IL25445A - Herbicides containing metamoric benzamide and pneumoxylic carboxylic acids - Google Patents
Herbicides containing metamoric benzamide and pneumoxylic carboxylic acidsInfo
- Publication number
- IL25445A IL25445A IL25445A IL2544566A IL25445A IL 25445 A IL25445 A IL 25445A IL 25445 A IL25445 A IL 25445A IL 2544566 A IL2544566 A IL 2544566A IL 25445 A IL25445 A IL 25445A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- substituted
- phenoxyaliphatic
- benzimidazole
- herbicidal composition
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 53
- 150000001556 benzimidazoles Chemical class 0.000 title claims description 24
- 230000002363 herbicidal effect Effects 0.000 title claims description 21
- 150000001735 carboxylic acids Chemical class 0.000 title claims description 5
- 239000005574 MCPA Substances 0.000 claims description 35
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 claims description 35
- 239000002253 acid Substances 0.000 claims description 33
- -1 cyano, thiocyano, isothiocyano Chemical group 0.000 claims description 18
- 241000196324 Embryophyta Species 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 239000004009 herbicide Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 3
- SOWBFZRMHSNYGE-UHFFFAOYSA-N Monoamide-Oxalic acid Natural products NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 150000001356 alkyl thiols Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 150000003573 thiols Chemical class 0.000 claims description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 claims 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 claims 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 43
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 12
- 240000005702 Galium aparine Species 0.000 description 9
- 235000014820 Galium aparine Nutrition 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 7
- 230000000451 tissue damage Effects 0.000 description 7
- 231100000827 tissue damage Toxicity 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229940126062 Compound A Drugs 0.000 description 6
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 5
- 244000251090 Anthemis cotula Species 0.000 description 4
- 235000007639 Anthemis cotula Nutrition 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- QJVXBRUGKLCUMY-UHFFFAOYSA-N 2-(2-methylphenoxy)acetic acid Chemical compound CC1=CC=CC=C1OCC(O)=O QJVXBRUGKLCUMY-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241001289540 Fallopia convolvulus Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- BKFXAUQYNCJXIZ-UHFFFAOYSA-N 2,6-bis(trifluoromethyl)-1h-benzimidazole Chemical compound C1=C(C(F)(F)F)C=C2NC(C(F)(F)F)=NC2=C1 BKFXAUQYNCJXIZ-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- MXFMPTXDHSDMTI-UHFFFAOYSA-N 2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=CC=C2NC(C(F)(F)F)=NC2=C1 MXFMPTXDHSDMTI-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- QLKDMIUEWFNEPV-UHFFFAOYSA-N 4,5,6,7-Tetrachloro-2-trifluoromethylbenzimidazole Chemical compound ClC1=C(Cl)C(Cl)=C2NC(C(F)(F)F)=NC2=C1Cl QLKDMIUEWFNEPV-UHFFFAOYSA-N 0.000 description 1
- KSROTSBULDYPKA-UHFFFAOYSA-N 4,5-dichloro-2-(trifluoromethyl)-1h-benzimidazole Chemical group ClC1=CC=C2NC(C(F)(F)F)=NC2=C1Cl KSROTSBULDYPKA-UHFFFAOYSA-N 0.000 description 1
- DHASGWFEIUMBMT-UHFFFAOYSA-N 4,5-dinitro-2-(trifluoromethyl)-1H-benzimidazole Chemical compound [N+](=O)([O-])C1=C(C2=C(N=C(N2)C(F)(F)F)C=C1)[N+](=O)[O-] DHASGWFEIUMBMT-UHFFFAOYSA-N 0.000 description 1
- CAFBQHRMRGNHME-UHFFFAOYSA-N 4,6-dichloro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=C(Cl)C=C2NC(C(F)(F)F)=NC2=C1Cl CAFBQHRMRGNHME-UHFFFAOYSA-N 0.000 description 1
- WUDKQPQAAUQCLT-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=CC=C2NC(C(F)(F)F)=NC2=C1Cl WUDKQPQAAUQCLT-UHFFFAOYSA-N 0.000 description 1
- XHHVZQKTSKYLQH-UHFFFAOYSA-N 4-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=CC2=C1N=C(C(F)(F)F)N2 XHHVZQKTSKYLQH-UHFFFAOYSA-N 0.000 description 1
- DCCVVWRWIMIAHK-UHFFFAOYSA-N 5,6-dichloro-4-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=CC2=C1N=C(C(F)(F)F)N2 DCCVVWRWIMIAHK-UHFFFAOYSA-N 0.000 description 1
- YFYACJUPYYEJMJ-UHFFFAOYSA-N 5-bromo-4-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound [O-][N+](=O)C1=C(Br)C=CC2=C1N=C(C(F)(F)F)N2 YFYACJUPYYEJMJ-UHFFFAOYSA-N 0.000 description 1
- RGHCRDDIYJEAFI-UHFFFAOYSA-N 5-chloro-4-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound [O-][N+](=O)C1=C(Cl)C=CC2=C1N=C(C(F)(F)F)N2 RGHCRDDIYJEAFI-UHFFFAOYSA-N 0.000 description 1
- FKSDCMMCSWXZLS-UHFFFAOYSA-N 6-bromo-2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=C(Br)C=C2NC(C(F)(F)F)=NC2=C1 FKSDCMMCSWXZLS-UHFFFAOYSA-N 0.000 description 1
- GQUMVBCXDLOULU-UHFFFAOYSA-N 6-bromo-4-chloro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=C(Br)C=C2NC(C(F)(F)F)=NC2=C1Cl GQUMVBCXDLOULU-UHFFFAOYSA-N 0.000 description 1
- USUPLSWSXSTERT-UHFFFAOYSA-N 6-bromo-4-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC(Br)=CC2=C1N=C(C(F)(F)F)N2 USUPLSWSXSTERT-UHFFFAOYSA-N 0.000 description 1
- STOJWTVNHAJLBI-UHFFFAOYSA-N 6-chloro-4-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC(Cl)=CC2=C1N=C(C(F)(F)F)N2 STOJWTVNHAJLBI-UHFFFAOYSA-N 0.000 description 1
- KNWBYYSQLWZITM-UHFFFAOYSA-N 6-chloro-5-nitro-2-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=C(Cl)C([N+](=O)[O-])=CC2=C1NC(C(F)(F)F)=N2 KNWBYYSQLWZITM-UHFFFAOYSA-N 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 235000002673 Dioscorea communis Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 244000110797 Polygonum persicaria Species 0.000 description 1
- 235000004442 Polygonum persicaria Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/10—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Vaporization, Distillation, Condensation, Sublimation, And Cold Traps (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB13329/65A GB1135563A (en) | 1965-03-30 | 1965-03-30 | Herbicidal compositions |
| GB5087265 | 1965-11-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25445A true IL25445A (en) | 1970-02-19 |
Family
ID=26249716
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25445A IL25445A (en) | 1965-03-30 | 1966-03-23 | Herbicides containing metamoric benzamide and pneumoxylic carboxylic acids |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3528798A (enFirst) |
| AT (1) | AT271984B (enFirst) |
| BE (1) | BE678571A (enFirst) |
| BR (1) | BR6678624D0 (enFirst) |
| CH (1) | CH451595A (enFirst) |
| DE (1) | DE1542871A1 (enFirst) |
| DK (1) | DK115585B (enFirst) |
| ES (1) | ES324834A1 (enFirst) |
| FI (1) | FI43511B (enFirst) |
| GB (1) | GB1135563A (enFirst) |
| IL (1) | IL25445A (enFirst) |
| LU (1) | LU50793A1 (enFirst) |
| NL (1) | NL6604181A (enFirst) |
| NO (1) | NO116782B (enFirst) |
| SE (1) | SE316652B (enFirst) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1770658A1 (de) * | 1968-06-19 | 1971-11-11 | Hoechst Ag | N-Hydroxi-benzimidazole,ihre Herstellung und Verwendung als Herbicide |
| US3927020A (en) * | 1972-01-28 | 1975-12-16 | Lilly Co Eli | 4-Substituted-5,7-dinitro-2-({60 ,{60 -difluoroalkyl)benzimidazole compounds |
| US3939166A (en) * | 1972-03-06 | 1976-02-17 | Eli Lilly And Company | 4-Substituted-5-cyano-7-nitro-2-(α,α-difluoroalkyl)benzimidazoles |
| US3954792A (en) * | 1975-03-06 | 1976-05-04 | United States Borax & Chemical Corporation | 2-Dialkylamino-5-trifluoromethyl-7-nitrobenzimidazoles |
| GB8515522D0 (en) * | 1985-06-19 | 1985-07-24 | Beecham Group Plc | Compounds |
| IT201700095717A1 (it) * | 2017-08-24 | 2019-02-24 | Lamberti Spa | Composizione erbicida |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB598104A (en) * | 1944-03-20 | 1948-02-10 | American Chem Paint Co | Improvements in compositions for the prevention and destruction of weeds |
| GB591744A (en) * | 1945-05-14 | 1947-08-27 | James Widdrington Warburg | Improvements in or relating to herbicides |
| NL92838C (enFirst) * | 1949-12-06 | |||
| US3317555A (en) * | 1963-07-17 | 1967-05-02 | United States Borax Chem | 5(6)-trifluoromethylbenzimidazole compounds |
| US3325271A (en) * | 1963-07-17 | 1967-06-13 | United States Borax Chem | Herbicidal composition and method employing substituted benzimidazoles |
| FR1473565A (fr) * | 1965-03-30 | 1967-03-17 | Fisons Pest Control Ltd | Composition herbicide |
| US3412101A (en) * | 1966-04-22 | 1968-11-19 | Shell Oil Co | Substituted 2-trifluoromethyl benzimidazoles |
-
1965
- 1965-03-30 GB GB13329/65A patent/GB1135563A/en not_active Expired
-
1966
- 1966-03-23 DE DE19661542871 patent/DE1542871A1/de active Pending
- 1966-03-23 IL IL25445A patent/IL25445A/en unknown
- 1966-03-25 US US537296A patent/US3528798A/en not_active Expired - Lifetime
- 1966-03-28 BE BE678571D patent/BE678571A/xx unknown
- 1966-03-29 SE SE4172/66A patent/SE316652B/xx unknown
- 1966-03-29 ES ES0324834A patent/ES324834A1/es not_active Expired
- 1966-03-29 DK DK162466AA patent/DK115585B/da unknown
- 1966-03-29 LU LU50793A patent/LU50793A1/xx unknown
- 1966-03-29 NO NO162343A patent/NO116782B/no unknown
- 1966-03-29 AT AT295766A patent/AT271984B/de active
- 1966-03-30 NL NL6604181A patent/NL6604181A/xx unknown
- 1966-03-30 FI FI0812/66A patent/FI43511B/fi active
- 1966-03-30 CH CH461166A patent/CH451595A/fr unknown
- 1966-04-12 BR BR178624/66A patent/BR6678624D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI43511B (enFirst) | 1970-12-31 |
| SE316652B (enFirst) | 1969-10-27 |
| GB1135563A (en) | 1968-12-04 |
| DE1542871A1 (de) | 1970-07-02 |
| BE678571A (enFirst) | 1966-09-28 |
| BR6678624D0 (pt) | 1973-10-25 |
| NO116782B (enFirst) | 1969-05-19 |
| NL6604181A (enFirst) | 1966-10-03 |
| AT271984B (de) | 1969-06-25 |
| DK115585B (da) | 1969-10-20 |
| ES324834A1 (es) | 1967-02-16 |
| LU50793A1 (enFirst) | 1966-09-29 |
| US3528798A (en) | 1970-09-15 |
| CH451595A (fr) | 1968-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4400196A (en) | Herbicidal compositions | |
| US2863754A (en) | Method of weed control | |
| US3112342A (en) | 1-methoxy-1-methyl-3-(3-chloro-4-cumenyl) urea | |
| IL25445A (en) | Herbicides containing metamoric benzamide and pneumoxylic carboxylic acids | |
| US2895817A (en) | Herbicidal method and composition employing substituted phenyl parabanic acids | |
| US2992913A (en) | Herbicidal composition and method employing a combination of a polychlorobenzoic acid and a phenoxyaliphatic acid | |
| US3013873A (en) | Herbicidal method using 3-nitro-2, 5-dichlorobenzoic acid | |
| GB2050349A (en) | Isonicotinoyl derivatives of aminoacids | |
| US4729781A (en) | 3,6-dichloro-2-methoxybenzohydroxamic acid derivatives and use as herbicidal agents | |
| CA1081493A (en) | Agents useful in the selective combating of weeds in cereals | |
| SU540552A3 (ru) | Ингибитор роста боковых побегов табака | |
| GB2137092A (en) | Phenoxypropionic Acid Derivatives for Selective Herbicides in Rice Crops | |
| US3979518A (en) | Fungicidal alkoxy substituted 2-cyanoacetamide derivatives | |
| US4032324A (en) | Synergistic herbicidal composition for the control of weeds | |
| US4256482A (en) | Herbicidal composition | |
| US3228762A (en) | Method of killing weeds | |
| US3984568A (en) | Fungicidal cyclopropyl substituted 2-cyanoacetamide derivatives | |
| KR100197302B1 (ko) | N-페닐-3,4,5,6 -테트라히드로프탈이미드와 페녹시알칸카르복실산 유도체로 이루어진 제초제 | |
| DE3545597A1 (de) | Neue herbizid wirksame imidazolinone | |
| US3473913A (en) | Herbicidal composition and method | |
| US4032320A (en) | Synergistic herbicidal mixtures of 4-chloro-2-oxobenzothiazolin-3-ylacetic acid and 2-methoxy-3,6-dichlorobenzoic acid | |
| EP0147683B1 (en) | A method for the control of galium aparine | |
| US3909234A (en) | Synergistic herbicidal composition for the control of weeds | |
| EP0198870A1 (en) | WEED KILLING COMPOSITIONS FOR KILLING MONOCOTYLENE AND DIKOTYLENE WEEDS IN MAIZE. | |
| SU1210650A3 (ru) | Гербицидное средство (его варианты) |