IL31079A - N,n'-disubstituted diazacycloalkanes alkylated at carbon atoms of the heterocyclus and pharmacologically acceptable acid addition salts thereof - Google Patents
N,n'-disubstituted diazacycloalkanes alkylated at carbon atoms of the heterocyclus and pharmacologically acceptable acid addition salts thereofInfo
- Publication number
- IL31079A IL31079A IL31079A IL3107968A IL31079A IL 31079 A IL31079 A IL 31079A IL 31079 A IL31079 A IL 31079A IL 3107968 A IL3107968 A IL 3107968A IL 31079 A IL31079 A IL 31079A
- Authority
- IL
- Israel
- Prior art keywords
- methyl
- hydrogen
- formula
- group
- trimethoxy
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 25
- 239000002253 acid Substances 0.000 title claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 32
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 239000002585 base Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 10
- SJSOFNCYXJUNBT-UHFFFAOYSA-N 3,4,5-trimethoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC(OC)=C1OC SJSOFNCYXJUNBT-UHFFFAOYSA-N 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- IWPZKOJSYQZABD-UHFFFAOYSA-N 3,4,5-trimethoxybenzoic acid Natural products COC1=CC(OC)=CC(C(O)=O)=C1 IWPZKOJSYQZABD-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 150000007514 bases Chemical class 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 13
- 230000000063 preceeding effect Effects 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 238000001816 cooling Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229940086542 triethylamine Drugs 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- IFFPICMESYHZPQ-UHFFFAOYSA-N Prenylamine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)CCNC(C)CC1=CC=CC=C1 IFFPICMESYHZPQ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000017531 blood circulation Effects 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229960001989 prenylamine Drugs 0.000 description 3
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 3
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 2
- LCAUMHWMXSOPCJ-UHFFFAOYSA-N 3-chloropropyl 3,4,5-trimethoxybenzoate Chemical compound COC1=CC(C(=O)OCCCCl)=CC(OC)=C1OC LCAUMHWMXSOPCJ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- KRQAMFQCSAJCRH-UHFFFAOYSA-N hexobendine Chemical compound COC1=C(OC)C(OC)=CC(C(=O)OCCCN(C)CCN(C)CCCOC(=O)C=2C=C(OC)C(OC)=C(OC)C=2)=C1 KRQAMFQCSAJCRH-UHFFFAOYSA-N 0.000 description 2
- 229960002212 hexobendine Drugs 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- NSMWYRLQHIXVAP-OLQVQODUSA-N (2r,5s)-2,5-dimethylpiperazine Chemical compound C[C@H]1CN[C@H](C)CN1 NSMWYRLQHIXVAP-OLQVQODUSA-N 0.000 description 1
- NSMWYRLQHIXVAP-WDSKDSINSA-N (2s,5s)-2,5-dimethylpiperazine Chemical compound C[C@H]1CN[C@@H](C)CN1 NSMWYRLQHIXVAP-WDSKDSINSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- GOTVEDVYURXGPS-UHFFFAOYSA-N 2,5-dimethylpiperazine;dihydrochloride Chemical compound Cl.Cl.CC1CNC(C)CN1 GOTVEDVYURXGPS-UHFFFAOYSA-N 0.000 description 1
- DXOHZOPKNFZZAD-UHFFFAOYSA-N 2-ethylpiperazine Chemical compound CCC1CNCCN1 DXOHZOPKNFZZAD-UHFFFAOYSA-N 0.000 description 1
- VCKAKBROIJTVJI-UHFFFAOYSA-N 2-ethylpiperazine;dihydrochloride Chemical compound Cl.Cl.CCC1CNCCN1 VCKAKBROIJTVJI-UHFFFAOYSA-N 0.000 description 1
- -1 3 , 4 , 5-trimethoxy benzoic acid halogenoalkyl ester Chemical class 0.000 description 1
- UVXAWMSPEPINFC-UHFFFAOYSA-N 3,3,4-trimethoxycyclohexa-1,5-diene-1-carboxylic acid Chemical compound COC1(C(C=CC(C(=O)O)=C1)OC)OC UVXAWMSPEPINFC-UHFFFAOYSA-N 0.000 description 1
- FZLSDZZNPXXBBB-KDURUIRLSA-N 5-chloro-N-[3-cyclopropyl-5-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-amine Chemical compound C[C@H]1CN(Cc2cc(Nc3ncc(Cl)c(n3)-c3c[nH]c4cc(C)ccc34)cc(c2)C2CC2)C[C@@H](C)N1 FZLSDZZNPXXBBB-KDURUIRLSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001446467 Mama Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010054880 Vascular insufficiency Diseases 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- 239000012971 dimethylpiperazine Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- QYRFJLLXPINATB-UHFFFAOYSA-N hydron;2,4,5,6-tetrafluorobenzene-1,3-diamine;dichloride Chemical compound Cl.Cl.NC1=C(F)C(N)=C(F)C(F)=C1F QYRFJLLXPINATB-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000009495 sugar coating Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 208000023577 vascular insufficiency disease Diseases 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/08—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1670011 | 1967-12-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL31079A0 IL31079A0 (en) | 1969-01-29 |
