IE41657B1 - New cephalospirin esters - Google Patents
New cephalospirin estersInfo
- Publication number
- IE41657B1 IE41657B1 IE1885/75A IE188575A IE41657B1 IE 41657 B1 IE41657 B1 IE 41657B1 IE 1885/75 A IE1885/75 A IE 1885/75A IE 188575 A IE188575 A IE 188575A IE 41657 B1 IE41657 B1 IE 41657B1
- Authority
- IE
- Ireland
- Prior art keywords
- ester
- oxide
- methyl
- cephem
- acid
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title claims abstract description 17
- -1 Cephalosporin esters Chemical class 0.000 claims abstract description 38
- 239000002253 acid Substances 0.000 claims abstract description 20
- 150000001875 compounds Chemical class 0.000 claims abstract description 20
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 239000003054 catalyst Substances 0.000 claims abstract description 8
- 229930182555 Penicillin Natural products 0.000 claims abstract description 6
- 229940049954 penicillin Drugs 0.000 claims abstract description 6
- 150000003839 salts Chemical class 0.000 claims abstract description 5
- 239000012442 inert solvent Substances 0.000 claims abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract 3
- CIPQGGYPCPIDBB-WPZCJLIBSA-N (6r)-3-methyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(O)=O)NC(=O)CC1=CC=CC=C1 CIPQGGYPCPIDBB-WPZCJLIBSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 2
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 6
- RKPYPVYWRWYHKC-WPZCJLIBSA-N (6r)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(O)=O)NC(=O)COC1=CC=CC=C1 RKPYPVYWRWYHKC-WPZCJLIBSA-N 0.000 claims 2
- DBLJWHPZEGMNDK-AFYYWNPRSA-N (6R)-3-methyl-8-oxo-4-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O(C1=CC=CC=C1)CC(=O)NC1S[C@H]2N(C(=C1C)C(=O)O)C(C2)=O DBLJWHPZEGMNDK-AFYYWNPRSA-N 0.000 claims 1
- 101100440696 Caenorhabditis elegans cor-1 gene Proteins 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 abstract description 4
- 229930186147 Cephalosporin Natural products 0.000 abstract description 3
- 150000007513 acids Chemical class 0.000 abstract description 3
- 229940124587 cephalosporin Drugs 0.000 abstract description 3
- 238000010438 heat treatment Methods 0.000 abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 abstract description 3
- 125000004442 acylamino group Chemical group 0.000 abstract 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 1
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 abstract 1
- 230000003647 oxidation Effects 0.000 abstract 1
- 238000007254 oxidation reaction Methods 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 125000004185 ester group Chemical group 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WEGADVTVSCOIGB-GBKBLRGTSA-N (5r)-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C1([C@H]2S(=O)CC(N2C1=O)C(=O)O)NC(=O)CC1=CC=CC=C1 WEGADVTVSCOIGB-GBKBLRGTSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 101100496169 Arabidopsis thaliana CLH1 gene Proteins 0.000 description 3
- 101100044057 Mesocricetus auratus SYCP3 gene Proteins 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 101100080600 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nse6 gene Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 101150111293 cor-1 gene Proteins 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- ROFVJSWBDQUQGW-UHFFFAOYSA-N piperidin-1-ium;bromide Chemical compound Br.C1CCNCC1 ROFVJSWBDQUQGW-UHFFFAOYSA-N 0.000 description 3
- 150000003222 pyridines Chemical class 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- XJRIDJAGAYGJCK-UHFFFAOYSA-N (1-acetyl-5-bromoindol-3-yl) acetate Chemical compound C1=C(Br)C=C2C(OC(=O)C)=CN(C(C)=O)C2=C1 XJRIDJAGAYGJCK-UHFFFAOYSA-N 0.000 description 2
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000001782 cephems Chemical group 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- IXTGXVWLIBNABC-UHFFFAOYSA-N dichloromethylphosphonic acid Chemical compound OP(O)(=O)C(Cl)Cl IXTGXVWLIBNABC-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- FGOGYEIAIATJMV-UHFFFAOYSA-N pyridine;2,2,2-trichloroethyl dihydrogen phosphate Chemical compound C1=CC=NC=C1.OP(O)(=O)OCC(Cl)(Cl)Cl FGOGYEIAIATJMV-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- CGOUSCKQZBRNIC-RDGDPYORSA-N (5r)-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C1([C@H]2S(=O)CC(N2C1=O)C(=O)O)NC(=O)COC1=CC=CC=C1 CGOUSCKQZBRNIC-RDGDPYORSA-N 0.000 description 1
- PHIMLNXVWFHTLQ-MYXBAGLQSA-N (6r)-3-methyl-5,8-dioxo-7-[(2-phenylacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2=O)C)C(O)=O)NC(=O)CC1=CC=CC=C1 PHIMLNXVWFHTLQ-MYXBAGLQSA-N 0.000 description 1
- NQNQSDYQPRGBSF-YOXFSPIKSA-N (6r)-4-acetamido-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=C(C)C(NC(=O)C)S[C@@H]2CC(=O)N21 NQNQSDYQPRGBSF-YOXFSPIKSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- YYQRGCZGSFRBAM-UHFFFAOYSA-N Triclofos Chemical compound OP(O)(=O)OCC(Cl)(Cl)Cl YYQRGCZGSFRBAM-UHFFFAOYSA-N 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- WNJHCCYBBGRYAE-UHFFFAOYSA-N dichloromethylphosphonic acid;pyridine Chemical compound C1=CC=NC=C1.OP(O)(=O)C(Cl)Cl WNJHCCYBBGRYAE-UHFFFAOYSA-N 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 1
- SFRFZSKYWXWLNI-UHFFFAOYSA-N phenyl dihydrogen phosphate;pyridine Chemical compound C1=CC=NC=C1.OP(O)(=O)OC1=CC=CC=C1 SFRFZSKYWXWLNI-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- HOJLDGRYURJOJS-UHFFFAOYSA-N phosphoric acid;pyridine Chemical compound OP(O)(O)=O.C1=CC=NC=C1 HOJLDGRYURJOJS-UHFFFAOYSA-N 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- NWEPJDPAVFDLBY-UHFFFAOYSA-N trichloromethylphosphonic acid Chemical compound OP(O)(=O)C(Cl)(Cl)Cl NWEPJDPAVFDLBY-UHFFFAOYSA-N 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9958174A JPS5126895A (en) | 1974-08-29 | 1974-08-29 | Fukusokankarubonsan no seizoho |
| JP4544775A JPS51122085A (en) | 1975-04-14 | 1975-04-14 | Method for preparing heterocyclic carboxylic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41657L IE41657L (en) | 1976-02-29 |
| IE41657B1 true IE41657B1 (en) | 1980-02-27 |
Family
ID=26385435
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1885/75A IE41657B1 (en) | 1974-08-29 | 1975-08-28 | New cephalospirin esters |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4022773A (enExample) |
| CA (1) | CA1061779A (enExample) |
| CH (1) | CH617203A5 (enExample) |
| DE (1) | DE2538387A1 (enExample) |
| FR (1) | FR2283141A1 (enExample) |
| GB (1) | GB1512660A (enExample) |
| IE (1) | IE41657B1 (enExample) |
| NL (1) | NL7510247A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4175185A (en) * | 1976-05-19 | 1979-11-20 | Meiji Seika Kaisha Ltd. | Process for preparing cephalosporanic acid derivatives |
| GB1577725A (en) * | 1976-06-30 | 1980-10-29 | Beecham Group Ltd | Azetidinone derivatives |
| US4123547A (en) * | 1977-08-04 | 1978-10-31 | Merck & Co., Inc. | Thienamycin sulfoxide and sulphone |
| US4150145A (en) * | 1977-09-15 | 1979-04-17 | Merck & Co., Inc. | N-alkylated derivatives of thienamycin sulfoxide and sulfone |
