HU176287B - Process for producing 7-bracket-2-thienylacetamido-bracket closed-3-triasolylthiomethyl-3-cepheme-4-carboxylic acid derivative - Google Patents
Process for producing 7-bracket-2-thienylacetamido-bracket closed-3-triasolylthiomethyl-3-cepheme-4-carboxylic acid derivative Download PDFInfo
- Publication number
- HU176287B HU176287B HU75ME1960A HUME001960A HU176287B HU 176287 B HU176287 B HU 176287B HU 75ME1960 A HU75ME1960 A HU 75ME1960A HU ME001960 A HUME001960 A HU ME001960A HU 176287 B HU176287 B HU 176287B
- Authority
- HU
- Hungary
- Prior art keywords
- group
- carbon atoms
- carboxylic acid
- thienylacetamido
- cephem
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 22
- 150000003839 salts Chemical class 0.000 claims abstract description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 239000002253 acid Substances 0.000 claims abstract description 4
- -1 7- (2-thienylacetamido) -3-triazolylthiomethyl-3-cephem-4-carboxylic acid derivatives Chemical class 0.000 claims description 32
- 238000002360 preparation method Methods 0.000 claims description 7
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical class OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 230000000911 decarboxylating effect Effects 0.000 claims description 3
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- UUPZTFTUZUQRQT-UHFFFAOYSA-N 2-thiophen-2-ylacetamide Chemical compound NC(=O)CC1=CC=CS1 UUPZTFTUZUQRQT-UHFFFAOYSA-N 0.000 claims 1
- 150000001782 cephems Chemical class 0.000 claims 1
- 229930186147 Cephalosporin Natural products 0.000 abstract description 12
- 229940124587 cephalosporin Drugs 0.000 abstract description 12
- 125000000217 alkyl group Chemical group 0.000 abstract description 10
- 150000001780 cephalosporins Chemical class 0.000 abstract description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract description 3
- 230000003115 biocidal effect Effects 0.000 abstract description 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 11
- 125000005843 halogen group Chemical group 0.000 abstract 4
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 abstract 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 2
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 230000000845 anti-microbial effect Effects 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- 239000003242 anti bacterial agent Substances 0.000 description 7
- 229940088710 antibiotic agent Drugs 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000588767 Proteus vulgaris Species 0.000 description 3
- 241000607142 Salmonella Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 231100000053 low toxicity Toxicity 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- 229940007042 proteus vulgaris Drugs 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000003852 triazoles Chemical group 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- TVZRAEYQIKYCPH-UHFFFAOYSA-N 3-(trimethylsilyl)propane-1-sulfonic acid Chemical compound C[Si](C)(C)CCCS(O)(=O)=O TVZRAEYQIKYCPH-UHFFFAOYSA-N 0.000 description 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical class C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 1
- OGNFNMAKJUDARY-UHFFFAOYSA-N 4-methyl-5-sulfanylidene-1h-1,2,4-triazole-3-carboxylic acid Chemical compound CN1C(S)=NN=C1C(O)=O OGNFNMAKJUDARY-UHFFFAOYSA-N 0.000 description 1
- DTMYDLZZAOPOHQ-UHFFFAOYSA-N 4-phenyl-5-sulfanylidene-1h-1,2,4-triazole-3-carboxylic acid Chemical compound OC(=O)C1=NN=C(S)N1C1=CC=CC=C1 DTMYDLZZAOPOHQ-UHFFFAOYSA-N 0.000 description 1
- JXGSRCDXKKHFSK-UHFFFAOYSA-N 5-sulfanylidene-1,2-dihydro-1,2,4-triazole-3-carboxylic acid Chemical compound OC(=O)C1=NN=C(S)N1 JXGSRCDXKKHFSK-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000293871 Salmonella enterica subsp. enterica serovar Typhi Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000007980 azole derivatives Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001731 carboxylic acid azides Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- HELHKLNWSVLNDP-UHFFFAOYSA-N ethyl acetate;methanol;propan-2-one Chemical compound OC.CC(C)=O.CCOC(C)=O HELHKLNWSVLNDP-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000012434 nucleophilic reagent Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- ZUFQCVZBBNZMKD-UHFFFAOYSA-M potassium 2-ethylhexanoate Chemical compound [K+].CCCCC(CC)C([O-])=O ZUFQCVZBBNZMKD-UHFFFAOYSA-M 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- HWEXKRHYVOGVDA-UHFFFAOYSA-M sodium;3-trimethylsilylpropane-1-sulfonate Chemical compound [Na+].C[Si](C)(C)CCCS([O-])(=O)=O HWEXKRHYVOGVDA-UHFFFAOYSA-M 0.000 description 1
- PVGBHEUCHKGFQP-UHFFFAOYSA-N sodium;n-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylacetamide Chemical class [Na+].CC(=O)NS(=O)(=O)C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 PVGBHEUCHKGFQP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- FFVJAVUSCJCRPT-UHFFFAOYSA-N thiophen-2-yl acetate Chemical compound CC(=O)OC1=CC=CS1 FFVJAVUSCJCRPT-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49069641A JPS612674B2 (enExample) | 1974-06-20 | 1974-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU176287B true HU176287B (en) | 1981-01-28 |
Family
ID=13408675
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75ME1960A HU176287B (en) | 1974-06-20 | 1975-06-19 | Process for producing 7-bracket-2-thienylacetamido-bracket closed-3-triasolylthiomethyl-3-cepheme-4-carboxylic acid derivative |
| HU75ME00001866A HU172045B (hu) | 1974-06-20 | 1975-06-19 | Sposob poluchenija proizvodnykh 7-acilamido-3-skobka-1,2-dvojjno zamehhennykh-1,3,4-triazol-5-il-tiometil-skobka zakryta-3-cefem-4-karbonovykh kislot |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75ME00001866A HU172045B (hu) | 1974-06-20 | 1975-06-19 | Sposob poluchenija proizvodnykh 7-acilamido-3-skobka-1,2-dvojjno zamehhennykh-1,3,4-triazol-5-il-tiometil-skobka zakryta-3-cefem-4-karbonovykh kislot |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4113944A (enExample) |
| JP (1) | JPS612674B2 (enExample) |
| AR (2) | AR211850A1 (enExample) |
| BE (1) | BE830457A (enExample) |
| CA (1) | CA1072950A (enExample) |
| CH (1) | CH619235A5 (enExample) |
| DE (1) | DE2527653C3 (enExample) |
| FR (1) | FR2275479A1 (enExample) |
| GB (1) | GB1467217A (enExample) |
| HU (2) | HU176287B (enExample) |
| IL (1) | IL47477A (enExample) |
| NL (1) | NL166943C (enExample) |
| SE (1) | SE429235B (enExample) |
| YU (1) | YU37348B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4297489A (en) * | 1974-09-03 | 1981-10-27 | Bristol-Myers Company | 7-α-Amino-substituted acylamino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| ZA76451B (en) * | 1975-02-27 | 1977-01-26 | Smithkline Corp | New cephalosporin compounds |
| US4220644A (en) * | 1976-05-03 | 1980-09-02 | Smithkline Corporation | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
| CA1083141A (en) * | 1977-03-07 | 1980-08-05 | Lowell D. Hatfield | Cephalosporin displacement reaction |
| US4174324A (en) * | 1977-06-30 | 1979-11-13 | Smithkline Corporation | 3-(Carboxymethyl)thio-1H-1,2,4-triazol-5-thione |
| US4404376A (en) * | 1980-04-30 | 1983-09-13 | American Cyanamid Company | Cephalosporanic acid derivatives |
| US4404375A (en) * | 1980-04-30 | 1983-09-13 | American Cyanamid Company | Cephalosporanic acid derivatives |
| US4336375A (en) * | 1980-04-30 | 1982-06-22 | American Cyanamid Company | Cephalosporanic acid derivatives |
| US4404374A (en) * | 1980-04-30 | 1983-09-13 | American Cyanamid Company | Cephalosporanic acid derivatives |
| US4334062A (en) * | 1980-10-24 | 1982-06-08 | American Cyanamid Company | Cephalosporanic acid derivatives |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH557381A (de) * | 1967-04-15 | 1974-12-31 | Fujisawa Pharmaceutical Co | Verfahren zur herstellung von (delta)3-cephemverbindungen. |
| US3819623A (en) * | 1968-04-12 | 1974-06-25 | Fujisawa Pharmaceutical Co | 3,7-disubstituted cephalosporin compounds |
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| JPS49124574A (enExample) * | 1972-09-15 | 1974-11-28 | ||
| US3989694A (en) * | 1974-12-27 | 1976-11-02 | Smithkline Corporation | 7-Acyl-3-(substituted triazolyl thiomethyl)cephalosporins |
-
1974
- 1974-06-20 JP JP49069641A patent/JPS612674B2/ja not_active Expired
-
1975
- 1975-06-13 IL IL47477A patent/IL47477A/xx unknown
- 1975-06-19 SE SE7507124A patent/SE429235B/xx not_active IP Right Cessation
- 1975-06-19 GB GB2607175A patent/GB1467217A/en not_active Expired
- 1975-06-19 HU HU75ME1960A patent/HU176287B/hu not_active IP Right Cessation
- 1975-06-19 US US05/588,555 patent/US4113944A/en not_active Expired - Lifetime
- 1975-06-19 AR AR259284A patent/AR211850A1/es active
- 1975-06-19 YU YU1574/75A patent/YU37348B/xx unknown
- 1975-06-19 HU HU75ME00001866A patent/HU172045B/hu not_active IP Right Cessation
- 1975-06-20 NL NL7507404.A patent/NL166943C/xx not_active IP Right Cessation
- 1975-06-20 DE DE2527653A patent/DE2527653C3/de not_active Expired
- 1975-06-20 CA CA229,809A patent/CA1072950A/en not_active Expired
- 1975-06-20 BE BE157519A patent/BE830457A/xx not_active IP Right Cessation
- 1975-06-20 FR FR7519352A patent/FR2275479A1/fr active Granted
- 1975-06-20 CH CH806775A patent/CH619235A5/de not_active IP Right Cessation
-
1976
- 1976-04-19 AR AR262927A patent/AR210118A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| SE429235B (sv) | 1983-08-22 |
| DE2527653A1 (de) | 1976-05-06 |
| YU157475A (en) | 1983-04-27 |
| NL166943C (nl) | 1981-10-15 |
| BE830457A (fr) | 1975-12-22 |
| IL47477A0 (en) | 1975-08-31 |
| SE7507124L (sv) | 1975-12-22 |
| AR210118A1 (es) | 1977-06-30 |
| DE2527653B2 (de) | 1980-05-08 |
| DE2527653C3 (de) | 1981-01-22 |
| CA1072950A (en) | 1980-03-04 |
| US4113944A (en) | 1978-09-12 |
| CH619235A5 (enExample) | 1980-09-15 |
| GB1467217A (en) | 1977-03-16 |
| JPS612674B2 (enExample) | 1986-01-27 |
| IL47477A (en) | 1978-09-29 |
| YU37348B (en) | 1984-08-31 |
| NL166943B (nl) | 1981-05-15 |
| FR2275479B1 (enExample) | 1979-10-19 |
| AR211850A1 (es) | 1978-03-31 |
| NL7507404A (nl) | 1975-12-23 |
| AU8217575A (en) | 1976-12-23 |
| JPS511487A (enExample) | 1976-01-08 |
| HU172045B (hu) | 1978-05-28 |
| FR2275479A1 (fr) | 1976-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR830000853B1 (ko) | 아실 유도체의 제조방법 | |
| JPS6016994A (ja) | セフアロスポリン誘導体 | |
| HU176287B (en) | Process for producing 7-bracket-2-thienylacetamido-bracket closed-3-triasolylthiomethyl-3-cepheme-4-carboxylic acid derivative | |
| EP0548338B1 (en) | Process for the preparation of cephalosporins intermediates | |
| US3674784A (en) | 3-formyl cephalosporin sulfoxides | |
| GB2071654A (en) | Hydroxamic acid derivatives of 7-(2-amino-4-thiazolyl)oximino cephalosporins | |
| US3956292A (en) | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS | |
| US4104469A (en) | 7-(Syn-α-alkoxy-iminofuryl)acetamido-3-(2-methyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| US4148997A (en) | 7-[Sulfomethyl)phenyl]acetamidocephalosporin derivatives | |
| US4117126A (en) | 7-(α-(4-Hydroxy-1,5-naphthyridine-3-carbonamido)-α-phenylacetamido) cephalosporin derivatives | |
| US4103085A (en) | 7-(Syn-α-alkoxy-iminofurylacetamido-3-(2-carboxyalkyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| EP0023045B1 (en) | Imidazolecarboxylic acid derivatives of penicillins and cephalosporins | |
| US4178444A (en) | Hydrazono derivatives of cephalosporins | |
| US4138554A (en) | 7-[D-α-(4-Hydroxy-1,5-naphthyridine-3-carboxamido)-α-phenyl (and p-hydroxyphenyl)acetamido]-3-carbamoyloxymethyl-3-cephem-4-carboxylic acids | |
| US4182863A (en) | 7-Amino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid | |
| US4179502A (en) | 7[2-Hydroxyiminoacetamido]cephalosporins | |
| US3991051A (en) | [(Oxyalkyl)thioacetyl]cephalosporin derivatives | |
| US4058609A (en) | 7-Dithioacetamido cephalosporins | |
| CA1068260A (en) | 7-(alpha-furoylureidoaryl and cyclohexadieny-lacetamido) cephalosporin antibiotics | |
| CA1104560A (en) | Pyrrole cephalosporin derivatives | |
| CA1151641A (en) | Cephalosporin esters and ethers | |
| CA1102790A (en) | 3,7-disubstituted cephalosporins and preparation thereof | |
| JPH093074A (ja) | セファロスポリン化合物、その用途および中間体化合物 | |
| GB1604740A (en) | 7-isothiazolylthioacetamido-7-methoxycephalosporanic acid derivatives | |
| JPS6156238B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |