IE57569B1 - Benzazepine and benzoxazepine derivatives - Google Patents
Benzazepine and benzoxazepine derivativesInfo
- Publication number
- IE57569B1 IE57569B1 IE1830/84A IE183084A IE57569B1 IE 57569 B1 IE57569 B1 IE 57569B1 IE 1830/84 A IE1830/84 A IE 1830/84A IE 183084 A IE183084 A IE 183084A IE 57569 B1 IE57569 B1 IE 57569B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- formula
- group
- alkyl
- hydrogen
- Prior art date
Links
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 title claims description 9
- ZCXLTWVZYXBHJS-UHFFFAOYSA-N 1,2-benzoxazepine Chemical class O1N=CC=CC2=CC=CC=C12 ZCXLTWVZYXBHJS-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 63
- 238000000034 method Methods 0.000 claims abstract description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000005864 Sulphur Substances 0.000 claims abstract description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 7
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 238000011282 treatment Methods 0.000 claims description 13
- 125000006239 protecting group Chemical group 0.000 claims description 11
- -1 nitro, amino Chemical group 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 208000006968 Helminthiasis Diseases 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 208000014837 parasitic helminthiasis infectious disease Diseases 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 241000242722 Cestoda Species 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical group C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 claims description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 4
- 238000007280 thionation reaction Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000011321 prophylaxis Methods 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 206010061217 Infestation Diseases 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 239000003814 drug Substances 0.000 abstract description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 abstract 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 abstract 1
- 125000000081 (C5-C8) cycloalkenyl group Chemical group 0.000 abstract 1
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 abstract 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000000243 solution Substances 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- XUUSYXJGMRQBKQ-UHFFFAOYSA-N 2h-2-benzazepine Chemical compound N1C=CC=C2C=CC=CC2=C1 XUUSYXJGMRQBKQ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000004440 column chromatography Methods 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 230000000507 anthelmentic effect Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 4
- UWXIKAZQXAYFPT-UHFFFAOYSA-N 1,4-benzoxazepine Chemical compound O1C=CN=CC2=CC=CC=C12 UWXIKAZQXAYFPT-UHFFFAOYSA-N 0.000 description 3
- FSVJFNAIGNNGKK-UHFFFAOYSA-N 2-[cyclohexyl(oxo)methyl]-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one Chemical compound C1C(C2=CC=CC=C2CC2)N2C(=O)CN1C(=O)C1CCCCC1 FSVJFNAIGNNGKK-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 241000935792 Dipylidium caninum Species 0.000 description 3
- 241000244156 Hydatigera taeniaeformis Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 229960002957 praziquantel Drugs 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- 239000001117 sulphuric acid Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- CDZCREIHDRCTHZ-UHFFFAOYSA-N 2h-cyclohepta[c]pyridine Chemical compound C1=CC=CC2=CNC=CC2=C1 CDZCREIHDRCTHZ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 208000026368 Cestode infections Diseases 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical class OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 241001175904 Labeo bata Species 0.000 description 2
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- PVKCAQKXTLCSBC-UHFFFAOYSA-N 1h-isoquinolin-4-one Chemical compound C1=CC=C2C(=O)C=NCC2=C1 PVKCAQKXTLCSBC-UHFFFAOYSA-N 0.000 description 1
- SZQUPQVVCLFZLC-UHFFFAOYSA-N 2-[benzyl(carboxymethyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)CC1=CC=CC=C1 SZQUPQVVCLFZLC-UHFFFAOYSA-N 0.000 description 1
- IMLAIXAZMVDRGA-UHFFFAOYSA-N 2-phenoxyethanamine Chemical compound NCCOC1=CC=CC=C1 IMLAIXAZMVDRGA-UHFFFAOYSA-N 0.000 description 1
- ZYPCNAHFCLFZKP-UHFFFAOYSA-N 4-benzyl-6-hydroxy-1-(3-phenylpropyl)piperazin-2-one Chemical compound C1C(=O)N(CCCC=2C=CC=CC=2)C(O)CN1CC1=CC=CC=C1 ZYPCNAHFCLFZKP-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- PPSLQAVZJVIPMU-UHFFFAOYSA-N C(=O)(O)C(O)C(O)C(=O)O.C=1NC=CC=C2C1C=CC=C2 Chemical compound C(=O)(O)C(O)C(O)C(=O)O.C=1NC=CC=C2C1C=CC=C2 PPSLQAVZJVIPMU-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000935794 Dipylidium Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241000244155 Taenia Species 0.000 description 1
- 241000718541 Tetragastris balsamifera Species 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 150000008038 benzoazepines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- AVNVZEQUGAWERL-UHFFFAOYSA-N methyl cyclohexanecarbodithioate Chemical compound CSC(=S)C1CCCCC1 AVNVZEQUGAWERL-UHFFFAOYSA-N 0.000 description 1
- HWYHDWGGACRVEH-UHFFFAOYSA-N n-methyl-n-(4-pyrrolidin-1-ylbut-2-ynyl)acetamide Chemical compound CC(=O)N(C)CC#CCN1CCCC1 HWYHDWGGACRVEH-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838319357A GB8319357D0 (en) | 1983-07-18 | 1983-07-18 | Compounds |
| GB838334502A GB8334502D0 (en) | 1983-12-24 | 1983-12-24 | Compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE841830L IE841830L (en) | 1985-01-16 |
| IE57569B1 true IE57569B1 (en) | 1992-12-16 |
Family
ID=26286633
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1830/84A IE57569B1 (en) | 1983-07-18 | 1984-07-16 | Benzazepine and benzoxazepine derivatives |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4661489A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0134984B1 (cg-RX-API-DMAC10.html) |
| AU (1) | AU572864B2 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1238320A (cg-RX-API-DMAC10.html) |
| DE (1) | DE3472678D1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK169548B1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES8604598A1 (cg-RX-API-DMAC10.html) |
| GR (1) | GR79947B (cg-RX-API-DMAC10.html) |
| IE (1) | IE57569B1 (cg-RX-API-DMAC10.html) |
| MX (1) | MX161064A (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ208896A (cg-RX-API-DMAC10.html) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3472678D1 (de) * | 1983-07-18 | 1988-08-18 | Beecham Group Plc | Benzazepine and benzoxazepine derivatives |
| EP0187012B1 (en) * | 1984-12-22 | 1989-06-21 | Beecham Group Plc | Novel compositions |
| GB8509435D0 (en) * | 1985-04-12 | 1985-05-15 | Beecham Group Plc | Intermediates & process |
| GB9024924D0 (en) * | 1990-11-16 | 1991-01-02 | Beecham Group Plc | Novel compositions |
| US5372130A (en) * | 1992-02-26 | 1994-12-13 | Djs&T Limited Partnership | Face mask assembly and method having a fan and replaceable filter |
| DE19628776A1 (de) | 1996-07-17 | 1998-01-22 | Bayer Ag | Oral applizierbare Granulate von Hexahydropyrazinderivaten |
| DE102005011779A1 (de) * | 2005-03-11 | 2006-09-14 | Bayer Healthcare Ag | Endoparasitizide Mittel |
| DE102008022520A1 (de) | 2008-05-07 | 2009-11-12 | Bayer Animal Health Gmbh | Feste Arzneimittelformulierung mit verzögerter Freisetzung |
| EP2651225A4 (en) * | 2010-12-13 | 2016-07-06 | Sequent Scient Ltd | PROCESS FOR PREPARING PRAZIQUANTEL |
| CN104844606B (zh) * | 2011-05-31 | 2017-03-01 | 山东大学(威海) | 抗寄生虫吡嗪异喹啉衍生物 |
| CN102321088A (zh) * | 2011-08-03 | 2012-01-18 | 威海秀水药物研发有限公司 | 一种新型抗血吸虫化合物 |
| CN110128325B (zh) * | 2019-04-11 | 2021-01-05 | 广州医科大学 | 取代苯基哌啶酮类化合物及其合成方法和应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL129434C (cg-RX-API-DMAC10.html) * | 1966-03-12 | |||
| DE2362539C2 (de) * | 1973-12-17 | 1986-05-07 | Merck Patent Gmbh, 6100 Darmstadt | 2-Acyl-4-oxo-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isochinoline, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US4162319A (en) * | 1974-08-28 | 1979-07-24 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Ring substituted pyrazino-isoquinoline derivatives and their preparation |
| DE2441261A1 (de) * | 1974-08-28 | 1976-03-18 | Merck Patent Gmbh | Ringsubstituierte pyrazino-isochinolin-derivat und verfahren zu ihrer herstellung |
| NL7809726A (nl) * | 1978-09-26 | 1980-03-28 | Akzo Nv | Nieuwe tetracyclische verbindingen. |
| FR2520740A1 (fr) * | 1982-01-29 | 1983-08-05 | Sanofi Sa | Procede pour la preparation d'acyl-2-hexahydro-1,3,4,6,7,11b-2h-pyrazino (2,1-a) isoquinoleinones-4 et intermediaires |
| IN157936B (cg-RX-API-DMAC10.html) * | 1982-07-08 | 1986-07-26 | Korea Advanced Inst Sci & Tech | |
| ZW6284A1 (en) * | 1983-05-05 | 1985-10-30 | Hoffmann La Roche | Novel pyrimidone derivatives |
| DE3472678D1 (de) * | 1983-07-18 | 1988-08-18 | Beecham Group Plc | Benzazepine and benzoxazepine derivatives |
-
1984
- 1984-07-07 DE DE8484107989T patent/DE3472678D1/de not_active Expired
- 1984-07-07 EP EP84107989A patent/EP0134984B1/en not_active Expired
- 1984-07-11 MX MX6774A patent/MX161064A/es unknown
- 1984-07-13 ES ES534315A patent/ES8604598A1/es not_active Expired
- 1984-07-13 US US06/630,524 patent/US4661489A/en not_active Expired - Lifetime
- 1984-07-13 GR GR75302A patent/GR79947B/el unknown
- 1984-07-13 NZ NZ208896A patent/NZ208896A/en unknown
- 1984-07-13 CA CA000458877A patent/CA1238320A/en not_active Expired
- 1984-07-13 DK DK347284A patent/DK169548B1/da not_active IP Right Cessation
- 1984-07-13 AU AU30581/84A patent/AU572864B2/en not_active Expired
- 1984-07-16 IE IE1830/84A patent/IE57569B1/en not_active IP Right Cessation
-
1986
- 1986-09-17 US US06/908,379 patent/US4866056A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK169548B1 (da) | 1994-11-28 |
| DE3472678D1 (de) | 1988-08-18 |
| EP0134984B1 (en) | 1988-07-13 |
| GR79947B (cg-RX-API-DMAC10.html) | 1984-10-31 |
| EP0134984A1 (en) | 1985-03-27 |
| AU572864B2 (en) | 1988-05-19 |
| CA1238320A (en) | 1988-06-21 |
| US4661489A (en) | 1987-04-28 |
| ES534315A0 (es) | 1986-02-01 |
| NZ208896A (en) | 1988-03-30 |
| ES8604598A1 (es) | 1986-02-01 |
| AU3058184A (en) | 1985-01-17 |
| IE841830L (en) | 1985-01-16 |
| DK347284A (da) | 1985-01-17 |
| DK347284D0 (da) | 1984-07-13 |
| US4866056A (en) | 1989-09-12 |
| MX161064A (es) | 1990-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2619208B1 (en) | Imidazotriazinone compounds | |
| EP0487071B1 (en) | Condensed heterocyclic compounds, their production and use | |
| EP0161632B1 (de) | Neue Pyrrolo-Benzimidazole, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel sowie Zwischenprodukte | |
| DK163145B (da) | Analogifremgangsmaade til fremstilling af 6-substituerede s-triazoloe3,4-aaaftalazin-derivater | |
| EP0153163A2 (en) | 7-Substituted-1-cyclopropyl-6,8-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acids; 7-substituted-1-cyclopropyl-1,4-dihydro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acids; their derivatives; and a process for preparing the compounds | |
| NL8801258A (nl) | Benzobpyranen en pyranopvridinen en werkwijzen voor het bereiden van deze verbindingen en hun toepassing. | |
| EP0106489A2 (en) | Antibacterial agents | |
| IE57569B1 (en) | Benzazepine and benzoxazepine derivatives | |
| CH674368A5 (cg-RX-API-DMAC10.html) | ||
| EP0216345B1 (de) | Chinolinderivate | |
| EP4055013B1 (en) | Wdr5 inhibitors and modulators | |
| HU191757B (en) | Process for producing new tricyclic ethers | |
| DD242045A5 (de) | Neue pyrolo-benzimidazole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP2880023A1 (fr) | Derives de griseofulvine | |
| EP3156405A1 (en) | Spirocyclic ether derivatives of pyrazolo[1,5-a]pyrimidine-3-carboxamide | |
| SK37394A3 (en) | 1,8-benzonaphthyridine derivatives, method of their preparation and compositions containing these derivatives | |
| GB2096143A (en) | Imidazo(1,2-a)quinoline derivatives | |
| EP0187012B1 (en) | Novel compositions | |
| JPS6130588A (ja) | ベンゾ〔c〕〔1,8〕ナフチリジン、その製造方法及びその使用、並びにこれらの化合物を含有する調製剤 | |
| EP0299345A2 (en) | Dihydro-1,4-oxazino(2,3-c)quinolines, a process and intermediates for the preparation thereof and their use as medicaments | |
| DE69708640T2 (de) | Pyridoncarbonsäure-derivate und zwischenverbindungen für deren herstellung | |
| US4716159A (en) | Pyridazino[4,3-c]-isoquinolines having anti-anxiety activity | |
| HU200768B (en) | Process for producing aryl-substituted naphthyridine derivatives an dpharmaceutical compositions comprising same | |
| DD147668A5 (de) | Verfahren zur herstellung von 7,8,9,10-tetrahydrothieno-eckige klammer auf 3,2-e eckige klammer zu pyrido eckige klammer auf 4,3-b eckige klammer zu indolen | |
| GB2637214A (en) | Novel compounds and uses thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK9A | Patent expired |