| IL31079A true IL31079A (en) | 1972-01-27 |
Family
ID=5686274
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL31079A IL31079A (en) | 1967-12-06 | 1968-11-17 | N,n'-disubstituted diazacycloalkanes alkylated at carbon atoms of the heterocyclus and pharmacologically acceptable acid addition salts thereof |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT284130B (de) |
| BR (1) | BR6804642D0 (de) |
| CH (1) | CH509327A (de) |
| CS (1) | CS159237B2 (de) |
| DK (1) | DK122609B (de) |
| FI (1) | FI49717C (de) |
| FR (1) | FR8139M (de) |
| GB (1) | GB1184408A (de) |
| IL (1) | IL31079A (de) |
| RO (1) | RO55756A (de) |
| SE (1) | SE345854B (de) |
| YU (1) | YU32624B (de) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS632986A (ja) * | 1986-06-23 | 1988-01-07 | Kanebo Ltd | 新規なピペラジン誘導体および該化合物を有効成分とする抗潰瘍薬 |
-
1968
- 1968-11-14 AT AT1108168A patent/AT284130B/de not_active IP Right Cessation
- 1968-11-17 IL IL31079A patent/IL31079A/en unknown
- 1968-11-19 CH CH1725968A patent/CH509327A/de not_active IP Right Cessation
- 1968-11-21 GB GB55228/68A patent/GB1184408A/en not_active Expired
- 1968-12-03 CS CS824668A patent/CS159237B2/cs unknown
- 1968-12-03 YU YU2841/68A patent/YU32624B/xx unknown
- 1968-12-05 FI FI683498A patent/FI49717C/fi active
- 1968-12-05 DK DK594168AA patent/DK122609B/da not_active IP Right Cessation
- 1968-12-05 SE SE16636/68A patent/SE345854B/xx unknown
- 1968-12-05 BR BR204642/68A patent/BR6804642D0/pt unknown
- 1968-12-06 RO RO58416A patent/RO55756A/ro unknown
-
1969
- 1969-02-25 FR FR176771A patent/FR8139M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BR6804642D0 (pt) | 1973-08-16 |
| DK122609B (da) | 1972-03-20 |
| IL31079A0 (en) | 1969-01-29 |
| CH509327A (de) | 1971-06-30 |
| FR8139M (de) | 1970-08-10 |
| FI49717C (fi) | 1975-09-10 |
| CS159237B2 (de) | 1974-12-27 |
| YU32624B (en) | 1975-04-30 |
| YU284168A (en) | 1974-10-31 |
| AT284130B (de) | 1970-09-10 |
| FI49717B (de) | 1975-06-02 |
| RO55756A (de) | 1974-02-01 |
| GB1184408A (en) | 1970-03-18 |
| SE345854B (de) | 1972-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH075539B2 (ja) | 置換スルホンアミドベンズアミド及びその製法 | |
| US4690924A (en) | 1,7-Naphthyridine derivatives and medicinal preparations containing same | |
| EP0025111A1 (de) | 3-Aminopropoxyaryl-Derivate, ihre Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| US3974156A (en) | 2-(Substituted anilino) methylmorpholine compounds | |
| US4207327A (en) | N-(4-Pyrazolidinyl)benzamides and their amino precursors | |
| EP0541617A1 (de) | 1,4-disubstituierte piperazine. | |
| DK158658B (da) | Analogifremgangsmaade til fremstilling af 9-aminoalkylfluorener eller farmaceutisk acceptable salte deraf | |
| US4977153A (en) | 3-aminopropyloxyphenyl derivatives, pharmaceutical compositions containing them and method for the therapy of diseases | |
| US4547507A (en) | Benzothiopyranopyridinones | |
| US4109088A (en) | 2-(indenyloxymethyl) morpholine derivatives | |
| US3989722A (en) | 1-Aminomethyl-2,2-diaryl-cyclopropane carboxamides | |
| IL31079A (en) | N,n'-disubstituted diazacycloalkanes alkylated at carbon atoms of the heterocyclus and pharmacologically acceptable acid addition salts thereof | |
| US3629444A (en) | Antidepressant compositions and method of treating | |
| US4016280A (en) | 4,4-Diarylpiperidine compositions and use | |
| US4021558A (en) | 1,3-Dioxo-2-[(methoxyphenethyl-amino)-alkyl]-4,4-dimethyl-isoquinolines and salts thereof useful as hypotensive agents | |
| US3936459A (en) | 1',4'-Dihydro-1-methyl-spiro [piperidine and pyrrolidine-2,3'(2'H)quinoline]-2'-one compounds | |
| NO124309B (de) | ||
| IE50100B1 (en) | 3-amino-1-benzoxepine derivatives and their salts;processes for their preparation and pharmaceutical composition containing these compounds | |
| HU183479B (en) | Process for producing new 6,7-diethoxy-1-aracket-4-ethoxy-3-hydroxy-benzyl-bracket closed-3,4-dihydroisoquinolin | |
| US2681911A (en) | 1, 2, 3, 4-tetrahydroisoquinolinalkanol esters of aromatically substituted aliphaticacids and their derivatives | |
| US3576819A (en) | Esters of alpha-(1-substituted-3-pyrrolidinyl)-alpha-phenyl acetic acid | |
| US3028384A (en) | Dihydroquinoxalone-(2) derivatives and process of preparing same | |
| US3975539A (en) | Pharmaceutical compositions containing an N,N-bis-(3-phenoxy-2-hydroxy-propyl)-alkylenediamine and method of use | |
| US3360562A (en) | 2-tertiaryaminomethyl-n-acylanilines | |
| US4022786A (en) | 4,4-Diarylpiperidines and process of making the same |