IL25505A - Aminothiophene derivatives and process for their manufacture - Google Patents
Aminothiophene derivatives and process for their manufactureInfo
- Publication number
- IL25505A IL25505A IL25505A IL2550566A IL25505A IL 25505 A IL25505 A IL 25505A IL 25505 A IL25505 A IL 25505A IL 2550566 A IL2550566 A IL 2550566A IL 25505 A IL25505 A IL 25505A
- Authority
- IL
- Israel
- Prior art keywords
- thiophene
- anilino
- carboxylic acid
- melting point
- cyano
- Prior art date
Links
- GLQWRXYOTXRDNH-UHFFFAOYSA-N thiophen-2-amine Chemical class NC1=CC=CS1 GLQWRXYOTXRDNH-UHFFFAOYSA-N 0.000 title claims description 4
- 238000000034 method Methods 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 19
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- NSMKVXCDRZWLRG-UHFFFAOYSA-N 4-(2,6-dimethylanilino)thiophene-3-carboxylic acid Chemical compound CC1=CC=CC(C)=C1NC1=CSC=C1C(O)=O NSMKVXCDRZWLRG-UHFFFAOYSA-N 0.000 claims 1
- QDLLQLPCGZKMQW-UHFFFAOYSA-N CC1=C(NC2=CSC=C2C(=O)O)C=CC=C1C Chemical compound CC1=C(NC2=CSC=C2C(=O)O)C=CC=C1C QDLLQLPCGZKMQW-UHFFFAOYSA-N 0.000 claims 1
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 238000002844 melting Methods 0.000 description 73
- 230000008018 melting Effects 0.000 description 73
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- -1 alkyl radical Chemical class 0.000 description 15
- 150000003254 radicals Chemical class 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000004093 cyano group Chemical group *C#N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- CWEUKXMDWMAICX-UHFFFAOYSA-N 4-(2,6-dichloroanilino)thiophene-3-carboxylic acid Chemical compound OC(=O)C1=CSC=C1NC1=C(Cl)C=CC=C1Cl CWEUKXMDWMAICX-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 230000001741 anti-phlogistic effect Effects 0.000 description 3
- 230000001754 anti-pyretic effect Effects 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229960002895 phenylbutazone Drugs 0.000 description 3
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- BYOASTMEXDDSMQ-UHFFFAOYSA-N 2,5-dihydrothiophene-3-carbonitrile Chemical class N#CC1=CCSC1 BYOASTMEXDDSMQ-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 2
- PSHCYDHEWNLNKF-UHFFFAOYSA-N 4-(2-chloroanilino)thiophene-3-carboxylic acid Chemical compound OC(=O)C1=CSC=C1NC1=CC=CC=C1Cl PSHCYDHEWNLNKF-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 206010015150 Erythema Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- STOSPPMGXZPHKP-UHFFFAOYSA-N tetrachlorohydroquinone Chemical compound OC1=C(Cl)C(Cl)=C(O)C(Cl)=C1Cl STOSPPMGXZPHKP-UHFFFAOYSA-N 0.000 description 2
- 150000003577 thiophenes Chemical class 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- FHDYRFNCTJFNQX-UHFFFAOYSA-N 1-(2-chloroethyl)-4-methylpiperazine Chemical compound CN1CCN(CCCl)CC1 FHDYRFNCTJFNQX-UHFFFAOYSA-N 0.000 description 1
- WNRWEBKEQARBKV-UHFFFAOYSA-N 1-(2-chloroethyl)piperidine Chemical compound ClCCN1CCCCC1 WNRWEBKEQARBKV-UHFFFAOYSA-N 0.000 description 1
- MDLKWDQMIZRIBY-UHFFFAOYSA-N 1-(dimethylamino)ethanol Chemical compound CC(O)N(C)C MDLKWDQMIZRIBY-UHFFFAOYSA-N 0.000 description 1
- FHMPFSKGDPKPDJ-UHFFFAOYSA-N 2,3,6-trimethylaniline Chemical compound CC1=CC=C(C)C(N)=C1C FHMPFSKGDPKPDJ-UHFFFAOYSA-N 0.000 description 1
- RXTJLDXSGNEJIT-UHFFFAOYSA-N 2,3-dihydro-1h-inden-4-amine Chemical compound NC1=CC=CC2=C1CCC2 RXTJLDXSGNEJIT-UHFFFAOYSA-N 0.000 description 1
- LEWZOBYWGWKNCK-UHFFFAOYSA-N 2,3-dihydro-1h-inden-5-amine Chemical compound NC1=CC=C2CCCC2=C1 LEWZOBYWGWKNCK-UHFFFAOYSA-N 0.000 description 1
- WPCVVFYUHADPCA-UHFFFAOYSA-N 2,5-dihydrothiophen-3-amine Chemical class NC=1CSCC1 WPCVVFYUHADPCA-UHFFFAOYSA-N 0.000 description 1
- AYVZXDFCFQSWJD-UHFFFAOYSA-N 2,6-dichloro-3-methylaniline Chemical compound CC1=CC=C(Cl)C(N)=C1Cl AYVZXDFCFQSWJD-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- VBLXCTYLWZJBKA-UHFFFAOYSA-N 2-(trifluoromethyl)aniline Chemical compound NC1=CC=CC=C1C(F)(F)F VBLXCTYLWZJBKA-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- XGZLERCWRSOYGY-UHFFFAOYSA-N 3-(2,4,6-trichloro-3-methylanilino)thiophene-2-carboxylic acid Chemical compound ClC1=C(NC2=C(SC=C2)C(=O)O)C(=C(C(=C1)Cl)C)Cl XGZLERCWRSOYGY-UHFFFAOYSA-N 0.000 description 1
- SSSLIOXNADPBIC-UHFFFAOYSA-N 3-(2,4,6-trichloroanilino)thiophene-2-carboxylic acid Chemical compound ClC1=C(NC2=C(SC=C2)C(=O)O)C(=CC(=C1)Cl)Cl SSSLIOXNADPBIC-UHFFFAOYSA-N 0.000 description 1
- ZHYPJWHNBWHVTJ-UHFFFAOYSA-N 3-(2,4,6-trimethylanilino)thiophene-2-carboxylic acid Chemical compound CC1=C(NC2=C(SC=C2)C(=O)O)C(=CC(=C1)C)C ZHYPJWHNBWHVTJ-UHFFFAOYSA-N 0.000 description 1
- SLWLIBFEBFJIMY-UHFFFAOYSA-N 3-(2,6-dichloroanilino)thiophene-2-carboxylic acid Chemical compound S1C=CC(NC=2C(=CC=CC=2Cl)Cl)=C1C(=O)O SLWLIBFEBFJIMY-UHFFFAOYSA-N 0.000 description 1
- FOSQFGVKHUAVNE-UHFFFAOYSA-N 3-(2,6-dimethylanilino)thiophene-2-carboxylic acid Chemical compound CC1=C(NC2=C(SC=C2)C(=O)O)C(=CC=C1)C FOSQFGVKHUAVNE-UHFFFAOYSA-N 0.000 description 1
- JQGVDMHNXRQCJT-UHFFFAOYSA-N 3-(2-chloro-5-methylanilino)thiophene-2-carboxylic acid Chemical compound CC1=CC=C(Cl)C(NC2=C(SC=C2)C(O)=O)=C1 JQGVDMHNXRQCJT-UHFFFAOYSA-N 0.000 description 1
- NNHXRUDOPLVTMS-UHFFFAOYSA-N 3-(2-chloroanilino)thiophene-2-carboxylic acid Chemical compound ClC1=C(NC2=C(SC=C2)C(=O)O)C=CC=C1 NNHXRUDOPLVTMS-UHFFFAOYSA-N 0.000 description 1
- FJRYBTGNQFYGIW-UHFFFAOYSA-N 3-(3,4-dimethylanilino)thiophene-2-carboxylic acid Chemical compound CC=1C=C(NC2=C(SC=C2)C(=O)O)C=CC1C FJRYBTGNQFYGIW-UHFFFAOYSA-N 0.000 description 1
- YUGHWVNGFOVRSV-UHFFFAOYSA-N 3-(4-ethoxyanilino)thiophene-2-carboxylic acid Chemical compound C(C)OC1=CC=C(NC2=C(SC=C2)C(=O)O)C=C1 YUGHWVNGFOVRSV-UHFFFAOYSA-N 0.000 description 1
- DPBDOUSDHLHDRA-UHFFFAOYSA-N 3-(4-propan-2-ylanilino)thiophene-2-carboxylic acid Chemical compound C(C)(C)C1=CC=C(NC2=C(SC=C2)C(=O)O)C=C1 DPBDOUSDHLHDRA-UHFFFAOYSA-N 0.000 description 1
- FRKPCXYPIHAOFI-UHFFFAOYSA-N 3-methylaniline Chemical compound [CH2]C1=CC=CC(N)=C1 FRKPCXYPIHAOFI-UHFFFAOYSA-N 0.000 description 1
- ULQFPGOVDGGDDX-UHFFFAOYSA-N 4-(2,3-dichloroanilino)-2,5-dihydrothiophene-3-carbonitrile Chemical compound ClC1=C(NC=2CSCC=2C#N)C=CC=C1Cl ULQFPGOVDGGDDX-UHFFFAOYSA-N 0.000 description 1
- WCYVGOMGUCKGFX-UHFFFAOYSA-N 4-(2,4-dichloro-5-methylanilino)thiophene-3-carbonitrile Chemical compound ClC1=C(NC2=CSC=C2C#N)C=C(C(=C1)Cl)C WCYVGOMGUCKGFX-UHFFFAOYSA-N 0.000 description 1
- MZZCNHHJVYCQRD-UHFFFAOYSA-N 4-(2-chloro-3-methylanilino)thiophene-3-carbonitrile Chemical compound ClC1=C(NC2=CSC=C2C#N)C=CC=C1C MZZCNHHJVYCQRD-UHFFFAOYSA-N 0.000 description 1
- MAGMHVGCLSZEIT-UHFFFAOYSA-N 4-(2-chloroanilino)thiophene-3-carbonitrile Chemical compound ClC1=C(NC2=CSC=C2C#N)C=CC=C1 MAGMHVGCLSZEIT-UHFFFAOYSA-N 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- SLMYAIGAJWJBKI-UHFFFAOYSA-N 4-cyclohexyl-2-methylaniline Chemical compound C1=C(N)C(C)=CC(C2CCCCC2)=C1 SLMYAIGAJWJBKI-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- SODWJACROGQSMM-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalen-1-amine Chemical compound C1CCCC2=C1C=CC=C2N SODWJACROGQSMM-UHFFFAOYSA-N 0.000 description 1
- MOXOFSFWYLTCFU-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalen-2-amine Chemical compound C1CCCC2=CC(N)=CC=C21 MOXOFSFWYLTCFU-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- DJQVGQNLOQVRGF-UHFFFAOYSA-N C(C)(C)C1=CC=C(NC2=CSC=C2C#N)C=C1 Chemical compound C(C)(C)C1=CC=C(NC2=CSC=C2C#N)C=C1 DJQVGQNLOQVRGF-UHFFFAOYSA-N 0.000 description 1
- YDFAYSIZBKGBJD-UHFFFAOYSA-N C1(CCCCC1)C1=CC=C(NC2=CSC=C2C#N)C=C1 Chemical compound C1(CCCCC1)C1=CC=C(NC2=CSC=C2C#N)C=C1 YDFAYSIZBKGBJD-UHFFFAOYSA-N 0.000 description 1
- BNLLPWQQYIFWQA-UHFFFAOYSA-N CC1=C(NC2=CSC=C2C#N)C(=CC(=C1)C)C Chemical compound CC1=C(NC2=CSC=C2C#N)C(=CC(=C1)C)C BNLLPWQQYIFWQA-UHFFFAOYSA-N 0.000 description 1
- STACAJVSXFEKQD-UHFFFAOYSA-N CC1=C(NC=2CSCC2C#N)C(=CC=C1)C Chemical compound CC1=C(NC=2CSCC2C#N)C(=CC=C1)C STACAJVSXFEKQD-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- SSLBLYBNAHUHLA-UHFFFAOYSA-N ClC1=C(NC2=C(SC=C2)C(=O)O)C(=CC=C1)C Chemical compound ClC1=C(NC2=C(SC=C2)C(=O)O)C(=CC=C1)C SSLBLYBNAHUHLA-UHFFFAOYSA-N 0.000 description 1
- FWRUDWKWYFQJIT-UHFFFAOYSA-N ClC1=C(NC2=CSC=C2C#N)C(=C(C(=C1)Cl)C)Cl Chemical compound ClC1=C(NC2=CSC=C2C#N)C(=C(C(=C1)Cl)C)Cl FWRUDWKWYFQJIT-UHFFFAOYSA-N 0.000 description 1
- HECFTSDIFBOZNQ-UHFFFAOYSA-N ClC1=C(NC2=CSC=C2C#N)C(=CC(=C1)Cl)Cl Chemical compound ClC1=C(NC2=CSC=C2C#N)C(=CC(=C1)Cl)Cl HECFTSDIFBOZNQ-UHFFFAOYSA-N 0.000 description 1
- OBKRUJNEJCOXQP-UHFFFAOYSA-N ClC1=C(NC=2CSCC=2C#N)C=C(C=C1)C Chemical compound ClC1=C(NC=2CSCC=2C#N)C=C(C=C1)C OBKRUJNEJCOXQP-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- CWERGRDVMFNCDR-UHFFFAOYSA-N alpha-mercaptoacetic acid Natural products OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 231100000321 erythema Toxicity 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N meta-toluidine Natural products CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N para-benzoquinone Natural products O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- CUPOOAWTRIURFT-UHFFFAOYSA-N thiophene-2-carbonitrile Chemical class N#CC1=CC=CS1 CUPOOAWTRIURFT-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/38—Heterocyclic compounds having sulfur as a ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0045788 | 1965-04-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25505A true IL25505A (en) | 1970-02-19 |
Family
ID=7100669
