GB1405348A - Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts - Google Patents
Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalystsInfo
- Publication number
- GB1405348A GB1405348A GB4616273A GB4616273A GB1405348A GB 1405348 A GB1405348 A GB 1405348A GB 4616273 A GB4616273 A GB 4616273A GB 4616273 A GB4616273 A GB 4616273A GB 1405348 A GB1405348 A GB 1405348A
- Authority
- GB
- United Kingdom
- Prior art keywords
- water
- strontium
- nitrate
- oil emulsion
- ion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title abstract 5
- 239000002360 explosive Substances 0.000 title abstract 3
- 239000003054 catalyst Substances 0.000 title abstract 2
- 238000005474 detonation Methods 0.000 title abstract 2
- 229910001427 strontium ion Inorganic materials 0.000 title abstract 2
- PWYYWQHXAPXYMF-UHFFFAOYSA-N strontium(2+) Chemical compound [Sr+2] PWYYWQHXAPXYMF-UHFFFAOYSA-N 0.000 title abstract 2
- 239000007762 w/o emulsion Substances 0.000 title abstract 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 abstract 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 abstract 3
- 239000007789 gas Substances 0.000 abstract 3
- 239000004615 ingredient Substances 0.000 abstract 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 3
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 abstract 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 abstract 2
- 239000000446 fuel Substances 0.000 abstract 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 abstract 2
- DHEQXMRUPNDRPG-UHFFFAOYSA-N strontium nitrate Chemical compound [Sr+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O DHEQXMRUPNDRPG-UHFFFAOYSA-N 0.000 abstract 2
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 abstract 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 abstract 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 abstract 1
- 101100188552 Arabidopsis thaliana OCT3 gene Proteins 0.000 abstract 1
- 101100188555 Arabidopsis thaliana OCT6 gene Proteins 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract 1
- 229920002907 Guar gum Polymers 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 abstract 1
- 235000014113 dietary fatty acids Nutrition 0.000 abstract 1
- 239000003995 emulsifying agent Substances 0.000 abstract 1
- FONBHTQCMAUYEF-UHFFFAOYSA-N ethane-1,2-diamine;nitric acid Chemical compound NCCN.O[N+]([O-])=O.O[N+]([O-])=O FONBHTQCMAUYEF-UHFFFAOYSA-N 0.000 abstract 1
- 239000000194 fatty acid Substances 0.000 abstract 1
- 229930195729 fatty acid Natural products 0.000 abstract 1
- 150000004665 fatty acids Chemical class 0.000 abstract 1
- 239000003349 gelling agent Substances 0.000 abstract 1
- 239000000665 guar gum Substances 0.000 abstract 1
- 229960002154 guar gum Drugs 0.000 abstract 1
- 235000010417 guar gum Nutrition 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 abstract 1
- 229910001959 inorganic nitrate Inorganic materials 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000004200 microcrystalline wax Substances 0.000 abstract 1
- 235000019808 microcrystalline wax Nutrition 0.000 abstract 1
- 239000002480 mineral oil Substances 0.000 abstract 1
- 235000010446 mineral oil Nutrition 0.000 abstract 1
- 239000003921 oil Substances 0.000 abstract 1
- 239000007800 oxidant agent Substances 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 abstract 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 abstract 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 235000010344 sodium nitrate Nutrition 0.000 abstract 1
- 239000004317 sodium nitrate Substances 0.000 abstract 1
- 239000001593 sorbitan monooleate Substances 0.000 abstract 1
- 229940035049 sorbitan monooleate Drugs 0.000 abstract 1
- 235000011069 sorbitan monooleate Nutrition 0.000 abstract 1
- 159000000008 strontium salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Liquid Carbonaceous Fuels (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29556572A | 1972-10-06 | 1972-10-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1405348A true GB1405348A (en) | 1975-09-10 |
Family
ID=23138238
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4616273A Expired GB1405348A (en) | 1972-10-06 | 1973-10-03 | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3765964A (enrdf_load_stackoverflow) |
| JP (1) | JPS49100211A (enrdf_load_stackoverflow) |
| BE (1) | BE805754A (enrdf_load_stackoverflow) |
| DE (1) | DE2350200A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2202055A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1405348A (enrdf_load_stackoverflow) |
| IE (1) | IE38342B1 (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2130572A (en) * | 1982-10-22 | 1984-06-06 | Ici Plc | Emulsion explosive composition |
| GB2138801A (en) * | 1983-04-21 | 1984-10-31 | Canadian Ind | Water-in-wax emulsion blasting agents |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU515896B2 (en) * | 1976-11-09 | 1981-05-07 | Atlas Powder Company | Water-in-oil explosive |
| USRE33788E (en) * | 1977-09-19 | 1992-01-07 | Hanex Products, Inc. | Water-in-oil blasting composition |
| US4138281A (en) * | 1977-11-04 | 1979-02-06 | Olney Robert S | Production of explosive emulsions |
| US4141767A (en) * | 1978-03-03 | 1979-02-27 | Ireco Chemicals | Emulsion blasting agent |
| SE428919C (sv) * | 1978-10-23 | 1984-11-19 | Nitro Nobel Ab | Forfarande for tillverkning av icke sprengkapselkensligt emulsionssprengemne |
| US4218272A (en) * | 1978-12-04 | 1980-08-19 | Atlas Powder Company | Water-in-oil NCN emulsion blasting agent |
| CA1096173A (en) * | 1978-12-08 | 1981-02-24 | Rejean Binet | Water-in -oil emulsion blasting agent |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
| US4287010A (en) * | 1979-08-06 | 1981-09-01 | E. I. Du Pont De Nemours & Company | Emulsion-type explosive composition and method for the preparation thereof |
| US4231821A (en) * | 1979-05-21 | 1980-11-04 | Ireco Chemicals | Emulsion blasting agent sensitized with perlite |
| JPS5663896A (en) * | 1979-10-23 | 1981-05-30 | Dai Ichi Kogyo Seiyaku Co Ltd | Slurry explosive composition |
| JPS5663897A (en) * | 1979-10-26 | 1981-05-30 | Dai Ichi Kogyo Seiyaku Co Ltd | Slurry explosive composition |
| US4322258A (en) * | 1979-11-09 | 1982-03-30 | Ireco Chemicals | Thermally stable emulsion explosive composition |
| US4383873A (en) * | 1980-10-27 | 1983-05-17 | Atlas Powder Company | Sensitive low water emulsion explosive compositions |
| US4371408A (en) * | 1980-10-27 | 1983-02-01 | Atlas Powder Company | Low water emulsion explosive compositions optionally containing inert salts |
| JPS57117306A (en) * | 1981-01-12 | 1982-07-21 | Nippon Oil & Fats Co Ltd | Water-in-oil emulsion type explosive composition |
| US4414044A (en) * | 1981-05-11 | 1983-11-08 | Nippon Oil And Fats, Co., Ltd. | Water-in-oil emulsion explosive composition |
| ZW9182A1 (en) * | 1981-05-26 | 1983-01-05 | Aeci Ltd | Explosive |
| JPS6028796B2 (ja) * | 1982-01-27 | 1985-07-06 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬の製造法 |
| US4439254A (en) * | 1982-04-05 | 1984-03-27 | Atlas Powder Company | Solid sensitizers in water gel explosives and method |
| US4453989A (en) * | 1982-04-05 | 1984-06-12 | Atlas Powder Company | Solid sensitizers for water-in-oil emulsion explosives |
| JPS6054992A (ja) * | 1983-09-07 | 1985-03-29 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬組成物 |
| US4844756A (en) * | 1985-12-06 | 1989-07-04 | The Lubrizol Corporation | Water-in-oil emulsions |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
| JPH0637344B2 (ja) * | 1986-03-10 | 1994-05-18 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬組成物 |
| US4828633A (en) * | 1987-12-23 | 1989-05-09 | The Lubrizol Corporation | Salt compositions for explosives |
| US5527491A (en) * | 1986-11-14 | 1996-06-18 | The Lubrizol Corporation | Emulsifiers and explosive emulsions containing same |
| US5047175A (en) * | 1987-12-23 | 1991-09-10 | The Lubrizol Corporation | Salt composition and explosives using same |
| US4840687A (en) * | 1986-11-14 | 1989-06-20 | The Lubrizol Corporation | Explosive compositions |
| US4863534A (en) * | 1987-12-23 | 1989-09-05 | The Lubrizol Corporation | Explosive compositions using a combination of emulsifying salts |
| US4775431A (en) * | 1987-11-23 | 1988-10-04 | Atlas Powder Company | Macroemulsion for preparing high density explosive compositions |
| US4830687A (en) * | 1987-11-23 | 1989-05-16 | Atlas Powder Company | Stable fluid systems for preparing high density explosive compositions |
| CA1325724C (en) * | 1988-11-07 | 1994-01-04 | C-I-L Inc. | Aromatic hydrocarbon-based emulsion explosive composition |
| CA1325723C (en) * | 1988-12-05 | 1994-01-04 | Anh D. Nguyen | Nitroalkane-based emulsion explosive composition |
| US4940497A (en) * | 1988-12-14 | 1990-07-10 | Atlas Powder Company | Emulsion explosive composition containing expanded perlite |
| US4933028A (en) * | 1989-06-30 | 1990-06-12 | Atlas Powder Company | High emulsifier content explosives |
| US5120375A (en) * | 1990-06-14 | 1992-06-09 | Atlas Powder Company | Explosive with-coated solid additives |
| US5034071A (en) * | 1990-06-14 | 1991-07-23 | Atlas Powder Company | Prill for emulsion explosives |
| US5123981A (en) * | 1990-06-14 | 1992-06-23 | Atlas Powder Company | Coated solid additives for explosives |
| US5920031A (en) * | 1992-03-17 | 1999-07-06 | The Lubrizol Corporation | Water-in-oil emulsions |
| US5366571A (en) * | 1993-01-15 | 1994-11-22 | The United States Of America As Represented By The Secretary Of The Interior | High pressure-resistant nonincendive emulsion explosive |
| MX9702621A (es) * | 1994-10-11 | 1998-04-30 | Dantex Explosives | Una composicion explosiva. |
| US6451920B1 (en) | 1999-11-09 | 2002-09-17 | Chevron Chemical Company Llc | Process for making polyalkylene/maleic anhydride copolymer |
| US6755438B2 (en) | 2001-10-22 | 2004-06-29 | Autoliv Asp, Inc. | Elongated inflator device and method of gas production |
| US6702909B2 (en) | 2002-04-29 | 2004-03-09 | Dyno Nobel Inc. | High energy explosive containing cast particles |
| JP4683191B2 (ja) | 2005-02-08 | 2011-05-11 | Nok株式会社 | 二部材間の密封構造 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3039903A (en) * | 1959-11-02 | 1962-06-19 | Nitroglycerin Ab | Explosive nitrate-alkylamine composition |
| DE1182566B (de) * | 1962-08-24 | 1964-11-26 | Dynamit Nobel Ag | Detonationsfaehiges, wasserhaltiges Sprenggemisch |
| US3296094A (en) * | 1966-05-05 | 1967-01-03 | Baxter Laboratories Inc | Stabilized aqueous enzyme solutions |
| US3447979A (en) * | 1966-12-23 | 1969-06-03 | Atlas Chem Ind | Gelled nitric acid blasting composition and method of preparing same |
| DE1646273C3 (de) * | 1967-02-01 | 1975-07-10 | Dynamit Nobel Ag, 5210 Troisdorf | Wasserhaltige, salpetersä ureesterfreie Ammoniumnitratsprengstoffe |
| US3447978A (en) * | 1967-08-03 | 1969-06-03 | Atlas Chem Ind | Ammonium nitrate emulsion blasting agent and method of preparing same |
