IL29254A - Thiobenzamide derivatives,their preparation,and herbicidal compositions containing them - Google Patents
Thiobenzamide derivatives,their preparation,and herbicidal compositions containing themInfo
- Publication number
- IL29254A IL29254A IL29254A IL2925468A IL29254A IL 29254 A IL29254 A IL 29254A IL 29254 A IL29254 A IL 29254A IL 2925468 A IL2925468 A IL 2925468A IL 29254 A IL29254 A IL 29254A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- group
- halogen
- compounds according
- hydrogen
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 15
- 230000002363 herbicidal effect Effects 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 3
- QIOZLISABUUKJY-UHFFFAOYSA-N Thiobenzamide Chemical class NC(=S)C1=CC=CC=C1 QIOZLISABUUKJY-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 44
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 239000013543 active substance Substances 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims 3
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 150000003840 hydrochlorides Chemical class 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- PRRMJTDPKZBCCQ-UHFFFAOYSA-N 2,3-dichlorobenzenecarbothioamide Chemical compound NC(=S)C1=CC=CC(Cl)=C1Cl PRRMJTDPKZBCCQ-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 241000743985 Alopecurus Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000008365 aromatic ketones Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- JARKCYVAAOWBJS-UHFFFAOYSA-N hexanal Chemical compound CCCCCC=O JARKCYVAAOWBJS-UHFFFAOYSA-N 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/32—Isothioureas having sulfur atoms of isothiourea groups bound to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6700027A NL6700027A (OSRAM) | 1967-01-03 | 1967-01-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL29254A true IL29254A (en) | 1971-11-29 |
Family
ID=19798889
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL29254A IL29254A (en) | 1967-01-03 | 1968-01-01 | Thiobenzamide derivatives,their preparation,and herbicidal compositions containing them |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3541145A (OSRAM) |
| BE (1) | BE708855A (OSRAM) |
| CH (1) | CH499960A (OSRAM) |
| DE (1) | DE1668507A1 (OSRAM) |
| ES (1) | ES348865A1 (OSRAM) |
| FR (1) | FR1550674A (OSRAM) |
| GB (1) | GB1208941A (OSRAM) |
| GR (1) | GR34443B (OSRAM) |
| IL (1) | IL29254A (OSRAM) |
| NL (1) | NL6700027A (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282169A (en) * | 1980-02-19 | 1981-08-04 | Olin Corporation | Selected 2-acyl- or 2-thioacyl-1-trichloroacetimidoylhydrazines and their use as fungicides |
| US4380468A (en) * | 1980-10-14 | 1983-04-19 | Stauffer Chemical Company | Isonitriles as herbicide extenders |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1090146A (en) * | 1965-06-17 | 1967-11-08 | Shell Int Research | Dichlorothiobenzoylhydrazines and their use as herbicides |
-
1967
- 1967-01-03 NL NL6700027A patent/NL6700027A/xx unknown
- 1967-12-12 DE DE19671668507 patent/DE1668507A1/de active Pending
- 1967-12-29 GR GR670134443A patent/GR34443B/el unknown
- 1967-12-29 CH CH1831867A patent/CH499960A/de not_active IP Right Cessation
- 1967-12-30 ES ES348865A patent/ES348865A1/es not_active Expired
-
1968
- 1968-01-01 IL IL29254A patent/IL29254A/en unknown
- 1968-01-02 US US694975A patent/US3541145A/en not_active Expired - Lifetime
- 1968-01-02 GB GB243/68A patent/GB1208941A/en not_active Expired
- 1968-01-02 BE BE708855D patent/BE708855A/xx unknown
- 1968-01-03 FR FR1550674D patent/FR1550674A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1208941A (en) | 1970-10-14 |
| US3541145A (en) | 1970-11-17 |
| ES348865A1 (es) | 1969-03-16 |
| FR1550674A (OSRAM) | 1968-12-20 |
| GR34443B (el) | 1968-05-04 |
| BE708855A (OSRAM) | 1968-07-02 |
| NL6700027A (OSRAM) | 1968-07-04 |
| DE1668507A1 (de) | 1971-08-05 |
| CH499960A (de) | 1970-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4283348A (en) | Method of preparing 2-aryl-3-cyclopentanedione compounds | |
| US3502720A (en) | N-(2-methyl-4-chlorophenyl)-formamidines | |
| US3734925A (en) | N-amino-3,4-dimethyl-6-isobutyl-phthalimides | |
| IL29254A (en) | Thiobenzamide derivatives,their preparation,and herbicidal compositions containing them | |
| US4001325A (en) | α-Chloroacetanilide selective herbicides | |
| SU1145906A3 (ru) | Способ борьбы с насекомыми | |
| US2917534A (en) | 2-nitro-3,4,6-trichlorophenyl alkyl carbonates | |
| SU741773A3 (ru) | Акарицидный состав | |
| US2697721A (en) | Amine salts of trichloroacetic acid | |
| US3879543A (en) | Certain benzoyl chloride phenylhydrazones as insecticides and miticides | |
| US3347850A (en) | Certain 3-dithiophosphorylacetyl-3-aza bicyclo [3, 2, 2] nonane compounds | |
| US3798327A (en) | Fungicidal compositions and their use | |
| US2945865A (en) | Phthalides | |
| US3182068A (en) | Certain 3-aryl-1, 4, 2-oxathiazol-one-5-compounds | |
| US3769341A (en) | 2-(1-naphthyl carbamoyl-1,1,1-trialkylhydrazinium salts and herbicidal use thereof | |
| US4269829A (en) | Method and composition for treating helminths containing O,O-dialkyl-N-(substituted phenyl)aminothiocarbonyl phosphoramidates | |
| US3535386A (en) | Novel diethynylcarbinols | |
| US3702241A (en) | Pesticide compositions containing dicarbadodecahydroundecaborates | |
| US4112002A (en) | Mononitrotrifluoromethyl diphenylethers | |
| US3767623A (en) | 1-(naphthyl and naphthloxy)-acetyl-2,2-dialkyl hydrazine acids | |
| PT93675B (pt) | Processo para a preparacao de derivados de acidos aminodicarboxilicos insaturados, contendo fosforo | |
| US2883321A (en) | Fungicidal composition comprising the reaction product of a phenylhydrazine with carbon disulfide, and the method of preparation | |
| US3290303A (en) | Substituted dihydro-thiadiazines | |
| US3155488A (en) | Controlling undesirable plant growth | |
| US3374084A (en) | Method of combatting the growth of undesired plants |