IL29562A - Diphenyl Theo-detectors and pesticides containing them - Google Patents
Diphenyl Theo-detectors and pesticides containing themInfo
- Publication number
- IL29562A IL29562A IL29562A IL2956268A IL29562A IL 29562 A IL29562 A IL 29562A IL 29562 A IL29562 A IL 29562A IL 2956268 A IL2956268 A IL 2956268A IL 29562 A IL29562 A IL 29562A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- preparation
- formula
- active ingredient
- compounds
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 20
- 230000000361 pesticidal effect Effects 0.000 title claims description 5
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical class C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 10
- 241000233866 Fungi Species 0.000 claims description 8
- 241000894006 Bacteria Species 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 239000000080 wetting agent Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000002270 dispersing agent Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 230000003032 phytopathogenic effect Effects 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 2
- 239000000853 adhesive Substances 0.000 claims description 2
- 230000001070 adhesive effect Effects 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 230000008030 elimination Effects 0.000 claims description 2
- 238000003379 elimination reaction Methods 0.000 claims description 2
- 239000000575 pesticide Substances 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 5
- 239000013543 active substance Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- HQROXDLWVGFPDE-UHFFFAOYSA-N 1-chloro-4-nitro-2-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 HQROXDLWVGFPDE-UHFFFAOYSA-N 0.000 description 2
- 241000238876 Acari Species 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000213004 Alternaria solani Species 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- UYDLBVPAAFVANX-UHFFFAOYSA-N octylphenoxy polyethoxyethanol Chemical group CC(C)(C)CC(C)(C)C1=CC=C(OCCOCCOCCOCCO)C=C1 UYDLBVPAAFVANX-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical class [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 1
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- WRXOZRLZDJAYDR-UHFFFAOYSA-N 3-methylbenzenethiol Chemical compound CC1=CC=CC(S)=C1 WRXOZRLZDJAYDR-UHFFFAOYSA-N 0.000 description 1
- KWXICGTUELOLSQ-UHFFFAOYSA-N 4-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=C(S(O)(=O)=O)C=C1 KWXICGTUELOLSQ-UHFFFAOYSA-N 0.000 description 1
- ISAVYTVYFVQUDY-UHFFFAOYSA-N 4-tert-Octylphenol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C=C1 ISAVYTVYFVQUDY-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000007087 Apium graveolens Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- 239000005766 Dodine Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000005809 Metiram Substances 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241001597359 Septoria apiicola Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- BABJTMNVJXLAEX-UHFFFAOYSA-N Triamiphos Chemical compound N1=C(N)N(P(=O)(N(C)C)N(C)C)N=C1C1=CC=CC=C1 BABJTMNVJXLAEX-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000005870 Ziram Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000011717 all-trans-retinol Substances 0.000 description 1
- 235000019169 all-trans-retinol Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 244000000007 bacterial human pathogen Species 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- CRHLZRRTZDFDAJ-UHFFFAOYSA-N butoxymethanol Chemical compound CCCCOCO CRHLZRRTZDFDAJ-UHFFFAOYSA-N 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- PYZSVQVRHDXQSL-UHFFFAOYSA-N dithianon Chemical compound S1C(C#N)=C(C#N)SC2=C1C(=O)C1=CC=CC=C1C2=O PYZSVQVRHDXQSL-UHFFFAOYSA-N 0.000 description 1
- MPVXINJRXRIDDB-VCDGYCQFSA-N dodecanoic acid;(2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCCCCCC(O)=O MPVXINJRXRIDDB-VCDGYCQFSA-N 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- WHDGWKAJBYRJJL-UHFFFAOYSA-K ferbam Chemical compound [Fe+3].CN(C)C([S-])=S.CN(C)C([S-])=S.CN(C)C([S-])=S WHDGWKAJBYRJJL-UHFFFAOYSA-K 0.000 description 1
- -1 for example Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 244000000013 helminth Species 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 1
- 229920000940 maneb Polymers 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- VHWYCFISAQVCCP-UHFFFAOYSA-N methoxymethanol Chemical compound COCO VHWYCFISAQVCCP-UHFFFAOYSA-N 0.000 description 1
- 229920000257 metiram Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- KCGUGVQODCQMBI-UHFFFAOYSA-N pyrrolidine-1-carbothioylsulfanyl pyrrolidine-1-carbodithioate Chemical compound C1CCCN1C(=S)SSC(=S)N1CCCC1 KCGUGVQODCQMBI-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- FBWNMEQMRUMQSO-UHFFFAOYSA-N tergitol NP-9 Chemical compound CCCCCCCCCC1=CC=C(OCCOCCOCCOCCOCCOCCOCCOCCOCCO)C=C1 FBWNMEQMRUMQSO-UHFFFAOYSA-N 0.000 description 1
- SXLHGORGKTWZKV-UHFFFAOYSA-J tetrasodium 3-[(3,4-disulfonatonaphthalen-2-yl)methyl]naphthalene-1,2-disulfonate Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C2C=CC=CC2=C(S([O-])(=O)=O)C(S(=O)(=O)[O-])=C1CC1=CC2=CC=CC=C2C(S([O-])(=O)=O)=C1S([O-])(=O)=O SXLHGORGKTWZKV-UHFFFAOYSA-J 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH339267 | 1967-03-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL29562A true IL29562A (en) | 1971-02-25 |
Family
ID=4254979
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL29562A IL29562A (en) | 1967-03-08 | 1968-03-03 | Diphenyl Theo-detectors and pesticides containing them |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3542880A (enExample) |
| BE (1) | BE711830A (enExample) |
| CH (1) | CH485398A (enExample) |
| DE (1) | DE1643867A1 (enExample) |
| FR (1) | FR1557271A (enExample) |
| GB (1) | GB1204202A (enExample) |
| IL (1) | IL29562A (enExample) |
| NL (1) | NL6803265A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4024162A (en) * | 1974-08-23 | 1977-05-17 | General Electric Company | Aromatic dithio dianhydrides |
| US4087553A (en) * | 1976-11-19 | 1978-05-02 | Gaf Corporation | Fungicidal 2,6-dinitrodiphenylthioethers |
| US4297513A (en) * | 1979-05-16 | 1981-10-27 | Ciba-Geigy Corporation | Process for the preparation of benzophenone thioethers |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL288695A (enExample) * | 1962-02-08 |
-
1967
- 1967-03-08 CH CH1574567A patent/CH485398A/de not_active IP Right Cessation
-
1968
- 1968-02-29 DE DE19681643867 patent/DE1643867A1/de active Pending
- 1968-03-03 IL IL29562A patent/IL29562A/en unknown
- 1968-03-05 FR FR1557271D patent/FR1557271A/fr not_active Expired
- 1968-03-05 US US710645A patent/US3542880A/en not_active Expired - Lifetime
- 1968-03-07 NL NL6803265A patent/NL6803265A/xx unknown
- 1968-03-07 BE BE711830D patent/BE711830A/xx unknown
- 1968-03-08 GB GB01394/68A patent/GB1204202A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6803265A (enExample) | 1968-09-09 |
| BE711830A (enExample) | 1968-09-09 |
| CH485398A (de) | 1970-02-15 |
| FR1557271A (enExample) | 1969-02-14 |
| DE1643867A1 (de) | 1971-06-09 |
| GB1204202A (en) | 1970-09-03 |
| US3542880A (en) | 1970-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2681879A (en) | Carbamic acid esters as well as pest combatting agents and a method of making the same | |
| US2754302A (en) | 2-6-dimethyl-4-pyridinol-phosphoric acid esters | |
| US2812280A (en) | Preparation of bis (halophenyl) trichloroethanol | |
| US2704245A (en) | Pesticidal tetra-substituted ureas | |
| US3542880A (en) | Trifluoromethyl-nitro-diphenyl sulfides | |
| US2560350A (en) | 2, 2-bis-(para-allyloxyphenyl) propane miticidal compositions | |
| US3131215A (en) | 2-halo-and 2, 4-dihalo-alkylphenyl carbamates | |
| DE1793643B1 (de) | Ysopropyl-2,4-dinitro-6-sek.-butylphenylcarbonat | |
| US2402016A (en) | Sulphonium salts | |
| US3394145A (en) | Nu-(3, 4-dichlorophenyl) maleimide | |
| US3625992A (en) | N-methyl phenyl carbamates | |
| US3306726A (en) | Method for the control of weeds | |
| US4291058A (en) | Naphthalenecarboxylic acid esters | |
| US2538513A (en) | Composition for control of mite and insect pests | |
| US2488501A (en) | 1, 4-di(alkenylphenoxy)-2-butenes | |
| US2823224A (en) | Haloaryloxyalkyl esters of alpha, alpha-dichlorobutyric acid | |
| US3114673A (en) | Novel 2, 5-dimethyl-6-(dialkylaminoalkyl) phenyl methylcarbamates and compositions and method for controlling insects | |
| US3388167A (en) | Beta-bromo-ethyl aryl thio-ethers | |
| DE2619090A1 (de) | 1.2.6-thiadiazinone, ihre herstellung und ihre verwendung | |
| EP0363308B1 (de) | Neue Aether | |
| US3005026A (en) | N-substituted-2, 6-xylidines | |
| US3775458A (en) | Substituted phenylethyl sulfites | |
| EP0097854B1 (de) | Thiolphosphorsäureester, ihre Herstellung und Verwendung | |
| US4163020A (en) | 2-Trichloromethyl-4-nitrobenzenesulfenic acid derivatives | |
| US3862327A (en) | Substituted phenylethyl sulfites useful for controlling mites |