IL31172A - N-(3,5-dichlorophenyl)cyclic imide derivatives,their preparation and microbicidal preparations containing them - Google Patents
N-(3,5-dichlorophenyl)cyclic imide derivatives,their preparation and microbicidal preparations containing themInfo
- Publication number
- IL31172A IL31172A IL31172A IL3117268A IL31172A IL 31172 A IL31172 A IL 31172A IL 31172 A IL31172 A IL 31172A IL 3117268 A IL3117268 A IL 3117268A IL 31172 A IL31172 A IL 31172A
- Authority
- IL
- Israel
- Prior art keywords
- dichlorophenyl
- cyclic imide
- cyclic
- succinimide
- active ingredient
- Prior art date
Links
- -1 cyclic imide Chemical class 0.000 title claims description 33
- 230000003641 microbiacidal effect Effects 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title description 4
- 239000000203 mixture Substances 0.000 claims description 15
- 239000004480 active ingredient Substances 0.000 claims description 11
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 claims description 10
- CFZLNRGUBAVQNO-UHFFFAOYSA-N N-(3,5-Dichlorophenyl)succinimide Chemical compound ClC1=CC(Cl)=CC(N2C(CCC2=O)=O)=C1 CFZLNRGUBAVQNO-UHFFFAOYSA-N 0.000 claims description 7
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 claims description 5
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 claims description 4
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229940014800 succinic anhydride Drugs 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 12
- 208000015181 infectious disease Diseases 0.000 description 10
- 235000013399 edible fruits Nutrition 0.000 description 9
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 9
- 230000000845 anti-microbial effect Effects 0.000 description 7
- 241000209094 Oryza Species 0.000 description 6
- OSSFTHGZMNLASE-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)pyrrole-2,5-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C=CC2=O)=O)=C1 OSSFTHGZMNLASE-UHFFFAOYSA-N 0.000 description 5
- 230000002458 infectious effect Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 241000233866 Fungi Species 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229960002317 succinimide Drugs 0.000 description 4
- HIDBROSJWZYGSZ-UHFFFAOYSA-N 1-phenylpyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C1=CC=CC=C1 HIDBROSJWZYGSZ-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000003032 phytopathogenic effect Effects 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 3
- 241000228245 Aspergillus niger Species 0.000 description 2
- 241001450781 Bipolaris oryzae Species 0.000 description 2
- 241000123650 Botrytis cinerea Species 0.000 description 2
- 235000016623 Fragaria vesca Nutrition 0.000 description 2
- 240000009088 Fragaria x ananassa Species 0.000 description 2
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 2
- 241000317981 Podosphaera fuliginea Species 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 244000052616 bacterial pathogen Species 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- NAGJZTKCGNOGPW-UHFFFAOYSA-K dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical compound [O-]P([O-])([S-])=S NAGJZTKCGNOGPW-UHFFFAOYSA-K 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- RRYATXLRCBOQTJ-UHFFFAOYSA-N (2,3,4,5,6-pentachlorophenyl) acetate Chemical compound CC(=O)OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl RRYATXLRCBOQTJ-UHFFFAOYSA-N 0.000 description 1
- CXNPLSGKWMLZPZ-GIFSMMMISA-N (2r,3r,6s)-3-[[(3s)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2h-pyran-2-carboxylic acid Chemical compound O1[C@@H](C(O)=O)[C@H](NC(=O)C[C@@H](N)CCN(C)C(N)=N)C=C[C@H]1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-GIFSMMMISA-N 0.000 description 1
- WBEJYOJJBDISQU-UHFFFAOYSA-N 1,2-Dibromo-3-chloropropane Chemical compound ClCC(Br)CBr WBEJYOJJBDISQU-UHFFFAOYSA-N 0.000 description 1
- 229940100682 1,2-dibromo-3-chloropropane Drugs 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZTUKZULGOCFJET-UHFFFAOYSA-N 1-phenylpyrrolidine-2,5-dione Chemical group O=C1CCC(=O)N1C1=CC=CC=C1 ZTUKZULGOCFJET-UHFFFAOYSA-N 0.000 description 1
