IE40385B1 - Piperazinyl esters of n-quinolylanthranilic acid - Google Patents
Piperazinyl esters of n-quinolylanthranilic acidInfo
- Publication number
- IE40385B1 IE40385B1 IE1002/74A IE100274A IE40385B1 IE 40385 B1 IE40385 B1 IE 40385B1 IE 1002/74 A IE1002/74 A IE 1002/74A IE 100274 A IE100274 A IE 100274A IE 40385 B1 IE40385 B1 IE 40385B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- formula
- acid
- piperazinyl
- esters
- Prior art date
Links
- 239000002253 acid Substances 0.000 title abstract 3
- 125000004193 piperazinyl group Chemical group 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- 125000005843 halogen group Chemical group 0.000 abstract 2
- ALXBXKJAVGIBDQ-UHFFFAOYSA-N 2-(quinolin-2-ylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=C(C=CC=C2)C2=N1 ALXBXKJAVGIBDQ-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 230000000202 analgesic effect Effects 0.000 abstract 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 231100000252 nontoxic Toxicity 0.000 abstract 1
- 230000003000 nontoxic effect Effects 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 abstract 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
- C07D215/44—Nitrogen atoms attached in position 4 with aryl radicals attached to said nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7317069A FR2228482B1 (enExample) | 1973-05-11 | 1973-05-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE40385L IE40385L (en) | 1974-11-11 |
| IE40385B1 true IE40385B1 (en) | 1979-05-23 |
Family
ID=9119165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1002/74A IE40385B1 (en) | 1973-05-11 | 1974-05-10 | Piperazinyl esters of n-quinolylanthranilic acid |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5014688A (enExample) |
| AU (1) | AU6876774A (enExample) |
| BE (1) | BE814792A (enExample) |
| CA (1) | CA1106376A (enExample) |
| CH (1) | CH585225A5 (enExample) |
| DE (1) | DE2422848A1 (enExample) |
| ES (1) | ES425974A1 (enExample) |
| FR (1) | FR2228482B1 (enExample) |
| GB (1) | GB1472652A (enExample) |
| IE (1) | IE40385B1 (enExample) |
| IL (1) | IL44708A0 (enExample) |
| LU (1) | LU70024A1 (enExample) |
| NL (1) | NL7406229A (enExample) |
| ZA (1) | ZA742658B (enExample) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR7870M (enExample) * | 1968-11-08 | 1970-04-27 | ||
| BE754587A (fr) * | 1969-08-08 | 1971-02-08 | Upjohn Co | Nouveaux p-(trihalomethylquinolylamino) benzamides et leur procede de preparation |
| BE785973A (fr) * | 1971-07-09 | 1973-01-08 | Roussel Uclaf | Nouvelles 4-amino quinoleines et procede de preparation |
-
1973
- 1973-05-11 FR FR7317069A patent/FR2228482B1/fr not_active Expired
-
1974
- 1974-04-24 IL IL44708A patent/IL44708A0/xx unknown
- 1974-04-26 ZA ZA00742658A patent/ZA742658B/xx unknown
- 1974-05-02 JP JP49048850A patent/JPS5014688A/ja active Pending
- 1974-05-04 ES ES425974A patent/ES425974A1/es not_active Expired
- 1974-05-08 CA CA199,329A patent/CA1106376A/fr not_active Expired
- 1974-05-09 NL NL7406229A patent/NL7406229A/xx not_active Application Discontinuation
- 1974-05-09 AU AU68767/74A patent/AU6876774A/en not_active Expired
- 1974-05-09 BE BE144130A patent/BE814792A/xx unknown
- 1974-05-09 LU LU70024A patent/LU70024A1/xx unknown
- 1974-05-10 DE DE2422848A patent/DE2422848A1/de not_active Ceased
- 1974-05-10 CH CH646174A patent/CH585225A5/xx not_active IP Right Cessation
- 1974-05-10 IE IE1002/74A patent/IE40385B1/xx unknown
- 1974-05-13 GB GB2109074A patent/GB1472652A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2422848A1 (de) | 1974-11-28 |
| CH585225A5 (enExample) | 1977-02-28 |
| IE40385L (en) | 1974-11-11 |
| FR2228482B1 (enExample) | 1976-05-14 |
| ZA742658B (en) | 1975-05-28 |
| AU6876774A (en) | 1975-11-13 |
| IL44708A0 (en) | 1974-06-30 |
| ES425974A1 (es) | 1976-07-01 |
| CA1106376A (fr) | 1981-08-04 |
| JPS5014688A (enExample) | 1975-02-15 |
| BE814792A (fr) | 1974-11-12 |
| GB1472652A (en) | 1977-05-04 |
| NL7406229A (enExample) | 1974-11-13 |
| FR2228482A1 (enExample) | 1974-12-06 |
| LU70024A1 (enExample) | 1974-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1419608A (en) | Aroyl-substituted naphthaleneacetic acids and their derivatives | |
| GB1313689A (en) | Quinoxaline derivatives | |
| GB1514870A (en) | Imidazolyloxime ethers having antimycotic and bactericidal activity | |
| GB1488692A (en) | Pyrazolo(3,4,6)quinolines | |
| US4028370A (en) | Novel pyrazolo [1,5-a]pyridines | |
| US4097483A (en) | Pyrazolo 1,5-a!pyridines | |
| IE36116B1 (en) | Furylmethyl morphinane derivatives and pharmaceutical compositions containing them | |
| IL33846A (en) | Derivatives of 1-thiachromone and 4-thionchromone,their preparation and pharmaceutical compositions containing them | |
| IE32844B1 (en) | Hydrazino-benzocinnoline and benzocycloheptapyridazine derivatives and pharmaceutical compositions containing them | |
| GB1374520A (en) | Substituted carboxylic acids processes for their preparation and compositions incorporating them | |
| GB1384035A (en) | Amino alkyl esters of 2-anilino nicotinic acid and their preparation | |
| GB1469006A (en) | 2-phenylhydrazinothiazolines or-thiazines and a process for the preparation thereof | |
| IE40385B1 (en) | Piperazinyl esters of n-quinolylanthranilic acid | |
| GB1528790A (en) | Benzisoquinoline derivatives | |
| GB1409648A (en) | Substituted pyrrolidinemethanol compounds and pharmaceutical compositions thereof | |
| GB1186495A (en) | 0-[3-(4-Fluorobenzoyl) Proplyl]-4-Substituted Piperazines, their Acid Addition Salts and their method of preparation | |
| GB1495305A (en) | 3-phenyl-4-oxo-4h-benzopyran derivatives | |
| GB1461667A (en) | Amphetamine derivatives | |
| GB1473971A (en) | 3-hydroxy-5,6-benzomorphinan derivatives | |
| GB1245549A (en) | (thienylideneamino)oxy-alkanoic acid and derivatives thereof | |
| ES2001516A6 (es) | Un procedimiento para preparar derivados de 7-oxo-4-tia-1-azabiciclo(3,2,o)hept-2-eno | |
| GB1438260A (en) | Sulphoxides and sulphones processes for their preparation and compositions containing them | |
| GB1386664A (en) | Aminothiophene-carboxylic acid esters and process for their preparation | |
| GB1531041A (en) | Substituted haloacetophenone oximes | |
| GB1295040A (enExample) |