| US3453155A (en) * | 1968-01-22 | 1969-07-01 | Oriard Powder Co Inc | Blasting agent composition containing a hydrocarbon fuel and coated ammonium nitrate |
| US3617406A (en) * | 1969-07-22 | 1971-11-02 | Hercules Inc | Hydrocarbon oil-containing gelled aqueous inorganic oxidizer salt explosives having improved stability to syneresis |
| US3674578A (en) * | 1970-02-17 | 1972-07-04 | Du Pont | Water-in-oil emulsion type blasting agent |
-
1972
- 1972-10-06 US US00295565A patent/US3765964A/en not_active Expired - Lifetime
-
1973
- 1973-10-01 IE IE1752/73A patent/IE38342B1/xx unknown
- 1973-10-03 GB GB4616273A patent/GB1405348A/en not_active Expired
- 1973-10-05 FR FR7335753A patent/FR2202055A1/fr not_active Withdrawn
- 1973-10-05 JP JP48112229A patent/JPS49100211A/ja active Pending
- 1973-10-05 BE BE1005406A patent/BE805754A/xx unknown
- 1973-10-05 DE DE19732350200 patent/DE2350200A1/de active Pending
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2130572A (en) * | 1982-10-22 | 1984-06-06 | Ici Plc | Emulsion explosive composition |
| US4490195A (en) * | 1982-10-22 | 1984-12-25 | Imperial Chemical Industries Plc | Emulsion explosive composition |
| GB2138801A (en) * | 1983-04-21 | 1984-10-31 | Canadian Ind | Water-in-wax emulsion blasting agents |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2202055A1 (enrdf_load_stackoverflow) | 1974-05-03 |
| BE805754A (fr) | 1974-04-05 |
| IE38342L (en) | 1974-04-06 |
| DE2350200A1 (de) | 1974-04-18 |
| IE38342B1 (en) | 1978-02-15 |
| US3765964A (en) | 1973-10-16 |
| JPS49100211A (enrdf_load_stackoverflow) | 1974-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1405348A (en) | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts | |
| US4104092A (en) | Emulsion sensitized gelled explosive composition | |
| US3447978A (en) | Ammonium nitrate emulsion blasting agent and method of preparing same | |
| US3715247A (en) | Water-in-oil emulsion explosive containing entrapped gas | |
| GB1593163A (en) | Water-in-oil emulsion explosive composition | |
| US3790415A (en) | Chemical foaming and sensitizing of water-bearing explosives with hydrogen peroxide | |
| US3886010A (en) | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent | |
| US3706607A (en) | Chemical foaming of water-bearing explosives | |
| CA1160052A (en) | Low water emulsion explosive compositions optionally containing inert salts | |
| NO144445B (no) | Innretning for menn med lettere urin-inkontinens | |
| GB1335097A (en) | Emulsion type blasting agent | |
| NZ206983A (en) | Dynamite explosive composition | |
| US4008110A (en) | Water gel explosives | |
| GB2058740A (en) | Blasting composition | |
| US3985593A (en) | Water gel explosives | |
| US4523967A (en) | Invert emulsion explosives containing a one-component oil phase | |
| US4976793A (en) | Explosive composition | |
| US3390029A (en) | Inorganic oxidizer salt explosive composition containing organic fuel solvent for said salt | |
| US3356544A (en) | Inorganic oxidizer salt aqueous blasting compositions containing a nitroparaffin | |
| GB2185474A (en) | Water-in-oil type emulsion explosives | |
| US4547232A (en) | Sensitization of water-in-oil emulsion explosives | |
| GB1384859A (en) | Process for the production of crosslinked gums | |
| US4081299A (en) | Aqueous explosive slurrie with inorganic peroxide sensitizer | |
| GB1362352A (en) | Slurry blasting compositions | |
| US4308081A (en) | Water-in-oil emulsion blasting agent |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PLNP | Patent lapsed through nonpayment of renewal fees |