HU192121B - Herbicide compositions containing phenyl-substituted sulfonamide derivatives and process for producing the active avents - Google Patents
Herbicide compositions containing phenyl-substituted sulfonamide derivatives and process for producing the active avents Download PDFInfo
- Publication number
- HU192121B HU192121B HU329082A HU329082A HU192121B HU 192121 B HU192121 B HU 192121B HU 329082 A HU329082 A HU 329082A HU 329082 A HU329082 A HU 329082A HU 192121 B HU192121 B HU 192121B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- methyl
- hydrogen
- priority
- active ingredient
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 100
- 238000000034 method Methods 0.000 title claims description 85
- -1 phenyl-substituted sulfonamide Chemical class 0.000 title claims description 80
- 230000008569 process Effects 0.000 title claims description 24
- 230000002363 herbicidal effect Effects 0.000 title claims description 11
- 239000004009 herbicide Substances 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 263
- 229910052739 hydrogen Inorganic materials 0.000 claims description 148
- 239000001257 hydrogen Substances 0.000 claims description 146
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 120
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 97
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 92
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 76
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 62
- 239000004480 active ingredient Substances 0.000 claims description 62
- 229910052801 chlorine Inorganic materials 0.000 claims description 60
- 239000000460 chlorine Substances 0.000 claims description 53
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 50
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 229910052794 bromium Inorganic materials 0.000 claims description 33
- 238000002360 preparation method Methods 0.000 claims description 33
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 31
- 229910052760 oxygen Inorganic materials 0.000 claims description 25
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 23
- 239000001301 oxygen Substances 0.000 claims description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 20
- 229940124530 sulfonamide Drugs 0.000 claims description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 19
- 150000001412 amines Chemical class 0.000 claims description 19
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 239000007858 starting material Substances 0.000 claims description 16
- 150000003456 sulfonamides Chemical class 0.000 claims description 15
- 229910052717 sulfur Inorganic materials 0.000 claims description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 14
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 14
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 13
- 239000011593 sulfur Substances 0.000 claims description 13
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 7
- 239000008096 xylene Substances 0.000 claims description 7
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical class O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 claims description 6
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 5
- 239000000010 aprotic solvent Substances 0.000 claims description 4
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical class COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 3
- 229910002029 synthetic silica gel Inorganic materials 0.000 claims description 3
- 239000005909 Kieselgur Substances 0.000 claims description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 claims description 2
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 claims description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000005648 plant growth regulator Substances 0.000 claims description 2
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 claims description 2
- SQQWBSBBCSFQGC-JLHYYAGUSA-N ubiquinone-2 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CCC=C(C)C)=C(C)C1=O SQQWBSBBCSFQGC-JLHYYAGUSA-N 0.000 claims description 2
- 239000000080 wetting agent Substances 0.000 claims description 2
- HFFXLYHRNRKAPM-UHFFFAOYSA-N 2,4,5-trichloro-n-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide Chemical compound O1C(C)=CC(NS(=O)(=O)C=2C(=CC(Cl)=C(Cl)C=2)Cl)=N1 HFFXLYHRNRKAPM-UHFFFAOYSA-N 0.000 claims 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 2
- WPWNEKFMGCWNPR-UHFFFAOYSA-N 3,4-dihydro-2h-thiochromene Chemical compound C1=CC=C2CCCSC2=C1 WPWNEKFMGCWNPR-UHFFFAOYSA-N 0.000 claims 1
- 239000005995 Aluminium silicate Substances 0.000 claims 1
- 235000012211 aluminium silicate Nutrition 0.000 claims 1
- 239000002270 dispersing agent Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 abstract description 2
- 150000002367 halogens Chemical class 0.000 abstract description 2
- 125000000962 organic group Chemical group 0.000 abstract 2
- 240000008042 Zea mays Species 0.000 description 141
- 241000209140 Triticum Species 0.000 description 140
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 140
- 235000021307 Triticum Nutrition 0.000 description 139
- 244000037364 Cinnamomum aromaticum Species 0.000 description 136
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 136
- 235000010469 Glycine max Nutrition 0.000 description 136
- 235000007164 Oryza sativa Nutrition 0.000 description 136
- 235000009566 rice Nutrition 0.000 description 136
- 240000007594 Oryza sativa Species 0.000 description 135
- 244000068988 Glycine max Species 0.000 description 133
- 235000007320 Avena fatua Nutrition 0.000 description 124
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 117
- 235000009973 maize Nutrition 0.000 description 117
- 240000001592 Amaranthus caudatus Species 0.000 description 115
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 115
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 112
