GB1593660A - Water-swellable copolymers - Google Patents
Water-swellable copolymers Download PDFInfo
- Publication number
- GB1593660A GB1593660A GB49130/77A GB4913077A GB1593660A GB 1593660 A GB1593660 A GB 1593660A GB 49130/77 A GB49130/77 A GB 49130/77A GB 4913077 A GB4913077 A GB 4913077A GB 1593660 A GB1593660 A GB 1593660A
- Authority
- GB
- United Kingdom
- Prior art keywords
- vinyl
- peroxide
- polymerisable
- methacrylate
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001577 copolymer Polymers 0.000 title description 4
- 239000000203 mixture Substances 0.000 claims description 85
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims description 62
- 229920000642 polymer Polymers 0.000 claims description 43
- 239000000017 hydrogel Substances 0.000 claims description 34
- -1 alkyl methacrylate Chemical compound 0.000 claims description 31
- 229920002554 vinyl polymer Polymers 0.000 claims description 30
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 18
- 150000005690 diesters Chemical class 0.000 claims description 16
- 150000002148 esters Chemical class 0.000 claims description 13
- 125000000623 heterocyclic group Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 12
- 150000002978 peroxides Chemical class 0.000 claims description 11
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical group CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 229920001567 vinyl ester resin Polymers 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 239000000178 monomer Substances 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 7
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 7
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 6
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 6
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 6
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 5
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical group COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 4
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical group CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 claims description 4
- 239000012535 impurity Substances 0.000 claims description 4
- 150000005846 sugar alcohols Polymers 0.000 claims description 4
- BWSZXUOMATYHHI-UHFFFAOYSA-N tert-butyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(C)(C)C BWSZXUOMATYHHI-UHFFFAOYSA-N 0.000 claims description 4
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 claims description 4
- 229920003169 water-soluble polymer Polymers 0.000 claims description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 3
- 239000004342 Benzoyl peroxide Substances 0.000 claims description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 3
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 3
- NSGQRLUGQNBHLD-UHFFFAOYSA-N butan-2-yl butan-2-yloxycarbonyloxy carbonate Chemical compound CCC(C)OC(=O)OOC(=O)OC(C)CC NSGQRLUGQNBHLD-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- QCHFTSOMWOSFHM-WPRPVWTQSA-N (+)-Pilocarpine Chemical compound C1OC(=O)[C@@H](CC)[C@H]1CC1=CN=CN1C QCHFTSOMWOSFHM-WPRPVWTQSA-N 0.000 claims description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 claims description 2
- NAGSMIOYEJTYQT-UHFFFAOYSA-N 1-ethenyl-3,3,5-trimethylpyrrolidin-2-one Chemical compound CC1CC(C)(C)C(=O)N1C=C NAGSMIOYEJTYQT-UHFFFAOYSA-N 0.000 claims description 2
- ZOZQTPQWSYVFPY-UHFFFAOYSA-N 1-ethenyl-3,5-dimethylpiperidin-2-one Chemical compound CC1CC(C)C(=O)N(C=C)C1 ZOZQTPQWSYVFPY-UHFFFAOYSA-N 0.000 claims description 2
- SBEBZMZHYUEOPQ-UHFFFAOYSA-N 1-ethenyl-3-methylpiperidin-2-one Chemical compound CC1CCCN(C=C)C1=O SBEBZMZHYUEOPQ-UHFFFAOYSA-N 0.000 claims description 2
- UBPXWZDJZFZKGH-UHFFFAOYSA-N 1-ethenyl-3-methylpyrrolidin-2-one Chemical compound CC1CCN(C=C)C1=O UBPXWZDJZFZKGH-UHFFFAOYSA-N 0.000 claims description 2
- CUFXUHMJEIELHB-UHFFFAOYSA-N 1-ethenyl-4,4-dimethylpiperidin-2-one Chemical compound CC1(C)CCN(C=C)C(=O)C1 CUFXUHMJEIELHB-UHFFFAOYSA-N 0.000 claims description 2
- CRJHKHYPIUPQSX-UHFFFAOYSA-N 1-ethenyl-4,5-dimethylpyrrolidin-2-one Chemical compound CC1CC(=O)N(C=C)C1C CRJHKHYPIUPQSX-UHFFFAOYSA-N 0.000 claims description 2
- LWWJIQWIJBMGKE-UHFFFAOYSA-N 1-ethenyl-4-methylpyrrolidin-2-one Chemical compound CC1CN(C=C)C(=O)C1 LWWJIQWIJBMGKE-UHFFFAOYSA-N 0.000 claims description 2
- IXUHPUSIYSUGNR-UHFFFAOYSA-N 1-ethenyl-5,5-dimethylpyrrolidin-2-one Chemical compound CC1(C)CCC(=O)N1C=C IXUHPUSIYSUGNR-UHFFFAOYSA-N 0.000 claims description 2
- FFDNCQYZAAVSSF-UHFFFAOYSA-N 1-ethenyl-6-methylpiperidin-2-one Chemical compound CC1CCCC(=O)N1C=C FFDNCQYZAAVSSF-UHFFFAOYSA-N 0.000 claims description 2
- HQOVXPHOJANJBR-UHFFFAOYSA-N 2,2-bis(tert-butylperoxy)butane Chemical compound CC(C)(C)OOC(C)(CC)OOC(C)(C)C HQOVXPHOJANJBR-UHFFFAOYSA-N 0.000 claims description 2
- WMKGMCCZGTXXQU-UHFFFAOYSA-N 2,3-benzodioxine-1,4-dione Chemical compound C1=CC=C2C(=O)OOC(=O)C2=C1 WMKGMCCZGTXXQU-UHFFFAOYSA-N 0.000 claims description 2
- QRIMLDXJAPZHJE-UHFFFAOYSA-N 2,3-dihydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(O)CO QRIMLDXJAPZHJE-UHFFFAOYSA-N 0.000 claims description 2
- OLQFXOWPTQTLDP-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCO OLQFXOWPTQTLDP-UHFFFAOYSA-N 0.000 claims description 2
- RWXMAAYKJDQVTF-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl prop-2-enoate Chemical compound OCCOCCOC(=O)C=C RWXMAAYKJDQVTF-UHFFFAOYSA-N 0.000 claims description 2
- ZACVGCNKGYYQHA-UHFFFAOYSA-N 2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate Chemical compound CCCCC(CC)COC(=O)OOC(=O)OCC(CC)CCCC ZACVGCNKGYYQHA-UHFFFAOYSA-N 0.000 claims description 2
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical group OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims description 2
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 2
- GAVHQOUUSHBDAA-UHFFFAOYSA-N 3-butyl-1-ethenylaziridin-2-one Chemical compound CCCCC1N(C=C)C1=O GAVHQOUUSHBDAA-UHFFFAOYSA-N 0.000 claims description 2
- PWXIKGAMKWRXHD-UHFFFAOYSA-N 3-butylaziridin-2-one Chemical compound CCCCC1NC1=O PWXIKGAMKWRXHD-UHFFFAOYSA-N 0.000 claims description 2
- FNKMJQGPHZOKSB-UHFFFAOYSA-N 3-ethenylpiperidine-2,6-dione Chemical compound C(=C)C1C(=O)NC(CC1)=O FNKMJQGPHZOKSB-UHFFFAOYSA-N 0.000 claims description 2
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 claims description 2
- MKTOIPPVFPJEQO-UHFFFAOYSA-N 4-(3-carboxypropanoylperoxy)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)OOC(=O)CCC(O)=O MKTOIPPVFPJEQO-UHFFFAOYSA-N 0.000 claims description 2
- ZMALNMQOXQXZRO-UHFFFAOYSA-N 4-ethenylmorpholin-3-one Chemical compound C=CN1CCOCC1=O ZMALNMQOXQXZRO-UHFFFAOYSA-N 0.000 claims description 2
- QLZINFDMOXMCCJ-UHFFFAOYSA-N 7-(7-hydroxyheptylperoxy)heptan-1-ol Chemical compound OCCCCCCCOOCCCCCCCO QLZINFDMOXMCCJ-UHFFFAOYSA-N 0.000 claims description 2
- QREUYUITSLZMBJ-UHFFFAOYSA-N C=CC1=N[C-]=[NH+]C1=O Chemical compound C=CC1=N[C-]=[NH+]C1=O QREUYUITSLZMBJ-UHFFFAOYSA-N 0.000 claims description 2
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 claims description 2
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 claims description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 2
- QZVCTJOXCFMACW-UHFFFAOYSA-N Phenoxybenzamine Chemical compound C=1C=CC=CC=1CN(CCCl)C(C)COC1=CC=CC=C1 QZVCTJOXCFMACW-UHFFFAOYSA-N 0.000 claims description 2
- QCHFTSOMWOSFHM-UHFFFAOYSA-N SJ000285536 Natural products C1OC(=O)C(CC)C1CC1=CN=CN1C QCHFTSOMWOSFHM-UHFFFAOYSA-N 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229940092732 belladonna alkaloid Drugs 0.000 claims description 2
- NZUPCNDJBJXXRF-UHFFFAOYSA-O bethanechol Chemical compound C[N+](C)(C)CC(C)OC(N)=O NZUPCNDJBJXXRF-UHFFFAOYSA-O 0.000 claims description 2
- 229960000910 bethanechol Drugs 0.000 claims description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 2
- 229960004484 carbachol Drugs 0.000 claims description 2
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical compound [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 claims description 2
- 229960003260 chlorhexidine Drugs 0.000 claims description 2
- 235000019864 coconut oil Nutrition 0.000 claims description 2
- 239000003240 coconut oil Substances 0.000 claims description 2
- 210000004087 cornea Anatomy 0.000 claims description 2
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 claims description 2
- 229940087490 dibenzyline Drugs 0.000 claims description 2
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 claims description 2
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 claims description 2
- AFSIMBWBBOJPJG-UHFFFAOYSA-N ethenyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC=C AFSIMBWBBOJPJG-UHFFFAOYSA-N 0.000 claims description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 claims description 2
- ZNAOFAIBVOMLPV-UHFFFAOYSA-N hexadecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCCCCCOC(=O)C(C)=C ZNAOFAIBVOMLPV-UHFFFAOYSA-N 0.000 claims description 2
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 claims description 2
- NZWOPGCLSHLLPA-UHFFFAOYSA-N methacholine Chemical compound C[N+](C)(C)CC(C)OC(C)=O NZWOPGCLSHLLPA-UHFFFAOYSA-N 0.000 claims description 2
- 229960002329 methacholine Drugs 0.000 claims description 2
- 150000002763 monocarboxylic acids Chemical group 0.000 claims description 2
- HMZGPNHSPWNGEP-UHFFFAOYSA-N octadecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C(C)=C HMZGPNHSPWNGEP-UHFFFAOYSA-N 0.000 claims description 2
- SRSFOMHQIATOFV-UHFFFAOYSA-N octanoyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(=O)CCCCCCC SRSFOMHQIATOFV-UHFFFAOYSA-N 0.000 claims description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 2
- 229960001416 pilocarpine Drugs 0.000 claims description 2
- BOQSSGDQNWEFSX-UHFFFAOYSA-N propan-2-yl 2-methylprop-2-enoate Chemical compound CC(C)OC(=O)C(C)=C BOQSSGDQNWEFSX-UHFFFAOYSA-N 0.000 claims description 2
- LYBIZMNPXTXVMV-UHFFFAOYSA-N propan-2-yl prop-2-enoate Chemical compound CC(C)OC(=O)C=C LYBIZMNPXTXVMV-UHFFFAOYSA-N 0.000 claims description 2
- YPVDWEHVCUBACK-UHFFFAOYSA-N propoxycarbonyloxy propyl carbonate Chemical compound CCCOC(=O)OOC(=O)OCCC YPVDWEHVCUBACK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- OPQYOFWUFGEMRZ-UHFFFAOYSA-N tert-butyl 2,2-dimethylpropaneperoxoate Chemical compound CC(C)(C)OOC(=O)C(C)(C)C OPQYOFWUFGEMRZ-UHFFFAOYSA-N 0.000 claims description 2
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 claims description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetraline Natural products C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 claims description 2
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 claims 3
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 claims 2
- JBKFPCSZNWLZAS-UHFFFAOYSA-N 1-ethenyl-4-methylpiperidin-2-one Chemical compound CC1CCN(C=C)C(=O)C1 JBKFPCSZNWLZAS-UHFFFAOYSA-N 0.000 claims 1
- LKAFOGJENXOWMO-UHFFFAOYSA-N 1-ethenyl-5-methylpiperidin-2-one Chemical compound CC1CCC(=O)N(C=C)C1 LKAFOGJENXOWMO-UHFFFAOYSA-N 0.000 claims 1
- HQGPZXPTJWUDQR-UHFFFAOYSA-N 1-ethenyl-5-methylpyrrolidin-2-one Chemical compound CC1CCC(=O)N1C=C HQGPZXPTJWUDQR-UHFFFAOYSA-N 0.000 claims 1
- MSRJEBGZJWLQOC-UHFFFAOYSA-N 4-ethenyl-5-methylmorpholin-3-one Chemical compound CC1COCC(=O)N1C=C MSRJEBGZJWLQOC-UHFFFAOYSA-N 0.000 claims 1
- DGUPYKXXILMJFL-UHFFFAOYSA-N C(=C)C1C(N(C(C1)C)CC)=O Chemical compound C(=C)C1C(N(C(C1)C)CC)=O DGUPYKXXILMJFL-UHFFFAOYSA-N 0.000 claims 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 1
- APZPSKFMSWZPKL-UHFFFAOYSA-N [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(CO)(CO)CO APZPSKFMSWZPKL-UHFFFAOYSA-N 0.000 claims 1
- 239000004202 carbamide Substances 0.000 claims 1
- 229960003133 ergot alkaloid Drugs 0.000 claims 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical group CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 239000004575 stone Substances 0.000 claims 1
- 229960002317 succinimide Drugs 0.000 claims 1
- 239000003431 cross linking reagent Substances 0.000 description 22
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical compound C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 description 12
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 11
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 230000003287 optical effect Effects 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 239000000470 constituent Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000004971 Cross linker Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- 239000002195 soluble material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- VOCDJQSAMZARGX-UHFFFAOYSA-N 1-ethenylpyrrolidine-2,5-dione Chemical compound C=CN1C(=O)CCC1=O VOCDJQSAMZARGX-UHFFFAOYSA-N 0.000 description 2
- 229940044192 2-hydroxyethyl methacrylate Drugs 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- PBKVEOSEPXMKDN-LZHUFOCISA-N chembl2311030 Chemical compound CS(O)(=O)=O.CS(O)(=O)=O.CS(O)(=O)=O.CS(O)(=O)=O.C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C(=O)N[C@]3(C(=O)N4[C@H](C(N5CCC[C@H]5[C@]4(O)O3)=O)C(C)C)C(C)C)=C3C2=CNC3=C1.C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C(=O)N[C@]3(C(=O)N4[C@H](C(N5CCC[C@H]5[C@]4(O)O3)=O)C(C)CC)C(C)C)=C3C2=CNC3=C1.C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C(=O)N[C@]3(C(=O)N4[C@H](C(N5CCC[C@H]5[C@]4(O)O3)=O)CC(C)C)C(C)C)=C3C2=CNC3=C1.C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@](C(N21)=O)(NC(=O)[C@H]1CN(C)[C@H]2[C@@H](C=3C=CC=C4NC=C(C=34)C2)C1)C(C)C)C1=CC=CC=C1 PBKVEOSEPXMKDN-LZHUFOCISA-N 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 238000005498 polishing Methods 0.000 description 2
- 238000011417 postcuring Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- OXYKVVLTXXXVRT-UHFFFAOYSA-N (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate Chemical compound C1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1 OXYKVVLTXXXVRT-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- PGHAPVDSVLWQGB-UHFFFAOYSA-N 1-ethenyl-3-ethyl-3,4,5-trimethylpyrrolidin-2-one Chemical compound CCC1(C)C(C)C(C)N(C=C)C1=O PGHAPVDSVLWQGB-UHFFFAOYSA-N 0.000 description 1
- JFUWJIKJUNAHEN-UHFFFAOYSA-N 1-ethenyl-3-ethylpyrrolidin-2-one Chemical compound CCC1CCN(C=C)C1=O JFUWJIKJUNAHEN-UHFFFAOYSA-N 0.000 description 1
- UUJDYNPZEYGKOF-UHFFFAOYSA-N 1-ethenyl-5-ethyl-5-methylpyrrolidin-2-one Chemical compound CCC1(C)CCC(=O)N1C=C UUJDYNPZEYGKOF-UHFFFAOYSA-N 0.000 description 1
- GIQLJJKZKUIRIU-UHFFFAOYSA-N 1-ethenyl-6-ethylpiperidin-2-one Chemical compound CCC1CCCC(=O)N1C=C GIQLJJKZKUIRIU-UHFFFAOYSA-N 0.000 description 1
- PBGPBHYPCGDFEZ-UHFFFAOYSA-N 1-ethenylpiperidin-2-one Chemical compound C=CN1CCCCC1=O PBGPBHYPCGDFEZ-UHFFFAOYSA-N 0.000 description 1
- JHQVCQDWGSXTFE-UHFFFAOYSA-N 2-(2-prop-2-enoxycarbonyloxyethoxy)ethyl prop-2-enyl carbonate Chemical compound C=CCOC(=O)OCCOCCOC(=O)OCC=C JHQVCQDWGSXTFE-UHFFFAOYSA-N 0.000 description 1
- IGDLZDCWMRPMGL-UHFFFAOYSA-N 2-ethenylisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(C=C)C(=O)C2=C1 IGDLZDCWMRPMGL-UHFFFAOYSA-N 0.000 description 1
- PTSGHGGLRADEFP-UHFFFAOYSA-N 4-methylpiperidin-2-one Chemical compound CC1CCNC(=O)C1 PTSGHGGLRADEFP-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- NSRPFJGOCZUUHE-UHFFFAOYSA-N 5-methylpiperidin-2-one Chemical compound CC1CCC(=O)NC1 NSRPFJGOCZUUHE-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920003072 Plasdone™ povidone Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- GERIGMSHTUAXSI-UHFFFAOYSA-N bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-phenyl-2,3-dihydro-1h-naphthalene-1,4-dicarboxylate Chemical compound CN1C(C2)CCC1CC2OC(=O)C(C1=CC=CC=C11)CCC1(C(=O)OC1CC2CCC(N2C)C1)C1=CC=CC=C1 GERIGMSHTUAXSI-UHFFFAOYSA-N 0.000 description 1
- 230000009172 bursting Effects 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- IKBVWGOHCLVYTA-UHFFFAOYSA-N butan-2-yl butan-2-yloxy carbonate Chemical compound CCC(C)OOC(=O)OC(C)CC IKBVWGOHCLVYTA-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- WCMINAGIRMRVHT-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate Chemical compound COC(=O)C(C)=C.CCOC(=O)C(C)=C WCMINAGIRMRVHT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- YVIVRJLWYJGJTJ-UHFFFAOYSA-N gamma-Valerolactam Chemical compound CC1CCC(=O)N1 YVIVRJLWYJGJTJ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 229940058401 polytetrafluoroethylene Drugs 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007939 sustained release tablet Substances 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B1/00—Optical elements characterised by the material of which they are made; Optical coatings for optical elements
- G02B1/04—Optical elements characterised by the material of which they are made; Optical coatings for optical elements made of organic materials, e.g. plastics
- G02B1/041—Lenses
- G02B1/043—Contact lenses
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Eyeglasses (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/745,141 US4123408A (en) | 1976-11-26 | 1976-11-26 | Hydrogel contact lens |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1593660A true GB1593660A (en) | 1981-07-22 |
Family
ID=24995422
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB49130/77A Expired GB1593660A (en) | 1976-11-26 | 1977-11-25 | Water-swellable copolymers |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4123408A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS6028328B2 (cg-RX-API-DMAC7.html) |
| AU (1) | AU508713B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE861202A (cg-RX-API-DMAC7.html) |
| CH (1) | CH638900A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2751453A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES464476A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2372452A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1593660A (cg-RX-API-DMAC7.html) |
| GR (1) | GR63998B (cg-RX-API-DMAC7.html) |
| IL (1) | IL53459A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1090583B (cg-RX-API-DMAC7.html) |
| NL (1) | NL192225C (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ185640A (cg-RX-API-DMAC7.html) |
| PH (1) | PH19762A (cg-RX-API-DMAC7.html) |
| PT (1) | PT67321B (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA776701B (cg-RX-API-DMAC7.html) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4264493A (en) * | 1978-10-18 | 1981-04-28 | Battista Orlando A | Natural protein polymer hydrogels |
| US4328148A (en) * | 1979-07-27 | 1982-05-04 | Petr Kuzma | Compositions comprising water and hydrophilic polymers and contact lenses therefrom |
| US4349470A (en) * | 1979-09-14 | 1982-09-14 | Battista Orlando A | Protein polymer hydrogels |
| CA1187645A (en) * | 1981-01-12 | 1985-05-21 | Kyoichi Tanaka | Contact lens and process for preparing the same |
| US4416814A (en) * | 1981-03-23 | 1983-11-22 | Battista Orlando A | Protein polymer hydrogels |
| AU550604B2 (en) * | 1981-05-01 | 1986-03-27 | Menicon Co., Ltd | Water absorptive contact lens |
| JPS57203440A (en) * | 1981-06-11 | 1982-12-13 | Nihon Contact Lens Seizou Kk | Treating tool |
| US4430458A (en) | 1981-10-08 | 1984-02-07 | Kelvin Lenses Limited | Hydrogel-forming polymeric materials |
| US4466705A (en) * | 1982-09-30 | 1984-08-21 | Michelson Paul E | Fluid lens |
| US4709996A (en) * | 1982-09-30 | 1987-12-01 | Michelson Paul E | Fluid lens |
| JPS59195621A (ja) * | 1983-04-22 | 1984-11-06 | Toyo Contact Lens Co Ltd | 軟質コンタクトレンズ |
| US4859719A (en) * | 1983-09-08 | 1989-08-22 | Minnesota Mining And Manufacturing Company | Polymer blends with high water absorption |
| US4771089A (en) * | 1983-09-08 | 1988-09-13 | Minnesota Mining And Manufacturing Co. | Polymer blends with high water absorption |
| CS249989B1 (en) * | 1984-04-06 | 1987-04-16 | Otto Wichterle | Hydrophilic thre-dimensional polymer and method of its production |
| US4833196A (en) * | 1986-08-04 | 1989-05-23 | Ciba-Geigy Corporation | Particulate hydroperoxidized poly-N-vinyl lactam, its preparation and use thereof |
| US4791175A (en) * | 1986-08-04 | 1988-12-13 | Ciba-Geigy Corporation | Particulate hydroperoxidized poly-n-vinyl lactam, its preparation and use thereof |
| US4678838A (en) * | 1986-08-04 | 1987-07-07 | Ciba-Geigy Corporation | Particulate hydroperoxidized poly-N-vinyl lactam, its preparation and use thereof |
| DE3730921A1 (de) * | 1987-09-15 | 1989-03-23 | Degussa | Hitzehaertbare dentalmassen |
| US5147394A (en) * | 1987-10-09 | 1992-09-15 | Siepser Steven B | High refractive index polymeric compositions suitable for use as expansile hydrogel intraocular lenses |
| US4931228A (en) * | 1989-04-05 | 1990-06-05 | Coastvision | Method of manufacturing soft contact lens buttons |
| US5352714A (en) * | 1991-11-05 | 1994-10-04 | Bausch & Lomb Incorporated | Wettable silicone hydrogel compositions and methods for their manufacture |
| EP0712867B1 (de) * | 1994-11-18 | 1999-07-14 | Novartis AG | Polymere Netzwerke aus wasserlöslichen Präpolymeren |
| US5665840A (en) * | 1994-11-18 | 1997-09-09 | Novartis Corporation | Polymeric networks from water-soluble prepolymers |
| US6822016B2 (en) | 2001-09-10 | 2004-11-23 | Johnson & Johnson Vision Care, Inc. | Biomedical devices containing internal wetting agents |
| US6367929B1 (en) * | 1998-03-02 | 2002-04-09 | Johnson & Johnson Vision Care, Inc. | Hydrogel with internal wetting agent |
| US7052131B2 (en) | 2001-09-10 | 2006-05-30 | J&J Vision Care, Inc. | Biomedical devices containing internal wetting agents |
| US7461937B2 (en) * | 2001-09-10 | 2008-12-09 | Johnson & Johnson Vision Care, Inc. | Soft contact lenses displaying superior on-eye comfort |
| US20070043140A1 (en) * | 1998-03-02 | 2007-02-22 | Lorenz Kathrine O | Method for the mitigation of symptoms of contact lens related dry eye |
| US6372815B1 (en) * | 2000-04-18 | 2002-04-16 | Ocular Sciences Inc | Ophthalmic lenses and compositions, and methods for producing same |
| US20070138692A1 (en) * | 2002-09-06 | 2007-06-21 | Ford James D | Process for forming clear, wettable silicone hydrogel articles |
| JP5047613B2 (ja) * | 2003-04-24 | 2012-10-10 | クーパーヴィジョン インターナショナル ホウルディング カンパニー リミテッド パートナーシップ | ヒドロゲルコンタクトレンズ及び包装システム及びそれらの製造方法 |
| JP2006065481A (ja) * | 2004-08-25 | 2006-03-09 | Aruze Corp | 情報処理装置 |
| KR20070114130A (ko) | 2005-02-14 | 2007-11-29 | 존슨 앤드 존슨 비젼 케어, 인코포레이티드 | 착용감이 편안한 안용 장치 및 이의 제조방법 |
| US9052529B2 (en) | 2006-02-10 | 2015-06-09 | Johnson & Johnson Vision Care, Inc. | Comfortable ophthalmic device and methods of its production |
| US20070264509A1 (en) * | 2006-05-11 | 2007-11-15 | Yu-Chin Lai | Copolymer and Medical Device with the Copolymer |
| US20070264503A1 (en) * | 2006-05-11 | 2007-11-15 | Yu-Chin Lai | Polymers comprising polyhydric alcohols, medical devices modified with same, and method of making |
| DK2178931T3 (da) * | 2007-07-19 | 2012-05-07 | Novartis Ag | Linser og materialer med høj ion- og metabolitstrøm |
| JP2011517418A (ja) * | 2008-03-27 | 2011-06-09 | アルコン,インコーポレイテッド | ヒドロゲル眼内レンズおよびこれを形成するための方法 |
| ES2678773B1 (es) * | 2017-01-16 | 2019-06-12 | Consejo Superior Investigacion | Recubrimientos tipo hidrogel en base vinil-lactamas |
| WO2021095489A1 (ja) * | 2019-11-12 | 2021-05-20 | 国立研究開発法人海洋研究開発機構 | セルロース系成形体及びヒドロゲル並びにこれらの製造方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2948708A (en) * | 1958-04-03 | 1960-08-09 | Dow Chemical Co | Water-soluble copolymers of ring substituted n-vinyl-2-oxazolidinone |
| US3390139A (en) * | 1964-03-04 | 1966-03-11 | Rohm & Haas | Nu-vinyl-2-piperazinones |
| US3689439A (en) * | 1968-06-12 | 1972-09-05 | Gaf Corp | Process for preparing a crosslinked porous polyvinyl pyrrolidone granule |
| US3639524A (en) * | 1969-07-28 | 1972-02-01 | Maurice Seiderman | Hydrophilic gel polymer insoluble in water from polyvinylpyrrolidone with n-vinyl-2-pyrrolidone and methacrylic modifier |
| BE759530A (fr) * | 1969-11-28 | 1971-04-30 | Griffin Lab Inc | Lentille de contact et son procede de fabrication |
| GB1391438A (en) * | 1971-04-20 | 1975-04-23 | Contact Lens Mfg Ltd | Hydrophilic copolymers and articles formed therefrom |
| US3894129A (en) * | 1973-03-15 | 1975-07-08 | American Optical Corp | Method of manufacture of strain free contact lenses |
| US3937680A (en) * | 1973-05-29 | 1976-02-10 | Global Vision, Inc. | Hydrophilic gel terpolymers from hydrophilic n-vinyl monomers, hydroxyalkyl acrylates or methacrylates and polymerizable unsaturated carboxylic acids |
| JPS5337028B2 (cg-RX-API-DMAC7.html) * | 1973-12-11 | 1978-10-06 | ||
| US3978164A (en) * | 1974-11-21 | 1976-08-31 | Warner-Lambert Company | Pyrrolidone-methacrylate graft copolymers from 3-stage polymerization process |
-
1976
- 1976-11-26 US US05/745,141 patent/US4123408A/en not_active Expired - Lifetime
-
1977
- 1977-11-07 NZ NZ185640A patent/NZ185640A/xx unknown
- 1977-11-08 GR GR54737A patent/GR63998B/el unknown
- 1977-11-09 ZA ZA00776701A patent/ZA776701B/xx unknown
- 1977-11-18 DE DE19772751453 patent/DE2751453A1/de active Granted
- 1977-11-18 AU AU30769/77A patent/AU508713B2/en not_active Expired
- 1977-11-22 PH PH20458A patent/PH19762A/en unknown
- 1977-11-23 CH CH1431677A patent/CH638900A5/de not_active IP Right Cessation
- 1977-11-23 NL NL7712889A patent/NL192225C/nl not_active IP Right Cessation
- 1977-11-24 PT PT67321A patent/PT67321B/pt unknown
- 1977-11-24 IT IT51921/77A patent/IT1090583B/it active
- 1977-11-24 IL IL53459A patent/IL53459A/xx unknown
- 1977-11-25 FR FR7735562A patent/FR2372452A1/fr active Granted
- 1977-11-25 BE BE182924A patent/BE861202A/xx not_active IP Right Cessation
- 1977-11-25 ES ES464476A patent/ES464476A1/es not_active Expired
- 1977-11-25 GB GB49130/77A patent/GB1593660A/en not_active Expired
- 1977-11-25 JP JP52142102A patent/JPS6028328B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS53105251A (en) | 1978-09-13 |
| PT67321B (en) | 1979-04-24 |
| PH19762A (en) | 1986-06-27 |
| FR2372452B1 (cg-RX-API-DMAC7.html) | 1981-11-27 |
| JPS6028328B2 (ja) | 1985-07-04 |
| NZ185640A (en) | 1979-03-16 |
| ZA776701B (en) | 1978-08-30 |
| AU508713B2 (en) | 1980-03-27 |
| AU3076977A (en) | 1979-05-24 |
| BE861202A (fr) | 1978-03-16 |
| US4123408A (en) | 1978-10-31 |
| CH638900A5 (de) | 1983-10-14 |
| IL53459A0 (en) | 1978-01-31 |
| IT1090583B (it) | 1985-06-26 |
| IL53459A (en) | 1980-11-30 |
| NL7712889A (nl) | 1978-05-30 |
| NL192225B (nl) | 1996-11-01 |
| DE2751453A1 (de) | 1978-06-01 |
| PT67321A (en) | 1977-12-01 |
| NL192225C (nl) | 1997-03-04 |
| GR63998B (en) | 1980-01-18 |
| FR2372452A1 (fr) | 1978-06-23 |
| DE2751453C2 (cg-RX-API-DMAC7.html) | 1990-12-06 |
| ES464476A1 (es) | 1979-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1593660A (en) | Water-swellable copolymers | |
| US4123407A (en) | Hydrophilic contact lens | |
| US3532679A (en) | Hydrogels from cross-linked polymers of n-vinyl lactams and alkyl acrylates | |
| US5311223A (en) | Ophthalmic lens polymer incorporating acyclic monomer | |
| US4866148A (en) | Hydrophilic copolymers, the use thereof as biomedical materials and contact-optical articles produced therefrom | |
| US4248989A (en) | Oxygen permeable hard and semi-hard contact lens compositions, methods and articles of manufacture II | |
| US3983083A (en) | Soft contact lenses and process for preparation thereof | |
| EP0345994B1 (en) | Contact lenses and materials and methods of making same | |
| US4242483A (en) | Oxygen permeable hard and semi-hard contact lens compositions, methods and articles of manufacture | |
| US3758448A (en) | Copolymers and hydrogels of unsaturated esters | |
| US3787380A (en) | Polymers of n-vinyl or n-allyl hetero-cyclic compounds with monoethyl-enically unsaturated esters and gly-cidyl esters | |
| US4430458A (en) | Hydrogel-forming polymeric materials | |
| JPH02147613A (ja) | 改良されたシリコーン含有ハードコンタクトレンズ材としてのシート又はロッド | |
| US5135965A (en) | Hydrogel-forming polymers used in intraocular lenses | |
| US3947401A (en) | Hydrogels of unsaturated ester copolymers | |
| US4492776A (en) | Hydrogel contact lenses for permanent wear | |
| US4218554A (en) | Process for preparing hydrogel contact lenses containing quaternary ammonium salts | |
| GB1588744A (en) | Cross-linked polymer composition for use in soft contact lenses | |
| EP0188110B1 (en) | Hydrogel-forming polymers | |
| US3951528A (en) | Method of making polymeric contact lens | |
| US6262208B1 (en) | Ocular lens material and process for producing the same | |
| US3772235A (en) | Copolymers and hydrogels of unsaturated heterocyclic compounds | |
| EP0064381B1 (en) | Soft contact lenses and manufacture thereof | |
| EP0017512B1 (en) | Polymeric materials, process for preparing them and shaped articles and contact lenses formed from them | |
| WO1983001777A1 (en) | Improved oxygen permeable hard and semi-hard contact lens compositions, methods and articles of manufacture |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 732 | Registration of transactions, instruments or events in the register (sect. 32/1977) | ||
| PE20 | Patent expired after termination of 20 years |
Effective date: 19971124 |