IE44478B1 - Internal protective coating for incandescent lamps - Google Patents
Internal protective coating for incandescent lampsInfo
- Publication number
- IE44478B1 IE44478B1 IE5277A IE5277A IE44478B1 IE 44478 B1 IE44478 B1 IE 44478B1 IE 5277 A IE5277 A IE 5277A IE 5277 A IE5277 A IE 5277A IE 44478 B1 IE44478 B1 IE 44478B1
- Authority
- IE
- Ireland
- Prior art keywords
- coating
- lamp
- halogen
- oxide
- envelope
- Prior art date
Links
- 239000011253 protective coating Substances 0.000 title claims abstract description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 46
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims abstract description 38
- 238000000576 coating method Methods 0.000 claims abstract description 37
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 35
- 239000011248 coating agent Substances 0.000 claims abstract description 30
- 150000002367 halogens Chemical class 0.000 claims abstract description 25
- 229910052751 metal Inorganic materials 0.000 claims abstract description 14
- 239000002184 metal Substances 0.000 claims abstract description 14
- 150000004820 halides Chemical class 0.000 claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 6
- 229910044991 metal oxide Inorganic materials 0.000 claims abstract description 6
- 150000004706 metal oxides Chemical class 0.000 claims abstract description 6
- 239000003495 polar organic solvent Substances 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 3
- 150000002736 metal compounds Chemical class 0.000 claims description 3
- 230000001681 protective effect Effects 0.000 claims description 3
- 239000004411 aluminium Substances 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 claims 1
- 229940125773 compound 10 Drugs 0.000 claims 1
- 229940126543 compound 14 Drugs 0.000 claims 1
- 229960002069 diamorphine Drugs 0.000 claims 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 claims 1
- 239000000463 material Substances 0.000 abstract description 12
- 150000002739 metals Chemical class 0.000 abstract description 6
- 229910052747 lanthanoid Inorganic materials 0.000 abstract description 2
- 150000002602 lanthanoids Chemical class 0.000 abstract description 2
- 229910052723 transition metal Inorganic materials 0.000 abstract description 2
- 150000003624 transition metals Chemical class 0.000 abstract description 2
- 238000011065 in-situ storage Methods 0.000 abstract 1
- 229910052721 tungsten Inorganic materials 0.000 description 17
- 239000010937 tungsten Substances 0.000 description 17
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 239000010410 layer Substances 0.000 description 11
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 9
- 229910052731 fluorine Inorganic materials 0.000 description 9
- 239000011737 fluorine Substances 0.000 description 9
- 239000011521 glass Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000005350 fused silica glass Substances 0.000 description 6
- 239000007789 gas Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000008199 coating composition Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- ZKIHCVGCBDREBT-UHFFFAOYSA-N [F].[W] Chemical compound [F].[W] ZKIHCVGCBDREBT-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- HUAUNKAZQWMVFY-UHFFFAOYSA-M sodium;oxocalcium;hydroxide Chemical compound [OH-].[Na+].[Ca]=O HUAUNKAZQWMVFY-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- -1 tungsten halide Chemical class 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-K Arsenate3- Chemical class [O-][As]([O-])([O-])=O DJHGAFSJWGLOIV-UHFFFAOYSA-K 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 241000272470 Circus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 150000001399 aluminium compounds Chemical class 0.000 description 1
- 239000005354 aluminosilicate glass Substances 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- VYLVYHXQOHJDJL-UHFFFAOYSA-K cerium trichloride Chemical compound Cl[Ce](Cl)Cl VYLVYHXQOHJDJL-UHFFFAOYSA-K 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 238000004890 malting Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910001463 metal phosphate Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 239000003870 refractory metal Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- XRXPBLNWIMLYNO-UHFFFAOYSA-J tetrafluorotungsten Chemical class F[W](F)(F)F XRXPBLNWIMLYNO-UHFFFAOYSA-J 0.000 description 1
- MMCXETIAXNXKPE-UHFFFAOYSA-J tetraiodotungsten Chemical class I[W](I)(I)I MMCXETIAXNXKPE-UHFFFAOYSA-J 0.000 description 1
- NXHILIPIEUBEPD-UHFFFAOYSA-H tungsten hexafluoride Chemical compound F[W](F)(F)(F)(F)F NXHILIPIEUBEPD-UHFFFAOYSA-H 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/28—Envelopes; Vessels
- H01K1/32—Envelopes; Vessels provided with coatings on the walls; Vessels or coatings thereon characterised by the material thereof
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Glass Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB104576A GB1571194A (en) | 1976-01-12 | 1976-01-12 | Internal protective coating for incandescent lamps |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE44478L IE44478L (en) | 1977-07-12 |
| IE44478B1 true IE44478B1 (en) | 1981-12-16 |
Family
ID=9715212
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE5277A IE44478B1 (en) | 1976-01-12 | 1977-01-12 | Internal protective coating for incandescent lamps |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS52101881A (enExample) |
| AU (1) | AU507484B2 (enExample) |
| BE (1) | BE850296A (enExample) |
| CA (1) | CA1097991A (enExample) |
| DE (1) | DE2701051A1 (enExample) |
| DK (1) | DK11577A (enExample) |
| FR (1) | FR2337939A1 (enExample) |
| GB (1) | GB1571194A (enExample) |
| IE (1) | IE44478B1 (enExample) |
| IT (1) | IT1075605B (enExample) |
| LU (1) | LU76555A1 (enExample) |
| NL (1) | NL185881C (enExample) |
| SE (1) | SE437743B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD143980A1 (de) * | 1979-07-13 | 1980-09-17 | Hasso Meinert | Gluehlampe mit einem fluor-kreisprozess |
| DE3139294A1 (de) * | 1981-10-02 | 1983-04-21 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Halogengluehlampe und verfahren zum schutz ihrer innenoberflaeche |
| JPS5958753A (ja) * | 1982-09-28 | 1984-04-04 | 株式会社東芝 | 白熱電球 |
| GB8428881D0 (en) * | 1984-11-15 | 1984-12-27 | Atomic Energy Authority Uk | Light scattering coatings |
| DE102008061776A1 (de) | 2008-12-11 | 2010-06-17 | Osram Gesellschaft mit beschränkter Haftung | Halogenglühlampe |
| DE102010042557A1 (de) | 2009-10-21 | 2011-04-28 | Osram Gesellschaft mit beschränkter Haftung | Halogenglühlampe |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT175628B (de) * | 1950-07-12 | 1953-07-25 | Egyesuelt Izzolampa | Glühlampe und Verfahren zu deren Herstellung |
| FR1139217A (fr) * | 1954-02-26 | 1957-06-26 | Philips Nv | Lampe à incandescence |
| FR1375567A (fr) * | 1963-11-27 | 1964-10-16 | Philips Nv | Lampe à incandescence à atmosphère gazeuse |
| DE1241531B (de) * | 1964-03-12 | 1967-06-01 | Philips Nv | Gluehlampe mit einem durch ein Hochfrequenzfeld erhitzbaren Gluehkoerper |
| HU162781B (enExample) * | 1971-12-22 | 1973-04-28 |
-
1976
- 1976-01-12 GB GB104576A patent/GB1571194A/en not_active Expired
-
1977
- 1977-01-07 NL NL7700150A patent/NL185881C/xx not_active IP Right Cessation
- 1977-01-11 IT IT1916677A patent/IT1075605B/it active
- 1977-01-11 CA CA269,431A patent/CA1097991A/en not_active Expired
- 1977-01-12 IE IE5277A patent/IE44478B1/en unknown
- 1977-01-12 SE SE7700252A patent/SE437743B/xx not_active IP Right Cessation
- 1977-01-12 DE DE19772701051 patent/DE2701051A1/de active Granted
- 1977-01-12 BE BE174002A patent/BE850296A/xx not_active IP Right Cessation
- 1977-01-12 AU AU21269/77A patent/AU507484B2/en not_active Expired
- 1977-01-12 LU LU76555A patent/LU76555A1/xx unknown
- 1977-01-12 JP JP281177A patent/JPS52101881A/ja active Pending
- 1977-01-12 FR FR7700792A patent/FR2337939A1/fr active Granted
- 1977-01-12 DK DK11577A patent/DK11577A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1571194A (en) | 1980-07-09 |
| FR2337939A1 (fr) | 1977-08-05 |
| DK11577A (da) | 1977-07-13 |
| IE44478L (en) | 1977-07-12 |
| IT1075605B (it) | 1985-04-22 |
| LU76555A1 (enExample) | 1977-06-17 |
| BE850296A (fr) | 1977-07-12 |
| JPS52101881A (en) | 1977-08-26 |
| SE437743B (sv) | 1985-03-11 |
| FR2337939B1 (enExample) | 1980-09-05 |
| CA1097991A (en) | 1981-03-24 |
| AU507484B2 (en) | 1980-02-14 |
| NL185881C (nl) | 1990-08-01 |
| SE7700252L (sv) | 1977-07-13 |
| NL185881B (nl) | 1990-03-01 |
| AU2126977A (en) | 1978-07-20 |
| NL7700150A (nl) | 1977-07-14 |
| DE2701051C2 (enExample) | 1988-08-11 |
| DE2701051A1 (de) | 1977-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4256988A (en) | Incandescent halogen lamp with protective envelope coating | |
| US4047067A (en) | Sodium halide discharge lamp with an alumina silicate barrier zone in fused silica envelope | |
| US3521110A (en) | Mercury-metallic halide vapor lamp with regenerative cycle | |
| KR0130879B1 (ko) | 할고겐화 금속 아크 방전램프용 금속 실리 케이트 보호코팅 | |
| US5473226A (en) | Incandescent lamp having hardglass envelope with internal barrier layer | |
| GB2045741A (en) | High-pressure discharge lamps having improved lead- through foils | |
| IE44478B1 (en) | Internal protective coating for incandescent lamps | |
| US3712701A (en) | Electric incandescent lamps | |
| US3984590A (en) | Electric discharge lamp | |
| US3902091A (en) | Incandescent lamp | |
| US4024425A (en) | Metal halide lamps | |
| US3538373A (en) | Electric incandescent lamp containing a reactive carrier gas which comprises hydrogen and bromine and/or chlorine and hydrogen | |
| US3982046A (en) | Incandescent lamps | |
| US3821585A (en) | Tungsten halogen incandescent lamp with group iva metal getter and method of manufacture | |
| US3263113A (en) | Tungsten filament lamp comprising hexafluoride gas at partial pressure not exceeding 10 torrs | |
| US3412277A (en) | Incandescent lamp with addition of fluorine compounds to the operating gas filling | |
| US4225635A (en) | Method for applying reacted boron oxide layer to vitreous silica substrate | |
| US4508991A (en) | Halogen cycle incandescent lamp and method for the protection of its inner surface | |
| US7965043B2 (en) | Inner coating of lamp vessels, such as discharge vessels of gas discharge lamps | |
| Coaton et al. | Tungsten-halogen lamps and regenerative mechanisms | |
| US3006783A (en) | Method of applying light-diffusing layers to glass surfaces and glass objects | |
| USRE30165E (en) | Electric discharge lamp | |
| Fitzpatrick et al. | Progress towards a practical fluorine lamp | |
| WO1999016100A1 (en) | Electroded selenium lamp | |
| US4629935A (en) | Tungsten-halogen lamp with organic and inorganic getters |