GB1593659A - Hydrophilic copolymers - Google Patents
Hydrophilic copolymers Download PDFInfo
- Publication number
- GB1593659A GB1593659A GB49129/77A GB4912977A GB1593659A GB 1593659 A GB1593659 A GB 1593659A GB 49129/77 A GB49129/77 A GB 49129/77A GB 4912977 A GB4912977 A GB 4912977A GB 1593659 A GB1593659 A GB 1593659A
- Authority
- GB
- United Kingdom
- Prior art keywords
- vinyl
- polymerisable
- peroxide
- methacrylate
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001480 hydrophilic copolymer Polymers 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims description 88
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims description 68
- 239000000017 hydrogel Substances 0.000 claims description 36
- -1 alkyl methacrylate Chemical compound 0.000 claims description 32
- 229920000642 polymer Polymers 0.000 claims description 31
- 229920002554 vinyl polymer Polymers 0.000 claims description 24
- 239000000463 material Substances 0.000 claims description 21
- 150000005690 diesters Chemical class 0.000 claims description 16
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 16
- 125000000623 heterocyclic group Chemical group 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- 150000002148 esters Chemical class 0.000 claims description 13
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical compound C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 claims description 13
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 12
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical group CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 10
- 150000002978 peroxides Chemical class 0.000 claims description 10
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 9
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 8
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical group COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229920001567 vinyl ester resin Polymers 0.000 claims description 7
- NSGQRLUGQNBHLD-UHFFFAOYSA-N butan-2-yl butan-2-yloxycarbonyloxy carbonate Chemical compound CCC(C)OC(=O)OOC(=O)OC(C)CC NSGQRLUGQNBHLD-UHFFFAOYSA-N 0.000 claims description 6
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 4
- 239000004342 Benzoyl peroxide Substances 0.000 claims description 4
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 4
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 4
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 4
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 239000012535 impurity Substances 0.000 claims description 4
- OPQYOFWUFGEMRZ-UHFFFAOYSA-N tert-butyl 2,2-dimethylpropaneperoxoate Chemical compound CC(C)(C)OOC(=O)C(C)(C)C OPQYOFWUFGEMRZ-UHFFFAOYSA-N 0.000 claims description 4
- BWSZXUOMATYHHI-UHFFFAOYSA-N tert-butyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(C)(C)C BWSZXUOMATYHHI-UHFFFAOYSA-N 0.000 claims description 4
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 claims description 4
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 4
- FFDNCQYZAAVSSF-UHFFFAOYSA-N 1-ethenyl-6-methylpiperidin-2-one Chemical compound CC1CCCC(=O)N1C=C FFDNCQYZAAVSSF-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- QCHFTSOMWOSFHM-WPRPVWTQSA-N (+)-Pilocarpine Chemical compound C1OC(=O)[C@@H](CC)[C@H]1CC1=CN=CN1C QCHFTSOMWOSFHM-WPRPVWTQSA-N 0.000 claims description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 claims description 2
- OXYKVVLTXXXVRT-UHFFFAOYSA-N (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate Chemical compound C1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1 OXYKVVLTXXXVRT-UHFFFAOYSA-N 0.000 claims description 2
- NAGSMIOYEJTYQT-UHFFFAOYSA-N 1-ethenyl-3,3,5-trimethylpyrrolidin-2-one Chemical compound CC1CC(C)(C)C(=O)N1C=C NAGSMIOYEJTYQT-UHFFFAOYSA-N 0.000 claims description 2
- ZOZQTPQWSYVFPY-UHFFFAOYSA-N 1-ethenyl-3,5-dimethylpiperidin-2-one Chemical compound CC1CC(C)C(=O)N(C=C)C1 ZOZQTPQWSYVFPY-UHFFFAOYSA-N 0.000 claims description 2
- SBEBZMZHYUEOPQ-UHFFFAOYSA-N 1-ethenyl-3-methylpiperidin-2-one Chemical compound CC1CCCN(C=C)C1=O SBEBZMZHYUEOPQ-UHFFFAOYSA-N 0.000 claims description 2
- UBPXWZDJZFZKGH-UHFFFAOYSA-N 1-ethenyl-3-methylpyrrolidin-2-one Chemical compound CC1CCN(C=C)C1=O UBPXWZDJZFZKGH-UHFFFAOYSA-N 0.000 claims description 2
- CUFXUHMJEIELHB-UHFFFAOYSA-N 1-ethenyl-4,4-dimethylpiperidin-2-one Chemical compound CC1(C)CCN(C=C)C(=O)C1 CUFXUHMJEIELHB-UHFFFAOYSA-N 0.000 claims description 2
- JBKFPCSZNWLZAS-UHFFFAOYSA-N 1-ethenyl-4-methylpiperidin-2-one Chemical compound CC1CCN(C=C)C(=O)C1 JBKFPCSZNWLZAS-UHFFFAOYSA-N 0.000 claims description 2
- IXUHPUSIYSUGNR-UHFFFAOYSA-N 1-ethenyl-5,5-dimethylpyrrolidin-2-one Chemical compound CC1(C)CCC(=O)N1C=C IXUHPUSIYSUGNR-UHFFFAOYSA-N 0.000 claims description 2
- HQGPZXPTJWUDQR-UHFFFAOYSA-N 1-ethenyl-5-methylpyrrolidin-2-one Chemical compound CC1CCC(=O)N1C=C HQGPZXPTJWUDQR-UHFFFAOYSA-N 0.000 claims description 2
- GIQLJJKZKUIRIU-UHFFFAOYSA-N 1-ethenyl-6-ethylpiperidin-2-one Chemical compound CCC1CCCC(=O)N1C=C GIQLJJKZKUIRIU-UHFFFAOYSA-N 0.000 claims description 2
- PBGPBHYPCGDFEZ-UHFFFAOYSA-N 1-ethenylpiperidin-2-one Chemical compound C=CN1CCCCC1=O PBGPBHYPCGDFEZ-UHFFFAOYSA-N 0.000 claims description 2
- VOCDJQSAMZARGX-UHFFFAOYSA-N 1-ethenylpyrrolidine-2,5-dione Chemical compound C=CN1C(=O)CCC1=O VOCDJQSAMZARGX-UHFFFAOYSA-N 0.000 claims description 2
- HQOVXPHOJANJBR-UHFFFAOYSA-N 2,2-bis(tert-butylperoxy)butane Chemical compound CC(C)(C)OOC(C)(CC)OOC(C)(C)C HQOVXPHOJANJBR-UHFFFAOYSA-N 0.000 claims description 2
- QRIMLDXJAPZHJE-UHFFFAOYSA-N 2,3-dihydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(O)CO QRIMLDXJAPZHJE-UHFFFAOYSA-N 0.000 claims description 2
- RWXMAAYKJDQVTF-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl prop-2-enoate Chemical compound OCCOCCOC(=O)C=C RWXMAAYKJDQVTF-UHFFFAOYSA-N 0.000 claims description 2
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 2
- GAVHQOUUSHBDAA-UHFFFAOYSA-N 3-butyl-1-ethenylaziridin-2-one Chemical compound CCCCC1N(C=C)C1=O GAVHQOUUSHBDAA-UHFFFAOYSA-N 0.000 claims description 2
- PWXIKGAMKWRXHD-UHFFFAOYSA-N 3-butylaziridin-2-one Chemical compound CCCCC1NC1=O PWXIKGAMKWRXHD-UHFFFAOYSA-N 0.000 claims description 2
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 claims description 2
- MKTOIPPVFPJEQO-UHFFFAOYSA-N 4-(3-carboxypropanoylperoxy)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)OOC(=O)CCC(O)=O MKTOIPPVFPJEQO-UHFFFAOYSA-N 0.000 claims description 2
- ZMALNMQOXQXZRO-UHFFFAOYSA-N 4-ethenylmorpholin-3-one Chemical compound C=CN1CCOCC1=O ZMALNMQOXQXZRO-UHFFFAOYSA-N 0.000 claims description 2
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 claims description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 2
- QZVCTJOXCFMACW-UHFFFAOYSA-N Phenoxybenzamine Chemical compound C=1C=CC=CC=1CN(CCCl)C(C)COC1=CC=CC=C1 QZVCTJOXCFMACW-UHFFFAOYSA-N 0.000 claims description 2
- QCHFTSOMWOSFHM-UHFFFAOYSA-N SJ000285536 Natural products C1OC(=O)C(CC)C1CC1=CN=CN1C QCHFTSOMWOSFHM-UHFFFAOYSA-N 0.000 claims description 2
- APZPSKFMSWZPKL-UHFFFAOYSA-N [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(CO)(CO)CO APZPSKFMSWZPKL-UHFFFAOYSA-N 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229940092732 belladonna alkaloid Drugs 0.000 claims description 2
- NZUPCNDJBJXXRF-UHFFFAOYSA-O bethanechol Chemical compound C[N+](C)(C)CC(C)OC(N)=O NZUPCNDJBJXXRF-UHFFFAOYSA-O 0.000 claims description 2
- 229960000910 bethanechol Drugs 0.000 claims description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 2
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical compound [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 claims description 2
- 235000019864 coconut oil Nutrition 0.000 claims description 2
- 239000003240 coconut oil Substances 0.000 claims description 2
- 210000004087 cornea Anatomy 0.000 claims description 2
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 claims description 2
- 229940087490 dibenzyline Drugs 0.000 claims description 2
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 claims description 2
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 claims description 2
- AFSIMBWBBOJPJG-UHFFFAOYSA-N ethenyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC=C AFSIMBWBBOJPJG-UHFFFAOYSA-N 0.000 claims description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 claims description 2
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical group CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims description 2
- ZNAOFAIBVOMLPV-UHFFFAOYSA-N hexadecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCCCCCOC(=O)C(C)=C ZNAOFAIBVOMLPV-UHFFFAOYSA-N 0.000 claims description 2
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 claims description 2
- NZWOPGCLSHLLPA-UHFFFAOYSA-N methacholine Chemical compound C[N+](C)(C)CC(C)OC(C)=O NZWOPGCLSHLLPA-UHFFFAOYSA-N 0.000 claims description 2
- 229960002329 methacholine Drugs 0.000 claims description 2
- 150000002763 monocarboxylic acids Chemical group 0.000 claims description 2
- HMZGPNHSPWNGEP-UHFFFAOYSA-N octadecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C(C)=C HMZGPNHSPWNGEP-UHFFFAOYSA-N 0.000 claims description 2
- SRSFOMHQIATOFV-UHFFFAOYSA-N octanoyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(=O)CCCCCCC SRSFOMHQIATOFV-UHFFFAOYSA-N 0.000 claims description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 2
- 229960001416 pilocarpine Drugs 0.000 claims description 2
- BOQSSGDQNWEFSX-UHFFFAOYSA-N propan-2-yl 2-methylprop-2-enoate Chemical compound CC(C)OC(=O)C(C)=C BOQSSGDQNWEFSX-UHFFFAOYSA-N 0.000 claims description 2
- LYBIZMNPXTXVMV-UHFFFAOYSA-N propan-2-yl prop-2-enoate Chemical compound CC(C)OC(=O)C=C LYBIZMNPXTXVMV-UHFFFAOYSA-N 0.000 claims description 2
- YPVDWEHVCUBACK-UHFFFAOYSA-N propoxycarbonyloxy propyl carbonate Chemical compound CCCOC(=O)OOC(=O)OCCC YPVDWEHVCUBACK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 claims description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetraline Natural products C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 claims description 2
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 claims description 2
- BEQKKZICTDFVMG-UHFFFAOYSA-N 1,2,3,4,6-pentaoxepane-5,7-dione Chemical compound O=C1OOOOC(=O)O1 BEQKKZICTDFVMG-UHFFFAOYSA-N 0.000 claims 1
- PGHAPVDSVLWQGB-UHFFFAOYSA-N 1-ethenyl-3-ethyl-3,4,5-trimethylpyrrolidin-2-one Chemical compound CCC1(C)C(C)C(C)N(C=C)C1=O PGHAPVDSVLWQGB-UHFFFAOYSA-N 0.000 claims 1
- JFUWJIKJUNAHEN-UHFFFAOYSA-N 1-ethenyl-3-ethylpyrrolidin-2-one Chemical compound CCC1CCN(C=C)C1=O JFUWJIKJUNAHEN-UHFFFAOYSA-N 0.000 claims 1
- CRJHKHYPIUPQSX-UHFFFAOYSA-N 1-ethenyl-4,5-dimethylpyrrolidin-2-one Chemical compound CC1CC(=O)N(C=C)C1C CRJHKHYPIUPQSX-UHFFFAOYSA-N 0.000 claims 1
- LWWJIQWIJBMGKE-UHFFFAOYSA-N 1-ethenyl-4-methylpyrrolidin-2-one Chemical compound CC1CN(C=C)C(=O)C1 LWWJIQWIJBMGKE-UHFFFAOYSA-N 0.000 claims 1
- LKAFOGJENXOWMO-UHFFFAOYSA-N 1-ethenyl-5-methylpiperidin-2-one Chemical compound CC1CCC(=O)N(C=C)C1 LKAFOGJENXOWMO-UHFFFAOYSA-N 0.000 claims 1
- XXVUSJBWYAWVQV-UHFFFAOYSA-N 1-ethenylpiperidine-2,6-dione Chemical compound C=CN1C(=O)CCCC1=O XXVUSJBWYAWVQV-UHFFFAOYSA-N 0.000 claims 1
- OLQFXOWPTQTLDP-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCO OLQFXOWPTQTLDP-UHFFFAOYSA-N 0.000 claims 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical group OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims 1
- MSRJEBGZJWLQOC-UHFFFAOYSA-N 4-ethenyl-5-methylmorpholin-3-one Chemical compound CC1COCC(=O)N1C=C MSRJEBGZJWLQOC-UHFFFAOYSA-N 0.000 claims 1
- CAMOXUXMFUTHPK-UHFFFAOYSA-N 5-ethyl-1-methylpyrrolidin-2-one Chemical compound CCC1CCC(=O)N1C CAMOXUXMFUTHPK-UHFFFAOYSA-N 0.000 claims 1
- 229960003260 chlorhexidine Drugs 0.000 claims 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 239000004575 stone Substances 0.000 claims 1
- 239000003431 cross linking reagent Substances 0.000 description 21
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- 238000004821 distillation Methods 0.000 description 11
- 239000000178 monomer Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000003287 optical effect Effects 0.000 description 8
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 7
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 239000000470 constituent Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 239000004971 Cross linker Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- 239000002195 soluble material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000005846 sugar alcohols Polymers 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- 229940044192 2-hydroxyethyl methacrylate Drugs 0.000 description 2
- YYPNJNDODFVZLE-UHFFFAOYSA-N 3-methylbut-2-enoic acid Chemical compound CC(C)=CC(O)=O YYPNJNDODFVZLE-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- PBKVEOSEPXMKDN-LZHUFOCISA-N chembl2311030 Chemical compound CS(O)(=O)=O.CS(O)(=O)=O.CS(O)(=O)=O.CS(O)(=O)=O.C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C(=O)N[C@]3(C(=O)N4[C@H](C(N5CCC[C@H]5[C@]4(O)O3)=O)C(C)C)C(C)C)=C3C2=CNC3=C1.C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C(=O)N[C@]3(C(=O)N4[C@H](C(N5CCC[C@H]5[C@]4(O)O3)=O)C(C)CC)C(C)C)=C3C2=CNC3=C1.C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)C(=O)N[C@]3(C(=O)N4[C@H](C(N5CCC[C@H]5[C@]4(O)O3)=O)CC(C)C)C(C)C)=C3C2=CNC3=C1.C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@](C(N21)=O)(NC(=O)[C@H]1CN(C)[C@H]2[C@@H](C=3C=CC=C4NC=C(C=34)C2)C1)C(C)C)C1=CC=CC=C1 PBKVEOSEPXMKDN-LZHUFOCISA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 238000005498 polishing Methods 0.000 description 2
- 238000011417 postcuring Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- BCNBMSZKALBQEF-UHFFFAOYSA-N 1,3-dimethylpyrrolidin-2-one Chemical compound CC1CCN(C)C1=O BCNBMSZKALBQEF-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- WMKGMCCZGTXXQU-UHFFFAOYSA-N 2,3-benzodioxine-1,4-dione Chemical compound C1=CC=C2C(=O)OOC(=O)C2=C1 WMKGMCCZGTXXQU-UHFFFAOYSA-N 0.000 description 1
- JHQVCQDWGSXTFE-UHFFFAOYSA-N 2-(2-prop-2-enoxycarbonyloxyethoxy)ethyl prop-2-enyl carbonate Chemical compound C=CCOC(=O)OCCOCCOC(=O)OCC=C JHQVCQDWGSXTFE-UHFFFAOYSA-N 0.000 description 1
- PDOKJBAHGUKEMR-UHFFFAOYSA-N 2-ethylbutoxycarbonyloxy 2-ethylbutyl carbonate Chemical compound CCC(CC)COC(=O)OOC(=O)OCC(CC)CC PDOKJBAHGUKEMR-UHFFFAOYSA-N 0.000 description 1
- FNKMJQGPHZOKSB-UHFFFAOYSA-N 3-ethenylpiperidine-2,6-dione Chemical compound C(=C)C1C(=O)NC(CC1)=O FNKMJQGPHZOKSB-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- WWPWUBHXXRVWJK-UHFFFAOYSA-N 5-methylmorpholin-3-one Chemical compound CC1COCC(=O)N1 WWPWUBHXXRVWJK-UHFFFAOYSA-N 0.000 description 1
- NSRPFJGOCZUUHE-UHFFFAOYSA-N 5-methylpiperidin-2-one Chemical compound CC1CCC(=O)NC1 NSRPFJGOCZUUHE-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- QLZINFDMOXMCCJ-UHFFFAOYSA-N 7-(7-hydroxyheptylperoxy)heptan-1-ol Chemical compound OCCCCCCCOOCCCCCCCO QLZINFDMOXMCCJ-UHFFFAOYSA-N 0.000 description 1
- DGUPYKXXILMJFL-UHFFFAOYSA-N C(=C)C1C(N(C(C1)C)CC)=O Chemical compound C(=C)C1C(N(C(C1)C)CC)=O DGUPYKXXILMJFL-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- GERIGMSHTUAXSI-UHFFFAOYSA-N bis(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-phenyl-2,3-dihydro-1h-naphthalene-1,4-dicarboxylate Chemical compound CN1C(C2)CCC1CC2OC(=O)C(C1=CC=CC=C11)CCC1(C(=O)OC1CC2CCC(N2C)C1)C1=CC=CC=C1 GERIGMSHTUAXSI-UHFFFAOYSA-N 0.000 description 1
- 230000009172 bursting Effects 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- 229960004484 carbachol Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011953 free-radical catalyst Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007939 sustained release tablet Substances 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B1/00—Optical elements characterised by the material of which they are made; Optical coatings for optical elements
- G02B1/04—Optical elements characterised by the material of which they are made; Optical coatings for optical elements made of organic materials, e.g. plastics
- G02B1/041—Lenses
- G02B1/043—Contact lenses
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Eyeglasses (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/745,140 US4123407A (en) | 1976-11-26 | 1976-11-26 | Hydrophilic contact lens |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1593659A true GB1593659A (en) | 1981-07-22 |
Family
ID=24995420
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB49129/77A Expired GB1593659A (en) | 1976-11-26 | 1977-11-25 | Hydrophilic copolymers |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4123407A (enExample) |
| JP (1) | JPS53105250A (enExample) |
| AU (1) | AU514538B2 (enExample) |
| BE (1) | BE861203A (enExample) |
| CH (1) | CH638901A5 (enExample) |
| DE (1) | DE2751215A1 (enExample) |
| ES (1) | ES464477A1 (enExample) |
| FR (1) | FR2372451A1 (enExample) |
| GB (1) | GB1593659A (enExample) |
| GR (1) | GR63678B (enExample) |
| IL (1) | IL53458A (enExample) |
| IT (1) | IT1090582B (enExample) |
| NL (1) | NL192011C (enExample) |
| NZ (1) | NZ185639A (enExample) |
| PH (1) | PH14089A (enExample) |
| PT (1) | PT67320B (enExample) |
| ZA (1) | ZA776698B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2181440A (en) * | 1985-09-04 | 1987-04-23 | Ceskoslovenska Akademie Ved | Hydrophilic copolymer suitable for contact lenses |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4243789A (en) * | 1977-09-01 | 1981-01-06 | The B. F. Goodrich Company | Hydroxyl-containing liquid polymers and pressure-sensitive adhesives prepared therefrom |
| US4328148A (en) * | 1979-07-27 | 1982-05-04 | Petr Kuzma | Compositions comprising water and hydrophilic polymers and contact lenses therefrom |
| EP0044293A1 (en) * | 1980-01-21 | 1982-01-27 | FOLEY, Jr., William M. | Quaternary ammonium salts in hydrogel contact lenses |
| CA1187645A (en) * | 1981-01-12 | 1985-05-21 | Kyoichi Tanaka | Contact lens and process for preparing the same |
| CA1182614A (en) * | 1981-05-01 | 1985-02-19 | Kyoichi Tanaka | Contact lens and process for preparing the same |
| US4430458A (en) | 1981-10-08 | 1984-02-07 | Kelvin Lenses Limited | Hydrogel-forming polymeric materials |
| JPS59195621A (ja) * | 1983-04-22 | 1984-11-06 | Toyo Contact Lens Co Ltd | 軟質コンタクトレンズ |
| US4891046A (en) * | 1984-03-15 | 1990-01-02 | Coopervision, Inc. | Tinted contact lens and method for preparation with dichlorotriazine reactive dye |
| CA1272329C (en) * | 1985-01-09 | 1990-07-31 | HIGHLY HYGROSCOPIC SOFT CONTACT LENSES | |
| US4693446A (en) * | 1985-09-20 | 1987-09-15 | Techna Vision, Inc. | Gasket for molding plastic lenses |
| EP0226123A3 (en) * | 1985-12-03 | 1988-08-10 | Matsushita Electric Industrial Co., Ltd. | Method for producing transparent plastic article |
| US4791175A (en) * | 1986-08-04 | 1988-12-13 | Ciba-Geigy Corporation | Particulate hydroperoxidized poly-n-vinyl lactam, its preparation and use thereof |
| US4833196A (en) * | 1986-08-04 | 1989-05-23 | Ciba-Geigy Corporation | Particulate hydroperoxidized poly-N-vinyl lactam, its preparation and use thereof |
| US4678838A (en) * | 1986-08-04 | 1987-07-07 | Ciba-Geigy Corporation | Particulate hydroperoxidized poly-N-vinyl lactam, its preparation and use thereof |
| US5151106A (en) * | 1990-12-21 | 1992-09-29 | Allergan, Inc. | Method for tinting a hydrophilic polymer by incorporating a reactive dye into the polymer prior to polymerization |
| NZ298808A (en) * | 1995-02-02 | 1999-11-29 | Novartis Ag | Process for manufacture of moulded optical articles like contact lenses that are partly coloured or have regions of different colours |
| US6132462A (en) * | 1995-12-22 | 2000-10-17 | Santen Pharmaceutical Co., Ltd. | Copolymers formed from three components and intraocular lenses made thereof |
| CN1089754C (zh) | 1997-06-05 | 2002-08-28 | 参天制药株式会社 | 用作聚合物成分的衣康酸衍生物 |
| CN1213671A (zh) | 1997-10-07 | 1999-04-14 | 参天制药株式会社 | 四成分共聚物及由该共聚物形成的眼用透镜 |
| US7052131B2 (en) * | 2001-09-10 | 2006-05-30 | J&J Vision Care, Inc. | Biomedical devices containing internal wetting agents |
| US20070043140A1 (en) * | 1998-03-02 | 2007-02-22 | Lorenz Kathrine O | Method for the mitigation of symptoms of contact lens related dry eye |
| US6822016B2 (en) * | 2001-09-10 | 2004-11-23 | Johnson & Johnson Vision Care, Inc. | Biomedical devices containing internal wetting agents |
| US7461937B2 (en) * | 2001-09-10 | 2008-12-09 | Johnson & Johnson Vision Care, Inc. | Soft contact lenses displaying superior on-eye comfort |
| US20070138692A1 (en) * | 2002-09-06 | 2007-06-21 | Ford James D | Process for forming clear, wettable silicone hydrogel articles |
| JP2006065481A (ja) * | 2004-08-25 | 2006-03-09 | Aruze Corp | 情報処理装置 |
| KR101231181B1 (ko) | 2007-06-25 | 2013-02-07 | 남택인 | 연질 콘텍트렌즈용 실리콘 하이드로겔 조성물 및 그 조성에의해 제조된 연질 콘텍트렌즈 |
| CA2693808C (en) * | 2007-07-19 | 2015-10-20 | Alcon, Inc. | High ion and metabolite flux lenses and materials |
| AU2009228847B2 (en) * | 2008-03-27 | 2014-08-07 | Alcon, Inc. | Hydrogel intraocular lens and method of forming same |
| CN102382227B (zh) * | 2011-08-12 | 2014-03-19 | 天津博纳艾杰尔科技有限公司 | 溶胀共聚法制备n-乙烯基吡咯烷酮与二乙烯苯单分散微球 |
| ES2550105B2 (es) * | 2015-06-25 | 2016-10-07 | Universidade De Santiago De Compostela | Lentes de contacto para conjuntivitis alérgica |
| ES2678773B1 (es) * | 2017-01-16 | 2019-06-12 | Consejo Superior Investigacion | Recubrimientos tipo hidrogel en base vinil-lactamas |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2948708A (en) * | 1958-04-03 | 1960-08-09 | Dow Chemical Co | Water-soluble copolymers of ring substituted n-vinyl-2-oxazolidinone |
| US3390139A (en) * | 1964-03-04 | 1966-03-11 | Rohm & Haas | Nu-vinyl-2-piperazinones |
| US3689439A (en) * | 1968-06-12 | 1972-09-05 | Gaf Corp | Process for preparing a crosslinked porous polyvinyl pyrrolidone granule |
| US3639524A (en) * | 1969-07-28 | 1972-02-01 | Maurice Seiderman | Hydrophilic gel polymer insoluble in water from polyvinylpyrrolidone with n-vinyl-2-pyrrolidone and methacrylic modifier |
| GB1391438A (en) * | 1971-04-20 | 1975-04-23 | Contact Lens Mfg Ltd | Hydrophilic copolymers and articles formed therefrom |
| US3937680A (en) * | 1973-05-29 | 1976-02-10 | Global Vision, Inc. | Hydrophilic gel terpolymers from hydrophilic n-vinyl monomers, hydroxyalkyl acrylates or methacrylates and polymerizable unsaturated carboxylic acids |
| JPS5337028B2 (enExample) * | 1973-12-11 | 1978-10-06 | ||
| US3978164A (en) * | 1974-11-21 | 1976-08-31 | Warner-Lambert Company | Pyrrolidone-methacrylate graft copolymers from 3-stage polymerization process |
-
1976
- 1976-11-26 US US05/745,140 patent/US4123407A/en not_active Expired - Lifetime
-
1977
- 1977-11-07 NZ NZ185639A patent/NZ185639A/xx unknown
- 1977-11-08 GR GR54736A patent/GR63678B/el unknown
- 1977-11-09 ZA ZA00776698A patent/ZA776698B/xx unknown
- 1977-11-16 DE DE19772751215 patent/DE2751215A1/de active Granted
- 1977-11-18 AU AU30770/77A patent/AU514538B2/en not_active Expired
- 1977-11-22 PH PH20459A patent/PH14089A/en unknown
- 1977-11-23 CH CH1431577A patent/CH638901A5/de not_active IP Right Cessation
- 1977-11-23 NL NL7712888A patent/NL192011C/xx not_active IP Right Cessation
- 1977-11-24 IL IL53458A patent/IL53458A/xx unknown
- 1977-11-24 IT IT51919/77A patent/IT1090582B/it active
- 1977-11-24 PT PT67320A patent/PT67320B/pt unknown
- 1977-11-25 JP JP14210177A patent/JPS53105250A/ja active Granted
- 1977-11-25 GB GB49129/77A patent/GB1593659A/en not_active Expired
- 1977-11-25 BE BE182925A patent/BE861203A/xx not_active IP Right Cessation
- 1977-11-25 FR FR7735561A patent/FR2372451A1/fr active Granted
- 1977-11-25 ES ES464477A patent/ES464477A1/es not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2181440A (en) * | 1985-09-04 | 1987-04-23 | Ceskoslovenska Akademie Ved | Hydrophilic copolymer suitable for contact lenses |
| GB2181440B (en) * | 1985-09-04 | 1990-04-25 | Ceskoslovenska Akademie Ved | Hydrophilic copolymer suitable for contact lenses and medical application and a method for producing thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| AU3077077A (en) | 1979-05-24 |
| IL53458A (en) | 1980-11-30 |
| IL53458A0 (en) | 1978-01-31 |
| ES464477A1 (es) | 1979-06-01 |
| AU514538B2 (en) | 1981-02-12 |
| FR2372451B1 (enExample) | 1981-11-27 |
| IT1090582B (it) | 1985-06-26 |
| PT67320A (en) | 1977-12-01 |
| US4123407A (en) | 1978-10-31 |
| JPS6148134B2 (enExample) | 1986-10-22 |
| DE2751215C2 (enExample) | 1990-12-20 |
| FR2372451A1 (fr) | 1978-06-23 |
| DE2751215A1 (de) | 1978-06-01 |
| NL192011C (nl) | 1996-12-03 |
| PT67320B (en) | 1979-04-24 |
| BE861203A (fr) | 1978-03-16 |
| ZA776698B (en) | 1978-08-30 |
| GR63678B (en) | 1979-11-28 |
| NZ185639A (en) | 1979-03-16 |
| NL7712888A (nl) | 1978-05-30 |
| PH14089A (en) | 1981-02-10 |
| JPS53105250A (en) | 1978-09-13 |
| NL192011B (nl) | 1996-08-01 |
| CH638901A5 (de) | 1983-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4123407A (en) | Hydrophilic contact lens | |
| US4123408A (en) | Hydrogel contact lens | |
| US3532679A (en) | Hydrogels from cross-linked polymers of n-vinyl lactams and alkyl acrylates | |
| US5311223A (en) | Ophthalmic lens polymer incorporating acyclic monomer | |
| US3503942A (en) | Hydrophilic plastic contact lens | |
| US3983083A (en) | Soft contact lenses and process for preparation thereof | |
| EP0345994B1 (en) | Contact lenses and materials and methods of making same | |
| US3758448A (en) | Copolymers and hydrogels of unsaturated esters | |
| US4866148A (en) | Hydrophilic copolymers, the use thereof as biomedical materials and contact-optical articles produced therefrom | |
| US4242483A (en) | Oxygen permeable hard and semi-hard contact lens compositions, methods and articles of manufacture | |
| US3985697A (en) | Hydrophilic contact lens material | |
| US5135965A (en) | Hydrogel-forming polymers used in intraocular lenses | |
| US3787380A (en) | Polymers of n-vinyl or n-allyl hetero-cyclic compounds with monoethyl-enically unsaturated esters and gly-cidyl esters | |
| GB1569493A (en) | Process of producing soft contact lenses | |
| US4430458A (en) | Hydrogel-forming polymeric materials | |
| US3947401A (en) | Hydrogels of unsaturated ester copolymers | |
| AU592962B2 (en) | Hydrogel-forming polymers | |
| GB1588744A (en) | Cross-linked polymer composition for use in soft contact lenses | |
| US3951528A (en) | Method of making polymeric contact lens | |
| US6262208B1 (en) | Ocular lens material and process for producing the same | |
| CA2785946A1 (en) | Methods for the preparation of biocompatible polymers, the polymers and their uses | |
| US3772235A (en) | Copolymers and hydrogels of unsaturated heterocyclic compounds | |
| EP0234749B1 (en) | Hydrogel polymers | |
| EP0017512B1 (en) | Polymeric materials, process for preparing them and shaped articles and contact lenses formed from them | |
| JP2503028B2 (ja) | コンタクトレンズの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 732 | Registration of transactions, instruments or events in the register (sect. 32/1977) | ||
| PE20 | Patent expired after termination of 20 years |
Effective date: 19971124 |