IL25775A - Pesticidal preparations containing quinolyl carbamates - Google Patents
Pesticidal preparations containing quinolyl carbamatesInfo
- Publication number
- IL25775A IL25775A IL25775A IL2577566A IL25775A IL 25775 A IL25775 A IL 25775A IL 25775 A IL25775 A IL 25775A IL 2577566 A IL2577566 A IL 2577566A IL 25775 A IL25775 A IL 25775A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- active ingredient
- combating
- compounds
- salt
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 26
- -1 quinolyl carbamates Chemical class 0.000 title description 2
- 230000000361 pesticidal effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 45
- 239000004480 active ingredient Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 238000005266 casting Methods 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000004965 chloroalkyl group Chemical group 0.000 claims description 2
- 238000009736 wetting Methods 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 230000000694 effects Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000013543 active substance Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 230000000844 anti-bacterial effect Effects 0.000 description 6
- 230000001857 anti-mycotic effect Effects 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000002543 antimycotic Substances 0.000 description 3
- 239000000645 desinfectant Substances 0.000 description 3
- 230000000249 desinfective effect Effects 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 230000002147 killing effect Effects 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- 241001474033 Acar Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000238557 Decapoda Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000196379 Gryllinae Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000254023 Locusta Species 0.000 description 1
- 241001465800 Orgyia Species 0.000 description 1
- 241000238661 Periplaneta Species 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 206010040904 Skin odour abnormal Diseases 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241001459572 Trichophyton interdigitale Species 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000551 dentifrice Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000001408 fungistatic effect Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000006233 lamp black Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 230000001459 mortal effect Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/32—Esters
- C07D215/34—Carbamates
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06M—TREATMENT, NOT PROVIDED FOR ELSEWHERE IN CLASS D06, OF FIBRES, THREADS, YARNS, FABRICS, FEATHERS OR FIBROUS GOODS MADE FROM SUCH MATERIALS
- D06M16/00—Biochemical treatment of fibres, threads, yarns, fabrics, or fibrous goods made from such materials, e.g. enzymatic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Microbiology (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH683865A CH436834A (de) | 1965-05-17 | 1965-05-17 | Verfahren zum Schützen von Textilien gegen Mikroorganismen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25775A true IL25775A (en) | 1970-08-19 |
Family
ID=4315815
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25775A IL25775A (en) | 1965-05-17 | 1966-05-15 | Pesticidal preparations containing quinolyl carbamates |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3538099A (enExample) |
| AT (1) | AT271988B (enExample) |
| BE (1) | BE681075A (enExample) |
| BR (1) | BR6679538D0 (enExample) |
| CH (3) | CH683865A4 (enExample) |
| DE (1) | DE1542851A1 (enExample) |
| DK (1) | DK117393B (enExample) |
| ES (1) | ES326803A1 (enExample) |
| FR (1) | FR1484002A (enExample) |
| GB (1) | GB1152872A (enExample) |
| IL (1) | IL25775A (enExample) |
| NL (1) | NL6606695A (enExample) |
| OA (1) | OA02056A (enExample) |
| SE (1) | SE326336B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3837836A (en) * | 1969-04-30 | 1974-09-24 | American Cyanamid Co | Herbicidal composition and method of using 4-alkyl-amino-3-nitroquinolines |
| IL37642A0 (en) * | 1970-09-10 | 1971-11-29 | Ciba Geigy Ag | Di-and tetrahydroquinolyl carbamates,their manufacture and their use as pesticides |
| US3946016A (en) * | 1973-03-16 | 1976-03-23 | R. T. Vanderbilt Company, Inc. | Fungicidal 8-quinolyl carbanilates |
| DE2432635A1 (de) * | 1974-07-06 | 1976-01-22 | Hoechst Ag | Insektizide mittel |
| US4168311A (en) * | 1973-12-10 | 1979-09-18 | Hoechst Aktiengesellschaft | Hydroxyquinoline carbamates and n-oxide hydroxyquinoline carbamates and their use as insecticides |
| US4554012A (en) * | 1982-06-10 | 1985-11-19 | Toyo Soda Manufacturing Co., Ltd. | Aryl N-alkyl-N-(pyridyl or pyrimidyl) carbamate |
| US4472404A (en) * | 1982-08-16 | 1984-09-18 | The Dow Chemical Company | 8-Quinolinyl carbamates and their use as urinary tract antimicrobials |
| US4547509A (en) * | 1983-01-03 | 1985-10-15 | Usv Pharmaceutical Corp. | 5,6,7-Quinoline carbanilates and method of treating ischemic heart disease therewith |
| US4530931A (en) * | 1983-01-03 | 1985-07-23 | Usv Pharmaceutical Corp. | 8-Quinoline carbanilates for the inhibition of lipolysis |
| EP0387510A1 (de) * | 1989-02-10 | 1990-09-19 | Bayer Ag | Substituierte 8-Carbamoyloxychinolin-Derivate, Verfahren zu deren Herstellung, sowie deren Verwendung zur Bekämpfung von Schädlingen |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2603662A (en) * | 1947-07-03 | 1952-07-15 | Gulf Research Development Co | Process for producing substituted hydroxy aromatic compounds |
| US3125598A (en) * | 1958-12-06 | 1964-03-17 | Dialkylaminoaryl arylcarbamates | |
| GB1172864A (en) * | 1966-02-16 | 1969-12-03 | Beecham Group Ltd | Aluminium-Containing Chelates |
| GB1017975A (en) * | 1963-06-25 | 1966-01-26 | Boots Pure Drug Co Ltd | Carbamate compounds and herbicidal compositions containing them |
| CH438307A (de) * | 1964-06-04 | 1967-06-30 | Agripat Sa | Verfahren zur Herstellung neuer heterocyclischer Carbaminsäureester und ihre Verwendung zur Bekämpfung phytopathogener Pilze |
| US3384538A (en) * | 1965-06-01 | 1968-05-21 | Geigy Chem Corp | Combatting insects with omicron-[-2-lower alkyl-quinolyl-(8)]n-methyl carbamates |
-
1965
- 1965-05-17 CH CH683865D patent/CH683865A4/xx unknown
- 1965-05-17 CH CH683865A patent/CH436834A/de unknown
- 1965-05-17 CH CH1715266A patent/CH486841A/de not_active IP Right Cessation
-
1966
- 1966-05-11 OA OA52448A patent/OA02056A/xx unknown
- 1966-05-12 DE DE19661542851 patent/DE1542851A1/de active Pending
- 1966-05-15 IL IL25775A patent/IL25775A/en unknown
- 1966-05-16 FR FR61830A patent/FR1484002A/fr not_active Expired
- 1966-05-16 ES ES0326803A patent/ES326803A1/es not_active Expired
- 1966-05-16 AT AT460566A patent/AT271988B/de active
- 1966-05-16 BE BE681075D patent/BE681075A/xx unknown
- 1966-05-16 DK DK249866AA patent/DK117393B/da unknown
- 1966-05-16 NL NL6606695A patent/NL6606695A/xx unknown
- 1966-05-17 SE SE678666A patent/SE326336B/xx unknown
- 1966-05-17 GB GB21921/66A patent/GB1152872A/en not_active Expired
- 1966-05-17 BR BR179538/66A patent/BR6679538D0/pt unknown
-
1969
- 1969-01-31 US US798251*A patent/US3538099A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH683865A4 (de) | 1966-11-30 |
| US3538099A (en) | 1970-11-03 |
| NL6606695A (enExample) | 1966-11-18 |
| CH436834A (de) | 1966-11-30 |
| DE1542851A1 (de) | 1970-07-02 |
| FR1484002A (fr) | 1967-06-09 |
| SE326336B (enExample) | 1970-07-20 |
| BE681075A (enExample) | 1966-11-16 |
| GB1152872A (en) | 1969-05-21 |
| OA02056A (fr) | 1970-05-05 |
| AT271988B (de) | 1969-06-25 |
| ES326803A1 (es) | 1967-03-16 |
| DK117393B (da) | 1970-04-20 |
| CH486841A (de) | 1970-03-15 |
| BR6679538D0 (pt) | 1973-12-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2295504A (en) | Cetyl quaternary ammonium compound | |
| US3660484A (en) | Aryl ureas a process for their preparation and agents containing them | |
| DE1802739A1 (de) | Neue biozide Mittel | |
| DE1693156C3 (de) | N-iDichlorbenzyl^N·-^dichlorphenyl)-thioharnstoffe und diese enthaltende biocide Mittel | |
| CA1334977C (en) | Mono-iodopropargyl esters of dicarboxylic anhydrides and their use as antimicrobial agents | |
| IL25775A (en) | Pesticidal preparations containing quinolyl carbamates | |
| US3557184A (en) | Halogenoacetonitrile derivatives and pesticidal preparations containing said derivatives | |
| US3222158A (en) | Organotin compositions | |
| US3626060A (en) | Agricultural compositions and process for utilizing same | |
| US3412090A (en) | Organotin-substituted s-triazines | |
| JPH06183914A (ja) | 工業用殺菌組成物 | |
| US3577453A (en) | Trifluoromethyl phenyl-n-(halophenyl)-carbamates and pesticidal preparations containing same | |
| US3772386A (en) | N-(3-trifluoromethyl-4-chlorophenyl)-carbamates | |
| US3141818A (en) | Biological toxicant | |
| US3733332A (en) | Halogenated cyanoacetic acid piperidide | |
| KR960001204B1 (ko) | N-알킬벤젠 술포닐 카르바모일-5-클로로이소티아졸 유도체 및 살미생물제 | |
| US3470232A (en) | Diurethane compounds | |
| EP0799570A1 (en) | Preparation and uses of microbicidal formulations | |
| JP2923571B2 (ja) | 水難溶性フェノール系化合物の可溶化方法及び殺ダニ剤等 | |
| US3917630A (en) | Heterocyclic compounds | |
| US3764678A (en) | Organotin-substituted s-triazines for controlling insects, acarinal, fungi, bacteria, and mollusks | |
| US1770886A (en) | Morris s | |
| US2668136A (en) | Tetradecylamine salt of o-phenylphenol | |
| US2787573A (en) | Pesticidal compositions and their use | |
| US3829485A (en) | Thiourea compounds and biocidal preparations containing them |