- RVCKCEDKBVEEHL-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobenzyl alcohol Chemical compound OCC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl RVCKCEDKBVEEHL-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- YAUCKEPYKXHCFF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;manganese Chemical compound [Mn].NC(=S)SCCSC(N)=S YAUCKEPYKXHCFF-UHFFFAOYSA-N 0.000 description 1
- SMARLDCRQUMZJR-UHFFFAOYSA-N 2-hydroxy-2-(2,3,4,5,6-pentachlorophenyl)acetonitrile Chemical compound N#CC(O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl SMARLDCRQUMZJR-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- 241000352690 Alternaria kikuchiana Species 0.000 description 1
- 241000412366 Alternaria mali Species 0.000 description 1
- 241001530056 Athelia rolfsii Species 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241001133184 Colletotrichum agaves Species 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- IWDQPCIQCXRBQP-UHFFFAOYSA-M Fenaminosulf Chemical compound [Na+].CN(C)C1=CC=C(N=NS([O-])(=O)=O)C=C1 IWDQPCIQCXRBQP-UHFFFAOYSA-M 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 206010027146 Melanoderma Diseases 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 241000918585 Pythium aphanidermatum Species 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 241000221662 Sclerotinia Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 241000589652 Xanthomonas oryzae Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- MLWMZTRCXNCAPF-UHFFFAOYSA-N azane;methylarsonic acid Chemical compound [NH4+].C[As](O)([O-])=O MLWMZTRCXNCAPF-UHFFFAOYSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- CXNPLSGKWMLZPZ-UHFFFAOYSA-N blasticidin-S Natural products O1C(C(O)=O)C(NC(=O)CC(N)CCN(C)C(N)=N)C=CC1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-UHFFFAOYSA-N 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- 229960005091 chloramphenicol Drugs 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- UPHVDBIPEJJINY-UHFFFAOYSA-L iron(2+);methyl-dioxido-oxo-$l^{5}-arsane Chemical compound [Fe+2].C[As]([O-])([O-])=O UPHVDBIPEJJINY-UHFFFAOYSA-L 0.000 description 1
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- PNMGPRJUKKTPSV-UHFFFAOYSA-N n-[(2,3,4,5,6-pentachlorophenyl)methylidene]hydroxylamine Chemical compound ON=CC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl PNMGPRJUKKTPSV-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- FBQQHUGEACOBDN-UHFFFAOYSA-N quinomethionate Chemical compound N1=C2SC(=O)SC2=NC2=CC(C)=CC=C21 FBQQHUGEACOBDN-UHFFFAOYSA-N 0.000 description 1
- CLHHSSXFXYAXDB-UHFFFAOYSA-M sodium;2-(naphthalen-1-ylcarbamoyl)benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1C(=O)NC1=CC=CC2=CC=CC=C12 CLHHSSXFXYAXDB-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
- Indole Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7723367 | 1967-12-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL31172A0 IL31172A0 (en) | 1969-01-29 |
| IL31172A true IL31172A (en) | 1972-03-28 |
Family
ID=13628130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL31172A IL31172A (en) | 1967-12-01 | 1968-11-27 | N-(3,5-dichlorophenyl)cyclic imide derivatives,their preparation and microbicidal preparations containing them |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3586697A (cs) |
| BR (1) | BR6804482D0 (cs) |
| CH (1) | CH500187A (cs) |
| CS (1) | CS152462B2 (cs) |
| DE (1) | DE1812206A1 (cs) |
| DK (1) | DK120289B (cs) |
| ES (1) | ES360892A1 (cs) |
| FR (1) | FR1604658A (cs) |
| GB (1) | GB1227620A (cs) |
| IL (1) | IL31172A (cs) |
| NL (1) | NL6817250A (cs) |
| PL (1) | PL69898B1 (cs) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2015493A1 (cs) * | 1968-08-12 | 1970-04-30 | Sumitomo Chemical Co | |
| JPS6017764B2 (ja) * | 1976-07-10 | 1985-05-07 | イハラケミカル工業株式会社 | 水中生物忌避剤 |
| JPS5398959A (en) * | 1977-02-07 | 1978-08-29 | Sumitomo Chem Co Ltd | Cycloalkanespiro-3- 1-(3,5-dihalogenophenyl) pyrrolidine-2,5-dione process for their preparation and nonmedical fungicides containing the same as active constituents |
