IE37940B1 - Penicillin and cephalosporin derivatives - Google Patents
Penicillin and cephalosporin derivativesInfo
- Publication number
- IE37940B1 IE37940B1 IE1243/73A IE124373A IE37940B1 IE 37940 B1 IE37940 B1 IE 37940B1 IE 1243/73 A IE1243/73 A IE 1243/73A IE 124373 A IE124373 A IE 124373A IE 37940 B1 IE37940 B1 IE 37940B1
- Authority
- IE
- Ireland
- Prior art keywords
- penicillin
- cephalosporin derivatives
- cephalosporin
- derivatives
- Prior art date
Links
- 229930186147 Cephalosporin Chemical class 0.000 title 1
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical class N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- 150000001780 cephalosporins Chemical class 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3429872A GB1442302A (en) | 1972-07-21 | 1972-07-21 | Penicillin and cephalosporin derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37940L IE37940L (en) | 1974-01-21 |
| IE37940B1 true IE37940B1 (en) | 1977-11-23 |
Family
ID=10363881
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1243/73A IE37940B1 (en) | 1972-07-21 | 1973-07-20 | Penicillin and cephalosporin derivatives |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3974150A (enExample) |
| JP (1) | JPS4985088A (enExample) |
| BE (1) | BE802603A (enExample) |
| CH (1) | CH592671A5 (enExample) |
| DE (1) | DE2337105A1 (enExample) |
| FR (2) | FR2220532B1 (enExample) |
| GB (1) | GB1442302A (enExample) |
| IE (1) | IE37940B1 (enExample) |
| LU (1) | LU68065A1 (enExample) |
| NL (1) | NL7310119A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3936446A (en) * | 1974-02-19 | 1976-02-03 | Beecham Group Limited | Isocyanocephalosporanates |
| US4123539A (en) * | 1977-12-29 | 1978-10-31 | Merck & Co., Inc. | 6-Ethylpenicillanic acid |
| DE3278878D1 (en) * | 1981-07-25 | 1988-09-15 | Beecham Group Plc | Beta-lactam antibacterial agents |
| JPS5818388A (ja) * | 1981-07-28 | 1983-02-02 | Banyu Pharmaceut Co Ltd | 3−置換チオメチルセフアロスポリン誘導体の製造法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3763154A (en) * | 1969-12-18 | 1973-10-02 | Koninklijke Gist Spiritus | Cephalosporanic acid derivatives |
-
1972
- 1972-07-21 GB GB3429872A patent/GB1442302A/en not_active Expired
-
1973
- 1973-07-09 US US05/377,247 patent/US3974150A/en not_active Expired - Lifetime
- 1973-07-20 BE BE133698A patent/BE802603A/xx unknown
- 1973-07-20 CH CH1071273A patent/CH592671A5/xx not_active IP Right Cessation
- 1973-07-20 DE DE19732337105 patent/DE2337105A1/de not_active Ceased
- 1973-07-20 JP JP48082480A patent/JPS4985088A/ja active Pending
- 1973-07-20 LU LU68065A patent/LU68065A1/xx unknown
- 1973-07-20 NL NL7310119A patent/NL7310119A/xx not_active Application Discontinuation
- 1973-07-20 FR FR7326802A patent/FR2220532B1/fr not_active Expired
- 1973-07-20 IE IE1243/73A patent/IE37940B1/xx unknown
-
1974
- 1974-04-19 FR FR7413829A patent/FR2236858B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1442302A (en) | 1976-07-14 |
| FR2220532A1 (enExample) | 1974-10-04 |
| US3974150A (en) | 1976-08-10 |
| FR2236858B1 (enExample) | 1978-01-27 |
| BE802603A (fr) | 1974-01-21 |
| JPS4985088A (enExample) | 1974-08-15 |
| CH592671A5 (enExample) | 1977-10-31 |
| LU68065A1 (enExample) | 1973-09-26 |
| DE2337105A1 (de) | 1974-01-31 |
| FR2236858A1 (enExample) | 1975-02-07 |
| FR2220532B1 (enExample) | 1977-08-05 |
| IE37940L (en) | 1974-01-21 |
| NL7310119A (enExample) | 1974-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL41361A0 (en) | Novel penicillin and cephalosporin derivatives and their preparation | |
| CA1032531A (en) | Penam and cepham derivatives and preparation thereof | |
| IL42510A0 (en) | Cephalosporin derivatives and their manufacture | |
| IE37402L (en) | Cephalosporin derivatives | |
| AU5321073A (en) | Penicillins and cephalosporins | |
| IL36281A0 (en) | Cephalosporin derivatives | |
| ZA746563B (en) | 2-oxo-1-pyridinyl penicillin and cephalosporin derivatives | |
| ZA731618B (en) | Cephalosporin derivatives | |
| IE37940B1 (en) | Penicillin and cephalosporin derivatives | |
| ZA715018B (en) | Cephalosporin derivatives | |
| IE39743L (en) | Penicillin and cephalosporin derivatives | |
| IL47348A0 (en) | Cephalosporin and penicillin derivatives | |
| PH10739A (en) | 2-4-dioxo-1-pyrimidinyl penicillin and cephalosporin derivatives | |
| IL45877A0 (en) | 4-oxo-1-pyridinyl penicillin and cephalosporin derivatives | |
| ZA738700B (en) | Ethynylindenyl compounds and derivatives thereof | |
| CA1006157A (en) | Penicillin derivatives | |
| ZA748050B (en) | Cephalosporin derivatives | |
| IE37109L (en) | Penicillins and cephalosporins | |
| CA986098A (en) | Penicillin and cephalosporin derivatives | |
| CA914164A (en) | Penicillin and cephalosporin derivatives | |
| ZA738002B (en) | Penam and cepham derivatives and preparation thereof | |
| CA834727A (en) | Penicillin and cephalosporin derivatives | |
| ZA746454B (en) | 4-oxo-1-pyridinyl penicillin and cephalosporin derivatives | |
| IE37110L (en) | Cephalosporin and penicillin derivatives | |
| AU470859B2 (en) | Penicillin and cephalosporin derivatives |