HU198828B - Insecticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo/2.2.2/-octane derivatives as active ingredient and process for producing the active ingredient - Google Patents
Insecticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo/2.2.2/-octane derivatives as active ingredient and process for producing the active ingredient Download PDFInfo
- Publication number
- HU198828B HU198828B HU851068A HU106885A HU198828B HU 198828 B HU198828 B HU 198828B HU 851068 A HU851068 A HU 851068A HU 106885 A HU106885 A HU 106885A HU 198828 B HU198828 B HU 198828B
- Authority
- HU
- Hungary
- Prior art keywords
- trioxabicyclo
- octane
- phenyl
- butyl
- cyclohexyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- 239000002917 insecticide Substances 0.000 title claims description 21
- 239000004480 active ingredient Substances 0.000 title claims description 16
- 230000008569 process Effects 0.000 title claims description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 50
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 53
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 39
- -1 C 1 -C 6 alkyl Chemical group 0.000 claims description 30
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 claims description 18
- 229960005235 piperonyl butoxide Drugs 0.000 claims description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 12
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 7
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 7
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 7
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 7
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 5
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 5
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Chemical group C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 4
- 239000002671 adjuvant Substances 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- LWJWGXUXSVJWBY-UHFFFAOYSA-L dioxido-phenoxy-sulfanylidene-$l^{5}-phosphane Chemical compound [O-]P([O-])(=S)OC1=CC=CC=C1 LWJWGXUXSVJWBY-UHFFFAOYSA-L 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000006730 (C2-C5) alkynyl group Chemical group 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- GPRLTFBKWDERLU-UHFFFAOYSA-N bicyclo[2.2.2]octane Chemical class C1CC2CCC1CC2 GPRLTFBKWDERLU-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- PQZJTHGEFIQMCO-UHFFFAOYSA-N oxetan-2-ylmethanol Chemical compound OCC1CCO1 PQZJTHGEFIQMCO-UHFFFAOYSA-N 0.000 claims description 2
- 239000003377 acid catalyst Substances 0.000 claims 2
- 239000000654 additive Substances 0.000 claims 2
- 230000000996 additive effect Effects 0.000 claims 2
- CAEKAEFKIHBJEB-UHFFFAOYSA-N 1-butan-2-yl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound O1CC(C(C)CC)(CO2)COC12C1=CC=C(Cl)C=C1 CAEKAEFKIHBJEB-UHFFFAOYSA-N 0.000 claims 1
- FVPOTPXWFCCIHG-UHFFFAOYSA-N 1-butyl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound O1CC(CCCC)(CO2)COC12C1=CC=C(Cl)C=C1 FVPOTPXWFCCIHG-UHFFFAOYSA-N 0.000 claims 1
- GTBFMOCRKWYAKE-UHFFFAOYSA-N 1-cyclohexyl-4-(3,4-dichlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound C1=C(Cl)C(Cl)=CC=C1C1(OC2)OCC2(C2CCCCC2)CO1 GTBFMOCRKWYAKE-UHFFFAOYSA-N 0.000 claims 1
- XJVYSPIPHNEBBR-UHFFFAOYSA-N 1-cyclohexyl-4-(4-fluorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound C1=CC(F)=CC=C1C1(OC2)OCC2(C2CCCCC2)CO1 XJVYSPIPHNEBBR-UHFFFAOYSA-N 0.000 claims 1
- IGIVPHZQIIYYDY-UHFFFAOYSA-N 1-tert-butyl-4-(3,4-dichlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound O1CC(C(C)(C)C)(CO2)COC12C1=CC=C(Cl)C(Cl)=C1 IGIVPHZQIIYYDY-UHFFFAOYSA-N 0.000 claims 1
- NNPJYXUHCVYJAJ-UHFFFAOYSA-N 1-tert-butyl-4-(4-fluorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound O1CC(C(C)(C)C)(CO2)COC12C1=CC=C(F)C=C1 NNPJYXUHCVYJAJ-UHFFFAOYSA-N 0.000 claims 1
- MYJNSONGYPIOFA-UHFFFAOYSA-N 1-tert-butyl-4-cyclohexyl-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound O1CC(C(C)(C)C)(CO2)COC12C1CCCCC1 MYJNSONGYPIOFA-UHFFFAOYSA-N 0.000 claims 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims 1
- SRTDSGMDDPOYGJ-UHFFFAOYSA-N 4-(1-tert-butyl-3,5,8-trioxabicyclo[2.2.2]octan-4-yl)benzonitrile Chemical compound O1CC(C(C)(C)C)(CO2)COC12C1=CC=C(C#N)C=C1 SRTDSGMDDPOYGJ-UHFFFAOYSA-N 0.000 claims 1
- UCCKBKIZMIWJHE-UHFFFAOYSA-N 4-(4-bromophenyl)-1-cyclohexyl-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound C1=CC(Br)=CC=C1C1(OC2)OCC2(C2CCCCC2)CO1 UCCKBKIZMIWJHE-UHFFFAOYSA-N 0.000 claims 1
- LTCOJWZDVNSFSL-UHFFFAOYSA-N 4-(4-chlorophenyl)-1-cyclohexyl-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound C1=CC(Cl)=CC=C1C1(OC2)OCC2(C2CCCCC2)CO1 LTCOJWZDVNSFSL-UHFFFAOYSA-N 0.000 claims 1
- RPRLUXNCQZHJGV-UHFFFAOYSA-N 4-(4-chlorophenyl)-1-propyl-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound O1CC(CCC)(CO2)COC12C1=CC=C(Cl)C=C1 RPRLUXNCQZHJGV-UHFFFAOYSA-N 0.000 claims 1
- ULQUZVALMFXQSA-UHFFFAOYSA-N 4-cycloheptyl-1-cyclohexyl-3,5,8-trioxabicyclo[2.2.2]octane Chemical compound C1CCCCC1C1(CO2)COC2(C2CCCCCC2)OC1 ULQUZVALMFXQSA-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- QLZHNIAADXEJJP-UHFFFAOYSA-L dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-L 0.000 claims 1
- GJVFBWCTGUSGDD-UHFFFAOYSA-L pentamethonium bromide Chemical group [Br-].[Br-].C[N+](C)(C)CCCCC[N+](C)(C)C GJVFBWCTGUSGDD-UHFFFAOYSA-L 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 20
- 241000607479 Yersinia pestis Species 0.000 abstract description 10
- 241000238631 Hexapoda Species 0.000 abstract description 8
- 230000037396 body weight Effects 0.000 abstract description 6
- 241000257159 Musca domestica Species 0.000 abstract description 5
- 230000000361 pesticidal effect Effects 0.000 abstract 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 abstract 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 49
- 125000003118 aryl group Chemical group 0.000 description 30
- 230000000694 effects Effects 0.000 description 17
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 230000000749 insecticidal effect Effects 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 10
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 6
- 231100000419 toxicity Toxicity 0.000 description 6
- 230000001988 toxicity Effects 0.000 description 6
- 241000257226 Muscidae Species 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 241000124008 Mammalia Species 0.000 description 4
- 206010029897 Obsessive thoughts Diseases 0.000 description 4
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- RDKIWEMZLCUDMD-UHFFFAOYSA-N 4-cyclooctyltrioxocane Chemical compound C1CCCCCCC1C1OOOCCCC1 RDKIWEMZLCUDMD-UHFFFAOYSA-N 0.000 description 3
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000238660 Blattidae Species 0.000 description 3
- 241001674044 Blattodea Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000000575 pesticide Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical class CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000238657 Blattella germanica Species 0.000 description 2
- 241000256113 Culicidae Species 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 241000258937 Hemiptera Species 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 102000004316 Oxidoreductases Human genes 0.000 description 2
- 108090000854 Oxidoreductases Proteins 0.000 description 2
- 241000238675 Periplaneta americana Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000007269 dehydrobromination reaction Methods 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ZQBFAOFFOQMSGJ-UHFFFAOYSA-N hexafluorobenzene Chemical compound FC1=C(F)C(F)=C(F)C(F)=C1F ZQBFAOFFOQMSGJ-UHFFFAOYSA-N 0.000 description 2
- 231100001225 mammalian toxicity Toxicity 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- 231100000027 toxicology Toxicity 0.000 description 2
- FMUFFUZPAMYTLG-UHFFFAOYSA-N (3-propan-2-yloxetan-3-yl)methanol Chemical compound CC(C)C1(CO)COC1 FMUFFUZPAMYTLG-UHFFFAOYSA-N 0.000 description 1
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 description 1
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical class CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- CZLVPINBLDRZCJ-UHFFFAOYSA-N 2,3,4,4,5,5,6,6-octachlorocyclohex-2-en-1-one Chemical class ClC1=C(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C1=O CZLVPINBLDRZCJ-UHFFFAOYSA-N 0.000 description 1
- KDHYEQYWOYBACO-UHFFFAOYSA-N 2-(hydroxymethyl)-2-propan-2-ylpropane-1,3-diol Chemical compound CC(C)C(CO)(CO)CO KDHYEQYWOYBACO-UHFFFAOYSA-N 0.000 description 1
- VVCMGAUPZIKYTH-VGHSCWAPSA-N 2-acetyloxybenzoic acid;[(2s,3r)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] propanoate;1,3,7-trimethylpurine-2,6-dione Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C.C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 VVCMGAUPZIKYTH-VGHSCWAPSA-N 0.000 description 1
- BNEQHTNDYHYJFK-UHFFFAOYSA-N 2-tert-butyl-2-(hydroxymethyl)propane-1,3-diol Chemical compound CC(C)(C)C(CO)(CO)CO BNEQHTNDYHYJFK-UHFFFAOYSA-N 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241000256844 Apis mellifera Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 238000005705 Cannizzaro reaction Methods 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241001107116 Castanospermum australe Species 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- 102000018832 Cytochromes Human genes 0.000 description 1
- 108010052832 Cytochromes Proteins 0.000 description 1
- 206010019909 Hernia Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000021279 black bean Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000000451 chemical ionisation Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000001784 detoxification Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 244000144992 flock Species 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000007031 hydroxymethylation reaction Methods 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002560 ketene acetals Chemical class 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000003228 microsomal effect Effects 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002921 oxetanes Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000002723 toxicity assay Methods 0.000 description 1
- 231100000041 toxicology testing Toxicity 0.000 description 1
- MVDRXYIEGOGRAI-UHFFFAOYSA-N tribromomethylbenzene Chemical compound BrC(Br)(Br)C1=CC=CC=C1 MVDRXYIEGOGRAI-UHFFFAOYSA-N 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical class [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/08—Bridged systems
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/90—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having two or more relevant hetero rings, condensed among themselves or with a common carbocyclic ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US57584384A | 1984-01-30 | 1984-01-30 | |
| US69281885A | 1985-01-23 | 1985-01-23 | |
| PCT/US1985/000150 WO1985003203A1 (en) | 1984-01-30 | 1985-01-29 | A new class of pesticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo ad2.2.2. bd octanes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT38034A HUT38034A (en) | 1986-04-28 |
| HU198828B true HU198828B (en) | 1989-12-28 |
Family
ID=27076803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU851068A HU198828B (en) | 1984-01-30 | 1985-01-29 | Insecticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo/2.2.2/-octane derivatives as active ingredient and process for producing the active ingredient |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0152229B1 (enExample) |
| JP (1) | JPH0623082B2 (enExample) |
| AU (2) | AU3933285A (enExample) |
| DE (1) | DE3585886D1 (enExample) |
| DK (1) | DK168765B1 (enExample) |
| EG (1) | EG17617A (enExample) |
| HU (1) | HU198828B (enExample) |
| IL (1) | IL74293A (enExample) |
| WO (1) | WO1985003203A1 (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8523582D0 (en) * | 1985-09-24 | 1985-10-30 | Wellcome Found | Insecticidal compounds |
| FI863091A7 (fi) | 1985-07-30 | 1987-01-31 | The Wellcome Foundation Ltd | Pestisidisiä yhdisteitä. |
| GB8519212D0 (en) * | 1985-07-30 | 1985-09-04 | Wellcome Found | Pesticidal compound |
| US5098929A (en) * | 1985-07-30 | 1992-03-24 | The Wellcome Foundation Limited | Pesticidal compounds |
| IL80115A0 (en) * | 1985-09-23 | 1986-12-31 | Wellcome Found | Bicyclic compounds,their preparation and their use as pesticides |
| US5116862A (en) * | 1985-09-24 | 1992-05-26 | The Wellcome Foundation Limited | Pesticidal compounds |
| PL261502A1 (en) * | 1985-09-24 | 1988-07-21 | A method of new bicyclo-heptane,octane or nonane derivatives production | |
| EP0216625A3 (en) * | 1985-09-24 | 1988-08-17 | The Wellcome Foundation Limited | Pesticidal compounds |
| GB8603383D0 (en) * | 1986-02-11 | 1986-03-19 | Wellcome Found | Pesticidal formulations |
| EP0243184A3 (en) * | 1986-04-25 | 1989-05-10 | Roussel-Uclaf | Pesticidal compounds |
| BR8803652A (pt) * | 1987-07-22 | 1989-02-14 | Wellcome Found | Processo para a preparacao de um composto,formulacao pesticida;e processos para a preparacao da mesma,para o controle de pragas de artropodes e helmintos e para o controle de infestacoes em animais e/ou plantas e/ou produtos armazenados e/ou no meio ambiente |
| US5466710A (en) * | 1988-03-21 | 1995-11-14 | Roussel Uclaf | Heterobicycloalkanes as pesticidal compounds |
| US5204333A (en) * | 1989-01-24 | 1993-04-20 | Larkin John P | Pesticidal compounds |
| ES2356035T3 (es) * | 2005-10-31 | 2011-04-04 | Alcon, Inc. | Iluminador granangular quirúrgico con cono concentrador parabólico compuesto (cpc). |
| TWI550071B (zh) | 2011-03-25 | 2016-09-21 | 捷恩智股份有限公司 | 原酸酯化合物、液晶組成物及液晶顯示元件 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI863091A7 (fi) * | 1985-07-30 | 1987-01-31 | The Wellcome Foundation Ltd | Pestisidisiä yhdisteitä. |
| IL80115A0 (en) * | 1985-09-23 | 1986-12-31 | Wellcome Found | Bicyclic compounds,their preparation and their use as pesticides |
| EP0216625A3 (en) * | 1985-09-24 | 1988-08-17 | The Wellcome Foundation Limited | Pesticidal compounds |
-
1985
- 1985-01-29 AU AU39332/85A patent/AU3933285A/en not_active Abandoned
- 1985-01-29 WO PCT/US1985/000150 patent/WO1985003203A1/en not_active Ceased
- 1985-01-29 JP JP60500578A patent/JPH0623082B2/ja not_active Expired - Lifetime
- 1985-01-29 HU HU851068A patent/HU198828B/hu not_active IP Right Cessation
- 1985-01-30 EP EP85300619A patent/EP0152229B1/en not_active Expired - Lifetime
- 1985-01-30 DE DE85300619T patent/DE3585886D1/de not_active Expired - Lifetime
- 1985-01-30 EG EG56/85A patent/EG17617A/xx active
- 1985-02-11 IL IL74293A patent/IL74293A/xx not_active IP Right Cessation
- 1985-09-27 DK DK440285A patent/DK168765B1/da not_active IP Right Cessation
-
1989
- 1989-02-13 AU AU29892/89A patent/AU615986B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| IL74293A0 (en) | 1988-12-30 |
| DE3585886D1 (enExample) | 1992-05-27 |
| EP0152229A3 (en) | 1985-12-04 |
| DK440285A (da) | 1985-11-27 |
| WO1985003203A1 (en) | 1985-08-01 |
| HUT38034A (en) | 1986-04-28 |
| JPH0623082B2 (ja) | 1994-03-30 |
| EP0152229B1 (en) | 1992-04-22 |
| AU3933285A (en) | 1985-08-09 |
| EG17617A (en) | 1990-08-30 |
| AU615986B2 (en) | 1991-10-17 |
| DK168765B1 (da) | 1994-06-06 |
| IL74293A (en) | 1992-12-01 |
| JPS61501149A (ja) | 1986-06-12 |
| DK440285D0 (da) | 1985-09-27 |
| EP0152229A2 (en) | 1985-08-21 |
| AU2989289A (en) | 1989-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU198828B (en) | Insecticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo/2.2.2/-octane derivatives as active ingredient and process for producing the active ingredient | |
| JP4758909B2 (ja) | イミダゾ[1,2−b]ピリダジン誘導体を使用することによる動物における寄生生物の制御 | |
| BR0209499A (pt) | Composto, processo para produzir o composto, e, composição pesticida | |
| JP2011105727A (ja) | 殺寄生虫薬2−フェニル−3−(1h−ピロール−2−イル)アクリロニトリル誘導体の使用による動物における寄生虫の制御 | |
| IL26400A (en) | Synergistic insecticidal compositions containing an insecticidal carbamate and an aryl propargyl ether | |
| EP0216625A2 (en) | Pesticidal compounds | |
| EP0144285A1 (de) | Neue Lactone zur Bekämpfung von tierischen und pflanzlichen Schädlingen | |
| US4772624A (en) | 1,4-bis-substituted-2,6,7-trioxabicyclo(2.2.2)-octanes having ethynyl substituted phenyl group | |
| AU680290B2 (en) | Antiparasitic agents | |
| CA2168731C (en) | Antiparasitic agents | |
| IL42639A (en) | 3 - Amino - 2, 4, 6 - Trichloro - benzaldehyde sulfonylhydrazones, processes for their production and preparations containing them for exterminating animals from rabbit ointment and rodents | |
| US3657357A (en) | Insecticidal compounds and methods for their preparation | |
| US3864405A (en) | 1,1-Bis-(phenyl)-2-nitropropanes | |
| HU199108B (en) | Process for production of derivatives of alcadien carbonic acid amid containing aromatic group and insecticides and acaricides containing these compositions | |
| US4876274A (en) | New class of pesticides comprising 1,4-bis-substituted-2,6,7-trioxabicyclo(2.2.2)octanes | |
| US2350324A (en) | Parasiticidal composition | |
| RU2063972C1 (ru) | Производные гетеробициклоалканов | |
| US4985582A (en) | Pesticidal compounds | |
| US4061757A (en) | Compounds having juvenile hormone activity | |
| FR2682382A1 (fr) | Nouveaux derives de l'acide 1-naphtalene acetique, leur procede de preparation et leur application comme pesticides. | |
| US3776925A (en) | Cyclic organic compounds | |
| US3936433A (en) | O-Ethyl-O-(3-methyl-6-nitrophenyl)-n-secondary butyl-phosphorothionoamidate | |
| US5643886A (en) | Avermectins and milbemycins to treat parasitic infestations in dogs | |
| JP4759679B2 (ja) | テトラヒドロベンゾトリアジン誘導体 | |
| US3234237A (en) | Novel substituted tetrahydrothiophenes and the preparation thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |