IE49234B1 - Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compounds - Google Patents
Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compoundsInfo
- Publication number
- IE49234B1 IE49234B1 IE2418/79A IE241879A IE49234B1 IE 49234 B1 IE49234 B1 IE 49234B1 IE 2418/79 A IE2418/79 A IE 2418/79A IE 241879 A IE241879 A IE 241879A IE 49234 B1 IE49234 B1 IE 49234B1
- Authority
- IE
- Ireland
- Prior art keywords
- hept
- bicyclo
- diaza
- compound
- formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 41
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 239000003814 drug Substances 0.000 title abstract description 5
- 229940124597 therapeutic agent Drugs 0.000 title abstract description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 6
- 230000009424 thromboembolic effect Effects 0.000 claims abstract description 6
- 206010020772 Hypertension Diseases 0.000 claims abstract description 5
- 238000011282 treatment Methods 0.000 claims abstract description 4
- -1 amino compound Chemical class 0.000 claims description 68
- 239000000203 mixture Substances 0.000 claims description 22
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000009472 formulation Methods 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000013078 crystal Substances 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000004458 analytical method Methods 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 238000004220 aggregation Methods 0.000 description 15
- 230000002776 aggregation Effects 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 210000001772 blood platelet Anatomy 0.000 description 13
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000005764 inhibitory process Effects 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 230000003276 anti-hypertensive effect Effects 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- YARZVGLNBOLGTP-UHFFFAOYSA-N 2-(4-aminophenyl)-3,4-diazabicyclo[4.1.0]hept-2-en-5-one Chemical compound C1=CC(N)=CC=C1C1=NNC(=O)C2C1C2 YARZVGLNBOLGTP-UHFFFAOYSA-N 0.000 description 7
- 102000008186 Collagen Human genes 0.000 description 7
- 108010035532 Collagen Proteins 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- 229920001436 collagen Polymers 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000008298 dragée Substances 0.000 description 6
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 6
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 6
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 5
- VQKLRVZQQYVIJW-UHFFFAOYSA-N dihydralazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=C1 VQKLRVZQQYVIJW-UHFFFAOYSA-N 0.000 description 5
- 229960002877 dihydralazine Drugs 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- 229960001138 acetylsalicylic acid Drugs 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 150000001413 amino acids Chemical class 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 208000035475 disorder Diseases 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 208000010513 Stupor Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000003931 anilides Chemical class 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- ZRMYHUFDVLRYPN-WSOKHJQSSA-N (1s,5r)-3-oxabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1OC(=O)[C@@H]2C[C@H]12 ZRMYHUFDVLRYPN-WSOKHJQSSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BBSJNSSPSCYJLF-UHFFFAOYSA-N 1-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1(Cl)CC1 BBSJNSSPSCYJLF-UHFFFAOYSA-N 0.000 description 2
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical class OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 2
- SKWKFLGOWJRSJK-UHFFFAOYSA-N 2,2-dichloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound ClC1(Cl)CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 SKWKFLGOWJRSJK-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- HKOFNJRSMKMTGH-UHFFFAOYSA-N 2-phenyl-3,4-diazabicyclo[4.1.0]hept-2-en-5-one Chemical compound C12CC2C(=O)NN=C1C1=CC=CC=C1 HKOFNJRSMKMTGH-UHFFFAOYSA-N 0.000 description 2
- CXXNLVYHLFPAJW-UHFFFAOYSA-N 3,4-diazabicyclo[4.1.0]hept-2-en-5-one Chemical compound O=C1NN=CC2CC12 CXXNLVYHLFPAJW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HXOUKQMDQCSFDW-UHFFFAOYSA-N bicyclo[4.1.0]hept-2-en-5-one Chemical compound O=C1CC=CC2CC12 HXOUKQMDQCSFDW-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011737 fluorine Chemical group 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- JHHZQADGLDKIPM-UHFFFAOYSA-N hept-3-en-2-one Chemical compound CCCC=CC(C)=O JHHZQADGLDKIPM-UHFFFAOYSA-N 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- ULULHWSQTRWPST-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1C1=NNC(=O)C2C1C2 ULULHWSQTRWPST-UHFFFAOYSA-N 0.000 description 2
- WSGLJMPGEWHZDJ-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropanecarboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1CC1 WSGLJMPGEWHZDJ-UHFFFAOYSA-N 0.000 description 2
- SIRJAQPRFJSIKX-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]formamide Chemical compound C1=CC(NC=O)=CC=C1C1=NNC(=O)C2C1C2 SIRJAQPRFJSIKX-UHFFFAOYSA-N 0.000 description 2
- MPKZWJNCWHWBGY-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CC)=CC=C1C1=NNC(=O)C2C1C2 MPKZWJNCWHWBGY-UHFFFAOYSA-N 0.000 description 2
- VIKNJXKGJWUCNN-XGXHKTLJSA-N norethisterone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 VIKNJXKGJWUCNN-XGXHKTLJSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 238000013222 sprague-dawley male rat Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000035488 systolic blood pressure Effects 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- 125000006426 1-chlorocyclopropyl group Chemical group [H]C1([H])C([H])([H])C1(Cl)* 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- CLHRGMHHCLQPFW-UHFFFAOYSA-N 1-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1(C)CC1 CLHRGMHHCLQPFW-UHFFFAOYSA-N 0.000 description 1
- GTDXPJJHRWOFDI-UHFFFAOYSA-N 1-methylcyclopropane-1-carbonyl chloride Chemical compound ClC(=O)C1(C)CC1 GTDXPJJHRWOFDI-UHFFFAOYSA-N 0.000 description 1
- CMFRINHLDIXCJX-UHFFFAOYSA-N 2,2,2-trifluoro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C(F)(F)F)=CC=C1C1=NNC(=O)C2C1C2 CMFRINHLDIXCJX-UHFFFAOYSA-N 0.000 description 1
- ZANROANQSDERGH-UHFFFAOYSA-N 2,2-difluoro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C(F)F)=CC=C1C1=NNC(=O)C2C1C2 ZANROANQSDERGH-UHFFFAOYSA-N 0.000 description 1
- KURKJXZWCPWPFX-UHFFFAOYSA-N 2,2-difluoroacetyl chloride Chemical compound FC(F)C(Cl)=O KURKJXZWCPWPFX-UHFFFAOYSA-N 0.000 description 1
- YYEVAXWKLUGSJO-UHFFFAOYSA-N 2,2-dimethyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound CC1(C)CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 YYEVAXWKLUGSJO-UHFFFAOYSA-N 0.000 description 1
- QQNQOWHUBGUGQI-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)CC1C(Cl)=O QQNQOWHUBGUGQI-UHFFFAOYSA-N 0.000 description 1
- SCFHHQYJOLMDKO-UHFFFAOYSA-N 2-(4-aminophenyl)-3,4-diazabicyclo[4.1.0]hept-2-en-5-one;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1C1=NNC(=O)C2C1C2 SCFHHQYJOLMDKO-UHFFFAOYSA-N 0.000 description 1
- OBTZDIRUQWFRFZ-UHFFFAOYSA-N 2-(5-methylfuran-2-yl)-n-(4-methylphenyl)quinoline-4-carboxamide Chemical compound O1C(C)=CC=C1C1=CC(C(=O)NC=2C=CC(C)=CC=2)=C(C=CC=C2)C2=N1 OBTZDIRUQWFRFZ-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- PHJYDQSVAJZXNQ-UHFFFAOYSA-N 2-bromo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]butanamide Chemical compound C1=CC(NC(=O)C(Br)CC)=CC=C1C1=NNC(=O)C2C1C2 PHJYDQSVAJZXNQ-UHFFFAOYSA-N 0.000 description 1
- QAUXKXVYCJUECX-UHFFFAOYSA-N 2-bromo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound BrC1CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 QAUXKXVYCJUECX-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- MQTWDYASJAYKIL-UHFFFAOYSA-N 2-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CCl)=CC=C1C1=NNC(=O)C2C1C2 MQTWDYASJAYKIL-UHFFFAOYSA-N 0.000 description 1
- UAPLCIWTLBXLSC-UHFFFAOYSA-N 2-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(Cl)C)=CC=C1C1=NNC(=O)C2C1C2 UAPLCIWTLBXLSC-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- FMLMPJGFFXJPSS-UHFFFAOYSA-N 2-fluoro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CF)=CC=C1C1=NNC(=O)C2C1C2 FMLMPJGFFXJPSS-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- LGYGLKHYBMRKHY-UHFFFAOYSA-N 2-iodo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)CI)=CC=C1C1=NNC(=O)C2C1C2 LGYGLKHYBMRKHY-UHFFFAOYSA-N 0.000 description 1
- IVVUZGRHJXLSCK-UHFFFAOYSA-N 2-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclobutane-1-carboxamide Chemical compound CC1CCC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 IVVUZGRHJXLSCK-UHFFFAOYSA-N 0.000 description 1
- UBQXHZLDCVCUPV-UHFFFAOYSA-N 2-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclopropane-1-carboxamide Chemical compound CC1CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 UBQXHZLDCVCUPV-UHFFFAOYSA-N 0.000 description 1
- VQWMWXOVWJLPQK-UHFFFAOYSA-N 2-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(C)C)=CC=C1C1=NNC(=O)C2C1C2 VQWMWXOVWJLPQK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- XRGMGBLABSDIKU-UHFFFAOYSA-N 3-bromo-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CCBr)=CC=C1C1=NNC(=O)C2C1C2 XRGMGBLABSDIKU-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- PIZIOUKNRXZMEM-UHFFFAOYSA-N 3-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclobutane-1-carboxamide Chemical compound C1C(Cl)CC1C(=O)NC1=CC=C(C=2C3CC3C(=O)NN=2)C=C1 PIZIOUKNRXZMEM-UHFFFAOYSA-N 0.000 description 1
- LFXNZAMYXNCGSE-UHFFFAOYSA-N 3-chloro-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CCCl)=CC=C1C1=NNC(=O)C2C1C2 LFXNZAMYXNCGSE-UHFFFAOYSA-N 0.000 description 1
- MSYYLDTUPRIJSX-UHFFFAOYSA-N 3-methyl-n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]butanamide Chemical compound C1=CC(NC(=O)CC(C)C)=CC=C1C1=NNC(=O)C2C1C2 MSYYLDTUPRIJSX-UHFFFAOYSA-N 0.000 description 1
- ZRMYHUFDVLRYPN-UHFFFAOYSA-N 3-oxabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1OC(=O)C2CC12 ZRMYHUFDVLRYPN-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical group OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- UCIWXHGABDMGPN-UHFFFAOYSA-N N12N=CCC(C2C1)=O Chemical compound N12N=CCC(C2C1)=O UCIWXHGABDMGPN-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940096529 carboxypolymethylene Drugs 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- RLWFMZKPPHHHCB-UHFFFAOYSA-N cyclopropane-1,2-dicarboxylate;hydron Chemical compound OC(=O)C1CC1C(O)=O RLWFMZKPPHHHCB-UHFFFAOYSA-N 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- VJGVELLBPBTDTK-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]butanamide Chemical compound C1=CC(NC(=O)CCC)=CC=C1C1=NNC(=O)C2C1C2 VJGVELLBPBTDTK-UHFFFAOYSA-N 0.000 description 1
- DGGVLXMHNRKPLL-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]cyclobutanecarboxamide Chemical compound C=1C=C(C=2C3CC3C(=O)NN=2)C=CC=1NC(=O)C1CCC1 DGGVLXMHNRKPLL-UHFFFAOYSA-N 0.000 description 1
- VPBMBAOZLXCLQE-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]pentanamide Chemical compound C1=CC(NC(=O)CCCC)=CC=C1C1=NNC(=O)C2C1C2 VPBMBAOZLXCLQE-UHFFFAOYSA-N 0.000 description 1
- LHDWHHARRUCYOH-UHFFFAOYSA-N n-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]prop-2-enamide Chemical compound C1=CC(NC(=O)C=C)=CC=C1C1=NNC(=O)C2C1C2 LHDWHHARRUCYOH-UHFFFAOYSA-N 0.000 description 1
- RJIXIHNBOCJFGR-UHFFFAOYSA-N n-[5-chloro-2-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]-2,2-difluoroacetamide Chemical compound FC(F)C(=O)NC1=CC(Cl)=CC=C1C1=NNC(=O)C2C1C2 RJIXIHNBOCJFGR-UHFFFAOYSA-N 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000079 pharmacotherapeutic effect Effects 0.000 description 1
- 238000005375 photometry Methods 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229940075065 polyvinyl acetate Drugs 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 235000010215 titanium dioxide Nutrition 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C62/00—Compounds having carboxyl groups bound to carbon atoms of rings other than six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C62/30—Unsaturated compounds
- C07C62/38—Unsaturated compounds containing keto groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782854475 DE2854475A1 (de) | 1978-12-16 | 1978-12-16 | Neue 3,4-diaza-bicyclo eckige klammer auf 4.1.0 eckige klammer zu hepten-(2)- one-(5), verfahren zu ihrer herstellung und diese verbindungen enthaltende therapeutische mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE792418L IE792418L (en) | 1980-06-16 |
| IE49234B1 true IE49234B1 (en) | 1985-09-04 |
Family
ID=6057438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2418/79A IE49234B1 (en) | 1978-12-16 | 1979-12-13 | Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compounds |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4271163A (enFirst) |
| EP (1) | EP0012366B1 (enFirst) |
| JP (1) | JPS5583758A (enFirst) |
| AT (1) | ATE6643T1 (enFirst) |
| CA (1) | CA1145749A (enFirst) |
| DE (2) | DE2854475A1 (enFirst) |
| DK (1) | DK149590C (enFirst) |
| HU (1) | HU182454B (enFirst) |
| IE (1) | IE49234B1 (enFirst) |
| ZA (1) | ZA796789B (enFirst) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3124699A1 (de) * | 1981-06-24 | 1983-01-13 | Basf Ag, 6700 Ludwigshafen | Neue 2-aryl-3,4-diaza-bicyclo(4.n.0.)alken-(2)-one-(5),verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3209159A1 (de) * | 1982-03-13 | 1983-09-15 | Basf Ag, 6700 Ludwigshafen | Neue 6-aryl-4,5-dihydro-3(2h)-pyridazinone, verfahren zu ihrer herstellung, diese verbindungen enthaltende therapeutische mittel und deren verwendung |
| DE3302021A1 (de) * | 1983-01-22 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | 6-aryl-4,5-dihydro-3(2h)-pyridazinone, ihre herstellung und verwendung |
| JP3442815B2 (ja) * | 1992-05-13 | 2003-09-02 | 第一製薬株式会社 | ジアザビシクロアルケン誘導体 |
| HRP950558A2 (en) * | 1994-11-15 | 1997-12-31 | Scott M. Wilhelm | Substituted 4-biarylbutric or biarylpentanoic acids and derivatives as matrix metalloprotease inhibitors |
| US5789434A (en) * | 1994-11-15 | 1998-08-04 | Bayer Corporation | Derivatives of substituted 4-biarylbutyric acid as matrix metalloprotease inhibitors |
| US5886022A (en) * | 1995-06-05 | 1999-03-23 | Bayer Corporation | Substituted cycloalkanecarboxylic acid derivatives as matrix metalloprotease inhibitors |
| WO2020157199A1 (en) | 2019-02-01 | 2020-08-06 | Bayer Aktiengesellschaft | Annulated dihydropyridazinone compounds as anti-cancer compounds |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3822260A (en) * | 1970-10-09 | 1974-07-02 | American Cyanamid Co | 6-(cyanophenyl)-4,5-dihydro-3(2h)-pyridazinones |
| IL37788A0 (en) | 1970-10-09 | 1971-12-29 | American Cyanamid Co | New pyridazinone compounds,their preparation and pharmaceutical compositions containing them |
| US3689652A (en) * | 1970-10-09 | 1972-09-05 | William Vincent Curran | Method of lowering blood pressure in mammals |
| FR2110329A1 (en) * | 1970-10-09 | 1972-06-02 | American Cyanamid Co | 6-phenyl-pyridazin-3-one derivs - hypotensives |
| US3975388A (en) * | 1971-02-22 | 1976-08-17 | Bdh Pharmaceuticals Limited | Pyridazinones |
| US4088762A (en) * | 1971-02-22 | 1978-05-09 | Bdh Pharmaceuticals Limited | 6-(P-PIPERAZINO)-PHENYL-4,5-DIHYDRO-3(2H)pyridazinones |
| GB1383906A (en) | 1971-02-22 | 1974-02-12 | Bdh Pharmaceuticals Ltd | Pyridazinones |
| US3746712A (en) * | 1971-06-08 | 1973-07-17 | A Ross | 6-(substituted-phenyl)-5-methyl-4,5-dihydro-3(2h)-pyridazinones |
| US3812256A (en) * | 1971-06-08 | 1974-05-21 | American Cyanamid Co | Novel method for lowering blood pressure in mammals |
| JPS5221616B2 (enFirst) * | 1974-01-09 | 1977-06-11 | ||
| DE2727481A1 (de) * | 1977-06-18 | 1979-01-11 | Basf Ag | Dihydropyridazone und dihydropyridazone enthaltende therapeutische mittel |
-
1978
- 1978-12-16 DE DE19782854475 patent/DE2854475A1/de not_active Withdrawn
-
1979
- 1979-11-30 US US06/098,854 patent/US4271163A/en not_active Expired - Lifetime
- 1979-12-06 DE DE7979104956T patent/DE2966809D1/de not_active Expired
- 1979-12-06 AT AT79104956T patent/ATE6643T1/de not_active IP Right Cessation
- 1979-12-06 EP EP79104956A patent/EP0012366B1/de not_active Expired
- 1979-12-12 CA CA000341754A patent/CA1145749A/en not_active Expired
- 1979-12-13 IE IE2418/79A patent/IE49234B1/en unknown
- 1979-12-14 HU HU79BA3905A patent/HU182454B/hu unknown
- 1979-12-14 DK DK532679A patent/DK149590C/da active
- 1979-12-14 ZA ZA00796789A patent/ZA796789B/xx unknown
- 1979-12-17 JP JP16290679A patent/JPS5583758A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2854475A1 (de) | 1980-07-03 |
| ZA796789B (en) | 1980-12-31 |
| DK532679A (da) | 1980-06-17 |
| JPS5583758A (en) | 1980-06-24 |
| DK149590C (da) | 1987-02-09 |
| JPS6328911B2 (enFirst) | 1988-06-10 |
| IE792418L (en) | 1980-06-16 |
| DE2966809D1 (en) | 1984-04-19 |
| EP0012366A1 (de) | 1980-06-25 |
| HU182454B (en) | 1984-01-30 |
| EP0012366B1 (de) | 1984-03-14 |
| US4271163A (en) | 1981-06-02 |
| DK149590B (da) | 1986-08-04 |
| CA1145749A (en) | 1983-05-03 |
| ATE6643T1 (de) | 1984-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4376771A (en) | 6-(p-Acylaminophenyl)-4,5-dihydropyridaz-3-ones and therapeutic agents containing said compounds | |
| RU2114113C1 (ru) | Пиразолопиримидиноны, фармацевтическая композиция и способ ингибирования фосфодиэстеразы циклического гуанозин-3',5'-монофосфата | |
| AU2008281545A1 (en) | Substituted bicyclolactam compounds | |
| NZ213130A (en) | Bicyclic compounds with two common nitrogen atoms; pharmaceutical composition | |
| FI73425B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 2-aryl-3,4-diaza-bicyklo/4.n.0/alken-(2)-on-(5)- derivat. | |
| IE49234B1 (en) | Novel 3,4-diaza-bicyclo(4.1.0)hept-2-en-5-ones,their preparation and therapeutic agents containing these compounds | |
| AU611610B2 (en) | Pyridazinone derivatives | |
| FR2678618A1 (fr) | Nouveaux derives de triazolo pyrimidine antagonistes des recepteurs a l'angiotensine ii; leurs procedes de preparation, compositions pharmaceutiques les contenant. | |
| HU180159B (en) | Process for producing triazolo-pyridazine derivatives | |
| HU190573B (en) | Process for producing new beta-carboline derivatives and pharmaceutical compositions cintaining them | |
| GB1579499A (en) | 1-(2-acylaminophenyl) imidazoles | |
| GB2267089A (en) | Cycloheptimidazole derivatives | |
| US4937241A (en) | N-substituted N-nitrosoaminoacetonitriles, process for their preparation and their use | |
| US4376121A (en) | Antiallerigically-active imidazothienopyrimidine derivatives | |
| US4410529A (en) | Novel dihydropyridazinones, their preparation and therapeutic agents containing these compounds | |
| CA1149811A (en) | Indole and indoline derivatives | |
| AU598927B2 (en) | Benzenesulfonamide derivatives and a process for the preparation thereof | |
| Taylor et al. | Efficient synthesis of 5‐substituted‐4, 5‐dihydro‐1, 2, 4‐triazin‐6‐ones and 5‐substituted‐1, 2, 4‐triazin‐6‐ones | |
| US4504669A (en) | 1,2-Benzisoxazoloxyethylamines and intermediates for the preparation thereof | |
| US3761487A (en) | Hydrazines of pyrazolopyridine carboxylic acids and esters | |
| US5003068A (en) | Pyridazinone manufacture | |
| JPS5933261A (ja) | 3a−(置換−フエニル)−3a,4,7,7a−テトラヒドロ−4,7−メタノイソインドリン類およびそれらの製造法 | |
| US3755312A (en) | 6-substituted-1, 2,4-pyrimido{8 4,5-e{9 thiadiazine-1,1-dioxides | |
| HU181114B (en) | Process for producing substituted pyrrolidinyl-benzoic acid derivatives | |
| US4286091A (en) | Synthesis of pyridazinone pharmaceutical intermediates using diketene reactant |