IE57058B1 - 2,2-diethoxypropionic acid derivatives - Google Patents
2,2-diethoxypropionic acid derivativesInfo
- Publication number
- IE57058B1 IE57058B1 IE625/84A IE62584A IE57058B1 IE 57058 B1 IE57058 B1 IE 57058B1 IE 625/84 A IE625/84 A IE 625/84A IE 62584 A IE62584 A IE 62584A IE 57058 B1 IE57058 B1 IE 57058B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- bromo
- nitrophenyl
- diethoxypropionate
- process according
- Prior art date
Links
- GZXUGANRHSLAKH-UHFFFAOYSA-N 2,2-diethoxypropanoic acid Chemical class CCOC(C)(C(O)=O)OCC GZXUGANRHSLAKH-UHFFFAOYSA-N 0.000 title description 3
- 239000002253 acid Substances 0.000 claims abstract description 14
- 238000000034 method Methods 0.000 claims abstract description 9
- 238000002360 preparation method Methods 0.000 claims abstract 4
- KJPCBBYQNDWZGC-UHFFFAOYSA-N (4-nitrophenyl) 3-bromo-2,2-diethoxypropanoate Chemical compound CCOC(CBr)(OCC)C(=O)OC1=CC=C([N+]([O-])=O)C=C1 KJPCBBYQNDWZGC-UHFFFAOYSA-N 0.000 claims abstract 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- YQIFOEKDQDTIGO-UHFFFAOYSA-N 3-bromo-2,2-diethoxypropanoic acid Chemical compound CCOC(CBr)(C(O)=O)OCC YQIFOEKDQDTIGO-UHFFFAOYSA-N 0.000 claims description 3
- 239000003377 acid catalyst Substances 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 claims 1
- VEYIMQVTPXPUHA-UHFFFAOYSA-N 3-hydroxypyran-4-one Chemical compound OC1=COC=CC1=O VEYIMQVTPXPUHA-UHFFFAOYSA-N 0.000 abstract description 10
- 230000015572 biosynthetic process Effects 0.000 abstract description 6
- 150000003384 small molecules Chemical class 0.000 abstract description 5
- 238000003786 synthesis reaction Methods 0.000 abstract description 5
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000012038 nucleophile Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- PRRZDZJYSJLDBS-UHFFFAOYSA-N 3-bromo-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CBr PRRZDZJYSJLDBS-UHFFFAOYSA-N 0.000 description 2
- XPCTZQVDEJYUGT-UHFFFAOYSA-N 3-hydroxy-2-methyl-4-pyrone Chemical compound CC=1OC=CC(=O)C=1O XPCTZQVDEJYUGT-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 2
- 229960001826 dimethylphthalate Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- VXBYODJVYJMASS-UHFFFAOYSA-N (2-nitrophenyl) 2,2,2-trifluoroacetate Chemical compound [O-][N+](=O)C1=CC=CC=C1OC(=O)C(F)(F)F VXBYODJVYJMASS-UHFFFAOYSA-N 0.000 description 1
- JFOIBTLTZWOAIC-UHFFFAOYSA-N (4-nitrophenyl) 2,2,2-trifluoroacetate Chemical compound [O-][N+](=O)C1=CC=C(OC(=O)C(F)(F)F)C=C1 JFOIBTLTZWOAIC-UHFFFAOYSA-N 0.000 description 1
- FQXXDYZRDMGONZ-UHFFFAOYSA-N 2,2-diethoxypropanamide Chemical compound CCOC(C)(C(N)=O)OCC FQXXDYZRDMGONZ-UHFFFAOYSA-N 0.000 description 1
- VTFGTYGRKKRNHW-UHFFFAOYSA-N 5-bromo-4,4-diethoxy-3-oxopentanenitrile Chemical compound CCOC(CBr)(OCC)C(=O)CC#N VTFGTYGRKKRNHW-UHFFFAOYSA-N 0.000 description 1
- LLQHSBBZNDXTIV-UHFFFAOYSA-N 6-[5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC1CC(=NO1)C1=CC2=C(NC(O2)=O)C=C1 LLQHSBBZNDXTIV-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- HYMLWHLQFGRFIY-UHFFFAOYSA-N Maltol Natural products CC1OC=CC(=O)C1=O HYMLWHLQFGRFIY-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- OFIPMSSTKFSADG-UHFFFAOYSA-N [Li]CC#N Chemical compound [Li]CC#N OFIPMSSTKFSADG-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019568 aromas Nutrition 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000005907 ketalization reaction Methods 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940043353 maltol Drugs 0.000 description 1
- AEXITZJSLGALNH-UHFFFAOYSA-N n'-hydroxyethanimidamide Chemical compound CC(N)=NO AEXITZJSLGALNH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- -1 o-nitrophenyl 3-bromo-2,2-diethoxypropionate Chemical compound 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/34—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D309/36—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
- C07D309/40—Oxygen atoms attached in positions 3 and 4, e.g. maltol
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/32—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/474,958 US4443621A (en) | 1983-03-14 | 1983-03-14 | p-Nitrophenyl 3-bromo-2,2-diethoxy-propionate and synthetic utility therefor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE840625L IE840625L (en) | 1984-09-14 |
| IE57058B1 true IE57058B1 (en) | 1992-04-08 |
Family
ID=23885672
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE625/84A IE57058B1 (en) | 1983-03-14 | 1984-03-13 | 2,2-diethoxypropionic acid derivatives |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4443621A (enFirst) |
| EP (1) | EP0119091B1 (enFirst) |
| JP (1) | JPS59176234A (enFirst) |
| AT (1) | ATE30014T1 (enFirst) |
| DE (1) | DE3466530D1 (enFirst) |
| DK (1) | DK163180C (enFirst) |
| GR (1) | GR81838B (enFirst) |
| IE (1) | IE57058B1 (enFirst) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6294502B1 (en) | 1998-05-22 | 2001-09-25 | Bayer Aktiengesellschaft | Thermally-responsive record material |
| US6015771A (en) * | 1998-05-22 | 2000-01-18 | Bayer Aktiengesellschaft | Thermally-responsive record material |
| DE10341952B4 (de) * | 2003-09-11 | 2008-11-20 | Lurgi Gmbh | Zwischenprodukt bestehend aus einer Mischung von organischen Carbonaten und Carbamaten und ein Verfahren zu seiner Herstellung |
| CN101518729B (zh) * | 2008-02-26 | 2013-04-24 | 拜耳材料科技(中国)有限公司 | 用于氨基甲酸烷基酯合成的催化剂及其制备方法和用途 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3130204A (en) * | 1962-02-07 | 1964-04-21 | Pfizer & Co C | Preparation of gamma-pyrones |
| FR1500765A (fr) * | 1963-09-19 | 1967-11-10 | Pfizer & Co C | Dérivés de l'acide pyroméconique et procédé pour leur préparation |
| US3468915A (en) * | 1966-04-18 | 1969-09-23 | Pfizer & Co C | Novel 2-substituted-6-methylpyromeconic acids |
| US3644635A (en) * | 1969-04-10 | 1972-02-22 | Pfizer | Method and compositions for inhibiting microbial growth |
| DE2537129C3 (de) * | 1975-08-20 | 1978-05-03 | Boehringer Mannheim Gmbh, 6800 Mannheim | Reaktive unsymmetrische, einen Digoxin- bzw. Digitoxinrest enthaltende Dicarbonsäureester, Verfahren zu deren Herstellung sowie ihre Verwendung zur Herstellung von Testreagentien |
| US4082717A (en) * | 1976-08-02 | 1978-04-04 | Pfizer Inc. | Preparation of gamma-pyrones |
-
1983
- 1983-03-14 US US06/474,958 patent/US4443621A/en not_active Expired - Fee Related
-
1984
- 1984-02-28 DK DK113884A patent/DK163180C/da active
- 1984-03-09 GR GR74042A patent/GR81838B/el unknown
- 1984-03-13 AT AT84301669T patent/ATE30014T1/de not_active IP Right Cessation
- 1984-03-13 DE DE8484301669T patent/DE3466530D1/de not_active Expired
- 1984-03-13 EP EP84301669A patent/EP0119091B1/en not_active Expired
- 1984-03-13 IE IE625/84A patent/IE57058B1/en not_active IP Right Cessation
- 1984-03-14 JP JP59048964A patent/JPS59176234A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4443621A (en) | 1984-04-17 |
| DK113884A (da) | 1984-09-15 |
| EP0119091B1 (en) | 1987-09-30 |
| ATE30014T1 (de) | 1987-10-15 |
| IE840625L (en) | 1984-09-14 |
| DK113884D0 (da) | 1984-02-28 |
| GR81838B (enFirst) | 1984-12-12 |
| EP0119091A2 (en) | 1984-09-19 |
| EP0119091A3 (en) | 1986-03-05 |
| JPS59176234A (ja) | 1984-10-05 |
| DE3466530D1 (de) | 1987-11-05 |
| DK163180B (da) | 1992-02-03 |
| DK163180C (da) | 1992-06-22 |
| JPS621941B2 (enFirst) | 1987-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4353829A (en) | Process for 5-aroylation of 1,2-dihydro-3H-pyrrolo[1,2-a]pyrrole-1-carboxylic esters | |
| US3895028A (en) | Alpha-(2-phenylbenzothiazol-5-yl)propionic acid | |
| KR850000923B1 (ko) | 피록시캄의 제조 방법 | |
| US3227721A (en) | Process for preparing 2-methyl-3-hydroxypyridines | |
| US3227724A (en) | Process for preparing 2-methyl-3-hydroxypyridines | |
| IE57058B1 (en) | 2,2-diethoxypropionic acid derivatives | |
| HU195773B (en) | Process for preparing alkyl esters of 4-alkoxy-3-pyrrolin-2-on-1-yl-acetic acid | |
| EP0284076B1 (en) | Process for preparing (+)-1,2-dihydro-3H-pyrrolo[1,2-a]pyrrole-1-carboxylic acid and related compounds | |
| US3998999A (en) | Process for preparing pyrazomycin and pyrazomycin B | |
| US3227722A (en) | Process for the preparation of pyredine | |
| MOHRI et al. | Meldrum's acid in organic synthesis. VI. Synthesis of 2-substituted indoles from acyl meldrum's acids and phenylhydroxylamine via [3, 3] sigmatropic rearrangement | |
| GB2036744A (en) | Eburnane derivatives | |
| US4009172A (en) | 2,3,3A,6,7,7A-Hexahydro-thieno[3,2-b]pyridin-(4H)5-ones | |
| US2525416A (en) | Preparation of dithiooxalodiamides and thioacetamides | |
| SU1017167A3 (ru) | Способ получени @ -5-ацетамидо-4,5,6,7-тетрагидро-2н-бензо/с/пиррола | |
| US3219668A (en) | Etihnylated lactams and process for their production | |
| SU453842A3 (enFirst) | ||
| US5599949A (en) | Bisphenol derivative and its manufacturing method | |
| US5254713A (en) | 2- and 3-chloropyrroles and process for preparing the same | |
| US5210218A (en) | 2- and 3-chloropyrroles and process for preparing the same | |
| KR950013852B1 (ko) | 4-에톡시카보닐-1-메틸-5-피라졸머캅탄의 제조방법 | |
| EP0344983B1 (en) | Process for preparing 2- and 4-alkoxycarbonyl thiolan-3-ones | |
| KR950013853B1 (ko) | 4-에톡시카보닐-i-메틸-5-피라졸머캅탄의 제조방법 | |
| HU196176B (en) | Process for preparing novel 4-alkoxy-2-oxo-pyrrolidin-1-yl-acetic acid-alkylesters | |
| Sheehan et al. | α-Lactams. III. The Reaction of 1-t-Butyl-3, 3-dimethylaziridinone with Lithium Aluminum Hydride |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |