IE49330B1 - Process for producing substituted 4-(pyridyl-2-oxy)phenoxy-alkanecarboxylic acid or its derivatives - Google Patents
Process for producing substituted 4-(pyridyl-2-oxy)phenoxy-alkanecarboxylic acid or its derivativesInfo
- Publication number
- IE49330B1 IE49330B1 IE777/80A IE77780A IE49330B1 IE 49330 B1 IE49330 B1 IE 49330B1 IE 777/80 A IE777/80 A IE 777/80A IE 77780 A IE77780 A IE 77780A IE 49330 B1 IE49330 B1 IE 49330B1
- Authority
- IE
- Ireland
- Prior art keywords
- derivative
- oxy
- reaction
- formula
- acid
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims abstract description 21
- 238000000034 method Methods 0.000 title claims description 24
- MEAAWTRWNWSLPF-UHFFFAOYSA-N 2-phenoxypyridine Chemical class C=1C=CC=NC=1OC1=CC=CC=C1 MEAAWTRWNWSLPF-UHFFFAOYSA-N 0.000 claims abstract description 14
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 17
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000002798 polar solvent Substances 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 2
- 238000010992 reflux Methods 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 239000004009 herbicide Substances 0.000 abstract description 2
- 239000004480 active ingredient Substances 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 24
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 20
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
- 235000019260 propionic acid Nutrition 0.000 description 10
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- DWUVKWPKIANOKG-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)-5-(trifluoromethyl)pyridine Chemical compound N1=CC(C(F)(F)F)=CC=C1OC1=CC=C(Cl)C=C1Cl DWUVKWPKIANOKG-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000005749 2-halopyridines Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 3
- JFZJMSDDOOAOIV-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1 JFZJMSDDOOAOIV-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- OCXLCEFMMCMNCS-UHFFFAOYSA-N 2-(4-methylphenoxy)-5-(trifluoromethyl)pyridine Chemical compound C1=CC(C)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 OCXLCEFMMCMNCS-UHFFFAOYSA-N 0.000 description 2
- PQGUJZLNSPLGSZ-UHFFFAOYSA-N 2-phenoxy-5-(trifluoromethyl)pyridine Chemical compound N1=CC(C(F)(F)F)=CC=C1OC1=CC=CC=C1 PQGUJZLNSPLGSZ-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229940073584 methylene chloride Drugs 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 229940005605 valeric acid Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XLHUBROMZOAQMV-UHFFFAOYSA-N 1,4-benzosemiquinone Chemical group [O]C1=CC=C(O)C=C1 XLHUBROMZOAQMV-UHFFFAOYSA-N 0.000 description 1
- UPWAAFFFSGQECJ-UHFFFAOYSA-N 2,6-dichloro-3-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1Cl UPWAAFFFSGQECJ-UHFFFAOYSA-N 0.000 description 1
- -1 2-(2, 4, 6-trichlorophenoxy)- 3, 5di chloropyridine Chemical compound 0.000 description 1
- CWRUMUCTRIRCOD-UHFFFAOYSA-N 2-(4-chlorophenoxy)-5-(trifluoromethyl)pyridine Chemical compound N1=CC(C(F)(F)F)=CC=C1OC1=CC=C(Cl)C=C1 CWRUMUCTRIRCOD-UHFFFAOYSA-N 0.000 description 1
- ATRQECRSCHYSNP-UHFFFAOYSA-N 2-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=CC=N1 ATRQECRSCHYSNP-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- GAEKPEKOJKCEMS-UHFFFAOYSA-N gamma-valerolactone Chemical compound CC1CCC(=O)O1 GAEKPEKOJKCEMS-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4814779A JPS55139361A (en) | 1979-04-19 | 1979-04-19 | Preparation of 4-(pyridyl-2-oxy)phenoxyalkane-carboxylic acid or its derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE800777L IE800777L (en) | 1980-10-19 |
| IE49330B1 true IE49330B1 (en) | 1985-09-18 |
Family
ID=12795243
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE777/80A IE49330B1 (en) | 1979-04-19 | 1980-04-17 | Process for producing substituted 4-(pyridyl-2-oxy)phenoxy-alkanecarboxylic acid or its derivatives |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4267336A (enExample) |
| JP (1) | JPS55139361A (enExample) |
| BR (1) | BR8002431A (enExample) |
| FR (1) | FR2454439A1 (enExample) |
| GB (1) | GB2048864B (enExample) |
| IE (1) | IE49330B1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4750931A (en) * | 1983-11-10 | 1988-06-14 | The Dow Chemical Company | Certain 3,5-disubstituted-2-pyridyloxy-fluorophenoxy-alkanoic acids, derivatives thereof and herbicidal properties |
| IL109104A (en) * | 1993-03-26 | 1998-08-16 | Shell Int Research | History of pyridine from wool - 2,6 Preparation and use as herbicides containing them |
| JPH07302673A (ja) * | 1994-05-09 | 1995-11-14 | Furukawa Electric Co Ltd:The | 圧縮ダイス |
| US7228793B2 (en) * | 2002-11-25 | 2007-06-12 | Fizzy Fruit, LLC | Carbonation system for enhancing the flavor of fruits and vegetables |
| CN107011250B (zh) * | 2017-03-29 | 2020-08-11 | 温州医科大学 | 一种2-(2,6-二氯苯氧基)吡啶化合物的合成方法及其用途 |
| CN114380740A (zh) * | 2021-12-24 | 2022-04-22 | 江阴苏利化学股份有限公司 | 一种多取代吡啶-2-氧醚类化合物的合成方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| GB1512189A (en) * | 1975-10-29 | 1978-05-24 | Ishihara Mining & Chemical Co | Herbicidal composition and method of use thereof |
| JPS52131540A (en) * | 1976-04-14 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxyvaleric acid derivatives and herbicides therefrom |
| US4133675A (en) * | 1976-07-23 | 1979-01-09 | Ciba-Geigy Corporation | Pyridyloxy-phenoxy-alkanecarboxylic acid derivatives which are effective as herbicides and as agents regulating plant growth |
-
1979
- 1979-04-19 JP JP4814779A patent/JPS55139361A/ja active Granted
-
1980
- 1980-04-07 US US06/137,954 patent/US4267336A/en not_active Expired - Lifetime
- 1980-04-16 GB GB8012507A patent/GB2048864B/en not_active Expired
- 1980-04-17 IE IE777/80A patent/IE49330B1/en not_active IP Right Cessation
- 1980-04-18 FR FR8008831A patent/FR2454439A1/fr active Granted
- 1980-04-18 BR BR8002431A patent/BR8002431A/pt not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS55139361A (en) | 1980-10-31 |
| IE800777L (en) | 1980-10-19 |
| GB2048864A (en) | 1980-12-17 |
| BR8002431A (pt) | 1980-12-02 |
| US4267336A (en) | 1981-05-12 |
| FR2454439B1 (enExample) | 1983-06-24 |
| JPS6343389B2 (enExample) | 1988-08-30 |
| GB2048864B (en) | 1983-05-25 |
| FR2454439A1 (fr) | 1980-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0021453B1 (en) | 2-chloro-5-trichloromethylpyridine | |
| KR100418807B1 (ko) | 2-(6-치환된-피리드-2-일옥시메틸)페닐아세테이트의제조방법 | |
| CA1236106A (en) | (r)-2-¬4-(5-chloro-3-fluoropyridin-2-yloxy)- phenoxyl|-propionic acid propynyl ester with herbicidal activity | |
| US4152328A (en) | 2-phenoxy-5-trifluoromethylpyridine compounds and process for preparation thereof | |
| EP0104715B1 (en) | 2,3-difluoro-5-(trifluoromethyl)pyridine and method of making and using the same | |
| US4990622A (en) | Process for the preparation of 2-chloro-5-chloromethylpyridine | |
| IE49330B1 (en) | Process for producing substituted 4-(pyridyl-2-oxy)phenoxy-alkanecarboxylic acid or its derivatives | |
| US4309547A (en) | Process for the preparation of phenoxypropionic acids and their alkali metal salts | |
| CS198298B2 (en) | Method of producing substituted benzylesters of vinyl cyclopropane carboxylic acids | |
| US5304651A (en) | Process for the preparation of 5-substituted 2-chloropyridines | |
| CA1131249A (en) | Process for the preparation of optically active aryloxyalkanoic acid compounds | |
| HU199798B (en) | Process for producing 2-substituted-5-methyl-pyridine derivatives | |
| US5936103A (en) | Process for the preparation of aromatic compounds containing a heterocyclic system | |
| EP0030867A1 (en) | Process for the preparation of substituted pyridinyloxy ethers | |
| ZA200210300B (en) | Process for the preparation of trifluoroethoxy-substituted benzoic acids. | |
| US4525205A (en) | Herbicidal compositions comprising compounds containing a phenylaminophenoxy moiety | |
| US4681941A (en) | Method of preparing esters of aryloxyphenoxy propanoic acid | |
| US5049675A (en) | Solvent-free process for the preparation of ((pyridinyloxy)phenoxy) propionate derivatives | |
| EP0548560B1 (en) | Process for the manufacturing of halomaleic and halofumaric esters | |
| EP0066827B1 (en) | Process for making pyridyloxyphenol compounds | |
| US4529438A (en) | Pyridyloxy-phenoxy-alkanoic acid esters and derivatives | |
| US4450308A (en) | Process for the preparation of trifluoromethylphenyl oxyphenyl ether compounds | |
| US4410701A (en) | Process for making pyridyloxyphenol compounds | |
| USH214H (en) | Distillation process for the isolation of 1,1-difluoro(mono- or dihalo)ethoxybenzeneamines | |
| EP0058173B1 (en) | Process for the synthesis of aryloxy derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |