IL34683A - Dibenzofuran dicarboxylic acid derivatives - Google Patents
Dibenzofuran dicarboxylic acid derivativesInfo
- Publication number
- IL34683A IL34683A IL34683A IL3468370A IL34683A IL 34683 A IL34683 A IL 34683A IL 34683 A IL34683 A IL 34683A IL 3468370 A IL3468370 A IL 3468370A IL 34683 A IL34683 A IL 34683A
- Authority
- IL
- Israel
- Prior art keywords
- dicarboxylic acid
- acid derivatives
- dibenzofuran
- dibenzofuran dicarboxylic
- derivatives
- Prior art date
Links
- HTVKDVKYIFLRTI-UHFFFAOYSA-N dibenzofuran-1,2-dicarboxylic acid Chemical class C1=CC=C2C3=C(C(O)=O)C(C(=O)O)=CC=C3OC2=C1 HTVKDVKYIFLRTI-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US833717A US3867409A (en) | 1969-06-16 | 1969-06-16 | Bis-basic esters of dibenzofuran |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34683A0 IL34683A0 (en) | 1970-08-19 |
| IL34683A true IL34683A (en) | 1974-03-14 |
Family
ID=25265097
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34683A IL34683A (en) | 1969-06-16 | 1970-06-08 | Dibenzofuran dicarboxylic acid derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3867409A (OSRAM) |
| JP (1) | JPS5141635B1 (OSRAM) |
| CA (1) | CA949564A (OSRAM) |
| CH (1) | CH538470A (OSRAM) |
| DE (1) | DE2029510C3 (OSRAM) |
| FR (1) | FR2052974B1 (OSRAM) |
| GB (1) | GB1262052A (OSRAM) |
| IL (1) | IL34683A (OSRAM) |
| ZA (1) | ZA704011B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA950456A (en) * | 1970-05-01 | 1974-07-02 | Richardson-Merrell (Canada) Ltd. | Bis-basic ketones of dibenzothiophene |
| US4146624A (en) * | 1970-09-14 | 1979-03-27 | Richardson-Merrell Inc. | Method of treating viruses with bis-basic ketones of dibenzofuran |
| US5019573A (en) * | 1989-09-19 | 1991-05-28 | Euroceltique, S.A. | Substituted dibenzofurans and methods of using same |
| US5710274A (en) * | 1996-02-28 | 1998-01-20 | Neurogen Corporation | N-aminoalkyldibenzofurancarboxamides; new dopamine receptor subtype specific ligands |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3647860A (en) * | 1969-01-09 | 1972-03-07 | Richardson Merrell Inc | Fluorene bis-basic esters |
-
1969
- 1969-06-16 US US833717A patent/US3867409A/en not_active Expired - Lifetime
-
1970
- 1970-05-13 CA CA082,659A patent/CA949564A/en not_active Expired
- 1970-06-04 GB GB27104/70A patent/GB1262052A/en not_active Expired
- 1970-06-08 IL IL34683A patent/IL34683A/xx unknown
- 1970-06-12 ZA ZA704011A patent/ZA704011B/xx unknown
- 1970-06-15 DE DE2029510A patent/DE2029510C3/de not_active Expired
- 1970-06-16 FR FR707022121A patent/FR2052974B1/fr not_active Expired
- 1970-06-16 JP JP45052335A patent/JPS5141635B1/ja active Pending
- 1970-06-16 CH CH910970A patent/CH538470A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2052974B1 (OSRAM) | 1974-06-14 |
| FR2052974A1 (OSRAM) | 1971-04-16 |
| DE2029510B2 (de) | 1979-10-04 |
| CA949564A (en) | 1974-06-18 |
| DE2029510C3 (de) | 1980-06-19 |
| JPS5141635B1 (OSRAM) | 1976-11-11 |
| US3867409A (en) | 1975-02-18 |
| IL34683A0 (en) | 1970-08-19 |
| DE2029510A1 (OSRAM) | 1970-12-23 |
| GB1262052A (en) | 1972-02-02 |
| CH538470A (fr) | 1973-06-30 |
| ZA704011B (en) | 1971-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH9579A (en) | Substituted phenylalkanoic acid derivatives | |
| ZA707727B (en) | Xanthone derivatives | |
| HK61677A (en) | Triazolobenzodiazepine derivatives | |
| CY697A (en) | New sulphamyl-benzoic acid derivatives | |
| KE2582A (en) | Alkanolaminie derivatives | |
| IL37019A (en) | Dihydro-furo-quinoline carboxylic acid derivatives | |
| CY806A (en) | Phenylaminoethanol derivatives | |
| IL34685A (en) | Dibenzodioxocine derivatives | |
| IL35931A (en) | Alpha-aminooxycarbohydroxamic acid derivatives | |
| PH9290A (en) | Tetrahydrocyclopropadibenzazepine derivatives | |
| IL34683A (en) | Dibenzofuran dicarboxylic acid derivatives | |
| IE33874B1 (en) | New sulphamyl-benzoic acid derivatives | |
| CY823A (en) | New penicillanic acid derivatives | |
| CY819A (en) | Indenopyridine derivatives | |
| CY710A (en) | Alpha-hydrazino acids | |
| ZA705022B (en) | Nitrilotriacetic acid anhydrides and derivatives thereof | |
| ZA707765B (en) | New hydrazinecarbodithioate derivatives | |
| IE34405L (en) | Benzofuran derivatives | |
| IL34994A0 (en) | Hydroxyisoquinuclidine derivatives | |
| ZA704094B (en) | 2-hydroxy-5-benzamide derivatives | |
| ZA704013B (en) | Benzoisothiazol derivatives | |
| ZA704238B (en) | Dihydrobenzazepine derivatives | |
| PH12184A (en) | Phenyl-imidazolyl-fatty acid derivatives | |
| PH9285A (en) | Derivatives of 3-cyclopentene-1-carboxylic acid | |
| ZA695730B (en) | Aminocyclopentanecarboxylic acid derivatives |