- 244000075634 Cyperus rotundus Species 0.000 description 112
- 235000021536 Sugar beet Nutrition 0.000 description 112
- 240000001549 Ipomoea eriocarpa Species 0.000 description 109
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 109
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 108
- 240000003176 Digitaria ciliaris Species 0.000 description 108
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 108
- 235000005476 Digitaria cruciata Nutrition 0.000 description 108
- 235000006830 Digitaria didactyla Nutrition 0.000 description 108
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 108
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 108
- 241000192043 Echinochloa Species 0.000 description 108
- 235000014716 Eleusine indica Nutrition 0.000 description 108
- 244000075850 Avena orientalis Species 0.000 description 107
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 107
- 229920000742 Cotton Polymers 0.000 description 104
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 100
- 240000003829 Sorghum propinquum Species 0.000 description 95
- 241001506766 Xanthium Species 0.000 description 84
- 235000007340 Hordeum vulgare Nutrition 0.000 description 83
- 240000005979 Hordeum vulgare Species 0.000 description 82
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 72
- 238000006243 chemical reaction Methods 0.000 description 72
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 58
- 239000000243 solution Substances 0.000 description 58
- 240000000321 Abutilon grandifolium Species 0.000 description 50
- 235000003403 Limnocharis flava Nutrition 0.000 description 50
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- 239000000543 intermediate Substances 0.000 description 46
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- 241000208296 Datura Species 0.000 description 32
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- 244000248416 Fagopyrum cymosum Species 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 31
- 239000002904 solvent Substances 0.000 description 30
- 229960000583 acetic acid Drugs 0.000 description 27
- 241000405217 Viola <butterfly> Species 0.000 description 25
- 239000000725 suspension Substances 0.000 description 24
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 23
- 235000005822 corn Nutrition 0.000 description 23
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 21
- 235000016068 Berberis vulgaris Nutrition 0.000 description 21
- 241000335053 Beta vulgaris Species 0.000 description 21
- 240000007049 Juglans regia Species 0.000 description 20
- 235000009496 Juglans regia Nutrition 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- 235000020234 walnut Nutrition 0.000 description 20
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 18
- 235000004135 Amaranthus viridis Nutrition 0.000 description 18
- 235000009344 Chenopodium album Nutrition 0.000 description 18
- 240000000005 Chenopodium berlandieri Species 0.000 description 18
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 18
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 18
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 18
- 241000209764 Avena fatua Species 0.000 description 17
- 235000004535 Avena sterilis Nutrition 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- 239000012954 diazonium Substances 0.000 description 16
- 150000001989 diazonium salts Chemical class 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- 239000002244 precipitate Substances 0.000 description 16
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 15
- 240000000950 Hippophae rhamnoides Species 0.000 description 15
- 235000003145 Hippophae rhamnoides Nutrition 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000009472 formulation Methods 0.000 description 15
- 238000005481 NMR spectroscopy Methods 0.000 description 14
- 244000046052 Phaseolus vulgaris Species 0.000 description 14
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 14
- 230000009467 reduction Effects 0.000 description 14
- 238000006722 reduction reaction Methods 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 239000002245 particle Substances 0.000 description 13
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 239000002002 slurry Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000012442 inert solvent Substances 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- 240000004585 Dactylis glomerata Species 0.000 description 9
- 241000219051 Fagopyrum Species 0.000 description 9
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000012362 glacial acetic acid Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- XATYIBVSSKQMDX-UHFFFAOYSA-N 1-benzothiophen-7-amine Chemical class NC1=CC=CC2=C1SC=C2 XATYIBVSSKQMDX-UHFFFAOYSA-N 0.000 description 8
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 8
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical class ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 8
- 241000255789 Bombyx mori Species 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 230000021736 acetylation Effects 0.000 description 8
- 238000006640 acetylation reaction Methods 0.000 description 8
- 229960000892 attapulgite Drugs 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 229910052625 palygorskite Inorganic materials 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 235000010288 sodium nitrite Nutrition 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 239000004094 surface-active agent Substances 0.000 description 8
- 239000004563 wettable powder Substances 0.000 description 8
- IRMXPESEXLQKHG-UHFFFAOYSA-N 1-benzothiophen-4-amine Chemical compound NC1=CC=CC2=C1C=CS2 IRMXPESEXLQKHG-UHFFFAOYSA-N 0.000 description 7
- CDGUTXAPQVWGNU-UHFFFAOYSA-N 7-nitro-1-benzothiophene Chemical class [O-][N+](=O)C1=CC=CC2=C1SC=C2 CDGUTXAPQVWGNU-UHFFFAOYSA-N 0.000 description 7
- 240000002791 Brassica napus Species 0.000 description 7
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- 244000309464 bull Species 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 150000002828 nitro derivatives Chemical class 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 238000006798 ring closing metathesis reaction Methods 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 7
- OCZGGFAZAPGFMC-UHFFFAOYSA-N 1-benzofuran-4-amine Chemical compound NC1=CC=CC2=C1C=CO2 OCZGGFAZAPGFMC-UHFFFAOYSA-N 0.000 description 6
- YYWJHOJMCOIVNS-UHFFFAOYSA-N 1-benzofuran-7-amine Chemical class NC1=CC=CC2=C1OC=C2 YYWJHOJMCOIVNS-UHFFFAOYSA-N 0.000 description 6
- 241000272814 Anser sp. Species 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 6
- 241000132536 Cirsium Species 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 235000005187 Taraxacum officinale ssp. officinale Nutrition 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 239000008188 pellet Substances 0.000 description 6
- 150000003918 triazines Chemical class 0.000 description 6
- KIEQGEBGYOOELD-UHFFFAOYSA-N 1,1-dioxo-2,3-dihydro-1-benzothiophen-7-amine Chemical class NC1=CC=CC2=C1S(=O)(=O)CC2 KIEQGEBGYOOELD-UHFFFAOYSA-N 0.000 description 5
- 241000209072 Sorghum Species 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000001246 bromo group Chemical group Br* 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 230000006196 deacetylation Effects 0.000 description 5
- 238000003381 deacetylation reaction Methods 0.000 description 5
- 150000002391 heterocyclic compounds Chemical class 0.000 description 5
- 238000002329 infrared spectrum Methods 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 230000008635 plant growth Effects 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- UKJAAQAVNJNZAX-UHFFFAOYSA-N 1,1-dioxo-1-benzothiophen-7-amine Chemical class NC1=CC=CC2=C1S(=O)(=O)C=C2 UKJAAQAVNJNZAX-UHFFFAOYSA-N 0.000 description 4
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 4
- JCVKIWWAMUGSNB-UHFFFAOYSA-N 2,3-dihydro-1-benzothiophen-7-amine Chemical class NC1=CC=CC2=C1SCC2 JCVKIWWAMUGSNB-UHFFFAOYSA-N 0.000 description 4
- 244000208874 Althaea officinalis Species 0.000 description 4
- 235000006576 Althaea officinalis Nutrition 0.000 description 4
- 235000009051 Ambrosia paniculata var. peruviana Nutrition 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 235000003097 Artemisia absinthium Nutrition 0.000 description 4
- 240000001851 Artemisia dracunculus Species 0.000 description 4
- 235000017731 Artemisia dracunculus ssp. dracunculus Nutrition 0.000 description 4
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 4
- 241000234642 Festuca Species 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 240000001949 Taraxacum officinale Species 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 4
- 239000003905 agrochemical Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000001138 artemisia absinthium Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 244000038559 crop plants Species 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 235000001035 marshmallow Nutrition 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 229920000137 polyphosphoric acid Polymers 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 235000011150 stannous chloride Nutrition 0.000 description 4
- 239000011550 stock solution Substances 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- UMHFSEWKWORSLP-UHFFFAOYSA-N thiophene 1,1-dioxide Chemical class O=S1(=O)C=CC=C1 UMHFSEWKWORSLP-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- RQVCNKOGKIBIEV-UHFFFAOYSA-N 4-nitro-1-benzothiophene Chemical compound [O-][N+](=O)C1=CC=CC2=C1C=CS2 RQVCNKOGKIBIEV-UHFFFAOYSA-N 0.000 description 3
- UWXIRVOEHNPCEV-UHFFFAOYSA-N 7-nitro-1-benzofuran Chemical class [O-][N+](=O)C1=CC=CC2=C1OC=C2 UWXIRVOEHNPCEV-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 241001674044 Blattodea Species 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 3
- 108010068370 Glutens Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- 241000219100 Rhamnaceae Species 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000005341 cation exchange Methods 0.000 description 3
- 150000001804 chlorine Chemical class 0.000 description 3
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- MPTQRFCYZCXJFQ-UHFFFAOYSA-L copper(II) chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Cu+2] MPTQRFCYZCXJFQ-UHFFFAOYSA-L 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000850 deacetylating effect Effects 0.000 description 3
- 239000012973 diazabicyclooctane Substances 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- QDYBCIWLGJMJGO-UHFFFAOYSA-N dinitromethanone Chemical compound [O-][N+](=O)C(=O)[N+]([O-])=O QDYBCIWLGJMJGO-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 235000021312 gluten Nutrition 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- 229910001629 magnesium chloride Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 3
- 238000006053 organic reaction Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 150000003230 pyrimidines Chemical class 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- 239000004576 sand Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 3
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 2
- KUTJQWIYMDRGMV-UHFFFAOYSA-N 1,1-dioxothiophene-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CS1(=O)=O KUTJQWIYMDRGMV-UHFFFAOYSA-N 0.000 description 2
- VJYJBBMMLIDJEF-UHFFFAOYSA-N 1-benzothiophen-2-amine Chemical class C1=CC=C2SC(N)=CC2=C1 VJYJBBMMLIDJEF-UHFFFAOYSA-N 0.000 description 2
- FRJNKYGTHPUSJR-UHFFFAOYSA-N 1-benzothiophene 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)C=CC2=C1 FRJNKYGTHPUSJR-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 2
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical class NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical class OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- QRRSUFOLWLZEFK-UHFFFAOYSA-N 2h-thiochromen-8-amine Chemical compound C1=CCSC2=C1C=CC=C2N QRRSUFOLWLZEFK-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 description 2
- DBFWZVAZJOPHHS-UHFFFAOYSA-N 4-nitro-1-benzothiophen-5-amine Chemical compound NC1=CC=C2SC=CC2=C1[N+]([O-])=O DBFWZVAZJOPHHS-UHFFFAOYSA-N 0.000 description 2
- VNFYMAPAENTMMO-UHFFFAOYSA-N 5-chloro-2-methylquinoline Chemical compound ClC1=CC=CC2=NC(C)=CC=C21 VNFYMAPAENTMMO-UHFFFAOYSA-N 0.000 description 2
- JOKOYDYGIPVGNU-UHFFFAOYSA-N 5-chloro-4-nitro-1-benzothiophene Chemical class [O-][N+](=O)C1=C(Cl)C=CC2=C1C=CS2 JOKOYDYGIPVGNU-UHFFFAOYSA-N 0.000 description 2
- WENSDTZOUQRQKZ-UHFFFAOYSA-N 6-chloro-7-nitro-1-benzothiophene Chemical class [O-][N+](=O)C1=C(Cl)C=CC2=C1SC=C2 WENSDTZOUQRQKZ-UHFFFAOYSA-N 0.000 description 2
- GSFKSRJPOHSIKM-UHFFFAOYSA-N 7-nitro-1-benzothiophene 1,1-dioxide Chemical compound [O-][N+](=O)C1=CC=CC2=C1S(=O)(=O)C=C2 GSFKSRJPOHSIKM-UHFFFAOYSA-N 0.000 description 2
- 235000003276 Apios tuberosa Nutrition 0.000 description 2
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical class NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 2
- 235000011293 Brassica napus Nutrition 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241001233914 Chelidonium majus Species 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- 206010029897 Obsessive thoughts Diseases 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241001300423 Strophostyles Species 0.000 description 2
- 229940100389 Sulfonylurea Drugs 0.000 description 2
- 241000245665 Taraxacum Species 0.000 description 2
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical class O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229940008075 allyl sulfide Drugs 0.000 description 2
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000005243 fluidization Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- XEPFDPFEEIGEJG-UHFFFAOYSA-N n-(1,1-dioxo-1-benzothiophen-7-yl)acetamide Chemical class CC(=O)NC1=CC=CC2=C1S(=O)(=O)C=C2 XEPFDPFEEIGEJG-UHFFFAOYSA-N 0.000 description 2
- JMPSAASTWSUILQ-UHFFFAOYSA-N n-(1,1-dioxo-2,3-dihydro-1-benzothiophen-7-yl)acetamide Chemical class CC(=O)NC1=CC=CC2=C1S(=O)(=O)CC2 JMPSAASTWSUILQ-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000003586 protic polar solvent Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002893 slag Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 2
- 239000012970 tertiary amine catalyst Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- MOJHRSXMOXAOKK-UHFFFAOYSA-N (1-aminotriazol-4-yl)methanol Chemical compound NN1C=C(CO)N=N1 MOJHRSXMOXAOKK-UHFFFAOYSA-N 0.000 description 1
- MVPIPOOIACGIOA-UHFFFAOYSA-N 1,1-dioxo-2,3-dihydro-1-benzothiophene-7-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CC2=C1S(=O)(=O)CC2 MVPIPOOIACGIOA-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- KCZIUKYAJJEIQG-UHFFFAOYSA-N 1,3,5-triazin-2-amine Chemical class NC1=NC=NC=N1 KCZIUKYAJJEIQG-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical class NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OGMBXKYJNLWIIG-UHFFFAOYSA-N 1-aminotriazole-4-thiol Chemical compound NN1C=C(S)N=N1 OGMBXKYJNLWIIG-UHFFFAOYSA-N 0.000 description 1
- PZJCFEKARHVHCQ-UHFFFAOYSA-N 1-benzofuran-2-ylsulfonylurea Chemical class C1=CC=C2OC(S(=O)(=O)NC(=O)N)=CC2=C1 PZJCFEKARHVHCQ-UHFFFAOYSA-N 0.000 description 1
- NIGNBCLEMMGDQP-UHFFFAOYSA-N 1-benzothiepine Chemical class S1C=CC=CC2=CC=CC=C12 NIGNBCLEMMGDQP-UHFFFAOYSA-N 0.000 description 1
- BMRZGYNNZTVECK-UHFFFAOYSA-N 1-benzothiophen-4-ol Chemical compound OC1=CC=CC2=C1C=CS2 BMRZGYNNZTVECK-UHFFFAOYSA-N 0.000 description 1
- GCMUDSUJOMUXKE-UHFFFAOYSA-N 1-benzothiophen-7-ol Chemical compound OC1=CC=CC2=C1SC=C2 GCMUDSUJOMUXKE-UHFFFAOYSA-N 0.000 description 1
- LWZYUACNWRVDDJ-UHFFFAOYSA-N 1-benzoxepine Chemical compound O1C=CC=CC2=CC=CC=C12 LWZYUACNWRVDDJ-UHFFFAOYSA-N 0.000 description 1
- QWAVNXZAQASOML-UHFFFAOYSA-N 1-phenoxypropan-2-one Chemical class CC(=O)COC1=CC=CC=C1 QWAVNXZAQASOML-UHFFFAOYSA-N 0.000 description 1
- SUQFCVOFANWOMT-UHFFFAOYSA-N 2,2-dioxo-1,3,2-dioxathietan-4-one Chemical compound O=C1OS(=O)(=O)O1 SUQFCVOFANWOMT-UHFFFAOYSA-N 0.000 description 1
- YTQQIHUQLOZOJI-UHFFFAOYSA-N 2,3-dihydro-1,2-thiazole Chemical compound C1NSC=C1 YTQQIHUQLOZOJI-UHFFFAOYSA-N 0.000 description 1
- RWPLKRGISDOAAG-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-4-amine Chemical compound NC1=CC=CC2=C1CCO2 RWPLKRGISDOAAG-UHFFFAOYSA-N 0.000 description 1
- YJUFGFXVASPYFQ-UHFFFAOYSA-N 2,3-dihydro-1-benzothiophene Chemical class C1=CC=C2SCCC2=C1 YJUFGFXVASPYFQ-UHFFFAOYSA-N 0.000 description 1
- NKPTVQFJWGCELJ-UHFFFAOYSA-N 2,3-dihydro-1-benzothiophene 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)CCC2=C1 NKPTVQFJWGCELJ-UHFFFAOYSA-N 0.000 description 1
- HIOHVHJNFQYADX-UHFFFAOYSA-N 2,3-dimethyl-1-benzofuran-7-amine Chemical compound C1=CC=C2C(C)=C(C)OC2=C1N HIOHVHJNFQYADX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- PMGFHEJUUBDCLU-UHFFFAOYSA-N 2-aminoguanidine;nitric acid Chemical compound O[N+]([O-])=O.NN=C(N)N PMGFHEJUUBDCLU-UHFFFAOYSA-N 0.000 description 1
- OVXJWSYBABKZMD-UHFFFAOYSA-N 2-chloro-1,1-diethoxyethane Chemical compound CCOC(CCl)OCC OVXJWSYBABKZMD-UHFFFAOYSA-N 0.000 description 1
- NDZXMOIVBGRFLC-UHFFFAOYSA-N 2-chloro-1,1-diethoxypropane Chemical compound CCOC(C(C)Cl)OCC NDZXMOIVBGRFLC-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- DRJZUEHEOHJEJW-UHFFFAOYSA-N 2-methyl-2,3-dihydro-1-benzofuran-7-amine Chemical compound C1=CC(N)=C2OC(C)CC2=C1 DRJZUEHEOHJEJW-UHFFFAOYSA-N 0.000 description 1
- OYJSYUMGPXRKRC-UHFFFAOYSA-N 2-methyl-2,3-dihydro-1-benzothiophen-7-amine Chemical compound C1=CC(N)=C2SC(C)CC2=C1 OYJSYUMGPXRKRC-UHFFFAOYSA-N 0.000 description 1
- HZKSZLFLAYUSJO-UHFFFAOYSA-N 2-methyl-4-nitro-2,3-dihydro-1-benzofuran-5-amine Chemical compound C1=CC(N)=C([N+]([O-])=O)C2=C1OC(C)C2 HZKSZLFLAYUSJO-UHFFFAOYSA-N 0.000 description 1
- OEEJLOZQSKNWQQ-UHFFFAOYSA-N 2-nitro-1-benzothiophene Chemical class C1=CC=C2SC([N+](=O)[O-])=CC2=C1 OEEJLOZQSKNWQQ-UHFFFAOYSA-N 0.000 description 1
- JKIFPWHZEZQCQA-UHFFFAOYSA-N 2-nitrobenzenethiol Chemical class [O-][N+](=O)C1=CC=CC=C1S JKIFPWHZEZQCQA-UHFFFAOYSA-N 0.000 description 1
- ONJRTQUWKRDCTA-UHFFFAOYSA-N 2h-thiochromene Chemical compound C1=CC=C2C=CCSC2=C1 ONJRTQUWKRDCTA-UHFFFAOYSA-N 0.000 description 1
- DHXNZYCXMFBMHE-UHFFFAOYSA-M 3-bromopropanoate Chemical compound [O-]C(=O)CCBr DHXNZYCXMFBMHE-UHFFFAOYSA-M 0.000 description 1
- JUHWLXRDVSBGOO-UHFFFAOYSA-N 3-methoxy-1h-1,2,4-triazol-5-amine Chemical compound COC1=NNC(N)=N1 JUHWLXRDVSBGOO-UHFFFAOYSA-N 0.000 description 1
- XGWWZKBCQLBJNH-UHFFFAOYSA-N 3-methylsulfanyl-1h-1,2,4-triazol-5-amine Chemical compound CSC1=NN=C(N)N1 XGWWZKBCQLBJNH-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical class OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- LVFRCHIUUKWBLR-UHFFFAOYSA-N 4,6-dimethoxypyrimidin-2-amine Chemical compound COC1=CC(OC)=NC(N)=N1 LVFRCHIUUKWBLR-UHFFFAOYSA-N 0.000 description 1
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 4-Chromanone Chemical class C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- SMTGVJNPFRLURH-UHFFFAOYSA-N 4-ethyltriazol-1-amine Chemical compound CCC1=CN(N)N=N1 SMTGVJNPFRLURH-UHFFFAOYSA-N 0.000 description 1
- 229940073735 4-hydroxy acetophenone Drugs 0.000 description 1
- SNWZXTZIZWBIDQ-UHFFFAOYSA-N 4-methoxy-6-methylpyrimidin-2-amine Chemical compound COC1=CC(C)=NC(N)=N1 SNWZXTZIZWBIDQ-UHFFFAOYSA-N 0.000 description 1
- ICGLPKIVTVWCFT-UHFFFAOYSA-N 4-methylbenzenesulfonohydrazide Chemical compound CC1=CC=C(S(=O)(=O)NN)C=C1 ICGLPKIVTVWCFT-UHFFFAOYSA-N 0.000 description 1
- LVILGAOSPDLNRM-UHFFFAOYSA-N 4-methylpyrimidine Chemical compound CC1=CC=NC=N1 LVILGAOSPDLNRM-UHFFFAOYSA-N 0.000 description 1
- PSTGSSGTRNEEBA-UHFFFAOYSA-N 4-methyltriazol-1-amine Chemical compound CC1=CN(N)N=N1 PSTGSSGTRNEEBA-UHFFFAOYSA-N 0.000 description 1
- UIARBASUQGZECQ-UHFFFAOYSA-N 5-chloro-4-nitro-2,3-dihydro-1-benzofuran Chemical class C1=C(Cl)C([N+](=O)[O-])=C2CCOC2=C1 UIARBASUQGZECQ-UHFFFAOYSA-N 0.000 description 1
- MWWWIBCZKNDADW-UHFFFAOYSA-N 5-chloro-4-nitro-2,3-dihydro-1-benzothiophene Chemical compound C1=C(Cl)C([N+](=O)[O-])=C2CCSC2=C1 MWWWIBCZKNDADW-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- LYZSVDRQKFXVPJ-UHFFFAOYSA-N 6-chloro-7-nitro-2,3-dihydro-1-benzofuran Chemical class C1=C(Cl)C([N+](=O)[O-])=C2OCCC2=C1 LYZSVDRQKFXVPJ-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- ZSWIGXOEYLXNKY-UHFFFAOYSA-N 8-nitro-2h-chromene Chemical compound C1=CCOC2=C1C=CC=C2[N+](=O)[O-] ZSWIGXOEYLXNKY-UHFFFAOYSA-N 0.000 description 1
- PUAKZCYBNAOEIK-UHFFFAOYSA-N 8-nitro-3,4-dihydro-2h-chromene Chemical compound C1CCOC2=C1C=CC=C2[N+](=O)[O-] PUAKZCYBNAOEIK-UHFFFAOYSA-N 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical class NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 235000002470 Asclepias syriaca Nutrition 0.000 description 1
- 244000000594 Asclepias syriaca Species 0.000 description 1
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 235000014698 Brassica juncea var multisecta Nutrition 0.000 description 1
- 235000006008 Brassica napus var napus Nutrition 0.000 description 1
- 235000006618 Brassica rapa subsp oleifera Nutrition 0.000 description 1
- 244000188595 Brassica sinapistrum Species 0.000 description 1
- 241000269420 Bufonidae Species 0.000 description 1
- 241000219357 Cactaceae Species 0.000 description 1
- 244000277285 Cassia obtusifolia Species 0.000 description 1
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 1
- 244000201986 Cassia tora Species 0.000 description 1
- 235000014552 Cassia tora Nutrition 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- 235000007542 Cichorium intybus Nutrition 0.000 description 1
- 244000298479 Cichorium intybus Species 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 240000009226 Corylus americana Species 0.000 description 1
- 235000001543 Corylus americana Nutrition 0.000 description 1
- 235000007466 Corylus avellana Nutrition 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 235000016854 Cyperus rotundus Nutrition 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 239000001836 Dioctyl sodium sulphosuccinate Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 241001071795 Gentiana Species 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 244000207740 Lemna minor Species 0.000 description 1
- 235000006439 Lemna minor Nutrition 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 241001435619 Lile Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 235000009421 Myristica fragrans Nutrition 0.000 description 1
- 244000270834 Myristica fragrans Species 0.000 description 1
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 1
- DIWMFONYCJAWIW-UHFFFAOYSA-N NS([S+]1C(C=CC=C2)=C2C=CC=C1)(=O)=O Chemical compound NS([S+]1C(C=CC=C2)=C2C=CC=C1)(=O)=O DIWMFONYCJAWIW-UHFFFAOYSA-N 0.000 description 1
- 241000750004 Nestor meridionalis Species 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 241001668545 Pascopyrum Species 0.000 description 1
- 241001307210 Pene Species 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- 235000005632 Phalaris canariensis Nutrition 0.000 description 1
- 208000012641 Pigmentation disease Diseases 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- 241001355178 Setaria faberi Species 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 244000010062 Setaria pumila Species 0.000 description 1
- 240000006410 Sida spinosa Species 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 241000746966 Zizania Species 0.000 description 1
- 235000002636 Zizania aquatica Nutrition 0.000 description 1
- 150000001241 acetals Chemical group 0.000 description 1
