IL25622A - 2-phenoxy-2-phenylacetamides and methods for their production - Google Patents
2-phenoxy-2-phenylacetamides and methods for their productionInfo
- Publication number
- IL25622A IL25622A IL25622A IL2562266A IL25622A IL 25622 A IL25622 A IL 25622A IL 25622 A IL25622 A IL 25622A IL 2562266 A IL2562266 A IL 2562266A IL 25622 A IL25622 A IL 25622A
- Authority
- IL
- Israel
- Prior art keywords
- phenylacetamides
- phenoxy
- production
- methods
- Prior art date
Links
- QEBZGDYGMMSNRY-UHFFFAOYSA-N 2-phenoxy-2-phenylacetamide Chemical class C=1C=CC=CC=1C(C(=O)N)OC1=CC=CC=C1 QEBZGDYGMMSNRY-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US45051065A | 1965-04-23 | 1965-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25622A true IL25622A (en) | 1970-05-21 |
Family
ID=23788375
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25622A IL25622A (en) | 1965-04-23 | 1966-04-22 | 2-phenoxy-2-phenylacetamides and methods for their production |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3446811A (enFirst) |
| AT (2) | AT265263B (enFirst) |
| BE (1) | BE679947A (enFirst) |
| BR (1) | BR6678908D0 (enFirst) |
| CH (1) | CH451907A (enFirst) |
| DE (1) | DE1620128C3 (enFirst) |
| DK (1) | DK122659B (enFirst) |
| ES (1) | ES325827A1 (enFirst) |
| FR (1) | FR5646M (enFirst) |
| GB (1) | GB1071239A (enFirst) |
| IL (1) | IL25622A (enFirst) |
| NL (1) | NL146149B (enFirst) |
| SE (1) | SE353529B (enFirst) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3998880A (en) * | 1975-08-15 | 1976-12-21 | Stauffer Chemical Company | Production of N,N-diethyl 2(α-naphthoxy)propionamide |
| US4192883A (en) * | 1976-04-09 | 1980-03-11 | Pierre Fabre, S.A. | Amides of pyrrolidinoethylamine which can be used in lung therapy |
| BE864269A (fr) * | 1977-03-03 | 1978-06-16 | Parke Davis & Co | Nouveaux n-(aminoalkyl substitue)-2-oxo-1-pyrrolidine-acetamides et procedes pour les produire |
| US5066680A (en) * | 1989-02-14 | 1991-11-19 | Fujisawa Pharmaceutical Co., Ltd. | Novel substituted-acetamide compound and a process for the preparation thereof |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2428978A (en) * | 1943-07-30 | 1947-10-14 | Geigy Ag J R | Basic derivatives of alpha-substituted aryloxy acetic acids and a process for their manufacture |
| US2715645A (en) * | 1952-07-16 | 1955-08-16 | Searle & Co | N-aryl and n-aralkyl derivatives of n-dialkylaminoalkyl-aryloxyalkanoamides and methods for their production |
| US2932645A (en) * | 1957-12-12 | 1960-04-12 | Mead Johnson & Co | Nu-(dialkylaminomethyl) benzilic amides |
| US2965638A (en) * | 1958-03-20 | 1960-12-20 | Geigy Chem Corp | Nu-substituted azepines and dihydroazepines |
| ES251290A1 (es) * | 1958-08-21 | 1960-04-01 | Parke Davis & Co | Un procedimiento para la producciën de alcohilaminas arilsustituidas |
| US3051706A (en) * | 1959-06-11 | 1962-08-28 | Eprova Ltd | New phenyloxy and phenylalkoxy benzoic acid amides |
| NL252004A (enFirst) * | 1959-07-28 | |||
| US3239520A (en) * | 1961-11-20 | 1966-03-08 | Nl Combinatie Chem Ind | N-(monocarbocyclic aryloxy-lower alkyl)-n' (diloweralkyl, or heterocyclic)-lower alkylene diamines |
-
1965
- 1965-04-23 US US450510A patent/US3446811A/en not_active Expired - Lifetime
-
1966
- 1966-04-21 DE DE1620128A patent/DE1620128C3/de not_active Expired
- 1966-04-22 DK DK207266AA patent/DK122659B/da unknown
- 1966-04-22 BE BE679947D patent/BE679947A/xx unknown
- 1966-04-22 AT AT902567A patent/AT265263B/de active
- 1966-04-22 AT AT379366A patent/AT265257B/de active
- 1966-04-22 IL IL25622A patent/IL25622A/xx unknown
- 1966-04-22 BR BR178908/66A patent/BR6678908D0/pt unknown
- 1966-04-22 ES ES0325827A patent/ES325827A1/es not_active Expired
- 1966-04-22 CH CH585666A patent/CH451907A/fr unknown
- 1966-04-22 SE SE05486/66A patent/SE353529B/xx unknown
- 1966-04-22 GB GB17774/66A patent/GB1071239A/en not_active Expired
- 1966-04-22 NL NL666605452A patent/NL146149B/xx unknown
- 1966-07-22 FR FR70445A patent/FR5646M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH451907A (fr) | 1968-05-15 |
| DE1620128C3 (de) | 1973-10-04 |
| AT265257B (de) | 1968-10-10 |
| ES325827A1 (es) | 1967-02-16 |
| NL6605452A (enFirst) | 1966-10-24 |
| BE679947A (enFirst) | 1966-10-03 |
| BR6678908D0 (pt) | 1973-09-06 |
| DK122659B (da) | 1972-03-27 |
| FR5646M (enFirst) | 1967-12-26 |
| SE353529B (enFirst) | 1973-02-05 |
| NL146149B (nl) | 1975-06-16 |
| US3446811A (en) | 1969-05-27 |
| DE1620128A1 (de) | 1970-03-12 |
| GB1071239A (en) | 1967-06-07 |
| DE1620128B2 (de) | 1973-03-08 |
| AT265263B (de) | 1968-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL25427A (en) | 2-nitro-imidazole derivatives and process for the manufacture thereof | |
| IL26539A (en) | Poly-n-oxides and their production | |
| IL25622A (en) | 2-phenoxy-2-phenylacetamides and methods for their production | |
| MY7000097A (en) | Carboxylic acid-n-methyl-piperazides and process for their manufacture | |
| IL26178A (en) | 3-amino-benzisothiazoles and their production | |
| IL26626A (en) | Sulfathiadiazoles and their production | |
| IL26194A (en) | Benzenesulfonyl-ureas and process for their manufacture | |
| CY566A (en) | Benzenesulphonyl-ureas and process for their manufacture | |
| IL25641A (en) | 1-aralkyl-3-aryl-3-propyl-pyrrolidines and methods for their production | |
| IL25794A (en) | Phenyl-propylamines and process for their manufacture | |
| MY7000096A (en) | Benzenesulphonyl-ureas and process for preparing them | |
| IL26161A (en) | Bisanilide compounds and methods for their production | |
| CA704890A (en) | Substituted polyhalocyclopentadienes and processes for their production | |
| CA718447A (en) | Beta-cyanoethylsilanes and process for their production | |
| AU400251B2 (en) | Steroid-guanyl-hydrazones and their production | |
| IL27215A (en) | 2-triluoromethyl-benzimidazoles and process for their production | |
| CA709407A (en) | Ketones and methods for their production | |
| AU415515B2 (en) | 1-hydroxymenthyl-3-oxo-2-oxa-steroids and process for their manufacture | |
| CA714554A (en) | Benz-cycloalkan-1-ones and process for their manufacture | |
| AU422266B2 (en) | Aminoalkyl-dihydroethanoanthracenes and process for their manufacture | |
| AU422079B2 (en) | Aminoalkyl-dihydro-ethano-anthracenes and process for their manufacture | |
| CA708207A (en) | Nitrobenzotrichlorides and process for their manufacture | |
| CA711715A (en) | Benzene-sulfonyl-semicarbazides and process for their manufacture | |
| CA714056A (en) | Benzenesulfonyl-semicarbazides and process for their manufacture | |
| AU407335B2 (en) | Benzenesulfonyl-ureas and process for their manufacture |