| US4128529A (en) * | 1977-04-08 | 1978-12-05 | Abbott Laboratories | Industrial biocide |
| DE2852924A1 (de) * | 1978-12-07 | 1980-06-26 | Bayer Ag | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| JPS5671006A (en) * | 1979-11-14 | 1981-06-13 | Ihara Chem Ind Co Ltd | Industrial mildewcide |
| DE3030926A1 (de) * | 1980-08-16 | 1982-04-01 | Consortium für elektrochemische Industrie GmbH, 8000 München | Substituierte bernsteinsaeureimide |
| IL76200A0 (en) * | 1984-08-30 | 1985-12-31 | Consortium Elektrochem Ind | Substituted 1-phenyl-3-methyl-pyrrolidinediones,their preparation and their use as fungicides |
| US5759462A (en) * | 1994-10-14 | 1998-06-02 | Amoco Corporaiton | Electrically conductive tapes and process |
| CN119707773A (zh) * | 2024-12-23 | 2025-03-28 | 中国农业大学 | 一种含马来酰亚胺结构的化合物的制备方法和应用 |
-
1968
- 1968-11-26 US US779278A patent/US3586697A/en not_active Expired - Lifetime
- 1968-11-27 DK DK577768AA patent/DK120289B/da unknown
- 1968-11-27 IL IL31172A patent/IL31172A/en unknown
- 1968-11-28 GB GB1227620D patent/GB1227620A/en not_active Expired
- 1968-11-29 ES ES0360892A patent/ES360892A1/es not_active Expired
- 1968-11-29 BR BR204482/68A patent/BR6804482D0/pt unknown
- 1968-11-29 FR FR1604658D patent/FR1604658A/fr not_active Expired
- 1968-12-02 CS CS8218A patent/CS152462B2/cs unknown
- 1968-12-02 PL PL1968135898A patent/PL69898B1/pl unknown
- 1968-12-02 DE DE19681812206 patent/DE1812206A1/de not_active Withdrawn
- 1968-12-02 NL NL6817250A patent/NL6817250A/xx unknown
- 1968-12-02 CH CH1793568A patent/CH500187A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH500187A (de) | 1970-12-15 |
| GB1227620A (cs) | 1971-04-07 |
| CS152462B2 (cs) | 1973-12-19 |
| PL69898B1 (cs) | 1973-10-31 |
| ES360892A1 (es) | 1971-10-16 |
| DK120289B (da) | 1971-05-10 |
| DE1812206A1 (de) | 1969-07-03 |
| FR1604658A (cs) | 1972-01-03 |
| IL31172A0 (en) | 1969-01-29 |
| US3586697A (en) | 1971-06-22 |
| BR6804482D0 (pt) | 1973-01-16 |
| NL6817250A (cs) | 1969-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3745170A (en) | Novel n-(3,5-dihalophenyl)-imide compounds | |
| US4229465A (en) | Cyanopyrrole derivatives | |
| DE3783289T2 (de) | Substituierte phenyl-2-propensaeure-derivate nuetzlich in der landwirtschaft. | |
| US3586697A (en) | Novel n-(3,5-dichlorophenyl) cyclic imide derivatives | |
| DE1806123A1 (de) | Bis (thioureido) benzole und ihre Metallsalze | |
| US4741768A (en) | Herbicidal substituted 2-[1-(3-trans-chloro-allyloxyamino)alkylidene]-cyclohexane dione salts | |
| US3966789A (en) | N-substituted aminonitrile derivatives | |
| US3925554A (en) | Certain 3,5-dichlorophenyl compound used as a plant fungicide | |
| EP0104432A2 (en) | Herbicide and plant growth regulator comprising alpha-beta-unsaturated compound | |
| US4081267A (en) | Pyridyltriazinone herbicidal compositions | |
| US4082849A (en) | Halogenated n-(3,5-dihalophenyl)cyclopropanedicarboximides | |
| CA1046061A (en) | Pyridyltriazinone compounds | |
| PL82801B1 (en) | N-(3,5-dihalogenophenyl)-oxazolidine compounds and preparation thereof[us3743651a] | |
| JPS57183764A (en) | Substituted acetanilide compound, its preparation, and herbicide | |
| US3963746A (en) | 4,5 Dihalopyrrol 2-yl di and tri halomethyl ketones | |
| EP0412681B1 (en) | Azolidine derivatives, process for preparing the same and agricultural and horticultural fungicide | |
| US4110462A (en) | N'-Sulfenyl-N"-dihalophenylimidazolidinediones | |
| US4115103A (en) | Germicidal herbicide for agriculture and horticulture | |
| US3636044A (en) | N-(3' 5'-dichlorophenyl)itaconimide | |
| US3876796A (en) | Anti-fungal composition and method | |
| US4100281A (en) | Mono-5-substituted-thio-3-chloro-4H-1,2,6-thiadiazin-4-one antifungal agents | |
| IL33040A (en) | Novel n-phenylmaleimide derivatives,process for preparing the same and fungicides and bactericides containing the same | |
| DE2617492A1 (de) | 3-(3',5'-dihalogenphenyl)-1-sulfonylimidazolidin-2,4-dione, verfahren zu ihrer herstellung und ihre verwendung als mikrobizide | |
| US4284427A (en) | Herbicidal composition for paddy fields | |
| SU296304A1 (cs) |