GB1590762A - Tracer compositions - Google Patents
Tracer compositions Download PDFInfo
- Publication number
- GB1590762A GB1590762A GB4509077A GB4509077A GB1590762A GB 1590762 A GB1590762 A GB 1590762A GB 4509077 A GB4509077 A GB 4509077A GB 4509077 A GB4509077 A GB 4509077A GB 1590762 A GB1590762 A GB 1590762A
- Authority
- GB
- United Kingdom
- Prior art keywords
- tracer
- acid
- acids
- sulphonic
- aromatic carboxylic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 59
- 239000000700 radioactive tracer Substances 0.000 title claims description 50
- 239000002253 acid Substances 0.000 claims description 30
- 150000007513 acids Chemical class 0.000 claims description 23
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 19
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 19
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- 125000003118 aryl group Chemical class 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 13
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 11
- 238000005660 chlorination reaction Methods 0.000 claims description 10
- 239000007800 oxidant agent Substances 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- -1 alkali metal salts Chemical class 0.000 claims description 8
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- 159000000007 calcium salts Chemical class 0.000 claims description 6
- 150000002894 organic compounds Chemical class 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 5
- 229910052749 magnesium Inorganic materials 0.000 claims description 5
- 239000011777 magnesium Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 150000002739 metals Chemical class 0.000 claims description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 4
- POPBYCBXVLHSKO-UHFFFAOYSA-N 9,10-dioxoanthracene-1-carboxylic acid Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O POPBYCBXVLHSKO-UHFFFAOYSA-N 0.000 claims description 3
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical group 0.000 claims description 3
- 150000002823 nitrates Chemical class 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 3
- ZGZXYZZHXXTTJN-UHFFFAOYSA-N 2,3-dichlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(Cl)=C1Cl ZGZXYZZHXXTTJN-UHFFFAOYSA-N 0.000 claims description 2
- WZHHYIOUKQNLQM-UHFFFAOYSA-N 3,4,5,6-tetrachlorophthalic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O WZHHYIOUKQNLQM-UHFFFAOYSA-N 0.000 claims description 2
- YUDBKSANIWMLCU-UHFFFAOYSA-N 3,4-dichlorophthalic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Cl)=C1C(O)=O YUDBKSANIWMLCU-UHFFFAOYSA-N 0.000 claims description 2
- 239000005749 Copper compound Substances 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 239000004411 aluminium Substances 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- MIAUJDCQDVWHEV-UHFFFAOYSA-N benzene-1,2-disulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O MIAUJDCQDVWHEV-UHFFFAOYSA-N 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 150000008107 benzenesulfonic acids Chemical class 0.000 claims description 2
- 239000007767 bonding agent Substances 0.000 claims description 2
- SFPILOGVGHIRAT-UHFFFAOYSA-L calcium;3,4,5,6-tetrachlorophthalate Chemical compound [Ca+2].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C([O-])=O SFPILOGVGHIRAT-UHFFFAOYSA-L 0.000 claims description 2
- DJKGDNKYTKCJKD-UHFFFAOYSA-N chlorendic acid Chemical compound ClC1=C(Cl)C2(Cl)C(C(=O)O)C(C(O)=O)C1(Cl)C2(Cl)Cl DJKGDNKYTKCJKD-UHFFFAOYSA-N 0.000 claims description 2
- URCLXLVQHAJFSJ-UHFFFAOYSA-N chlorosulfonyl hypochlorite Chemical class ClOS(Cl)(=O)=O URCLXLVQHAJFSJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims description 2
- 150000001880 copper compounds Chemical class 0.000 claims description 2
- 229910000765 intermetallic Inorganic materials 0.000 claims description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N lead dioxide Inorganic materials O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 claims description 2
- YTHCQFKNFVSQBC-UHFFFAOYSA-N magnesium silicide Chemical compound [Mg]=[Si]=[Mg] YTHCQFKNFVSQBC-UHFFFAOYSA-N 0.000 claims description 2
- 229910021338 magnesium silicide Inorganic materials 0.000 claims description 2
- 150000003022 phthalic acids Chemical class 0.000 claims description 2
- 235000010344 sodium nitrate Nutrition 0.000 claims description 2
- 239000004317 sodium nitrate Substances 0.000 claims description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims 1
- GWZCCUDJHOGOSO-UHFFFAOYSA-N diphenic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1C(O)=O GWZCCUDJHOGOSO-UHFFFAOYSA-N 0.000 claims 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B27/00—Compositions containing a metal, boron, silicon, selenium or tellurium or mixtures, intercompounds or hydrides thereof, and hydrocarbons or halogenated hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Electroluminescent Light Sources (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762650114 DE2650114C3 (de) | 1976-10-30 | 1976-10-30 | Pyrotechnischer Leuchtsatz hoher spezifischer Lichtleistung und dessen Verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1590762A true GB1590762A (en) | 1981-06-10 |
Family
ID=5992204
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4509077A Expired GB1590762A (en) | 1976-10-30 | 1977-10-28 | Tracer compositions |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE860252A (enrdf_load_stackoverflow) |
| DE (1) | DE2650114C3 (enrdf_load_stackoverflow) |
| FR (1) | FR2369536A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1590762A (enrdf_load_stackoverflow) |
| IT (1) | IT1090049B (enrdf_load_stackoverflow) |
| SE (1) | SE420537B (enrdf_load_stackoverflow) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2153809A (en) * | 1984-01-26 | 1985-08-29 | Weber Hermann Pyro Chemie | Pyrotechnic composition for the production of flashes of light |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2415847C1 (de) * | 1974-04-02 | 1985-12-05 | Dynamit Nobel Ag, 5210 Troisdorf | Farbiger Leuchtspursatz für kleine Kalibermunition |
| DE102023125957A1 (de) * | 2023-09-25 | 2025-03-27 | Rws Gmbh | Leuchtspurprojektil mit mindestens einem farbwechsel |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE750642C (de) * | 1935-01-10 | 1945-01-23 | Farbige Leuchtsaetze hoher Intensitaet | |
| BE569015A (enrdf_load_stackoverflow) * | 1957-07-17 |
-
1976
- 1976-10-30 DE DE19762650114 patent/DE2650114C3/de not_active Expired
-
1977
- 1977-10-27 SE SE7712100A patent/SE420537B/xx not_active IP Right Cessation
- 1977-10-28 BE BE182163A patent/BE860252A/xx not_active IP Right Cessation
- 1977-10-28 GB GB4509077A patent/GB1590762A/en not_active Expired
- 1977-10-28 FR FR7732768A patent/FR2369536A1/fr active Granted
- 1977-10-28 IT IT5162377A patent/IT1090049B/it active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2153809A (en) * | 1984-01-26 | 1985-08-29 | Weber Hermann Pyro Chemie | Pyrotechnic composition for the production of flashes of light |
Also Published As
| Publication number | Publication date |
|---|---|
| BE860252A (fr) | 1978-02-15 |
| SE7712100L (sv) | 1978-05-01 |
| SE420537B (sv) | 1981-10-12 |
| DE2650114C3 (de) | 1980-06-19 |
| FR2369536B1 (enrdf_load_stackoverflow) | 1984-08-03 |
| FR2369536A1 (fr) | 1978-05-26 |
| DE2650114B2 (de) | 1979-10-04 |
| DE2650114A1 (de) | 1978-05-03 |
| IT1090049B (it) | 1985-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5639984A (en) | Infrared tracer compositions | |
| FI79519B (fi) | Bly- och bariumfri taendsats. | |
| DE69224081T2 (de) | Nichtgiftige vorbehandlungsmischung | |
| US5388519A (en) | Low toxicity primer composition | |
| US3707411A (en) | Primer composition for solid propellant charges | |
| DE69513251T2 (de) | Nichtgiftige Materialien enthaltende, schlagempfindliche Zündmittelzusammensetzung und deren Verwendung für Perkussionszündsatzpatronen | |
| US5917146A (en) | High-nitrogen energetic material based pyrotechnic compositions | |
| EP0652277A2 (en) | Infrared illuminating composition | |
| US3046168A (en) | Chemically produced colored smokes | |
| US3370537A (en) | Castable pyrotechnic composition comprising metal nitrates or chlorates and finely divided metal | |
| GB1590762A (en) | Tracer compositions | |
| US3951705A (en) | Blue-burning tracer mix | |
| US3788908A (en) | Tracer incendiary composition of alkylaluminum,inorganic oxidizer,and zirconium | |
| US3617405A (en) | Incendiary composition containing a metal, metal alloy, oxidizer salt, and nitrated organic compound | |
| US3464869A (en) | Pyrotechnic compositions containing metal fuel,inorganic oxidizer salt,and a vinyl polymer in a solvent | |
| US2951752A (en) | Incendiary composition | |
| GB1605237A (en) | Tracer composition for small calibre ammunition | |
| CA2604980C (en) | Non-toxic boron-containing ir tracer compositions and ir tracer projectiles containing the same for generating a dim visibility ir trace | |
| US2409201A (en) | Smoke-producing mixture | |
| EP0070932B1 (en) | Initiatory explosive for detonators and method of preparing the same | |
| US6946042B2 (en) | Pyrotechnic body | |
| US3262824A (en) | Smokeless ashless signal flare composition containing ammonium perchlorate | |
| RU99109175A (ru) | Баллиститное ракетное твердое топливо | |
| US8066833B2 (en) | Non-toxic boron-containing IR tracer compositions and IR tracer projectiles containing the same for generating a dim visibility IR trace | |
| US1244940A (en) | Smoke-producing compound. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19931028 |