GB1529126A - Ypsilon-(phenoxy or pyridyloxyphenoxy)valeric acid derivatives herbicidal compositions containing them and methods for their use - Google Patents
Ypsilon-(phenoxy or pyridyloxyphenoxy)valeric acid derivatives herbicidal compositions containing them and methods for their useInfo
- Publication number
- GB1529126A GB1529126A GB14444/77A GB1444477A GB1529126A GB 1529126 A GB1529126 A GB 1529126A GB 14444/77 A GB14444/77 A GB 14444/77A GB 1444477 A GB1444477 A GB 1444477A GB 1529126 A GB1529126 A GB 1529126A
- Authority
- GB
- United Kingdom
- Prior art keywords
- phenoxy
- compound
- acid derivatives
- herbicidal compositions
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002363 herbicidal effect Effects 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 title abstract 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N pentanoic acid group Chemical class C(CCCC)(=O)O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 5
- -1 4-trifluoromethylphenyl- Chemical group 0.000 abstract 4
- 239000002253 acid Substances 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000004414 alkyl thio group Chemical group 0.000 abstract 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 239000002671 adjuvant Substances 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 229950001902 dimevamide Drugs 0.000 abstract 1
- IVQSXIKFCANEOP-UHFFFAOYSA-N ethylsulfanyl pentanoate Chemical compound C(C)SOC(CCCC)=O IVQSXIKFCANEOP-UHFFFAOYSA-N 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 150000002596 lactones Chemical class 0.000 abstract 1
- IPWFJLQDVFKJDU-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O IPWFJLQDVFKJDU-UHFFFAOYSA-N 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4295276A JPS52131540A (en) | 1976-04-14 | 1976-04-14 | Phenoxyvaleric acid derivatives and herbicides therefrom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1529126A true GB1529126A (en) | 1978-10-18 |
Family
ID=12650346
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB14444/77A Expired GB1529126A (en) | 1976-04-14 | 1977-04-05 | Ypsilon-(phenoxy or pyridyloxyphenoxy)valeric acid derivatives herbicidal compositions containing them and methods for their use |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4134751A (enExample) |
| JP (1) | JPS52131540A (enExample) |
| AR (1) | AR215893A1 (enExample) |
| BR (1) | BR7702315A (enExample) |
| CA (1) | CA1110245A (enExample) |
| DE (1) | DE2715284A1 (enExample) |
| FR (2) | FR2364206A1 (enExample) |
| GB (1) | GB1529126A (enExample) |
| SU (1) | SU668569A3 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7129274B1 (en) | 1999-11-05 | 2006-10-31 | Emisphere Technologies Inc. | Phenoxy carboxylic acid compounds and compositions for delivering active agents |
| US7279597B1 (en) | 1999-11-05 | 2007-10-09 | Emisphere Technologies, Inc. | Phenyl amine carboxylic acid compounds and compositions for delivering active agents |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH624087A5 (en) * | 1976-08-25 | 1981-07-15 | Hoechst Ag | Process for the preparation of phenoxyphenoxypropionic acid derivatives |
| JPS54119476A (en) * | 1978-03-10 | 1979-09-17 | Ishihara Sangyo Kaisha Ltd | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| US4491468A (en) * | 1977-07-22 | 1985-01-01 | The Dow Chemical Company | Herbicidal trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanenitriles and derivatives thereof |
| US4263040A (en) * | 1978-02-18 | 1981-04-21 | Kumiai Chemical Industry Co., Ltd. | Phenoxyphenoxy unsaturated derivatives and herbicidal composition |
| DE2961736D1 (en) * | 1978-03-17 | 1982-02-25 | Ciba Geigy Ag | Derivatives of phenoxy-alkanecarboxylic acids, their preparation, weed-killing products containing them and their use |
| JPS54144375A (en) * | 1978-04-27 | 1979-11-10 | Ishihara Sangyo Kaisha Ltd | 4-(5-trifluoromethyl-2-pyridyloxy)phenoxyalkane derivative and herbicide containing the same |
| CA1114382A (en) * | 1978-07-03 | 1981-12-15 | Hermann Rempfler | Esters of 0-(pyridyloxy-phenyl)-lactic acids |
| JPS5562043A (en) * | 1978-11-01 | 1980-05-10 | Ihara Chem Ind Co Ltd | Preparation of phenoxycarboxylic acid derivative |
| JPS55139361A (en) * | 1979-04-19 | 1980-10-31 | Ishihara Sangyo Kaisha Ltd | Preparation of 4-(pyridyl-2-oxy)phenoxyalkane-carboxylic acid or its derivative |
| US4228172A (en) * | 1979-07-30 | 1980-10-14 | The Dow Chemical Company | Substituted pyridine methyl esters of 2-isopropyl-2-(4-chlorophenyl)acetic acid and their use as insecticides |
| US4221799A (en) * | 1979-07-30 | 1980-09-09 | The Dow Chemical | Substituted pyridine methyl esters of tetramethyl cyclopropane carboxylic acids and their use as insecticides |
| US4258048A (en) * | 1979-07-30 | 1981-03-24 | The Dow Chemical Company | Substituted pyridine methyl esters of tetramethyl cyclopropane carboxylic acids and their use as insecticides |
| BR8005226A (pt) * | 1979-08-23 | 1981-03-04 | Du Pont | Composto herbicida, composicao e processo para o controle de vegetacao indesejavel, composicao e processo para o controle de er vas gramineas em plantas de folhas grandes e processo para preparar um composto herbicida |
| IL63944A (en) * | 1980-10-14 | 1985-02-28 | Zoecon Corp | Substituted phenoxy aliphatic compounds and weed control compositions containing the same |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| US4529438A (en) * | 1982-03-23 | 1985-07-16 | Zoecon Corp. | Pyridyloxy-phenoxy-alkanoic acid esters and derivatives |
| US4522647A (en) * | 1982-07-30 | 1985-06-11 | Zoecon Corporation | Substituted phenoxyalkanediones and their herbicidal method of use |
| US4477672A (en) * | 1982-08-06 | 1984-10-16 | Zoecon Corporation | Alkylsulfonyloxy substituted phenoxy alkanoic esters |
| US4483992A (en) * | 1982-08-06 | 1984-11-20 | Zoecon Corporation | Alkylthio substituted phenoxy alkanoic acid esters |
| US4520199A (en) * | 1982-08-13 | 1985-05-28 | Zoecon Corporation | Alkoxy substituted phenoxy alkanoic acid esters |
| US4467092A (en) * | 1982-08-20 | 1984-08-21 | Zoecon Corporation | Carbamates and thiocarbamates of 3-hydroxy-4-pyridyloxyphenoxy alkanoic acid esters |
| US4469872A (en) * | 1982-08-20 | 1984-09-04 | Zoecon Corporation | Substituted pyridyloxyphenoxyhydroxyketones |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| US4629813A (en) * | 1985-05-14 | 1986-12-16 | Ciba-Geigy Corporation | Hydroxyphenyloxime ethers |
| WO2013148512A1 (en) * | 2012-03-26 | 2013-10-03 | Dow Agrosciences Llc | Materials and methods for the base-assisted synthesis of substituted heteroaromatics |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2223894C3 (de) * | 1972-05-17 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Herbizide Mittel auf Basis von Phenoxycarbonsäurederivaten |
| JPS5327768B2 (enExample) * | 1974-10-17 | 1978-08-10 | ||
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
-
1976
- 1976-04-14 JP JP4295276A patent/JPS52131540A/ja active Pending
-
1977
- 1977-04-05 GB GB14444/77A patent/GB1529126A/en not_active Expired
- 1977-04-05 DE DE19772715284 patent/DE2715284A1/de not_active Ceased
- 1977-04-07 CA CA276,016A patent/CA1110245A/en not_active Expired
- 1977-04-13 SU SU772469257A patent/SU668569A3/ru active
- 1977-04-13 BR BR7702315A patent/BR7702315A/pt unknown
- 1977-04-13 AR AR267202A patent/AR215893A1/es active
- 1977-04-14 US US05/787,640 patent/US4134751A/en not_active Expired - Lifetime
- 1977-04-14 FR FR7711323A patent/FR2364206A1/fr active Granted
- 1977-12-22 FR FR7738868A patent/FR2364198A1/fr active Granted
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7129274B1 (en) | 1999-11-05 | 2006-10-31 | Emisphere Technologies Inc. | Phenoxy carboxylic acid compounds and compositions for delivering active agents |
| US7279597B1 (en) | 1999-11-05 | 2007-10-09 | Emisphere Technologies, Inc. | Phenyl amine carboxylic acid compounds and compositions for delivering active agents |
| US7951971B1 (en) | 1999-11-05 | 2011-05-31 | Emisphere Technologies, Inc. | Phenoxy carboxylic acid compounds and compositions for delivering active agents |
| US8410309B2 (en) | 1999-11-05 | 2013-04-02 | Emisphere Technologies, Inc. | Phenoxy carboxylic acid compounds and compositions for delivering active agents |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2364198B1 (enExample) | 1980-07-18 |
| DE2715284A1 (de) | 1977-10-27 |
| SU668569A3 (ru) | 1979-06-15 |
| US4134751A (en) | 1979-01-16 |
| FR2364206A1 (fr) | 1978-04-07 |
| FR2364198A1 (fr) | 1978-04-07 |
| FR2364206B1 (enExample) | 1981-07-17 |
| CA1110245A (en) | 1981-10-06 |
| BR7702315A (pt) | 1978-05-09 |
| JPS52131540A (en) | 1977-11-04 |
| AR215893A1 (es) | 1979-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1529126A (en) | Ypsilon-(phenoxy or pyridyloxyphenoxy)valeric acid derivatives herbicidal compositions containing them and methods for their use | |
| GB1491274A (en) | Substituted(pyridyl-2-oxy)phenoxy alkane carboxylic acid derivatives and their use as herbicides | |
| IE42969L (en) | Pyrazino-pyridoazepines | |
| EP0256503A3 (en) | Pyridinecarboxamide derivatives and their use as fungicide | |
| ES8502105A1 (es) | Un procedimiento para la preparacion de derivados de diben- zopirano | |
| ES481729A1 (es) | Procedimiento para la preparacion de derivados de 1,2-dihi- droquinolein-2-onas. | |
| ES8609204A1 (es) | Procedimiento de preparar derivados aminicos | |
| FR2509312B1 (enExample) | ||
| PT83104B (en) | Novel guanidinomethylbenzoic acid derivatives | |
| ZA882931B (en) | New herbicide,its preparation and use | |
| EP0173377A3 (en) | Pyrimidone compounds, their preparation and pharmaceutical compositions containing them | |
| EP0003648A3 (en) | 4-aryloxy-substituted phenoxypropionamide derivatives useful as herbicides, compositions containing them, and processes for making them | |
| EP0209843A3 (en) | Benzylpiperazine compound, preparation thereof, pharmaceutical composition, and use | |
| EP0037851A3 (en) | Carboxylates, a process for their production, an insecticidal and/or acaricidal composition and the use of the compounds as insecticides and/or acaricides | |
| IL60601A0 (en) | Azolyl-alkenols, their preparation and their use as fungicides | |
| GB1174160A (en) | Novel Dithiophosphoric Acid Esters having Herbicidal Activity | |
| ES8506605A1 (es) | Procedimiento de preparacion de eteres oximas basicos y de sus sales de adicion acidas | |
| EP0103895A3 (en) | Novel hydroxylamine derivatives, production and use thereof | |
| EP0014893A3 (en) | 3-trifluorothiomethyl-2-(3-amino-2-subst.-propoxy)pyridines, their pharmaceutically acceptable salts and intermediates, their preparation and an antihypertensive composition containing them | |
| GB1437364A (en) | Pesticidal phosphorus-containing triazole derivatives | |
| GB8500482D0 (en) | Substituted phenyl ethers | |
| AU9093382A (en) | Substituted pyrimidinyl organophosphorus insecticides | |
| IE831620L (en) | Herbicidal mixtures | |
| GB1410965A (en) | Cyclic phosphorus esters having pesticidal properties | |
| UA19166A1 (uk) | Гербіцидhа композиція |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |