-07-02 RO RO63817A patent/RO57547A/ro unknown
- 1970-07-02 RO RO7000069978A patent/RO62415A/ro unknown
- 1970-07-03 CH CH1013970A patent/CH551981A/xx not_active IP Right Cessation
- 1970-07-03 PL PL1970141807A patent/PL72734B1/pl unknown
- 1970-07-03 BE BE753009D patent/BE753009A/xx unknown
- 1970-07-03 AT AT603570A patent/AT297711B/de not_active IP Right Cessation
- 1970-07-03 AT AT603670A patent/AT296999B/de not_active IP Right Cessation
- 1970-07-03 ZA ZA704558A patent/ZA704558B/xx unknown
- 1970-07-03 ES ES381403A patent/ES381403A1/es not_active Expired
- 1970-07-03 GB GB3238470A patent/GB1311543A/en not_active Expired
- 1970-07-03 CH CH1013870A patent/CH551980A/xx not_active IP Right Cessation
- 1970-07-03 NO NO02638/70A patent/NO127580B/no unknown
- 1970-07-03 FR FR7024774A patent/FR2059481B1/fr not_active Expired
- 1970-07-03 ES ES381402A patent/ES381402A1/es not_active Expired
- 1970-07-03 CA CA087,172A patent/CA949971A/en not_active Expired
- 1970-07-06 CS CS4715A patent/CS167924B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH551980A (de) | 1974-07-31 |
| CS167924B2 (ro) | 1976-05-28 |
| RO62415A (fr) | 1977-10-15 |
| ES381403A1 (es) | 1973-03-16 |
| GB1311543A (en) | 1973-03-28 |
| AT297711B (de) | 1972-04-10 |
| CA949971A (en) | 1974-06-25 |
| IL34741A0 (en) | 1970-08-19 |
| ES381402A1 (es) | 1973-04-01 |
| DE1934036A1 (de) | 1971-01-07 |
| IE34309L (en) | 1971-01-04 |
| AT296999B (de) | 1972-03-10 |
| FR2059481B1 (ro) | 1974-03-22 |
| FR2059481A1 (ro) | 1971-06-04 |
| US3740398A (en) | 1973-06-19 |
| ZA704558B (en) | 1971-03-31 |
| BG17777A3 (bg) | 1973-12-25 |
| BR6915287D0 (pt) | 1973-04-19 |
| CH551981A (de) | 1974-07-31 |
| BE753009A (fr) | 1971-01-04 |
| BG17572A3 (bg) | 1973-11-10 |
| PL72734B1 (ro) | 1974-08-30 |
| IE34309B1 (en) | 1975-04-02 |
| NO127580B (ro) | 1973-07-16 |
| DK124683B (da) | 1972-11-13 |
| RO57547A (ro) | 1975-02-15 |
| NL7009211A (ro) | 1971-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4315007A (en) | 4-Amino-6,7-dimethoxyquinazol-2-yl alkylenediamines | |
| US4171363A (en) | 1,2,3-Thiadiazole process | |
| US4101548A (en) | 1,2,3-Thiadiazole amides | |
| US4029673A (en) | N-(1-benzyl pyrrolidinyl 2-alkyl) substituted benzamides and derivatives thereof | |
| CA1086735A (en) | Piperidino-quinazolines | |
| US4783530A (en) | 8-arylxanthines | |
| CA1092111A (en) | Sulfonamido-benzoic acid derivatives and process for the preparation thereof | |
| JPH07500817A (ja) | 有機ニトラート、その製造方法及びこれを心臓血管疾患の治療に使用する方法 | |
| US3200151A (en) | Arylaminoalkyl guanidines | |
| Kornet et al. | Synthesis of 3‐amino‐2, 4 (1H, 3H)‐quinazolinediones for testing as anticonvulsants | |
| IL34741A (en) | Basically substituted 2,4-(1h,3h)-quinazolinedione derivatives,their preparation and pharmaceutical compositions containing them | |
| HU211517A9 (en) | 2-amino-1,2,3,4-tetrahydronaphthalene derivatives active on the cardiovascular system, processes for their preparation and pharmaceutical compositions containing them | |
| US3718648A (en) | Basically substituted 2,4-(1h,3h)-quinazolindione derivatives | |
| US2449638A (en) | Substituted glycinamides | |
| US3959281A (en) | Piperazino substituted coumarin derivatives | |
| US3509141A (en) | 2-amino-quinazolines | |
| US4268511A (en) | 3-Amino(1H,3H)quinazoline-2,4-dione derivatives and their therapeutic applications | |
| US4333937A (en) | 2-(Piperazinyl)-4-pyrimioinamines | |
| US4102890A (en) | 2-Amino oxazolines and process for making the same | |
| US3726902A (en) | Furfuryl amino-coumarins | |
| HU181580B (en) | Process for preparing 1-benzoxepin-5/2h/-one derivatives | |
| US5232922A (en) | Imidazole compounds, processes for their preparation, pharmaceuticals based on these compounds and some intermediates | |
| US3663610A (en) | Amidine derivatives with spasmolytic,psychostimulant and anorexigenic properties | |
| US3738985A (en) | Certain 3-(3-amino-2-benzoyloxypropyl)-4(3h)-quinazolinones | |
| US4749705A (en) | Quinazoline derivative and anti-hypertensive agents |