- 239000012445 acidic reagent Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000004964 aerogel Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical class BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229940063656 aluminum chloride Drugs 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- LGEQQWMQCRIYKG-DOFZRALJSA-N anandamide Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)NCCO LGEQQWMQCRIYKG-DOFZRALJSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000002519 antifouling agent Substances 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004421 aryl sulphonamide group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 208000027697 autoimmune lymphoproliferative syndrome due to CTLA4 haploinsuffiency Diseases 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 150000001562 benzopyrans Chemical class 0.000 description 1
- 150000005119 benzoxepines Chemical class 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- BKMYCYCJQUNQBL-UHFFFAOYSA-N butylsulfonylurea Chemical class CCCCS(=O)(=O)NC(N)=O BKMYCYCJQUNQBL-UHFFFAOYSA-N 0.000 description 1
- CNWSQCLBDWYLAN-UHFFFAOYSA-N butylurea Chemical compound CCCCNC(N)=O CNWSQCLBDWYLAN-UHFFFAOYSA-N 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 150000004777 chromones Chemical class 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 150000001907 coumarones Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- FKTUXVQEOXYNMO-UHFFFAOYSA-N cyanocarbamodithioic acid Chemical compound SC(=S)NC#N FKTUXVQEOXYNMO-UHFFFAOYSA-N 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 235000020774 essential nutrients Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- CJTDBBPQNDKTLR-UHFFFAOYSA-N ethyl 2-cyanoethanimidate Chemical compound CCOC(=N)CC#N CJTDBBPQNDKTLR-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- PLVWUINOWYHRAA-UHFFFAOYSA-N ethyl n-cyanoethanimidate Chemical compound CCOC(C)=NC#N PLVWUINOWYHRAA-UHFFFAOYSA-N 0.000 description 1
- MWIGGUZSIJZLJM-UHFFFAOYSA-N ethyl n-cyanomethanimidate Chemical compound CCOC=NC#N MWIGGUZSIJZLJM-UHFFFAOYSA-N 0.000 description 1
- ATZIPACKTBIFAX-UHFFFAOYSA-N ethyl propanimidate;hydrochloride Chemical compound Cl.CCOC(=N)CC ATZIPACKTBIFAX-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000002828 fuel tank Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 230000012447 hatching Effects 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical class [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- TVZISJTYELEYPI-UHFFFAOYSA-N hypodiphosphoric acid Chemical compound OP(O)(=O)P(O)(O)=O TVZISJTYELEYPI-UHFFFAOYSA-N 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- VGYWBWHGPATCBZ-UHFFFAOYSA-N methyl n-(4-methoxy-6-methylpyrimidin-2-yl)carbamate Chemical compound COC(=O)NC1=NC(C)=CC(OC)=N1 VGYWBWHGPATCBZ-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- IXCKOXLJNNFOCM-UHFFFAOYSA-N n,n,2-triethylaniline Chemical compound CCN(CC)C1=CC=CC=C1CC IXCKOXLJNNFOCM-UHFFFAOYSA-N 0.000 description 1
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 1
- XTODEBKTNUVROE-UHFFFAOYSA-N n-(1-benzofuran-7-yl)acetamide Chemical compound CC(=O)NC1=CC=CC2=C1OC=C2 XTODEBKTNUVROE-UHFFFAOYSA-N 0.000 description 1
- IVUUEQSCGDMSDQ-UHFFFAOYSA-N n-(1-benzothiophen-7-yl)acetamide Chemical compound CC(=O)NC1=CC=CC2=C1SC=C2 IVUUEQSCGDMSDQ-UHFFFAOYSA-N 0.000 description 1
- DVYYZZKFDGCHBM-UHFFFAOYSA-N n-(1-oxo-2,3-dihydro-1-benzothiophen-7-yl)acetamide Chemical class CC(=O)NC1=CC=CC2=C1S(=O)CC2 DVYYZZKFDGCHBM-UHFFFAOYSA-N 0.000 description 1
- RJPCPSWLPCHPHG-UHFFFAOYSA-N n-(2,3-dihydro-1-benzothiophen-7-yl)acetamide Chemical class CC(=O)NC1=CC=CC2=C1SCC2 RJPCPSWLPCHPHG-UHFFFAOYSA-N 0.000 description 1
- DTXNEMUOZGTFQA-UHFFFAOYSA-N n-(2-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-7-yl)acetamide Chemical compound C1=CC(NC(C)=O)=C2S(=O)(=O)C(C)CC2=C1 DTXNEMUOZGTFQA-UHFFFAOYSA-N 0.000 description 1
- BUYXTMVPKDFVRG-UHFFFAOYSA-N n-(2h-thiochromen-8-yl)acetamide Chemical compound C1=CCSC2=C1C=CC=C2NC(=O)C BUYXTMVPKDFVRG-UHFFFAOYSA-N 0.000 description 1
- LOVVPMWAHUSQSJ-UHFFFAOYSA-N n-(4-nitrophenyl)-4-oxo-4h-pyrido[1,2-a]thieno[2,3-d]pyrimidine-2-carboxamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1NC(=O)C(S1)=CC(C2=O)=C1N=C1N2C=CC=C1 LOVVPMWAHUSQSJ-UHFFFAOYSA-N 0.000 description 1
- DUDBXAHYGSLWJT-UHFFFAOYSA-N n-(oxomethylidene)-2h-thiochromene-8-sulfonamide Chemical compound C1=CCSC2=C1C=CC=C2S(=O)(=O)N=C=O DUDBXAHYGSLWJT-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- CQEQGGWLBYIMLV-UHFFFAOYSA-N n-tert-butyl-2,2-dimethyl-3h-1-benzothiophene-7-sulfonamide Chemical compound CC(C)(C)NS(=O)(=O)C1=CC=CC2=C1SC(C)(C)C2 CQEQGGWLBYIMLV-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- LJDZFAPLPVPTBD-UHFFFAOYSA-N nitroformic acid Chemical class OC(=O)[N+]([O-])=O LJDZFAPLPVPTBD-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000001702 nutmeg Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- LYKMMUBOEFYJQG-UHFFFAOYSA-N piperoxan Chemical compound C1OC2=CC=CC=C2OC1CN1CCCCC1 LYKMMUBOEFYJQG-UHFFFAOYSA-N 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- POSICDHOUBKJKP-UHFFFAOYSA-N prop-2-enoxybenzene Chemical compound C=CCOC1=CC=CC=C1 POSICDHOUBKJKP-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- IDXKTTNFXPPXJY-UHFFFAOYSA-N pyrimidin-1-ium;chloride Chemical compound Cl.C1=CN=CN=C1 IDXKTTNFXPPXJY-UHFFFAOYSA-N 0.000 description 1
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 235000002020 sage Nutrition 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000008054 sulfonate salts Chemical class 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000006055 thio-Claisen rearrangement reaction Methods 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- LWRYDHOHXNQTSK-UHFFFAOYSA-N thiophene oxide Chemical class O=S1C=CC=C1 LWRYDHOHXNQTSK-UHFFFAOYSA-N 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 229930003799 tocopherol Natural products 0.000 description 1
- 239000011732 tocopherol Substances 0.000 description 1
- 235000019149 tocopherols Nutrition 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- APEJMQOBVMLION-VOTSOKGWSA-N trans-cinnamamide Chemical compound NC(=O)\C=C\C1=CC=CC=C1 APEJMQOBVMLION-VOTSOKGWSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- QUEDXNHFTDJVIY-UHFFFAOYSA-N γ-tocopherol Chemical class OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1 QUEDXNHFTDJVIY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D521/00—Heterocyclic compounds containing unspecified hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Indole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Furan Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31218381A | 1981-10-16 | 1981-10-16 | |
| US06/406,191 US4492596A (en) | 1982-08-11 | 1982-08-11 | Phenyl-substituted sulfonamides |
| US41099382A | 1982-08-27 | 1982-08-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU192121B true HU192121B (en) | 1987-05-28 |
Family
ID=27405567
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU329082A HU192121B (en) | 1981-10-16 | 1982-10-15 | Herbicide compositions containing phenyl-substituted sulfonamide derivatives and process for producing the active avents |
Country Status (14)
| Country | Link |
|---|---|
| EP (1) | EP0079683B1 (enExample) |
| JP (1) | JPS5879992A (enExample) |
| KR (1) | KR890002092B1 (enExample) |
| AU (1) | AU591450B2 (enExample) |
| BR (1) | BR8206012A (enExample) |
| DE (1) | DE3276236D1 (enExample) |
| DK (1) | DK456982A (enExample) |
| ES (3) | ES8401019A1 (enExample) |
| GR (1) | GR77013B (enExample) |
| HU (1) | HU192121B (enExample) |
| IE (1) | IE54064B1 (enExample) |
| NZ (1) | NZ202182A (enExample) |
| PT (1) | PT75689B (enExample) |
| TR (1) | TR21760A (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4465506A (en) * | 1981-12-17 | 1984-08-14 | E. I. Dupont De Nemours And Company | Herbicidal N-[heterocyclicaminocarbonyl]-1H-indene and tetrahydronaphthalene sulfonamides |
| US4586950A (en) * | 1982-05-31 | 1986-05-06 | E. I. Du Pont De Nemours & Company | Novel phenyl-substituted sulfonamides |
| US4634465A (en) * | 1982-07-16 | 1987-01-06 | Ciba-Geigy Corporation | Fused N-phenylsulfonyl-N'-pyrimidinylureas and N-phenylsulfonyl-N'triazinylureas |
| ATE32892T1 (de) * | 1982-08-23 | 1988-03-15 | Ciba Geigy Ag | Verfahren zur herstellung von herbiziden und pflanzenwuchsregulierenden sulfonylharnstoffen. |
| IT1161220B (it) * | 1983-04-21 | 1987-03-18 | Montedison Spa | Diidro-benzofurano derivati ad attivita' erbicida |
| US4589911A (en) * | 1983-05-11 | 1986-05-20 | Ciba-Geigy Corporation | Fused N-phenylsulfonyl-N-triazinylureas |
| US4521241A (en) * | 1983-09-19 | 1985-06-04 | E. I. Du Pont De Nemours And Company | Herbicidal benzenesulfonamides |
| US4620870A (en) * | 1983-09-20 | 1986-11-04 | E. I. Du Pont De Nemours And Company | Phenyl-substituted sulfonamides |
| US4683000A (en) * | 1983-12-22 | 1987-07-28 | E. I. Du Pont De Nemours And Comany | Herbicidal sulfonamides |
| US4622062A (en) * | 1984-02-09 | 1986-11-11 | E. I. Du Pont De Nemours And Company | Herbicidal N-[(4,6-substituted pyrimidin-2-yl)aminocarbonyl]-substituted fused pyrazole-3-sulfonamides |
| EP0333304A3 (en) * | 1984-02-21 | 1990-07-25 | E.I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| AU570298B2 (en) * | 1984-02-21 | 1988-03-10 | E.I. Du Pont De Nemours And Company | Aryl or heterocyclic sulfonyl urea derivatives with herbicidal properties |
| US4609395A (en) * | 1984-03-01 | 1986-09-02 | E. I. Du Pont De Nemours And Company | Novel benzylsulfonylureas and arylsulfamoylureas N-[(substituted pyrimidin-2-yl)aminocarbonyl]-1-oxo-fused benzyl-7-methanesulfonamides useful as herbicides and plant growth regulants |
| US4853025A (en) * | 1984-03-01 | 1989-08-01 | E. I. Du Pont De Nemour And Company | Benzylsulfonylureas and arylsulfamoylureas |
| US4746355A (en) * | 1984-12-26 | 1988-05-24 | E. I. Du Pont De Nemours And Company | Benzylsulfonylureas and arylsulfamoylureas |
| EP0158600B1 (de) * | 1984-04-11 | 1991-04-03 | Ciba-Geigy Ag | Verfahren zur selektiven Unkrautbekämpfung in Nutzpflanzenkulturen |
| AU579369B2 (en) * | 1984-05-07 | 1988-11-24 | E.I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| CA1229086A (en) * | 1984-05-09 | 1987-11-10 | Hugh M. Brown | Herbicidal halopyrimidines |
| US4795485A (en) * | 1985-03-01 | 1989-01-03 | E. I. Du Pont De Nemours And Company | Phenyl-substituted sulfonamides |
| US4723987A (en) * | 1985-05-09 | 1988-02-09 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| CA1234812A (en) * | 1985-05-14 | 1988-04-05 | Donald J. Dumas | Herbicidal sulfonamides |
| US4741765A (en) * | 1986-01-30 | 1988-05-03 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| DK174587A (da) * | 1986-04-07 | 1987-10-08 | Du Pont | Herbicide sulfonamider |
| US4838929A (en) * | 1986-04-22 | 1989-06-13 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| KR20030061474A (ko) * | 2002-01-14 | 2003-07-22 | 한미약품 주식회사 | 서트랄린 제조용 중간체로서 사용되는 시스-라세메이트화합물의 개선된 제조방법 |
| EP1836894A1 (de) | 2006-03-25 | 2007-09-26 | Bayer CropScience GmbH | Neue Sulfonamid-haltige feste Formulungen |
| DE102007013362A1 (de) | 2007-03-16 | 2008-09-18 | Bayer Cropscience Ag | Penetrationsförderer für herbizide Wirkstoffe |
| EP1844654A1 (de) | 2006-03-29 | 2007-10-17 | Bayer CropScience GmbH | Penetrationsförderer für agrochemische Wirkstoffe |
| CN101517084B (zh) | 2006-09-22 | 2014-12-10 | 丹尼斯科美国公司 | 来自里氏木霉的乙酰乳酸合酶(als)选择性标记 |
| RU2522524C2 (ru) | 2008-09-04 | 2014-07-20 | Акцо Нобель Н.В. | Вязкоупругая система для снижения сноса |
| EP2193712A1 (de) | 2008-12-05 | 2010-06-09 | Bayer CropScience AG | Dispersionen enthaltend Inhibitoren der Hydroxyphenylpyruvat-Dioxygenase |
| WO2011076731A1 (de) | 2009-12-23 | 2011-06-30 | Bayer Cropscience Ag | Flüssige formulierung von 2-iodo-n-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamid |
| WO2012110517A1 (en) | 2011-02-15 | 2012-08-23 | Bayer Cropscience Ag | Synergistic combinations containing a dithiino-tetracarboxamide fungicide and a herbicide, safener or plant growth regulator |
| DE102011080020A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Dicarboximid-Fungizide als Safener |
| DE102011079997A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Corpscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Pyrazol-Insektizide als Safener |
| DE102011079991A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Crop Science Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Nicotinoid-Insektizide als Safener |
| DE102011080010A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Anilid- und Thiazol-Fungizide als Safener |
| DE102011080007A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Conazole- und Triazol-Fungizide als Safener |
| DE102011080004A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Fungizide als Safener |
| DE102011080001A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Insektizide als Safener |
| DE102011080016A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Strobilurin-Fungizide als Safener |
| WO2014060502A1 (en) | 2012-10-19 | 2014-04-24 | Bayer Cropscience Ag | Active compound combinations comprising carboxamide derivatives |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| OA05625A (fr) * | 1976-04-07 | 1981-04-30 | Du Pont | N-(hétérocyclique aminocarbonyl) aryl sulfonamides herbicides, compositions les contenant et procédés les utilisant . |
| DK37880A (da) * | 1979-02-22 | 1980-08-23 | Du Pont | Herbicide sulfonamider |
| US4391627A (en) * | 1980-07-25 | 1983-07-05 | E. I. Du Pont De Nemours And Company | Herbicidal benzothiophene and benzofuran sulfonamides |
| US4634465A (en) * | 1982-07-16 | 1987-01-06 | Ciba-Geigy Corporation | Fused N-phenylsulfonyl-N'-pyrimidinylureas and N-phenylsulfonyl-N'triazinylureas |
| AU567896B2 (en) * | 1982-10-29 | 1987-12-10 | Chloride Group Public Limited Company | Multicell storage battery |
-
1982
- 1982-10-14 BR BR8206012A patent/BR8206012A/pt unknown
- 1982-10-14 AU AU89354/82A patent/AU591450B2/en not_active Ceased
- 1982-10-14 DK DK456982A patent/DK456982A/da not_active Application Discontinuation
- 1982-10-14 ES ES516504A patent/ES8401019A1/es not_active Expired
- 1982-10-15 DE DE8282305498T patent/DE3276236D1/de not_active Expired
- 1982-10-15 EP EP82305498A patent/EP0079683B1/en not_active Expired
- 1982-10-15 HU HU329082A patent/HU192121B/hu not_active IP Right Cessation
- 1982-10-15 JP JP18005882A patent/JPS5879992A/ja active Pending
- 1982-10-15 NZ NZ20218282A patent/NZ202182A/en unknown
- 1982-10-15 GR GR69550A patent/GR77013B/el unknown
- 1982-10-15 TR TR2176082A patent/TR21760A/xx unknown
- 1982-10-15 IE IE249182A patent/IE54064B1/en unknown
- 1982-10-15 PT PT7568982A patent/PT75689B/pt not_active IP Right Cessation
- 1982-10-16 KR KR8204673A patent/KR890002092B1/ko not_active Expired
-
1983
- 1983-05-31 ES ES522843A patent/ES522843A0/es active Granted
- 1983-05-31 ES ES522842A patent/ES522842A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IE822491L (en) | 1983-04-16 |
| PT75689B (en) | 1985-12-03 |
| ES8501754A1 (es) | 1984-12-01 |
| ES516504A0 (es) | 1983-11-16 |
| KR890002092B1 (ko) | 1989-06-18 |
| AU591450B2 (en) | 1989-12-07 |
| PT75689A (en) | 1982-11-01 |
| AU8935482A (en) | 1983-04-21 |
| ES8406429A1 (es) | 1984-07-16 |
| EP0079683B1 (en) | 1987-05-06 |
| EP0079683A2 (en) | 1983-05-25 |
| KR840002001A (ko) | 1984-06-11 |
| TR21760A (tr) | 1985-06-06 |
| BR8206012A (pt) | 1983-09-13 |
| JPS5879992A (ja) | 1983-05-13 |
| GR77013B (enExample) | 1984-09-04 |
| DE3276236D1 (en) | 1987-06-11 |
| ES522842A0 (es) | 1984-12-01 |
| IE54064B1 (en) | 1989-06-07 |
| NZ202182A (en) | 1985-11-08 |
| ES522843A0 (es) | 1984-07-16 |
| DK456982A (da) | 1983-04-17 |
| EP0079683A3 (en) | 1983-11-16 |
| ES8401019A1 (es) | 1983-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU192121B (en) | Herbicide compositions containing phenyl-substituted sulfonamide derivatives and process for producing the active avents | |
| US4169719A (en) | Herbicidal sulfonamides | |
| US4391627A (en) | Herbicidal benzothiophene and benzofuran sulfonamides | |
| US4191553A (en) | Herbicidal sulfamates | |
| CA1229607A (en) | N-(cyclopropyl-triazinyl-and-pyrimidinyl-n'- (arylsulfonyl)ureas having herbicidal activity | |
| US4441910A (en) | Thiophene or furan herbicides | |
| US4342587A (en) | Herbicidal pyridinsulfonamides | |
| US4302241A (en) | Agricultural sulfonamides | |
| US4368069A (en) | Herbicidal sulfonamides | |
| US4348219A (en) | Herbicidal sulfonamides | |
| US4514211A (en) | Benzofuran and benzothiophene sulfonamides | |
| HU181423B (en) | Herbicide and growth-inhibiting preparations containing sulphonamides | |
| US4595407A (en) | Triazinyl-amino-carbonyl-1,3-benzohetero- or -1,4-benzohetero-sulfonamides | |
| US4368067A (en) | Herbicidal sulfonamides | |
| EP0039239A2 (en) | Herbicidal pyrrole sulfonamides | |
| EP0161905A2 (en) | Herbicidal halopyrimidines | |
| US4491467A (en) | Herbicidal sulfonamides | |
| EP0082681A2 (en) | Herbicidal sulfonamides | |
| US4465506A (en) | Herbicidal N-[heterocyclicaminocarbonyl]-1H-indene and tetrahydronaphthalene sulfonamides | |
| US4502882A (en) | Substituted sulfonamides 1,3-benzodioxole | |
| US5163996A (en) | Sulfonylureas | |
| US4555261A (en) | Herbicidal sulfonamides | |
| US4461640A (en) | Herbicidal alkenyl sulfonamides | |
| US4604131A (en) | Herbicidal sulfonamides | |
| PH26072A (en) | Heterocyclic-substituted phenylsulfamates processes for their preparation and their use as herbicides and plant growth regulators |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |