IL30111A - Water-bearing explosion compositions - Google Patents
Water-bearing explosion compositionsInfo
- Publication number
- IL30111A IL30111A IL30111A IL3011168A IL30111A IL 30111 A IL30111 A IL 30111A IL 30111 A IL30111 A IL 30111A IL 3011168 A IL3011168 A IL 3011168A IL 30111 A IL30111 A IL 30111A
- Authority
- IL
- Israel
- Prior art keywords
- composition according
- composition
- sensitizer
- water
- weight
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 90
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 28
- 238000004880 explosion Methods 0.000 title description 2
- 239000002360 explosive Substances 0.000 claims description 51
- 150000003839 salts Chemical class 0.000 claims description 38
- -1 fatty alcohol sulphate Chemical class 0.000 claims description 33
- 239000000446 fuel Substances 0.000 claims description 24
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 22
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 21
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 230000001590 oxidative effect Effects 0.000 claims description 17
- 239000002585 base Substances 0.000 claims description 16
- 229910002651 NO3 Inorganic materials 0.000 claims description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 15
- 239000001301 oxygen Substances 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 11
- 239000007787 solid Substances 0.000 claims description 11
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 10
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 claims description 5
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical group [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 5
- 150000001448 anilines Chemical class 0.000 claims description 5
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 239000008346 aqueous phase Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine group Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 239000000843 powder Substances 0.000 claims description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 4
- 239000002562 thickening agent Substances 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- 239000004615 ingredient Substances 0.000 claims description 2
- 229910021653 sulphate ion Inorganic materials 0.000 claims 9
- 238000000034 method Methods 0.000 claims 4
- 125000002015 acyclic group Chemical group 0.000 claims 3
- 230000004048 modification Effects 0.000 claims 2
- 238000012986 modification Methods 0.000 claims 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims 1
- 239000004141 Sodium laurylsulphate Substances 0.000 claims 1
- 229910017604 nitric acid Inorganic materials 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 claims 1
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 20
- 235000010344 sodium nitrate Nutrition 0.000 description 10
- 239000004317 sodium nitrate Substances 0.000 description 10
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 8
- 239000004411 aluminium Substances 0.000 description 7
- 229910052782 aluminium Inorganic materials 0.000 description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 7
- 238000005474 detonation Methods 0.000 description 7
- HODPISPVTPCXIU-UHFFFAOYSA-N ethane-1,2-diamine;nitric acid Chemical compound NCCN.O[N+]([O-])=O HODPISPVTPCXIU-UHFFFAOYSA-N 0.000 description 7
- 230000035945 sensitivity Effects 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 239000011593 sulfur Substances 0.000 description 6
- 229920002907 Guar gum Polymers 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000003245 coal Substances 0.000 description 5
- 239000000665 guar gum Substances 0.000 description 5
- 229960002154 guar gum Drugs 0.000 description 5
- 235000010417 guar gum Nutrition 0.000 description 5
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 230000001235 sensitizing effect Effects 0.000 description 4
- 230000008719 thickening Effects 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 241000609240 Ambelania acida Species 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 2
- 229910000519 Ferrosilicon Inorganic materials 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 229920000926 Galactomannan Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- ZUBJEHHGZYTRPH-KTKRTIGZSA-N [(z)-octadec-9-enyl] hydrogen sulfate Chemical compound CCCCCCCC\C=C/CCCCCCCCOS(O)(=O)=O ZUBJEHHGZYTRPH-KTKRTIGZSA-N 0.000 description 2
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 2
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 description 2
- 239000010905 bagasse Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 2
- 229940043264 dodecyl sulfate Drugs 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- PTIUDKQYXMFYAI-UHFFFAOYSA-N methylammonium nitrate Chemical compound NC.O[N+]([O-])=O PTIUDKQYXMFYAI-UHFFFAOYSA-N 0.000 description 2
- 238000005065 mining Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- VMPIHZLTNJDKEN-UHFFFAOYSA-O triethanolammonium nitrate Chemical compound [O-][N+]([O-])=O.OCC[NH+](CCO)CCO VMPIHZLTNJDKEN-UHFFFAOYSA-O 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- UKVBWDYMOLOAKV-UHFFFAOYSA-N 2-(2-hydroxyethylamino)ethanol;nitric acid Chemical compound O[N+]([O-])=O.OCCNCCO UKVBWDYMOLOAKV-UHFFFAOYSA-N 0.000 description 1
- HZTVIZREFBBQMG-UHFFFAOYSA-N 2-methyl-1,3,5-trinitrobenzene;[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O HZTVIZREFBBQMG-UHFFFAOYSA-N 0.000 description 1
- WFMYUEXTOBKQOY-UHFFFAOYSA-N 4-chloroaniline;nitric acid Chemical compound O[N+]([O-])=O.NC1=CC=C(Cl)C=C1 WFMYUEXTOBKQOY-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910000861 Mg alloy Inorganic materials 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- GANNOFFDYMSBSZ-UHFFFAOYSA-N [AlH3].[Mg] Chemical compound [AlH3].[Mg] GANNOFFDYMSBSZ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- RAESLDWEUUSRLO-UHFFFAOYSA-O aminoazanium;nitrate Chemical compound [NH3+]N.[O-][N+]([O-])=O RAESLDWEUUSRLO-UHFFFAOYSA-O 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- BTBJBAZGXNKLQC-UHFFFAOYSA-N ammonium lauryl sulfate Chemical compound [NH4+].CCCCCCCCCCCCOS([O-])(=O)=O BTBJBAZGXNKLQC-UHFFFAOYSA-N 0.000 description 1
- 229940063953 ammonium lauryl sulfate Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- OADXQALOSREDRB-UHFFFAOYSA-N azanium;hexadecyl sulfate Chemical compound N.CCCCCCCCCCCCCCCCOS(O)(=O)=O OADXQALOSREDRB-UHFFFAOYSA-N 0.000 description 1
- KJMUTWRTZIMOJC-UHFFFAOYSA-N benzene-1,2-diamine nitric acid Chemical compound [N+](=O)(O)[O-].[N+](=O)(O)[O-].C1(=C(C=CC=C1)N)N KJMUTWRTZIMOJC-UHFFFAOYSA-N 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- HSYRGCIIEXIYFS-UHFFFAOYSA-N cyclohexanamine;nitric acid Chemical compound O[N+]([O-])=O.NC1CCCCC1 HSYRGCIIEXIYFS-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- CSMFSDCPJHNZRY-UHFFFAOYSA-M decyl sulfate Chemical class CCCCCCCCCCOS([O-])(=O)=O CSMFSDCPJHNZRY-UHFFFAOYSA-M 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FONBHTQCMAUYEF-UHFFFAOYSA-N ethane-1,2-diamine;nitric acid Chemical compound NCCN.O[N+]([O-])=O.O[N+]([O-])=O FONBHTQCMAUYEF-UHFFFAOYSA-N 0.000 description 1
- AHRQMWOXLCFNAV-UHFFFAOYSA-O ethylammonium nitrate Chemical compound CC[NH3+].[O-][N+]([O-])=O AHRQMWOXLCFNAV-UHFFFAOYSA-O 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 description 1
- HXXHWKZFQGPFJX-UHFFFAOYSA-N hydrazine;nitric acid Chemical compound NN.O[N+]([O-])=O.O[N+]([O-])=O HXXHWKZFQGPFJX-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- UTGIWXUFDNQZEG-UHFFFAOYSA-N methanamine;perchloric acid Chemical compound NC.OCl(=O)(=O)=O UTGIWXUFDNQZEG-UHFFFAOYSA-N 0.000 description 1
- 150000003956 methylamines Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- DXYSWDKLPZXRTC-UHFFFAOYSA-N n-ethylethanamine;nitric acid Chemical compound O[N+]([O-])=O.O[N+]([O-])=O.CCNCC DXYSWDKLPZXRTC-UHFFFAOYSA-N 0.000 description 1
- UZZYXUGECOQHPU-UHFFFAOYSA-M n-octyl sulfate Chemical class CCCCCCCCOS([O-])(=O)=O UZZYXUGECOQHPU-UHFFFAOYSA-M 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 229940067739 octyl sulfate Drugs 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- IIQJBVZYLIIMND-UHFFFAOYSA-J potassium;antimony(3+);2,3-dihydroxybutanedioate Chemical compound [K+].[Sb+3].[O-]C(=O)C(O)C(O)C([O-])=O.[O-]C(=O)C(O)C(O)C([O-])=O IIQJBVZYLIIMND-UHFFFAOYSA-J 0.000 description 1
- GBEYVKHMIPVAHD-UHFFFAOYSA-M potassium;hexadecyl sulfate Chemical compound [K+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GBEYVKHMIPVAHD-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- FTWCSAMTIKSPAT-UHFFFAOYSA-M sodium;nonyl sulfate Chemical compound [Na+].CCCCCCCCCOS([O-])(=O)=O FTWCSAMTIKSPAT-UHFFFAOYSA-M 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- CSMFSDCPJHNZRY-UHFFFAOYSA-N sulfuric acid monodecyl ester Chemical class CCCCCCCCCCOS(O)(=O)=O CSMFSDCPJHNZRY-UHFFFAOYSA-N 0.000 description 1
- UZZYXUGECOQHPU-UHFFFAOYSA-N sulfuric acid monooctyl ester Natural products CCCCCCCCOS(O)(=O)=O UZZYXUGECOQHPU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Liquid Carbonaceous Fuels (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64306467A | 1967-06-02 | 1967-06-02 | |
| US70037168A | 1968-01-25 | 1968-01-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL30111A0 IL30111A0 (en) | 1970-03-22 |
| IL30111A true IL30111A (en) | 1971-10-20 |
Family
ID=27094179
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL30111A IL30111A (en) | 1967-06-02 | 1968-05-31 | Water-bearing explosion compositions |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT291073B (enExample) |
| BE (1) | BE716028A (enExample) |
| CH (1) | CH543463A (enExample) |
| DE (1) | DE1771480B1 (enExample) |
| ES (1) | ES354558A1 (enExample) |
| FR (1) | FR1583223A (enExample) |
| GB (1) | GB1216229A (enExample) |
| IE (1) | IE32090B1 (enExample) |
| IL (1) | IL30111A (enExample) |
| MY (1) | MY7100184A (enExample) |
| NO (1) | NO123076B (enExample) |
| SE (2) | SE369186B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4055449A (en) * | 1976-08-11 | 1977-10-25 | Ireco Chemicals | Aqueous blasting composition with crystal habit modifier |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
| GB2080279B (en) * | 1980-07-21 | 1984-02-15 | Ici Ltd | Emulsion type blasting agent containing hydrazine mononitrate |
| ZW23483A1 (en) * | 1982-11-04 | 1985-07-12 | Aeci Ltd | An emulsion explosive having a solid fuel component of ferrosilicon |
| ES2081744B1 (es) * | 1993-04-20 | 1997-01-16 | Espanola Explosivos | Composicion explosiva encartuchable en papel y su procedimiento de fabricacion. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA477865A (en) * | 1951-10-16 | Imperial Chemical Industries Limited | Compositions suitable for use as gas and power producing liquids | |
| FR742312A (enExample) * | 1931-09-29 | 1933-03-04 | ||
| DE1119740B (de) * | 1959-07-17 | 1961-12-14 | Paul Rene De Wilde | Plastischer Sprengstoff |
-
1968
- 1968-05-28 CH CH787168A patent/CH543463A/de not_active IP Right Cessation
- 1968-05-30 IE IE644/68A patent/IE32090B1/xx unknown
- 1968-05-30 DE DE19681771480 patent/DE1771480B1/de active Pending
- 1968-05-30 AT AT519268A patent/AT291073B/de not_active IP Right Cessation
- 1968-05-31 NO NO2140/68A patent/NO123076B/no unknown
- 1968-05-31 IL IL30111A patent/IL30111A/en unknown
- 1968-05-31 ES ES354558A patent/ES354558A1/es not_active Expired
- 1968-05-31 GB GB26233/68A patent/GB1216229A/en not_active Expired
- 1968-05-31 SE SE07343/68A patent/SE369186B/xx unknown
- 1968-05-31 BE BE716028D patent/BE716028A/xx not_active IP Right Cessation
- 1968-05-31 FR FR1583223D patent/FR1583223A/fr not_active Expired
-
1971
- 1971-12-30 MY MY184/71A patent/MY7100184A/xx unknown
-
1973
- 1973-11-22 SE SE7315819A patent/SE400276B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH543463A (de) | 1973-10-31 |
| SE369186B (enExample) | 1974-08-12 |
| IL30111A0 (en) | 1970-03-22 |
| ES354558A1 (es) | 1970-02-16 |
| NO123076B (enExample) | 1971-09-20 |
| SE400276B (sv) | 1978-03-20 |
| FR1583223A (enExample) | 1969-10-24 |
| MY7100184A (en) | 1971-12-31 |
| IE32090B1 (en) | 1973-04-04 |
| DE1771480B1 (de) | 1971-11-11 |
| IE32090L (en) | 1968-12-02 |
| AT291073B (de) | 1971-06-25 |
| BE716028A (enExample) | 1968-10-16 |
| GB1216229A (en) | 1970-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4104092A (en) | Emulsion sensitized gelled explosive composition | |
| US3400026A (en) | Thickened aqueous inorganic oxidizer salt explosive composition containing dissolvedproteinaceous material | |
| AU597973B2 (en) | Explosive compound | |
| US3996078A (en) | Explosive composition and eutectic mixture therefor | |
| US3431155A (en) | Water-bearing explosive containing nitrogen-base salt and method of preparing same | |
| US3190777A (en) | Fluidizing agents for water-bearing explosive compositions | |
| US4600452A (en) | Eutectic microknit composite explosives and processes for making same | |
| US3356547A (en) | Water-in-oil explosive emulsion containing organic nitro compound and solid explosive adjuvant | |
| US4401490A (en) | Melt explosive composition | |
| US4552597A (en) | Soft composite explosives and process for making same | |
| US4456492A (en) | Melt explosive composition | |
| US4032375A (en) | Blasting composition containing calcium nitrate and sulfur | |
| US3629021A (en) | Slurry explosive composition containing nitrogen-base salt and tnt, smokeless powder or composition b | |
| US3471346A (en) | Fatty alcohol sulfate modified water-bearing explosives containing nitrogen-base salt | |
| US4547232A (en) | Sensitization of water-in-oil emulsion explosives | |
| IL30111A (en) | Water-bearing explosion compositions | |
| US3645809A (en) | Aqueous slurry explosives having improved oxidizer-fuel system and method of making | |
| US3406051A (en) | Aqueous explosive compositions containing a partially nitrated aromatic hydrocarbon dispersed by a monoamide | |
| US3734864A (en) | Aqueous gel for slurry explosives composition and method of preparing said gel | |
| US4364782A (en) | Permissible slurry explosive | |
| US4058420A (en) | Aqueous slurry explosives with colloidal hydrous metal oxide | |
| US3160535A (en) | Free flowing granular explosive composition of controlled particle size | |
| US5670741A (en) | Method of preparing a cast solid explosive product | |
| US3201291A (en) | Dispersion-type blasting explosives | |
| US6214140B1 (en) | Development of new high energy blasting products using demilitarized ammonium picrate |