HU196187B - Process for producing 2-isopropyl-4-methyl-6-hydroxy-pyrimidine - Google Patents
Process for producing 2-isopropyl-4-methyl-6-hydroxy-pyrimidine Download PDFInfo
- Publication number
- HU196187B HU196187B HU844573A HU457384A HU196187B HU 196187 B HU196187 B HU 196187B HU 844573 A HU844573 A HU 844573A HU 457384 A HU457384 A HU 457384A HU 196187 B HU196187 B HU 196187B
- Authority
- HU
- Hungary
- Prior art keywords
- hydroxypyrimidine
- isobutyric
- acid amide
- cyclization
- isopropyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- AJPIUNPJBFBUKK-UHFFFAOYSA-N 2-isopropyl-6-methylpyrimidin-4-ol Chemical compound CC(C)C1=NC(C)=CC(O)=N1 AJPIUNPJBFBUKK-UHFFFAOYSA-N 0.000 title description 15
- KQNPFQTWMSNSAP-UHFFFAOYSA-N alpha-isobutyric acid Natural products CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 claims description 19
- UAUSQEVPWPGBHG-IHWYPQMZSA-N (z)-3-aminobut-2-enamide Chemical compound C\C(N)=C\C(N)=O UAUSQEVPWPGBHG-IHWYPQMZSA-N 0.000 claims description 13
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical class OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 claims description 12
- 238000007363 ring formation reaction Methods 0.000 claims description 10
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 238000005917 acylation reaction Methods 0.000 claims description 8
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 8
- -1 isobutyryl compound Chemical class 0.000 claims description 8
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 7
- 230000010933 acylation Effects 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 238000006386 neutralization reaction Methods 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims 3
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000002955 isolation Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- JSLCOZYBKYHZNL-UHFFFAOYSA-N butylisobutyrate Chemical compound CCCCOC(=O)C(C)C JSLCOZYBKYHZNL-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- JYCDILBEUUCCQD-UHFFFAOYSA-N sodium;2-methylpropan-1-olate Chemical compound [Na+].CC(C)C[O-] JYCDILBEUUCCQD-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- GUKKGBSNKJVHDK-IHWYPQMZSA-N (z)-2-aminobut-2-enamide Chemical compound C\C=C(/N)C(N)=O GUKKGBSNKJVHDK-IHWYPQMZSA-N 0.000 description 1
- JBKZUDJFOSCJDL-XQRVVYSFSA-N (z)-3-(2-methylpropanoylamino)but-2-enamide Chemical compound CC(C)C(=O)N\C(C)=C/C(N)=O JBKZUDJFOSCJDL-XQRVVYSFSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LOUODJGOYJHXPS-UHFFFAOYSA-N 1h-pyrimidin-2-one;sodium Chemical compound [Na].OC1=NC=CC=N1 LOUODJGOYJHXPS-UHFFFAOYSA-N 0.000 description 1
- VDOKWPVSGXHSNP-UHFFFAOYSA-N 2-methylprop-1-en-1-one Chemical compound CC(C)=C=O VDOKWPVSGXHSNP-UHFFFAOYSA-N 0.000 description 1
- OTIQERGVDQYVAK-UHFFFAOYSA-N 2-methylpropanoic acid Chemical compound CC(C)C(O)=O.CC(C)C(O)=O OTIQERGVDQYVAK-UHFFFAOYSA-N 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000004806 hydroxypyridines Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- LSYJHRREPKXURZ-UHFFFAOYSA-N pyrimidine;hydrate Chemical compound O.C1=CN=CN=C1 LSYJHRREPKXURZ-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- TWEGKFXBDXYJIU-UHFFFAOYSA-M sodium;2-methylpropanoate Chemical compound [Na+].CC(C)C([O-])=O TWEGKFXBDXYJIU-UHFFFAOYSA-M 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
- C07D239/36—One oxygen atom as doubly bound oxygen atom or as unsubstituted hydroxy radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833344429 DE3344429A1 (de) | 1983-12-08 | 1983-12-08 | Verfahren zur herstellung von 2-isopropyl-4-methyl-6-hydroxypyrimidin |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT36465A HUT36465A (en) | 1985-09-30 |
| HU196187B true HU196187B (en) | 1988-10-28 |
Family
ID=6216391
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU844573A HU196187B (en) | 1983-12-08 | 1984-12-07 | Process for producing 2-isopropyl-4-methyl-6-hydroxy-pyrimidine |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4585863A (enExample) |
| EP (1) | EP0148408B1 (enExample) |
| JP (1) | JPS60139674A (enExample) |
| KR (1) | KR860001805B1 (enExample) |
| DE (2) | DE3344429A1 (enExample) |
| HU (1) | HU196187B (enExample) |
| IL (1) | IL72271A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4791199A (en) * | 1985-09-19 | 1988-12-13 | G. D. Searle & Co. | Process for antiarrhythmic 1,3-diazabicyclo[4.4.0]dec-2-en-4-ones |
| US7045586B2 (en) * | 2003-08-14 | 2006-05-16 | Dow Corning Corporation | Adhesives having improved chemical resistance and curable silicone compositions for preparing the adhesives |
| US20080116144A1 (en) * | 2006-10-10 | 2008-05-22 | Spicer Randolph, Llc | Methods and compositions for reducing chlorine demand, decreasing disinfection by-products and controlling deposits in drinking water distribution systems |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2065698C3 (de) * | 1969-11-17 | 1979-08-30 | Chisso Corp., Osaka (Japan) | Verfahren zur Herstellung von 2-Isopropyl-6-methyl-4(3H)-pyrimidon |
| US4012506A (en) * | 1975-07-03 | 1977-03-15 | Ciba-Geigy Corporation | Pyrimidyl thio- and dithio-phosphoric acid esters |
| US4052396A (en) * | 1976-11-22 | 1977-10-04 | Ciba-Geigy Corporation | Process for the production of 2-alkyl or 2-cycloalkyl-4-methyl-6-hydroxypyrimidines |
| US4052397A (en) * | 1976-11-22 | 1977-10-04 | Ciba-Geigy Corporation | Process for the production of 2-alkyl or 2-cycloalkyl-4-methyl-6-hydroxypyrimidines |
| US4163848A (en) * | 1978-08-08 | 1979-08-07 | Ciba-Geigy Corporation | Process for the production of 2-alkyl- or cycloalkyl-4-methyl-6-hydroxypyrimidines |
| DE2853887A1 (de) * | 1978-12-14 | 1980-07-03 | Consortium Elektrochem Ind | Verfahren zur herstellung von beta -isobutyrylaminocrotonsaeureamid |
| DE2907773A1 (de) * | 1979-02-28 | 1980-09-11 | Consortium Elektrochem Ind | Verfahren zur herstellung von diazinon |
| GB2083814B (en) * | 1980-09-11 | 1984-08-15 | Ciba Geigy Ag | Method for the production of 2-isopropyl-4-methyl-6-hydroxypyrimidine |
-
1983
- 1983-12-08 DE DE19833344429 patent/DE3344429A1/de not_active Withdrawn
-
1984
- 1984-06-29 IL IL72271A patent/IL72271A/xx unknown
- 1984-07-04 KR KR1019840003853A patent/KR860001805B1/ko not_active Expired
- 1984-08-16 US US06/641,329 patent/US4585863A/en not_active Expired - Fee Related
- 1984-12-05 DE DE8484114717T patent/DE3469523D1/de not_active Expired
- 1984-12-05 EP EP84114717A patent/EP0148408B1/de not_active Expired
- 1984-12-07 JP JP59257731A patent/JPS60139674A/ja active Granted
- 1984-12-07 HU HU844573A patent/HU196187B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60139674A (ja) | 1985-07-24 |
| IL72271A0 (en) | 1984-10-31 |
| IL72271A (en) | 1987-10-30 |
| DE3469523D1 (en) | 1988-04-07 |
| JPS6121952B2 (enExample) | 1986-05-29 |
| KR850004960A (ko) | 1985-08-19 |
| EP0148408A1 (de) | 1985-07-17 |
| DE3344429A1 (de) | 1985-06-20 |
| EP0148408B1 (de) | 1988-03-02 |
| US4585863A (en) | 1986-04-29 |
| KR860001805B1 (ko) | 1986-10-23 |
| HUT36465A (en) | 1985-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU189641B (en) | Process for preparing l-ascorbic acid | |
| KR960001913B1 (ko) | 3-시아노-4-아릴-피롤의 제조방법 | |
| HU196187B (en) | Process for producing 2-isopropyl-4-methyl-6-hydroxy-pyrimidine | |
| HU200446B (en) | Process for production of 1-alkyl-5-nitro-imidasoles | |
| CA1280426C (en) | 4-benzyloxy-3-pyrrolin-2-on-1-yl acetamide, its production and use | |
| JP4641667B2 (ja) | 1−メチル−5−ハイドロキシピラゾールの製造法 | |
| US5250689A (en) | Process for the production of 2-(methylthio)-disodium barbiturate | |
| US5869694A (en) | Process for preparing 4-hydroxy-2-pyrrolidone | |
| US4332727A (en) | Preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indolylacetoxyacetic acid | |
| US4521616A (en) | Method for the preparation of fluoroanthranilic acids | |
| US4275216A (en) | Process for preparing 4(5)-hydroxymethyl 5(4)-lower alkyl imidazoles | |
| IE57288B1 (en) | Preparation process of acemetacin | |
| US4965363A (en) | Process for the preparation of 3-cyano-4-aryl-pyrroles | |
| US4133952A (en) | Process and intermediate for preparing auranofin | |
| US5973180A (en) | Process for the production of an N-acyl derivative of O,S-dialkyl phosphoroamidothioate | |
| US5436256A (en) | Process for the preparation of arylhydantoins | |
| JP2578797B2 (ja) | N−(スルホニルメチル)ホルムアミド類の製造法 | |
| US4892956A (en) | 5-cyano-4,5-dihydro-3,4-dicarboxypyrazole derivatives | |
| CA1214171A (en) | Process for the preparation of 4-methyl-5-oxo-3- thioxo-tetrahydro-1,2,4-(2h, 4h)-triazines | |
| US4924001A (en) | Process for preparing 5-cyano-4, 5-dihydro-3,4-dicarboxypyrazole derivatives | |
| SU1154269A1 (ru) | Способ получени уреидов ароилуксусных кислот | |
| US5708182A (en) | Method for preparation of 2-imino 4-oxo-5-phenyloxazolidine | |
| US4476306A (en) | Method of preparing 2,4-dihydroxypyrimidine | |
| EP0066440B1 (en) | Chemical process | |
| GB2181432A (en) | Chemical process |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |