IL29505A - Process for the production of aminoguanidine bicarbonate - Google Patents
Process for the production of aminoguanidine bicarbonateInfo
- Publication number
- IL29505A IL29505A IL29505A IL2950568A IL29505A IL 29505 A IL29505 A IL 29505A IL 29505 A IL29505 A IL 29505A IL 2950568 A IL2950568 A IL 2950568A IL 29505 A IL29505 A IL 29505A
- Authority
- IL
- Israel
- Prior art keywords
- hydrazine
- aminoguanidine
- cyanamide
- reaction
- bicarbonate
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 32
- OTXHZHQQWQTQMW-UHFFFAOYSA-N (diaminomethylideneamino)azanium;hydrogen carbonate Chemical compound OC([O-])=O.N[NH2+]C(N)=N OTXHZHQQWQTQMW-UHFFFAOYSA-N 0.000 title claims description 23
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 70
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 claims description 40
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 33
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 32
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 23
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 claims description 18
- 229910052742 iron Inorganic materials 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 9
- 229960004887 ferric hydroxide Drugs 0.000 claims description 9
- IEECXTSVVFWGSE-UHFFFAOYSA-M iron(3+);oxygen(2-);hydroxide Chemical compound [OH-].[O-2].[Fe+3] IEECXTSVVFWGSE-UHFFFAOYSA-M 0.000 claims description 9
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims description 8
- DBLJAFVPFHRQSP-UHFFFAOYSA-N aminoazanium;sulfate Chemical compound NN.NN.OS(O)(=O)=O DBLJAFVPFHRQSP-UHFFFAOYSA-N 0.000 claims description 8
- 239000010802 sludge Substances 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- -1 alkali metal bicarbonate Chemical class 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 239000001569 carbon dioxide Substances 0.000 claims description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 4
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 3
- 239000001099 ammonium carbonate Substances 0.000 claims description 3
- 239000000908 ammonium hydroxide Substances 0.000 claims description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 2
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 claims description 2
- UFONUKZQWFSQLP-UHFFFAOYSA-N [N].NC#N Chemical compound [N].NC#N UFONUKZQWFSQLP-UHFFFAOYSA-N 0.000 claims description 2
- 235000012538 ammonium bicarbonate Nutrition 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 2
- 230000001376 precipitating effect Effects 0.000 claims description 2
- 230000001105 regulatory effect Effects 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 235000012501 ammonium carbonate Nutrition 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 21
- 239000000047 product Substances 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 11
- 238000001556 precipitation Methods 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 7
- 238000005406 washing Methods 0.000 description 7
- 238000001914 filtration Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 5
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 229910000377 hydrazine sulfate Inorganic materials 0.000 description 4
- 239000012493 hydrazine sulfate Substances 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229960005069 calcium Drugs 0.000 description 3
- 235000001465 calcium Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- JWEKFMCYIRVOQZ-UHFFFAOYSA-N cyanamide;sodium Chemical compound [Na].NC#N JWEKFMCYIRVOQZ-UHFFFAOYSA-N 0.000 description 3
- ZGCHATBSUIJLRL-UHFFFAOYSA-N hydrazine sulfate Chemical compound NN.OS(O)(=O)=O ZGCHATBSUIJLRL-UHFFFAOYSA-N 0.000 description 3
- WTLKTXIHIHFSGU-UHFFFAOYSA-N 2-nitrosoguanidine Chemical compound NC(N)=NN=O WTLKTXIHIHFSGU-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 235000014413 iron hydroxide Nutrition 0.000 description 2
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical compound [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- IDCPFAYURAQKDZ-UHFFFAOYSA-N 1-nitroguanidine Chemical compound NC(=N)N[N+]([O-])=O IDCPFAYURAQKDZ-UHFFFAOYSA-N 0.000 description 1
- BAKYASSDAXQKKY-UHFFFAOYSA-N 4-Hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(C=O)=CC=C1O BAKYASSDAXQKKY-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- MYFXBBAEXORJNB-UHFFFAOYSA-N calcium cyanamide Chemical compound [Ca+2].[N-]=C=[N-] MYFXBBAEXORJNB-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- DKIDFDYBDZCAAU-UHFFFAOYSA-L carbonic acid;iron(2+);carbonate Chemical compound [Fe+2].OC([O-])=O.OC([O-])=O DKIDFDYBDZCAAU-UHFFFAOYSA-L 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 150000001912 cyanamides Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000006698 hydrazinolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 238000010518 undesired secondary reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
- C07C281/16—Compounds containing any of the groups, e.g. aminoguanidine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Removal Of Specific Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0051627 | 1967-02-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL29505A true IL29505A (en) | 1971-05-26 |
Family
ID=7104768
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL29505A IL29505A (en) | 1967-02-24 | 1968-02-20 | Process for the production of aminoguanidine bicarbonate |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3673253A (enExample) |
| AT (1) | AT278034B (enExample) |
| BE (1) | BE711188A (enExample) |
| CH (1) | CH498098A (enExample) |
| CS (1) | CS158211B2 (enExample) |
| ES (1) | ES350898A1 (enExample) |
| FR (1) | FR1554501A (enExample) |
| GB (1) | GB1218209A (enExample) |
| IL (1) | IL29505A (enExample) |
| IT (1) | IT947016B (enExample) |
| NL (1) | NL6802339A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4906778A (en) * | 1988-08-29 | 1990-03-06 | Amoco Corporation | Process for the production of aminoguanidine bicarbonate |
| CN113214117A (zh) * | 2020-12-01 | 2021-08-06 | 胡东林 | 一种氨基胍重碳酸盐工业化制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD51029A (enExample) * | ||||
| GB885575A (en) * | 1959-07-10 | 1961-12-28 | France Etat | Improvements in or relating to amino-guanidine preparation |
| FR1443108A (fr) * | 1964-02-01 | 1966-06-24 | Ministerul Ind Petrolului | Procédé pour l'obtention de bicarbonate d'amino-guanidine |
-
1968
- 1968-01-19 CH CH84468A patent/CH498098A/de not_active IP Right Cessation
- 1968-02-15 AT AT145968A patent/AT278034B/de not_active IP Right Cessation
- 1968-02-16 CS CS121768A patent/CS158211B2/cs unknown
- 1968-02-19 NL NL6802339A patent/NL6802339A/xx unknown
- 1968-02-20 IL IL29505A patent/IL29505A/en unknown
- 1968-02-21 GB GB8385/68A patent/GB1218209A/en not_active Expired
- 1968-02-21 US US707320A patent/US3673253A/en not_active Expired - Lifetime
- 1968-02-22 IT IT35007/68A patent/IT947016B/it active
- 1968-02-23 BE BE711188D patent/BE711188A/xx unknown
- 1968-02-23 FR FR1554501D patent/FR1554501A/fr not_active Expired
- 1968-02-24 ES ES350898A patent/ES350898A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6802339A (enExample) | 1968-08-26 |
| AT278034B (de) | 1970-01-26 |
| CS158211B2 (enExample) | 1974-10-15 |
| FR1554501A (enExample) | 1969-01-17 |
| CH498098A (de) | 1970-10-31 |
| BE711188A (enExample) | 1968-08-23 |
| IT947016B (it) | 1973-05-21 |
| ES350898A1 (es) | 1969-05-16 |
| GB1218209A (en) | 1971-01-06 |
| US3673253A (en) | 1972-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4233063A (en) | Process for producing cobalt powder | |
| US4278567A (en) | Process for preparation of copper-iron-aluminum hydrogenation catalyst | |
| US4045340A (en) | Method for recovering and exploiting waste of the chromic anhydride production | |
| US3091626A (en) | Method of making ferrous citrate | |
| US2500792A (en) | Production of potassium | |
| IL29505A (en) | Process for the production of aminoguanidine bicarbonate | |
| JP3394981B2 (ja) | フリーヒドロキシルアミン水溶液の製造方法 | |
| EP0055707B1 (en) | Preparation of dihydroxyaluminium sodium carbonate | |
| US1998925A (en) | Process for the preparation of benzoic acid and benzoates | |
| US4906778A (en) | Process for the production of aminoguanidine bicarbonate | |
| US4154802A (en) | Upgrading of magnesium containing materials | |
| US2460975A (en) | Recovery of molybdenum compounds | |
| US2380779A (en) | Method of preparing sodium perborate of low bulk density | |
| US2252867A (en) | Process for production of alkali metal sulphide and hydrosulphide of high purity and concentration | |
| IL46740A (en) | Purification of phosphoric acid | |
| US3172830A (en) | Koh ore | |
| US1784950A (en) | Process of producing chromic acid | |
| US3116110A (en) | Production of beryllium hydroxide | |
| US3453078A (en) | Process of preparing high purity cadmium hydroxide | |
| US2487874A (en) | Recovery of pyridine carboxylic acid | |
| US3429658A (en) | Preparation of alkali metal dicyanamides | |
| US3116111A (en) | Production of beryllium hydroxide | |
| US3366690A (en) | Production of ninhydrin | |
| US2353781A (en) | Electrolytic preparation of alkali metal ferricyanides | |
| JP2639567B2 (ja) | 高純度硫酸クロムの製造方法 |