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25505A IL25505A (en) | 1965-04-10 | 1966-03-31 | Aminothiophene derivatives and process for their manufacture |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3445473A (h) |
| AT (3) | AT263760B (h) |
| BE (1) | BE679374A (h) |
| BR (1) | BR6678492D0 (h) |
| CH (2) | CH534688A (h) |
| DK (1) | DK121127B (h) |
| ES (1) | ES325278A1 (h) |
| FR (1) | FR5539M (h) |
| GB (1) | GB1133850A (h) |
| IL (1) | IL25505A (h) |
| NL (1) | NL6604742A (h) |
| NO (1) | NO118669B (h) |
| SE (1) | SE316489B (h) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4360681A (en) * | 1973-12-03 | 1982-11-23 | Hoffmann-La Roche Inc. | Novel thiophene compounds |
| US4299968A (en) * | 1973-12-03 | 1981-11-10 | Hoffmann-La Roche Inc. | Novel thiophene compounds |
| US4428963A (en) | 1976-08-23 | 1984-01-31 | Hoffmann-La Roche Inc. | Novel thiophene derivatives |
| US4317915A (en) * | 1976-08-23 | 1982-03-02 | Hoffmann-La Roche Inc. | Novel thiophene derivatives |
| YU118379A (en) * | 1978-05-24 | 1983-02-28 | Byk Gulden Lomberg Chemischefa | Process for preparing phenylaminothiophene acetic acid |
| DE3861268D1 (de) * | 1987-07-07 | 1991-01-24 | Shell Int Research | Verfahren zur herstellung von thiophenderivaten. |
| US5166346A (en) * | 1987-12-11 | 1992-11-24 | Hoechst Aktiengesellschaft | Process for the preparation of thiophene derivatives and also new dihydrothiophene 1-oxides |
| US6515009B1 (en) | 1991-09-27 | 2003-02-04 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US5811447A (en) | 1993-01-28 | 1998-09-22 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US6251920B1 (en) | 1993-05-13 | 2001-06-26 | Neorx Corporation | Prevention and treatment of cardiovascular pathologies |
| US6491938B2 (en) | 1993-05-13 | 2002-12-10 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| WO1994026303A1 (en) * | 1993-05-13 | 1994-11-24 | Neorx Corporation | Prevention and treatment of pathologies associated with abnormally proliferative smooth muscle cells |
| US6136984A (en) * | 1996-04-22 | 2000-10-24 | Novo Nordisk A/S | Solid phase and combinatorial synthesis of substituted thiophenes and of arrays of substituted thiophenes |
| AU6959898A (en) * | 1997-04-11 | 1998-11-11 | David J. Grainger | Compounds and therapies for the prevention of vascular and non-vascular pathol ogies |
| US6613083B2 (en) | 2001-05-02 | 2003-09-02 | Eckhard Alt | Stent device and method |
| JP7323913B2 (ja) * | 2019-04-12 | 2023-08-09 | 国立大学法人 筑波大学 | 睡眠誘導剤である複素環化合物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3097206A (en) * | 1962-03-19 | 1963-07-09 | Smith Kline French Lab | Aminomethylthienyl and furyl alcohol derivatives |
-
1966
- 1966-03-30 US US538569A patent/US3445473A/en not_active Expired - Lifetime
- 1966-03-31 IL IL25505A patent/IL25505A/en unknown
- 1966-04-05 CH CH497666A patent/CH534688A/de not_active IP Right Cessation
- 1966-04-05 CH CH1780368A patent/CH547816A/xx not_active IP Right Cessation
- 1966-04-05 BR BR178492/66A patent/BR6678492D0/pt unknown
- 1966-04-06 DK DK184666AA patent/DK121127B/da unknown
- 1966-04-06 ES ES0325278A patent/ES325278A1/es not_active Expired
- 1966-04-06 NO NO162507A patent/NO118669B/no unknown
- 1966-04-06 SE SE4666/66A patent/SE316489B/xx unknown
- 1966-04-07 NL NL6604742A patent/NL6604742A/xx unknown
- 1966-04-08 AT AT142067A patent/AT263760B/de active
- 1966-04-08 AT AT142167A patent/AT263761B/de active
- 1966-04-08 AT AT338466A patent/AT260919B/de active
- 1966-04-12 BE BE679374D patent/BE679374A/xx unknown
- 1966-04-12 GB GB15940/66A patent/GB1133850A/en not_active Expired
- 1966-07-08 FR FR68769A patent/FR5539M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT263761B (de) | 1968-08-12 |
| AT260919B (de) | 1968-03-25 |
| FR5539M (h) | 1967-11-13 |
| DK121127B (da) | 1971-09-13 |
| BR6678492D0 (pt) | 1973-09-18 |
| AT263760B (de) | 1968-08-12 |
| CH534688A (de) | 1973-03-15 |
| NO118669B (h) | 1970-01-26 |
| SE316489B (h) | 1969-10-27 |
| CH547816A (de) | 1974-04-11 |
| ES325278A1 (es) | 1967-04-01 |
| NL6604742A (h) | 1966-10-11 |
| GB1133850A (en) | 1968-11-20 |
| US3445473A (en) | 1969-05-20 |
| BE679374A (h) | 1966-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL25505A (en) | Aminothiophene derivatives and process for their manufacture | |
| JP2572591B2 (ja) | 新規キノロン誘導体およびその塩 | |
| US4327222A (en) | 3,4-Diarylisoxazol-5-acetic acids and process for making same | |
| US4207341A (en) | Hypoglycaemically and hypolipidaemically active derivatives of phenylacetic acid | |
| US3678077A (en) | 9-oxoxanthen-2-yl-alkanoic acids | |
| US2489235A (en) | Synthesis of biotin | |
| US3632645A (en) | Substituted phenylacetyl derivatives of guanidine o-alkylisoureas s-alkylisothioureas and p-nitrobenzylisothiourea | |
| DE2537070C2 (h) | ||
| US4247706A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| US4134991A (en) | Derivatives of 2-(3-phenyl-2-aminopropionyloxy)-acetic acid | |
| DE69319859T2 (de) | Neue tetracyclische verbindungen | |
| CA1331604C (en) | Acylindole derivatives and process for producing thereof | |
| FI66857B (fi) | Foerfarande foer framstaellning av nya farmaceutiskt anvaendbara 3-substituerade dibensofuranderivat | |
| US3631177A (en) | 3-phenacyl-2-oxoindolines | |
| US4659728A (en) | Hydroxy substituted 4,5-diphenyl-2-oxazole propanoic acid | |
| EP0029602B1 (en) | 1,2-bis(nicotinamido)propane, process for preparing the same and pharmaceutical composition containing the same | |
| US4116972A (en) | Anti-inflammatory 1-oxo-isoindoline derivatives and processes for their preparation | |
| US4118504A (en) | Isoindoline derivatives for treating pain | |
| US3978069A (en) | Phenyl-imidazolyl-fatty acid derivatives | |
| NO743135L (h) | ||
| CA1276158C (en) | 4h-benzo[4,5]cyclohepta[1,2-b]thiophene derivatives | |
| IL34468A (en) | Acidic salt salts of the history of indonopyridine, their preparation and pharmaceutical preparations containing them | |
| NO833157L (no) | Sulfamoylbenzofenon-derivater, fremgangsmaate til deres fremstilling, deres anvendelse samt farmasoeytiske preparater paa basis av disse forbindelser | |
| US3526632A (en) | Derivatives of bis-(4-biphenylyloxy)acetic acid | |
| US3862214A (en) | 2-hydroxy-2-(methylsulfonyl)-acetophenone acetates and related compounds |