GB1272354A - Hypoglycemic arylsulphonylureas and arylsulphonylsemicarbazides - Google Patents
Hypoglycemic arylsulphonylureas and arylsulphonylsemicarbazidesInfo
- Publication number
- GB1272354A GB1272354A GB37983/70A GB3798370A GB1272354A GB 1272354 A GB1272354 A GB 1272354A GB 37983/70 A GB37983/70 A GB 37983/70A GB 3798370 A GB3798370 A GB 3798370A GB 1272354 A GB1272354 A GB 1272354A
- Authority
- GB
- United Kingdom
- Prior art keywords
- group
- prepared
- alkylene
- compound
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002218 hypoglycaemic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 5
- -1 Arylsulphonyl ureas Chemical class 0.000 abstract 4
- 125000002947 alkylene group Chemical group 0.000 abstract 4
- 150000001412 amines Chemical class 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- 229910052783 alkali metal Inorganic materials 0.000 abstract 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 2
- 125000003368 amide group Chemical group 0.000 abstract 2
- 235000013877 carbamide Nutrition 0.000 abstract 2
- 230000005494 condensation Effects 0.000 abstract 2
- 238000009833 condensation Methods 0.000 abstract 2
- 230000008030 elimination Effects 0.000 abstract 2
- 238000003379 elimination reaction Methods 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 abstract 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 238000005903 acid hydrolysis reaction Methods 0.000 abstract 1
- 125000004442 acylamino group Chemical group 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 238000006193 diazotization reaction Methods 0.000 abstract 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- 150000004820 halides Chemical class 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000003345 hyperglycaemic effect Effects 0.000 abstract 1
- 125000001841 imino group Chemical group [H]N=* 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- 150000002513 isocyanates Chemical class 0.000 abstract 1
- 150000002828 nitro derivatives Chemical class 0.000 abstract 1
- 238000006400 oxidative hydrolysis reaction Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000000546 pharmaceutical excipient Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 abstract 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 abstract 1
- 229940124530 sulfonamide Drugs 0.000 abstract 1
- 125000000565 sulfonamide group Chemical group 0.000 abstract 1
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical compound O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/28—Nitrogen atoms
- C07D295/32—Nitrogen atoms acylated with carboxylic or carbonic acids, or their nitrogen or sulfur analogues
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/58—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/59—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691939895 DE1939895A1 (de) | 1969-08-06 | 1969-08-06 | Carbonamidgruppen enthaltende Arylsulfonylharnstoffe und Arylsulfonylsemicarbazide mi blutzuckersenkender Wirkung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1272354A true GB1272354A (en) | 1972-04-26 |
Family
ID=5742011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB37983/70A Expired GB1272354A (en) | 1969-08-06 | 1970-08-06 | Hypoglycemic arylsulphonylureas and arylsulphonylsemicarbazides |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT299230B (enExample) |
| BE (1) | BE754454A (enExample) |
| DE (1) | DE1939895A1 (enExample) |
| FR (1) | FR2068469B1 (enExample) |
| GB (1) | GB1272354A (enExample) |
| HU (1) | HU162715B (enExample) |
| NL (1) | NL7011655A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5607976A (en) * | 1995-02-10 | 1997-03-04 | Hoechst Aktiengesellschaft | Substituted benzenesulfonyl-thioureas and pharmaceutical preparations containing them |
| US5633239A (en) * | 1995-02-21 | 1997-05-27 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use for the production of pharmaceutical preparations, and medicaments containing them |
| AU700793B2 (en) * | 1995-02-17 | 1999-01-14 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use as a medicament or diagnostic, and medicament containing them |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE791638A (fr) * | 1971-11-20 | 1973-05-21 | Hoechst Ag | Sulfonyl-urees, leur procede de preparation et leurs applications |
| HU226462B1 (en) * | 1995-02-17 | 2008-12-29 | Hoechst Ag | Substituted benzol-sulfonyl-ureas and -thioureas, process for producing them, pharmaceutical compositions containing them, and their use |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
-
0
- BE BE754454D patent/BE754454A/xx unknown
-
1969
- 1969-08-06 DE DE19691939895 patent/DE1939895A1/de active Pending
-
1970
- 1970-08-04 AT AT707170A patent/AT299230B/de not_active IP Right Cessation
- 1970-08-04 HU HUBA2451A patent/HU162715B/hu unknown
- 1970-08-06 FR FR707029093A patent/FR2068469B1/fr not_active Expired
- 1970-08-06 GB GB37983/70A patent/GB1272354A/en not_active Expired
- 1970-08-06 NL NL7011655A patent/NL7011655A/xx unknown
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5607976A (en) * | 1995-02-10 | 1997-03-04 | Hoechst Aktiengesellschaft | Substituted benzenesulfonyl-thioureas and pharmaceutical preparations containing them |
| AU700883B2 (en) * | 1995-02-10 | 1999-01-14 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use for the production of pharmaceutical preparations, and pharmaceutical preparations containing them |
| AU700793B2 (en) * | 1995-02-17 | 1999-01-14 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use as a medicament or diagnostic, and medicament containing them |
| US5633239A (en) * | 1995-02-21 | 1997-05-27 | Hoechst Aktiengesellschaft | Substituted benzenesulfonylureas and -thioureas, processes for their preparation, their use for the production of pharmaceutical preparations, and medicaments containing them |
Also Published As
| Publication number | Publication date |
|---|---|
| BE754454A (fr) | 1971-02-05 |
| AT299230B (de) | 1972-06-12 |
| FR2068469B1 (enExample) | 1974-06-14 |
| FR2068469A1 (enExample) | 1971-08-27 |
| DE1939895A1 (de) | 1971-02-18 |
| HU162715B (enExample) | 1973-04-28 |
| NL7011655A (enExample) | 1971-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1353179A (en) | Hydantoin derivatives processes for producing them and compositions containing them | |
| GB1505296A (en) | 8-thiomethylergolines | |
| GB1262965A (en) | Butyrophenones | |
| GB1272354A (en) | Hypoglycemic arylsulphonylureas and arylsulphonylsemicarbazides | |
| GB1352467A (en) | Thiazolines and their use as flavourants | |
| GB1133423A (en) | Imidazoles | |
| GB1256530A (enExample) | ||
| GB1391584A (en) | N-substituted anthranilic acids | |
| SE7413856L (enExample) | ||
| GB1176288A (en) | Aryl Sulphonyl Ureas | |
| GB1472127A (en) | Phenyl-thiadiazolyl-thiourea | |
| GB1255752A (en) | A novel imidazolidin 2-one-1-carboxylic acid amide and its use as a herbicidal agent | |
| GB1375378A (enExample) | ||
| GB1373276A (en) | 2-aryl-amino-imidazoline-2 compounds | |
| GB1393573A (en) | Thiocarbonates and process for producing the same | |
| GB1259568A (enExample) | ||
| IE32674L (en) | Sulphanilamide derivatives | |
| SE7407493L (enExample) | ||
| US3894007A (en) | 2-{8 (2,4-Dioxo-1-imidazolidinyl)imino{9 ethyl-P-chlorobenzoate | |
| GB1203105A (en) | New n,n'-substituted ureas, processes for their production and pharmaceuticals containing them | |
| GB567353A (en) | Improvements in the manufacture of tetrazole compounds | |
| GB1309621A (en) | Disulphonylimides | |
| GB1151450A (en) | Arylsulphonylureas and -Thioureas | |
| IE35302L (en) | Sulphamoyl-1, 3, 4-thiadiazoles | |
| GB802885A (en) | Process for the production of n-substituted n-aryl sulphonyl ureas |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| PLNP | Patent lapsed through nonpayment of renewal fees |