HU176873B - Herbicide composition for algae and water plants - Google Patents
Herbicide composition for algae and water plants Download PDFInfo
- Publication number
- HU176873B HU176873B HUSA003049A HU176873B HU 176873 B HU176873 B HU 176873B HU SA003049 A HUSA003049 A HU SA003049A HU 176873 B HU176873 B HU 176873B
- Authority
- HU
- Hungary
- Prior art keywords
- copper
- complex
- agent
- amine
- formula
- Prior art date
Links
- 241000195493 Cryptophyta Species 0.000 title claims description 19
- 239000000203 mixture Substances 0.000 title claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title abstract description 20
- 230000002363 herbicidal effect Effects 0.000 title abstract description 14
- 239000004009 herbicide Substances 0.000 title abstract description 12
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims abstract description 21
- 150000001412 amines Chemical class 0.000 claims abstract description 19
- 241000196324 Embryophyta Species 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000010949 copper Substances 0.000 claims description 57
- 229910052802 copper Inorganic materials 0.000 claims description 45
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 44
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 21
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical group O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 claims description 9
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 7
- 239000008096 xylene Substances 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 claims description 3
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 claims description 2
- 235000011069 sorbitan monooleate Nutrition 0.000 claims description 2
- 239000001593 sorbitan monooleate Substances 0.000 claims description 2
- 229940035049 sorbitan monooleate Drugs 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 239000008139 complexing agent Substances 0.000 claims 2
- 239000012141 concentrate Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 9
- 239000007864 aqueous solution Substances 0.000 abstract description 6
- -1 copper (II) compound Chemical class 0.000 abstract description 6
- 150000001879 copper Chemical class 0.000 abstract description 5
- 239000005630 Diquat Substances 0.000 abstract description 4
- GXEKYRXVRROBEV-FBXFSONDSA-N (1r,2s,3r,4s)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid Chemical compound C1C[C@@H]2[C@@H](C(O)=O)[C@@H](C(=O)O)[C@H]1O2 GXEKYRXVRROBEV-FBXFSONDSA-N 0.000 abstract description 3
- 239000003619 algicide Substances 0.000 abstract description 3
- SYJFEGQWDCRVNX-UHFFFAOYSA-N diquat Chemical compound C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 SYJFEGQWDCRVNX-UHFFFAOYSA-N 0.000 abstract description 3
- 239000000839 emulsion Substances 0.000 abstract description 2
- 239000004215 Carbon black (E152) Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229930195733 hydrocarbon Natural products 0.000 abstract 1
- 230000000361 pesticidal effect Effects 0.000 abstract 1
- 229920006395 saturated elastomer Polymers 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 34
- JJLJMEJHUUYSSY-UHFFFAOYSA-L copper(II) hydroxide Inorganic materials [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 description 16
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 8
- AEJIMXVJZFYIHN-UHFFFAOYSA-N copper;dihydrate Chemical compound O.O.[Cu] AEJIMXVJZFYIHN-UHFFFAOYSA-N 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 6
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 6
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 6
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 description 5
- 239000011707 mineral Substances 0.000 description 5
- 235000010755 mineral Nutrition 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 241000498251 Hydrilla Species 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000010668 complexation reaction Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 2
- 241000251468 Actinopterygii Species 0.000 description 2
- 239000005750 Copper hydroxide Substances 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 2
- 241000544053 Egeria densa Species 0.000 description 2
- 241000169203 Eichhornia Species 0.000 description 2
- 241001113556 Elodea Species 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 241001113566 Hydrocharitaceae Species 0.000 description 2
- 241001134698 Lyngbya Species 0.000 description 2
- 241000192701 Microcystis Species 0.000 description 2
- 241000342009 Pithophora Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- YEOCHZFPBYUXMC-UHFFFAOYSA-L copper benzoate Chemical compound [Cu+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 YEOCHZFPBYUXMC-UHFFFAOYSA-L 0.000 description 2
- 229910001956 copper hydroxide Inorganic materials 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- GEZOTWYUIKXWOA-UHFFFAOYSA-L copper;carbonate Chemical compound [Cu+2].[O-]C([O-])=O GEZOTWYUIKXWOA-UHFFFAOYSA-L 0.000 description 2
- ZQLBQWDYEGOYSW-UHFFFAOYSA-L copper;disulfamate Chemical compound [Cu+2].NS([O-])(=O)=O.NS([O-])(=O)=O ZQLBQWDYEGOYSW-UHFFFAOYSA-L 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000002147 killing effect Effects 0.000 description 2
- 238000009533 lab test Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- QHJABUZHRJTCAR-UHFFFAOYSA-N n'-methylpropane-1,3-diamine Chemical compound CNCCCN QHJABUZHRJTCAR-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229960001124 trientine Drugs 0.000 description 2
- RDHNFSNXWLWMIX-UHFFFAOYSA-N 1-n,2-n-dimethylpropane-1,2-diamine Chemical compound CNCC(C)NC RDHNFSNXWLWMIX-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- ODPOAESBSUKMHD-UHFFFAOYSA-L 6,7-dihydrodipyrido[1,2-b:1',2'-e]pyrazine-5,8-diium;dibromide Chemical compound [Br-].[Br-].C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 ODPOAESBSUKMHD-UHFFFAOYSA-L 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000192542 Anabaena Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001478778 Cladophora Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical compound [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 241001035792 Dictyosphaerium Species 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 241000544050 Egeria Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000196173 Hydrodictyon Species 0.000 description 1
- 241000721656 Lepomis Species 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- 241001244589 Myriophyllum verticillatum Species 0.000 description 1
- 241000546131 Oedogonium Species 0.000 description 1
- 241000199919 Phaeophyceae Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 241000206572 Rhodophyta Species 0.000 description 1
- 241000196294 Spirogyra Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- DPRMFUAMSRXGDE-UHFFFAOYSA-N ac1o530g Chemical compound NCCN.NCCN DPRMFUAMSRXGDE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- VCTISDHTSRYNQM-UHFFFAOYSA-N copper 2-[bis(2-hydroxyethyl)amino]ethanolate Chemical compound [Cu++].OCCN(CCO)CC[O-].OCCN(CCO)CC[O-] VCTISDHTSRYNQM-UHFFFAOYSA-N 0.000 description 1
- 229940116318 copper carbonate Drugs 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 229910000009 copper(II) carbonate Inorganic materials 0.000 description 1
- MAUZTCHAIPUZJB-OLXYHTOASA-L copper;(2r,3r)-2,3-dihydroxybutanedioate;hydrate Chemical compound O.[Cu+2].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O MAUZTCHAIPUZJB-OLXYHTOASA-L 0.000 description 1
- IJCCOEGCVILSMZ-UHFFFAOYSA-L copper;dichlorate Chemical compound [Cu+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O IJCCOEGCVILSMZ-UHFFFAOYSA-L 0.000 description 1
- HFDWIMBEIXDNQS-UHFFFAOYSA-L copper;diformate Chemical compound [Cu+2].[O-]C=O.[O-]C=O HFDWIMBEIXDNQS-UHFFFAOYSA-L 0.000 description 1
- GPNKJBLELXHFFQ-UHFFFAOYSA-L copper;ethane-1,2-diamine;sulfate Chemical compound [Cu+2].NCCN.NCCN.[O-]S([O-])(=O)=O GPNKJBLELXHFFQ-UHFFFAOYSA-L 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000011646 cupric carbonate Substances 0.000 description 1
- 235000019854 cupric carbonate Nutrition 0.000 description 1
- 239000011642 cupric gluconate Substances 0.000 description 1
- 235000019856 cupric gluconate Nutrition 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UQUPIHHYKUEXQD-UHFFFAOYSA-N n,n′-dimethyl-1,3-propanediamine Chemical compound CNCCCNC UQUPIHHYKUEXQD-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- UXIJQZSBOOKEKZ-UHFFFAOYSA-N oxocopper hydrate Chemical compound O.[Cu]=O UXIJQZSBOOKEKZ-UHFFFAOYSA-N 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- WJKIGWPCVFLGAT-UHFFFAOYSA-N pyridine;dihydrobromide Chemical compound [Br-].[Br-].C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1 WJKIGWPCVFLGAT-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- KUNICNFETYAKKO-UHFFFAOYSA-N sulfuric acid;pentahydrate Chemical compound O.O.O.O.O.OS(O)(=O)=O KUNICNFETYAKKO-UHFFFAOYSA-N 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- LITQZINTSYBKIU-UHFFFAOYSA-F tetracopper;hexahydroxide;sulfate Chemical compound [OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Cu+2].[Cu+2].[Cu+2].[Cu+2].[O-]S([O-])(=O)=O LITQZINTSYBKIU-UHFFFAOYSA-F 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- STDMRMREKPZQFJ-UHFFFAOYSA-H tricopper;2-hydroxypropane-1,2,3-tricarboxylate Chemical compound [Cu+2].[Cu+2].[Cu+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O STDMRMREKPZQFJ-UHFFFAOYSA-H 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44349374A | 1974-02-19 | 1974-02-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU176873B true HU176873B (en) | 1981-05-28 |
Family
ID=23761000
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HUSA003049 HU176873B (en) | 1974-02-19 | 1975-02-18 | Herbicide composition for algae and water plants |
| HU75SA00002750A HU170893B (hu) | 1974-02-19 | 1975-02-18 | Sposob istreblenija al'gi i vodnykh trav |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75SA00002750A HU170893B (hu) | 1974-02-19 | 1975-02-18 | Sposob istreblenija al'gi i vodnykh trav |
Country Status (16)
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4098602A (en) * | 1976-06-28 | 1978-07-04 | Applied Biochemists, Inc. | Algaecidal composition |
| US4324578A (en) * | 1977-09-15 | 1982-04-13 | Applied Biochemists, Inc. | Method of preparing a copper complex for use as an algaecide |
| SE459164B (sv) * | 1981-05-08 | 1989-06-12 | Kenogard Ab | Traeskyddsmedel baserade paa konserverande metaller och organiska kvaeveinnehaallande foereningar samt anvaendning av medlet |
| US5426121A (en) * | 1994-10-04 | 1995-06-20 | Akzo Nobel N.V. | Wood preservation formulation comprising complex of a copper cation and alkoxylated diamine |
| ES2248511T3 (es) * | 2002-03-08 | 2006-03-16 | Bms Micro-Nutrients N.V. | Formulacion fitosanitaria que contiene un quelato de cobre-poliamina. |
-
1975
- 1975-02-07 CH CH154675A patent/CH604509A5/xx not_active IP Right Cessation
- 1975-02-15 DE DE19752506431 patent/DE2506431A1/de not_active Withdrawn
- 1975-02-17 FR FR7504884A patent/FR2260950B1/fr not_active Expired
- 1975-02-17 GB GB656775A patent/GB1491137A/en not_active Expired
- 1975-02-17 MX MX465675U patent/MX3820E/es unknown
- 1975-02-17 NZ NZ17668475A patent/NZ176684A/xx unknown
- 1975-02-18 SU SU2110614A patent/SU559614A3/ru active
- 1975-02-18 HU HUSA003049 patent/HU176873B/hu unknown
- 1975-02-18 BR BR7500983A patent/BR7500983A/pt unknown
- 1975-02-18 IT IT2037875A patent/IT1054605B/it active
- 1975-02-18 JP JP50020812A patent/JPS50117921A/ja active Pending
- 1975-02-18 HU HU75SA00002750A patent/HU170893B/hu unknown
- 1975-02-18 TR TR1908275A patent/TR19082A/xx unknown
- 1975-02-18 YU YU38475A patent/YU38475A/xx unknown
- 1975-02-19 ZA ZA00751041A patent/ZA751041B/xx unknown
-
1976
- 1976-02-16 IN IN277/CAL/1976A patent/IN144623B/en unknown
-
1981
- 1981-02-26 KE KE311981A patent/KE3119A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA751041B (en) | 1976-09-29 |
| CH604509A5 (enrdf_load_html_response) | 1978-09-15 |
| YU38475A (en) | 1982-02-28 |
| SU559614A3 (ru) | 1977-05-25 |
| FR2260950B1 (enrdf_load_html_response) | 1979-01-05 |
| AU7827375A (en) | 1976-08-19 |
| JPS50117921A (enrdf_load_html_response) | 1975-09-16 |
| HU170893B (hu) | 1977-09-28 |
| IN144623B (enrdf_load_html_response) | 1978-05-20 |
| FR2260950A1 (enrdf_load_html_response) | 1975-09-12 |
| TR19082A (tr) | 1978-05-01 |
| MX3820E (es) | 1981-07-30 |
| KE3119A (en) | 1981-04-10 |
| IT1054605B (it) | 1981-11-30 |
| DE2506431A1 (de) | 1975-09-18 |
| BR7500983A (pt) | 1975-12-02 |
| GB1491137A (en) | 1977-11-09 |
| NZ176684A (en) | 1978-03-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4098602A (en) | Algaecidal composition | |
| CA2247375C (en) | Synergistic antimicrobial compositions containing an ionene polymer and a salt of dodecylamine and methods of using the same | |
| AU641761B2 (en) | Herbicidal solutions based on N-phosphonomethylglycine | |
| AU728022B2 (en) | Herbicidal and plant growth regulant compositions and the use thereof | |
| US3930834A (en) | Algaecidal composition | |
| NO751651L (enrdf_load_html_response) | ||
| US4361435A (en) | Copper and amine based aquatic herbicides | |
| EP1258472A2 (en) | Quaternary ammonium salts having a tertiary alkyl group | |
| US2977279A (en) | Copper chelate coordination complexes | |
| US3856851A (en) | Potassium n-hydroxylmethyl-n-methyldithiocarbamate | |
| US4505734A (en) | Copper based algaecides and aquatic herbicides | |
| HU176873B (en) | Herbicide composition for algae and water plants | |
| DE69005464T2 (de) | Biozide Mittel und Behandlungsverfahren. | |
| EP0039538A1 (en) | Metal amine carboxylates and use thereof as preservatives | |
| US20100331416A1 (en) | Use of Monochlorourea to Treat Industrial Waters | |
| JPS5812243B2 (ja) | 安定な防菌防藻液剤 | |
| EP0606986B1 (en) | Iron stabilizers for 3-isothiazolones | |
| JPH02134302A (ja) | 抗菌組成物及びその使用方法 | |
| US3973034A (en) | Certain stabilized dithiocarbomate pesticidal compositions and methods of using same | |
| US20020136781A1 (en) | Method for making colloidal cupric compounds and their uses | |
| US20020177627A1 (en) | Microbiocidal properties of poly-substituted guanidinium salts | |
| JPS6270301A (ja) | 工業用殺菌組成物 | |
| US4578489A (en) | Ammonium stannates-(IV) | |
| US4363923A (en) | 4-Halgeno-oxetan-2-ones and process for their production | |
| CH604513A5 (en) | Herbicide for controlling aquatic weeds |