| US4232030A (en) * | 1977-09-15 | 1980-11-04 | Merck & Co., Inc. | Substituted N-methylene derivatives of thienamycin sulfoxide and sulfone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| YU35448B (en) * | 1970-02-18 | 1981-02-28 | Koninkl Gist Spiritus | Process for obtaining 7-substituted amino-deacetoxy cephalosporanic acids |
| US3879398A (en) * | 1970-03-10 | 1975-04-22 | Glaxo Lab Ltd | Salts of a monophosphonic acid and a monoamine |
| US3856785A (en) * | 1972-07-24 | 1974-12-24 | Squibb & Sons Inc | Cephalosporin esters |
-
1975
- 1975-08-25 US US05/607,363 patent/US4022773A/en not_active Expired - Lifetime
- 1975-08-25 CA CA234,036A patent/CA1061779A/en not_active Expired
- 1975-08-27 FR FR7526397A patent/FR2283141A1/fr active Granted
- 1975-08-28 GB GB35520/75A patent/GB1512660A/en not_active Expired
- 1975-08-28 CH CH1115875A patent/CH617203A5/de not_active IP Right Cessation
- 1975-08-28 IE IE1885/75A patent/IE41657B1/en unknown
- 1975-08-28 DE DE19752538387 patent/DE2538387A1/de not_active Ceased
- 1975-08-29 NL NL7510247A patent/NL7510247A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CH617203A5 (enExample) | 1980-05-14 |
| NL7510247A (nl) | 1976-03-02 |
| IE41657L (en) | 1976-02-29 |
| DE2538387A1 (de) | 1976-03-11 |
| CA1061779A (en) | 1979-09-04 |
| GB1512660A (en) | 1978-06-01 |
| US4022773A (en) | 1977-05-10 |
| FR2283141B1 (enExample) | 1979-03-16 |
| FR2283141A1 (fr) | 1976-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO159019B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive 6beta-hydroksyalkylpenicillansyrederivater. | |
| DE2258221C2 (de) | Verfahren zur Herstellung von Penicillinen und Cepholosporinen mit einem weiteren Substituenten in 6- bzw. 7-Stellung | |
| DE2258278A1 (de) | Verfahren zur herstellung substituierter cephalosporine | |
| DE2065236A1 (enExample) | ||
| US3780034A (en) | Process for preparing substituted cephalosporins | |
| US3875146A (en) | Process to prepare intermediates for the preparation of cephalosporins and penicillins | |
| US3544581A (en) | Production of 6-amino-penicillanic acid sulfoxide | |
| DE2222953A1 (de) | Verfahren zur herstellung antibakterieller mittel | |
| US3632578A (en) | Cleavage of acylamidocephalosporins and acylamidopenicillins | |
| US3780033A (en) | Process for preparing cephalosporin compounds | |
| IE41657B1 (en) | New cephalospirin esters | |
| US3852281A (en) | Process for the preparation of 7-substituted amino-desacetoxycephalosporanic acid compounds | |
| US3998817A (en) | Process for producing cephalosporanic acid derivatives | |
| DE2534926A1 (de) | Sauerstoffanaloge von cephalosporinen | |
| IE50650B1 (en) | Method for producing penicillanic acid derivatives | |
| US5229509A (en) | Process for the preparation of 3-chloro-cefem compounds | |
| CS203983B2 (en) | Method of preparing ester of 7-acylamido-3-methyl-3-cephem-4-carboxylic acid | |
| US4183850A (en) | Process for preparing 2-acyloxymethylpenams and 3-acyloxycephams | |
| US3878198A (en) | {62 -Ketoacyl derivatives of 6-aminopenicillanic acid and process thereof | |
| US3962226A (en) | 3-nitrooxycepham compounds and process for preparing desacetoxycephalosporins therefrom | |
| PL85296B1 (en) | Production of antibacterial agents[gb1314758a] | |
| DE2337105A1 (de) | Antibiotika und verfahren zu ihrer herstellung | |
| CA1056816A (en) | Process for the conversion of 6-aminopenicillanic acid (6-apa) in 7-aminodesacetoxycephalosporanic acid (7-adca) | |
| US4046759A (en) | Penicillin esters | |
| US3873519A (en) | Preparation of esters of penicillanic acids |