GB1385543A - Alpha-thioureidocehalosporanic acid compounds - Google Patents
Alpha-thioureidocehalosporanic acid compoundsInfo
- Publication number
- GB1385543A GB1385543A GB2193672A GB2193672A GB1385543A GB 1385543 A GB1385543 A GB 1385543A GB 2193672 A GB2193672 A GB 2193672A GB 2193672 A GB2193672 A GB 2193672A GB 1385543 A GB1385543 A GB 1385543A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- hydrogen
- hydroxy
- substituted
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title abstract 4
- 150000001875 compounds Chemical class 0.000 title abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 8
- 229910052739 hydrogen Inorganic materials 0.000 abstract 5
- 239000001257 hydrogen Substances 0.000 abstract 5
- 125000003118 aryl group Chemical group 0.000 abstract 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 abstract 3
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 abstract 2
- 125000004423 acyloxy group Chemical group 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 229910052799 carbon Inorganic materials 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract 2
- 229920006395 saturated elastomer Polymers 0.000 abstract 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- 125000005333 aroyloxy group Chemical group 0.000 abstract 1
- 125000004429 atom Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 150000002500 ions Chemical class 0.000 abstract 1
- 150000002540 isothiocyanates Chemical class 0.000 abstract 1
- 125000000686 lactone group Chemical group 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000001453 quaternary ammonium group Chemical group 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14595571A | 1971-05-21 | 1971-05-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1385543A true GB1385543A (en) | 1975-02-26 |
Family
ID=22515301
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB2193672A Expired GB1385543A (en) | 1971-05-21 | 1972-05-10 | Alpha-thioureidocehalosporanic acid compounds |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3741962A (enExample) |
| CA (1) | CA1005437A (enExample) |
| CH (1) | CH542882A (enExample) |
| DE (1) | DE2224651A1 (enExample) |
| FR (1) | FR2138850B1 (enExample) |
| GB (1) | GB1385543A (enExample) |
| HU (1) | HU163445B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3855211A (en) * | 1972-06-09 | 1974-12-17 | Squibb & Sons Inc | Dithiocarbonylaminoacetyl cephalosporins |
| AR206201A1 (es) * | 1972-06-29 | 1976-07-07 | Ciba Geigy Ag | Procedimiento para la obtencion de compuestos de acido 7beta-amino-3-cefem-3-01-4-carboxilico0-substituidos |
| US3926985A (en) * | 1972-08-03 | 1975-12-16 | Squibb & Sons Inc | Acylthiomethyl esters of cephalosporins |
| US3929774A (en) * | 1972-08-03 | 1975-12-30 | Squibb & Sons Inc | Acylthiomethyl esters of cephalosporins |
| US3897423A (en) * | 1973-03-05 | 1975-07-29 | Squibb & Sons Inc | Amino substituted acylthio cephalosporins |
| US3892735A (en) * | 1973-03-05 | 1975-07-01 | Squibb & Sons Inc | Cyanodithiocarbamic acid derivatives of cephalosporins |
| US3989693A (en) * | 1973-05-02 | 1976-11-02 | E. R. Squibb & Sons, Inc. | 7-Methoxy cyclonexadienylureidocephalosporins |
| US3875153A (en) * | 1973-05-31 | 1975-04-01 | Squibb & Sons Inc | Thiovinyl(thioacetamido) cephalosporins |
| GB1479711A (en) * | 1973-06-12 | 1977-07-13 | Beecham Group Ltd | Acylureido cephalosporins |
| US4107304A (en) * | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US3956292A (en) * | 1974-04-01 | 1976-05-11 | Eli Lilly And Company | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS |
| US3925368A (en) * | 1974-04-01 | 1975-12-09 | Lilly Co Eli | Acylureido substituted cephalosporins |
| DE2559932C2 (de) * | 1974-05-09 | 1983-04-21 | Toyama Chemical Co. Ltd., Tokyo | Cephalosporine, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben |
| US4198503A (en) * | 1974-11-05 | 1980-04-15 | Beecham Group Limited | 3-Carbamoyl substituted-7-ureido substituted cephalosporins |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
-
1971
- 1971-05-21 US US00145955A patent/US3741962A/en not_active Expired - Lifetime
-
1972
- 1972-05-02 CA CA141,075A patent/CA1005437A/en not_active Expired
- 1972-05-10 GB GB2193672A patent/GB1385543A/en not_active Expired
- 1972-05-18 CH CH740172A patent/CH542882A/fr not_active IP Right Cessation
- 1972-05-19 FR FR7218176A patent/FR2138850B1/fr not_active Expired
- 1972-05-19 DE DE19722224651 patent/DE2224651A1/de active Pending
- 1972-05-19 HU HUSU738A patent/HU163445B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2224651A1 (enExample) | 1972-12-07 |
| CH542882A (fr) | 1973-10-15 |
| FR2138850B1 (enExample) | 1975-10-31 |
| US3741962A (en) | 1973-06-26 |
| FR2138850A1 (enExample) | 1973-01-05 |
| CA1005437A (en) | 1977-02-15 |
| HU163445B (enExample) | 1973-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1385543A (en) | Alpha-thioureidocehalosporanic acid compounds | |
| GB1325192A (en) | Phloroglucinol derivatives | |
| GB1337000A (en) | Alpha-ureidocephalosporanic acid compounds | |
| GB1496874A (en) | 5-substituted-alkanoyl-8-hydroxycarbostyril derivatives and production thereof | |
| GB1497260A (en) | Guanidine derivatives | |
| GB1450010A (en) | Preparation of triamino pyrimidine n-oxides | |
| GB1471615A (en) | Morpholinothiooxamide derivatives and their use in vulcani zable rubber compositions | |
| GB1342558A (en) | Substituted 3-benzylpyridines | |
| GB1436307A (en) | Diaromatic o-aminoalkyl-oximes | |
| GB1413175A (en) | Alpha-amidinothiocetamidocephalosporanic acid compounds | |
| FR2100682B1 (enExample) | ||
| GB1415528A (en) | 2-thiocarbonylamino acetamidocephalosporanic acid compounds | |
| GB1269697A (en) | Preparation of cephalosporin compounds | |
| GB1299566A (en) | Bis-basic ethers of 2,6- and 2,7-dihydroxyanthraquinones | |
| GB1395214A (en) | Thiazolinyl and thiazinyl derivatives of benzimidazoles | |
| GB1446833A (en) | Hydroxamic acid derivatives of substituted a-aminooxycarboxylic acids and a process for the preparation thereof | |
| GB1139985A (en) | Basically substituted 2-imidazolidone derivatives and their production | |
| GB1457911A (en) | Guanyl-hydrazones | |
| GB1422223A (en) | Isothiocyanates | |
| GB1385742A (en) | Imidazole derivatives | |
| GB1333524A (en) | Penicilloic acid derivatives | |
| GB1318859A (en) | Imidazo-4,5-b-pyridine derivatives | |
| GB1377647A (en) | Acyloxymethyl esters of alpha-ureidocyclohexadienylalkylene- penicillins | |
| GB1472496A (en) | N-di substituted amino ethyl esters of raubasine and process for praparing them | |
| GB1417996A (en) | Maleopimarimide derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |