GB1388776A - Phenoxyphenylacetic acid derivatives - Google Patents
Phenoxyphenylacetic acid derivativesInfo
- Publication number
- GB1388776A GB1388776A GB678973A GB678973A GB1388776A GB 1388776 A GB1388776 A GB 1388776A GB 678973 A GB678973 A GB 678973A GB 678973 A GB678973 A GB 678973A GB 1388776 A GB1388776 A GB 1388776A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkoxy
- alkyl
- amino
- alkylamino
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ABUKMOCUMIPDHV-UHFFFAOYSA-N 2-phenoxy-2-phenylacetic acid Chemical class C=1C=CC=CC=1C(C(=O)O)OC1=CC=CC=C1 ABUKMOCUMIPDHV-UHFFFAOYSA-N 0.000 title abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 11
- 125000000217 alkyl group Chemical group 0.000 abstract 8
- -1 1,2,3,4-tetrahydronaphthyl Chemical group 0.000 abstract 6
- 125000003282 alkyl amino group Chemical group 0.000 abstract 6
- 239000002253 acid Substances 0.000 abstract 5
- 150000004820 halides Chemical class 0.000 abstract 4
- 229910052736 halogen Inorganic materials 0.000 abstract 4
- 125000003118 aryl group Chemical group 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- 150000002367 halogens Chemical class 0.000 abstract 3
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 abstract 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 125000004104 aryloxy group Chemical group 0.000 abstract 2
- 231100000252 nontoxic Toxicity 0.000 abstract 2
- 230000003000 nontoxic effect Effects 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- CYULZVSDRMPXJQ-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]acetic acid Chemical compound C1(CCCC2=CC=CC=C12)C1=CC=C(OC(C(=O)O)C2=CC=C(C=C2)Cl)C=C1 CYULZVSDRMPXJQ-UHFFFAOYSA-N 0.000 abstract 1
- OMYWAGBURSAPFG-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-[4-(4-chlorophenyl)phenoxy]acetic acid Chemical compound ClC1=CC=C(C=C1)C1=CC=C(OC(C(=O)O)C2=CC=C(C=C2)Cl)C=C1 OMYWAGBURSAPFG-UHFFFAOYSA-N 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 150000001350 alkyl halides Chemical class 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000001769 aryl amino group Chemical group 0.000 abstract 1
- 125000005110 aryl thio group Chemical group 0.000 abstract 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 abstract 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 230000002140 halogenating effect Effects 0.000 abstract 1
- 125000004970 halomethyl group Chemical group 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 150000004707 phenolate Chemical class 0.000 abstract 1
- 229940031826 phenolate Drugs 0.000 abstract 1
- 229960003424 phenylacetic acid Drugs 0.000 abstract 1
- 239000003279 phenylacetic acid Substances 0.000 abstract 1
- 125000004953 trihalomethyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/04—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms
- C07C275/06—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C275/10—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/42—Unsaturated compounds containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/72—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US22629372A | 1972-02-14 | 1972-02-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1388776A true GB1388776A (en) | 1975-03-26 |
Family
ID=22848330
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB678973A Expired GB1388776A (en) | 1972-02-14 | 1973-02-12 | Phenoxyphenylacetic acid derivatives |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS4886842A (enrdf_load_stackoverflow) |
| CH (1) | CH587794A5 (enrdf_load_stackoverflow) |
| DE (1) | DE2307038A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2181725B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1388776A (enrdf_load_stackoverflow) |
| NL (1) | NL7301246A (enrdf_load_stackoverflow) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3125059A1 (de) * | 1981-06-26 | 1983-01-05 | Bayer Ag, 5090 Leverkusen | Dioxybenzoletherderivate, diese enthaltende arzneimittel, verfahren zu ihrer herstellung und ihre verwendung |
| EP1620420A2 (en) * | 2003-04-30 | 2006-02-01 | The Institutes for Pharmaceutical Discovery, LLC | Substituted carboxylic acids |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1076871A (en) * | 1964-03-20 | 1967-07-26 | Merck & Co Inc | (phenoxy)phenylacetic acids and derivatives thereof |
| US3378582A (en) * | 1964-03-20 | 1968-04-16 | Merck & Co Inc | (alpha-phenoxy)-and (alpha-phenylthio)-omegaphenyl-alkanoic acids |
-
1973
- 1973-01-29 NL NL7301246A patent/NL7301246A/xx not_active Application Discontinuation
- 1973-02-09 CH CH190173A patent/CH587794A5/xx not_active IP Right Cessation
- 1973-02-12 JP JP1666773A patent/JPS4886842A/ja active Pending
- 1973-02-12 GB GB678973A patent/GB1388776A/en not_active Expired
- 1973-02-13 DE DE19732307038 patent/DE2307038A1/de active Pending
- 1973-02-13 FR FR7304988A patent/FR2181725B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2307038A1 (de) | 1973-09-06 |
| JPS4886842A (enrdf_load_stackoverflow) | 1973-11-15 |
| NL7301246A (enrdf_load_stackoverflow) | 1973-08-16 |
| FR2181725B1 (enrdf_load_stackoverflow) | 1976-05-14 |
| CH587794A5 (enrdf_load_stackoverflow) | 1977-05-13 |
| FR2181725A1 (enrdf_load_stackoverflow) | 1973-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1182007A (en) | Haloaryloxyacetic Acid Esters and Amides | |
| NL950022I2 (nl) | Analoga van mevalolacton en derivaten daarvan, werkwijzen voor hun bereiding, farmaceutische prepar aten die ze bevatten en hun toepassing als farmaceutica. | |
| GB1535770A (en) | Pharmaceutical compositions | |
| GB1388776A (en) | Phenoxyphenylacetic acid derivatives | |
| GB1241617A (en) | New carboxylic acid amides, processes for their manufacture and their use | |
| GB1063744A (en) | 4-substituted-4'-tertiary aminoalkoxy biphenyls | |
| HU9500211D0 (en) | Phenyl-alkyl-carboxylic acid-guanidine derivatives containing perfluoroalkyl-groups, and pharmaceutical and diagnostical compositions containing them | |
| GB1316894A (en) | Benzimidazole derivatives | |
| ES8505662A1 (es) | Procedimiento para la obtencion de oximeteres sustituidos por 1-azolilo | |
| PT82932B (en) | Process for the preparation of a production promoting composition for arylethanol-hydroxylamines and intermediate products | |
| GB1458340A (en) | Ixo | |
| GB1450801A (en) | Pyridinecarboxamide sulphonylurea hypoglycemic agents | |
| HUT35930A (en) | Fungicides containing hydroxy-ethyl-azolile-oxym-derivatives as agent and process for the production of hydroxy-ethyl-azolile-oxym-derivatives | |
| GB1449802A (en) | Piperazine derivatives and compositions containing them for treating parkinsons disease | |
| GB1263116A (en) | Chloramphenicol and thiamphenicol derivatives | |
| GB1160064A (en) | Indole Derivatives | |
| GB1467761A (en) | Phenoxypropylamine derivatives and preparation thereof | |
| GB1527941A (en) | 1-(3-phenylpropyl)-4-(beta-alkoxyacryloyl)piperazine derivatives | |
| GB1460811A (en) | Bis-benzamido-benzoic acid derivatives | |
| GB1331181A (en) | Phenylacetohydroxamic acids process for their manufacture and preparations containing them | |
| IL73043A0 (en) | Hydroxyethyl-azole derivatives,their preparation and their use as fungicides | |
| GB1441589A (en) | Aminomethylenemalonitriles and their use as fungicides | |
| GB1383867A (en) | Esters and amides of trifluoromethylphenoxy-4-chlorophenyl-acetic acid | |
| GB1412168A (en) | Penicillins and production thereof | |
| GB1164058A (en) | Novel Sulphanilamides and a process for the manufacture thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| PCNP | Patent ceased through non-payment of renewal fee |