GB1502232A - Substituted 2-phenylimino-1,3-dithiolanes process for their preparation and their use as ectoparasiticidal agents - Google Patents
Substituted 2-phenylimino-1,3-dithiolanes process for their preparation and their use as ectoparasiticidal agentsInfo
- Publication number
- GB1502232A GB1502232A GB34790/76A GB3479076A GB1502232A GB 1502232 A GB1502232 A GB 1502232A GB 34790/76 A GB34790/76 A GB 34790/76A GB 3479076 A GB3479076 A GB 3479076A GB 1502232 A GB1502232 A GB 1502232A
- Authority
- GB
- United Kingdom
- Prior art keywords
- dithiolanes
- chloro
- methyl
- phenylimino
- halophenylimino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000001984 ectoparasiticidal effect Effects 0.000 title abstract 2
- NIHKXHCRGWYVLM-UHFFFAOYSA-N n-phenyl-1,3-dithiolan-2-imine Chemical class S1CCSC1=NC1=CC=CC=C1 NIHKXHCRGWYVLM-UHFFFAOYSA-N 0.000 title 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 2
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 2
- 101710178035 Chorismate synthase 2 Proteins 0.000 abstract 1
- 101710152694 Cysteine synthase 2 Proteins 0.000 abstract 1
- -1 N - (-chloro- -methylphenyl)dithiocarbamic acid triethylammonium salt Chemical compound 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 150000001768 cations Chemical class 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- NOWALCIBCFXQGY-UHFFFAOYSA-N n-(4-bromo-2-methylphenyl)-1,3-dithiolan-2-imine Chemical class CC1=CC(Br)=CC=C1N=C1SCCS1 NOWALCIBCFXQGY-UHFFFAOYSA-N 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D339/00—Heterocyclic compounds containing rings having two sulfur atoms as the only ring hetero atoms
- C07D339/02—Five-membered rings
- C07D339/06—Five-membered rings having the hetero atoms in positions 1 and 3, e.g. cyclic dithiocarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752537379 DE2537379A1 (de) | 1975-08-22 | 1975-08-22 | Substituierte 2-phenylimino-1,3- dithiolane, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitizide mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1502232A true GB1502232A (en) | 1978-02-22 |
Family
ID=5954571
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB34790/76A Expired GB1502232A (en) | 1975-08-22 | 1976-08-20 | Substituted 2-phenylimino-1,3-dithiolanes process for their preparation and their use as ectoparasiticidal agents |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4060628A (enExample) |
| AR (1) | AR211551A1 (enExample) |
| AU (1) | AU497414B2 (enExample) |
| BE (1) | BE845384A (enExample) |
| CA (1) | CA1064948A (enExample) |
| DE (1) | DE2537379A1 (enExample) |
| EG (1) | EG12328A (enExample) |
| ES (1) | ES450849A1 (enExample) |
| FR (1) | FR2321493A1 (enExample) |
| GB (1) | GB1502232A (enExample) |
| KE (1) | KE2863A (enExample) |
| NL (1) | NL7609313A (enExample) |
| ZA (1) | ZA765004B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0100815A1 (en) * | 1982-04-12 | 1984-02-22 | Merrell Dow Pharmaceuticals Inc. | N-(1,3-dithiolan-2-ylidene)anilines and their use as anti-inflammatory and anti-asthmatic agents |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4231783A (en) * | 1978-11-15 | 1980-11-04 | Monsanto Company | Substituted 2-imino-1,3-dithio and 1,3-oxathio heterocyclic compounds as herbicidal antidotes |
| US4471571A (en) * | 1978-11-15 | 1984-09-18 | Monsanto Company | Substituted 2-imino-1,3-dithio and 1,3-oxathio heterocyclic compounds as herbicidal antidotes |
| US4542609A (en) * | 1978-11-15 | 1985-09-24 | Monsanto Co. | Substituted 2-imino-1,3-dithio and 1,3-oxathio heterocyclic compounds as herbicidal antidotes |
| US4454682A (en) * | 1980-07-21 | 1984-06-19 | Monsanto Co. | Substituted 2-imino-1,3-dithio and 1,3-oxathio heterocyclic compounds as herbicidal antidotes |
| DE3266542D1 (en) * | 1981-08-04 | 1985-10-31 | British Gas Corp | Fuel-fired fluid heating appliance |
| US4391818A (en) * | 1982-04-12 | 1983-07-05 | Merrell Dow Pharmaceuticals Inc. | 4-(Substituted alkyl)-N-(1,3-dithiolan-2-ylidene(aniline |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3139439A (en) * | 1960-06-06 | 1964-06-30 | Pennsalt Chemicals Corp | Reaction products of alkylene dihalides and dithiocarbamates |
| FR1510014A (fr) * | 1966-12-05 | 1968-01-19 | Aquitaine Petrole | Préparation de dithiolannes |
| FR1516855A (fr) * | 1966-12-20 | 1968-02-05 | Aquitaine Petrole | Fabrication d'imino-dithiolannes |
| US3484455A (en) * | 1967-04-21 | 1969-12-16 | American Cyanamid Co | 2-imino-1,3-dithietanes and processes for their preparation |
| US3954801A (en) * | 1972-02-10 | 1976-05-04 | American Cyanamid Company | 2-Imino-1,3-dithietanes |
| US3915962A (en) * | 1973-02-28 | 1975-10-28 | American Cyanamid Co | Procedure for the preparation of aromatic 2-imino-1,3-dithietanes |
-
1975
- 1975-08-22 DE DE19752537379 patent/DE2537379A1/de active Pending
-
1976
- 1976-08-16 US US05/714,401 patent/US4060628A/en not_active Expired - Lifetime
- 1976-08-18 EG EG76510A patent/EG12328A/xx active
- 1976-08-20 CA CA259,542A patent/CA1064948A/en not_active Expired
- 1976-08-20 NL NL7609313A patent/NL7609313A/xx not_active Application Discontinuation
- 1976-08-20 ES ES450849A patent/ES450849A1/es not_active Expired
- 1976-08-20 GB GB34790/76A patent/GB1502232A/en not_active Expired
- 1976-08-20 ZA ZA765004A patent/ZA765004B/xx unknown
- 1976-08-20 FR FR7625279A patent/FR2321493A1/fr active Granted
- 1976-08-20 AR AR264402A patent/AR211551A1/es active
- 1976-08-20 BE BE169965A patent/BE845384A/xx unknown
- 1976-08-23 AU AU17047/76A patent/AU497414B2/en not_active Expired
-
1978
- 1978-08-03 KE KE2863A patent/KE2863A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0100815A1 (en) * | 1982-04-12 | 1984-02-22 | Merrell Dow Pharmaceuticals Inc. | N-(1,3-dithiolan-2-ylidene)anilines and their use as anti-inflammatory and anti-asthmatic agents |
Also Published As
| Publication number | Publication date |
|---|---|
| US4060628A (en) | 1977-11-29 |
| ZA765004B (en) | 1977-07-27 |
| AU497414B2 (en) | 1978-12-14 |
| DE2537379A1 (de) | 1977-03-03 |
| CA1064948A (en) | 1979-10-23 |
| EG12328A (en) | 1978-12-31 |
| FR2321493A1 (fr) | 1977-03-18 |
| BE845384A (fr) | 1977-02-21 |
| FR2321493B1 (enExample) | 1980-09-12 |
| AR211551A1 (es) | 1978-01-30 |
| ES450849A1 (es) | 1977-08-16 |
| AU1704776A (en) | 1978-03-02 |
| NL7609313A (nl) | 1977-02-24 |
| KE2863A (en) | 1978-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1377225A (en) | Acylanilino compounds and herbicidal compositions containing them | |
| GB1411213A (en) | 1,3-dithiolo-4,5-6- quinoxalines process for their preparation and their use as insecticides acaricides and fungicides | |
| GB1502232A (en) | Substituted 2-phenylimino-1,3-dithiolanes process for their preparation and their use as ectoparasiticidal agents | |
| GB1394099A (en) | 2,5-dioxoimidazolidines as selective herbicides | |
| GB1387661A (en) | Phosphorus-containing pyrimidine derivatives having pesticidal properties | |
| GB1363597A (en) | 2-acyloxy-benzoic acid anilides process for their preparation and their insecticidal and acaricidal use | |
| GB1471041A (en) | Bis-sulphonamidocarboxyclic acids and salts thereof and use of the salts as metal-working agents | |
| GB1469060A (en) | Pyrimidinyl-thionophosphonic acid esters process for their preparation and their use as insecticides acaricides and nematocides | |
| GB1458629A (en) | 2,3-dihydrobenzofuranyl-7-n-methylcarbamates their preparation and their use as insecticides | |
| GB1364218A (en) | N-alkoxy-carbonyl- or n-alkylthiocarbonyl-2-/2 -thienyl/-benzimi dazoles a process for their preparation and their use as fungi cides | |
| GB1341155A (en) | Dithiophosphoric acid esters having insecticidal acaricidal and nematocidal properties | |
| GB1344039A (en) | Process for the preparation of 4-substituted 1,3,4-thiadiazolon- 5-yl-2-ureas | |
| GB1390588A (en) | 1-alkyl-sulphonyl-2-trifluoromethylbenzimidazoles process for their production and their use as agents against ectoparasites | |
| GB1462098A (en) | Thiophosphonic acid ester derivatives having pesticidal properties | |
| GB1363758A (en) | Process for the production of 1,2,4-oxa-diazoles and novel 1,2,4- oxadiazoles | |
| GB881977A (en) | Thiophosphonic acid esters | |
| GB1469741A (en) | 2-chloroalkyl-2-3,5-disubstituted phenyl-oxiranes | |
| GB1441877A (en) | Bis-substituted succinamides and their utility as herbicides | |
| IE35352L (en) | Phosphoric acid amide esters | |
| GB1409202A (en) | Fluorine-containing organo-phosphorus esters having pesticidal properties | |
| GB1367274A (en) | Dithio-and trithiophosphoric acid esters and their use as pesticides | |
| GB982246A (en) | Fluoro-acetyl ureas, their manufacture and use | |
| GB1240780A (en) | Phosphoroamidothioate esters having herbicidal activity | |
| GB1423017A (en) | Phosphorothionoamidate derivatives having plant growth regulating properties | |
| GB1375799A (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |