GB1108291A - Improved hygienic devices - Google Patents
Improved hygienic devicesInfo
- Publication number
- GB1108291A GB1108291A GB32075/65A GB3207565A GB1108291A GB 1108291 A GB1108291 A GB 1108291A GB 32075/65 A GB32075/65 A GB 32075/65A GB 3207565 A GB3207565 A GB 3207565A GB 1108291 A GB1108291 A GB 1108291A
- Authority
- GB
- United Kingdom
- Prior art keywords
- outer tube
- tube
- applicator
- inner tube
- paper
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 emeryboard Substances 0.000 abstract 5
- 239000000123 paper Substances 0.000 abstract 5
- 239000000829 suppository Substances 0.000 abstract 5
- 239000004698 Polyethylene Substances 0.000 abstract 4
- 239000000463 material Substances 0.000 abstract 4
- 229920000573 polyethylene Polymers 0.000 abstract 4
- 239000011888 foil Substances 0.000 abstract 3
- 239000004033 plastic Substances 0.000 abstract 3
- 229920003023 plastic Polymers 0.000 abstract 3
- 239000005030 aluminium foil Substances 0.000 abstract 2
- 239000011087 paperboard Substances 0.000 abstract 2
- 238000005728 strengthening Methods 0.000 abstract 2
- 239000000853 adhesive Substances 0.000 abstract 1
- 230000001070 adhesive effect Effects 0.000 abstract 1
- 239000011111 cardboard Substances 0.000 abstract 1
- 239000005018 casein Substances 0.000 abstract 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 abstract 1
- 235000021240 caseins Nutrition 0.000 abstract 1
- 229910010293 ceramic material Inorganic materials 0.000 abstract 1
- 239000002657 fibrous material Substances 0.000 abstract 1
- 230000004927 fusion Effects 0.000 abstract 1
- 239000003292 glue Substances 0.000 abstract 1
- 238000003475 lamination Methods 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 229910052751 metal Inorganic materials 0.000 abstract 1
- 238000004806 packaging method and process Methods 0.000 abstract 1
- 230000035515 penetration Effects 0.000 abstract 1
- 239000012815 thermoplastic material Substances 0.000 abstract 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61F—FILTERS IMPLANTABLE INTO BLOOD VESSELS; PROSTHESES; DEVICES PROVIDING PATENCY TO, OR PREVENTING COLLAPSING OF, TUBULAR STRUCTURES OF THE BODY, e.g. STENTS; ORTHOPAEDIC, NURSING OR CONTRACEPTIVE DEVICES; FOMENTATION; TREATMENT OR PROTECTION OF EYES OR EARS; BANDAGES, DRESSINGS OR ABSORBENT PADS; FIRST-AID KITS
- A61F13/00—Bandages or dressings; Absorbent pads
- A61F13/15—Absorbent pads, e.g. sanitary towels, swabs or tampons for external or internal application to the body; Supporting or fastening means therefor; Tampon applicators
- A61F13/20—Tampons, e.g. catamenial tampons; Accessories therefor
- A61F13/26—Means for inserting tampons, i.e. applicators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61M—DEVICES FOR INTRODUCING MEDIA INTO, OR ONTO, THE BODY; DEVICES FOR TRANSDUCING BODY MEDIA OR FOR TAKING MEDIA FROM THE BODY; DEVICES FOR PRODUCING OR ENDING SLEEP OR STUPOR
- A61M31/00—Devices for introducing or retaining media, e.g. remedies, in cavities of the body
- A61M31/007—Injectors for solid bodies, e.g. suppositories
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Biomedical Technology (AREA)
- Heart & Thoracic Surgery (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hematology (AREA)
- Anesthesiology (AREA)
- Epidemiology (AREA)
- Vascular Medicine (AREA)
- Absorbent Articles And Supports Therefor (AREA)
- Package Closures (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US387590A US3347234A (en) | 1964-08-05 | 1964-08-05 | Hygienic devices |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1108291A true GB1108291A (en) | 1968-04-03 |
Family
ID=23530555
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB32075/65A Expired GB1108291A (en) | 1964-08-05 | 1965-07-27 | Improved hygienic devices |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3347234A (enExample) |
| AT (1) | AT282815B (enExample) |
| BE (1) | BE667613A (enExample) |
| BR (1) | BR6571729D0 (enExample) |
| CH (1) | CH437655A (enExample) |
| DE (1) | DE1491859A1 (enExample) |
| DK (1) | DK120908B (enExample) |
| ES (1) | ES316139A1 (enExample) |
| FI (1) | FI46324C (enExample) |
| GB (1) | GB1108291A (enExample) |
| NL (1) | NL149380B (enExample) |
| SE (1) | SE314769B (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2323368A1 (fr) * | 1975-09-11 | 1977-04-08 | Kimberly Clark Co | Dispositifs d'introduction de tampons periodiques |
| EP0159629A3 (en) * | 1984-04-23 | 1986-10-15 | Kimberley-Clark Corporation | Reverse folded convolutely wound tampon tube |
| US5346468A (en) * | 1992-01-13 | 1994-09-13 | Tambrands Inc. | Tampon applicator |
| US5433912A (en) * | 1994-03-03 | 1995-07-18 | Kimberly-Clark Corporation | Process for injection molding arcuately-shaped hollow articles |
| US5690884A (en) * | 1995-05-04 | 1997-11-25 | Kimberly-Clark Worldwide, Inc. | Method of injection molding a thin walled article |
| RU2166525C2 (ru) * | 1995-02-17 | 2001-05-10 | МакНЕЙЛ-ППС, ИНК. | Термосклеиваемое разлагающееся полотно, впитывающее изделие, тампон и аппликатор для тампона |
| US6423025B1 (en) | 2000-06-30 | 2002-07-23 | Herve Buzot | Catamenial applicator having a fingergrip |
| US6572577B1 (en) | 2000-06-23 | 2003-06-03 | Mcneil-Ppc, Inc. | Applicator for catamenial device having improved gripper end |
| US6673032B2 (en) | 2001-03-30 | 2004-01-06 | Mcneil-Ppc, Inc. | Applicator having improved gripper end |
| CN104888295A (zh) * | 2015-05-07 | 2015-09-09 | 广东美捷威通生物科技有限公司 | 一种阴道冲洗液输送器 |
Families Citing this family (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3431909A (en) * | 1965-11-04 | 1969-03-11 | Scott Paper Co | Uncompressed tampon and applicator |
| US3433225A (en) * | 1965-12-22 | 1969-03-18 | Joseph A Voss | Hygienic devices and methods of making the same |
| US3568577A (en) * | 1967-12-12 | 1971-03-09 | Joseph A Voss | Applicators for catamenial devices |
| US3581744A (en) * | 1968-05-03 | 1971-06-01 | Joseph A Voss | Laminated tube structure |
| BE758152A (fr) * | 1969-11-07 | 1971-04-28 | Oreal | Conditionnement de tampons catameniaux |
| US3760808A (en) * | 1969-12-01 | 1973-09-25 | K Bleuer | Tampon applicator assembly |
| US3667465A (en) * | 1969-12-08 | 1972-06-06 | Kimberly Clark Co | Applicator tubes for suppositories and the like |
| US3628533A (en) * | 1970-04-20 | 1971-12-21 | Johnson & Johnson | Domed-tipped applicator for catamenial tampons |
| US3696812A (en) * | 1970-08-13 | 1972-10-10 | Tampax Inc | Tampon applicator |
| US3674026A (en) * | 1970-12-28 | 1972-07-04 | Kimberly Clark Co | Tampon insertion device |
| US3765416A (en) * | 1971-08-04 | 1973-10-16 | Kimberly Clark Co | Locking arrangement for plastic telescoping tubes used to insert tampons and the like |
| US3807399A (en) * | 1971-12-09 | 1974-04-30 | Kimberly Clark Co | Tampon applicator |
| US3805786A (en) * | 1973-03-28 | 1974-04-23 | Kimberly Clark Co | Tampon applicator combination |
| US3895634A (en) * | 1973-10-18 | 1975-07-22 | Rapid American Corp | Tampon inserter |
| US4361150A (en) * | 1980-04-07 | 1982-11-30 | Voss Joseph A | Extruded plastic hygienic applicator |
| DE3121364A1 (de) * | 1981-05-29 | 1982-12-16 | Henkel KGaA, 4000 Düsseldorf | "applikator zum hygienischen einfuehren eines tampons" |
| US4573964A (en) * | 1983-10-17 | 1986-03-04 | Kimberly-Clark Corporation | Outer tampon tube with recessed finger grip |
| US4650459A (en) * | 1985-10-21 | 1987-03-17 | Kimberly-Clark Corporation | Convolutely wound paper tampon tube |
| JPH03106365A (ja) * | 1989-09-20 | 1991-05-02 | Kao Corp | タンポン |
| DE4002975C1 (enExample) * | 1990-02-01 | 1991-01-03 | Johnson & Johnson Gmbh, 4000 Duesseldorf, De | |
| DE9014464U1 (de) * | 1990-10-18 | 1990-12-20 | Johnson & Johnson GmbH, 4000 Düsseldorf | Tamponapplikator |
| DE69324239T2 (de) * | 1992-01-21 | 1999-11-04 | The Regents Of The University Of Minnesota, Minneapolis | Verschlusseinrichtung eines septumschadens |
| US5348534A (en) * | 1992-11-06 | 1994-09-20 | Tambrands Inc. | Tampon applicator |
| US5279541A (en) * | 1992-11-06 | 1994-01-18 | Tambrands Inc. | Tampon applicator |
| US5330421A (en) * | 1992-12-04 | 1994-07-19 | Tambrands Inc. | Tampon applicator |
| AU677612B2 (en) * | 1992-12-31 | 1997-05-01 | Mcneil-Ppc, Inc. | Environmentally friendly catamenial tampon assembly and method of construction |
| US5814073A (en) * | 1996-12-13 | 1998-09-29 | Bonutti; Peter M. | Method and apparatus for positioning a suture anchor |
| CA2114815C (en) * | 1993-02-24 | 2005-06-14 | Mark Kevin Melius | Absorbent composite |
| US5454820A (en) * | 1993-07-14 | 1995-10-03 | Ethicon, Inc. | Method of tying knots using a tube knot applicator |
| US5571540A (en) * | 1994-09-06 | 1996-11-05 | Kimberly-Clark Corporation | Apparatus for crimping, pleating and forming a tip on a hollow tube |
| US5501063A (en) * | 1994-09-06 | 1996-03-26 | Kimberly-Clark Corporation | Apparatus and method of reducing the force to expel a tampon from a tampon applicator and the applicator itself |
| US5683358A (en) * | 1994-12-29 | 1997-11-04 | Kimberly-Clark Worldwide, Inc. | Applicator for holding and dispensing a substance |
| US5614230A (en) * | 1994-12-29 | 1997-03-25 | Kimberly-Clark Corporation | Apparatus for forming a curl on an end of a tubular member |
| US5643196A (en) * | 1995-03-03 | 1997-07-01 | Tambrands Inc. | Tampon applicator |
| US5713921A (en) * | 1996-03-29 | 1998-02-03 | Bonutti; Peter M. | Suture anchor |
| US5718717A (en) | 1996-08-19 | 1998-02-17 | Bonutti; Peter M. | Suture anchor |
| US5948002A (en) * | 1996-11-15 | 1999-09-07 | Bonutti; Peter M. | Apparatus and method for use in positioning a suture anchor |
| US5806527A (en) * | 1997-06-04 | 1998-09-15 | Borodulin; German | Urethral plug with means for protection against infection |
| US6045551A (en) | 1998-02-06 | 2000-04-04 | Bonutti; Peter M. | Bone suture |
| US6416488B1 (en) | 1998-08-12 | 2002-07-09 | Playtex Products, Inc. | Tampon applicator with taped finger grip |
| US6368343B1 (en) | 2000-03-13 | 2002-04-09 | Peter M. Bonutti | Method of using ultrasonic vibration to secure body tissue |
| US6592609B1 (en) * | 1999-08-09 | 2003-07-15 | Bonutti 2003 Trust-A | Method and apparatus for securing tissue |
| US6447516B1 (en) | 1999-08-09 | 2002-09-10 | Peter M. Bonutti | Method of securing tissue |
| WO2001021075A1 (en) * | 1999-09-20 | 2001-03-29 | Sapi Med S.P.A. | Accessory for a transanal access surgical instrument and, in particular, for a mechanical circular suturing device |
| US6635073B2 (en) * | 2000-05-03 | 2003-10-21 | Peter M. Bonutti | Method of securing body tissue |
| US7094251B2 (en) | 2002-08-27 | 2006-08-22 | Marctec, Llc. | Apparatus and method for securing a suture |
| US9138222B2 (en) | 2000-03-13 | 2015-09-22 | P Tech, Llc | Method and device for securing body tissue |
| US6719765B2 (en) | 2001-12-03 | 2004-04-13 | Bonutti 2003 Trust-A | Magnetic suturing system and method |
| GB2385273B (en) | 2002-02-13 | 2004-05-26 | Deborah Huang | Drug delivery device |
| US6923789B2 (en) * | 2002-02-22 | 2005-08-02 | Playtex Products, Inc. | Multiple-component tampon applicator |
| US9155544B2 (en) | 2002-03-20 | 2015-10-13 | P Tech, Llc | Robotic systems and methods |
| AU2003238300A1 (en) | 2002-06-21 | 2004-01-06 | Playtex Products, Inc. | Tapered tampon applicator |
| US7727208B2 (en) | 2002-09-12 | 2010-06-01 | Playtex Products, Inc. | Ergonomic tampon applicator |
| USD492033S1 (en) | 2003-04-04 | 2004-06-22 | Playtex Products, Inc. | Tampon applicator assembly |
| USD572362S1 (en) | 2003-04-04 | 2008-07-01 | Playtex Products, Inc. | Tampon applicator with finger grip |
| AU2003203792B1 (en) * | 2003-04-22 | 2004-05-06 | Deborah Huang | Drug delivery device |
| US7497864B2 (en) | 2003-04-30 | 2009-03-03 | Marctec, Llc. | Tissue fastener and methods for using same |
| US9192522B2 (en) | 2003-05-02 | 2015-11-24 | Eveready Battery Company, Inc. | Tampon assembly having shaped pledget |
| US20080039873A1 (en) | 2004-03-09 | 2008-02-14 | Marctec, Llc. | Method and device for securing body tissue |
| US9173647B2 (en) | 2004-10-26 | 2015-11-03 | P Tech, Llc | Tissue fixation system |
| US9463012B2 (en) | 2004-10-26 | 2016-10-11 | P Tech, Llc | Apparatus for guiding and positioning an implant |
| US20060089646A1 (en) | 2004-10-26 | 2006-04-27 | Bonutti Peter M | Devices and methods for stabilizing tissue and implants |
| US9271766B2 (en) | 2004-10-26 | 2016-03-01 | P Tech, Llc | Devices and methods for stabilizing tissue and implants |
| US9089323B2 (en) | 2005-02-22 | 2015-07-28 | P Tech, Llc | Device and method for securing body tissue |
| US11253296B2 (en) | 2006-02-07 | 2022-02-22 | P Tech, Llc | Methods and devices for intracorporeal bonding of implants with thermal energy |
| US8496657B2 (en) | 2006-02-07 | 2013-07-30 | P Tech, Llc. | Methods for utilizing vibratory energy to weld, stake and/or remove implants |
| US7967820B2 (en) * | 2006-02-07 | 2011-06-28 | P Tech, Llc. | Methods and devices for trauma welding |
| US11278331B2 (en) | 2006-02-07 | 2022-03-22 | P Tech Llc | Method and devices for intracorporeal bonding of implants with thermal energy |
| US8308675B2 (en) * | 2006-03-31 | 2012-11-13 | Mcneil-Ppc, Inc. | Applicator device |
| US11246638B2 (en) | 2006-05-03 | 2022-02-15 | P Tech, Llc | Methods and devices for utilizing bondable materials |
| KR101154134B1 (ko) | 2006-06-12 | 2012-06-14 | 플레이텍스 프로덕츠, 엘엘씨. | 거즈의 적절한 신체내 위치를 제공하는 탐폰 어셈블리 |
| US8617185B2 (en) | 2007-02-13 | 2013-12-31 | P Tech, Llc. | Fixation device |
| EP2231035B1 (en) | 2007-12-21 | 2019-08-07 | Smith & Nephew, Inc. | Multiple portal guide |
| US9826992B2 (en) | 2007-12-21 | 2017-11-28 | Smith & Nephew, Inc. | Multiple portal guide |
| US20100100028A1 (en) * | 2008-10-21 | 2010-04-22 | Steven Ray Gilbert | Applicators having improved light scattering properties |
| WO2010099222A1 (en) | 2009-02-24 | 2010-09-02 | P Tech, Llc | Methods and devices for utilizing bondable materials |
| KR20150023200A (ko) | 2010-09-27 | 2015-03-05 | 스미스 앤드 네퓨, 인크. | 관절경 수술 동안의 사용 장치 및 방법 |
| EP2635199A1 (en) | 2010-11-03 | 2013-09-11 | Smith & Nephew, Inc. | Drill guide |
| US8790352B2 (en) * | 2011-10-03 | 2014-07-29 | Smith & Nephew, Inc. | Ovoid tunnel guide and method of ACL reconstruction |
| US10076377B2 (en) | 2013-01-05 | 2018-09-18 | P Tech, Llc | Fixation systems and methods |
| US10058393B2 (en) | 2015-10-21 | 2018-08-28 | P Tech, Llc | Systems and methods for navigation and visualization |
| US11439803B2 (en) * | 2019-01-31 | 2022-09-13 | Niva Medtech LLC | Medicant applicator |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2092427A (en) * | 1932-07-13 | 1937-09-07 | Ross Frederick Alexnader | Catamenial device |
| US2413480A (en) * | 1944-04-07 | 1946-12-31 | Sanitary Tampon Corp | Tampon applicator |
| US2739593A (en) * | 1954-02-25 | 1956-03-27 | Zonite Products Corp | Medicated vaginal tampons |
| US3204635A (en) * | 1963-03-21 | 1965-09-07 | Voss | Hygienic devices |
-
1964
- 1964-08-05 US US387590A patent/US3347234A/en not_active Expired - Lifetime
-
1965
- 1965-07-27 GB GB32075/65A patent/GB1108291A/en not_active Expired
- 1965-07-29 BE BE667613D patent/BE667613A/xx unknown
- 1965-07-29 DE DE19651491859 patent/DE1491859A1/de active Pending
- 1965-07-29 NL NL656509800A patent/NL149380B/xx unknown
- 1965-07-30 BR BR171729/65A patent/BR6571729D0/pt unknown
- 1965-07-30 CH CH1074665A patent/CH437655A/fr unknown
- 1965-07-30 AT AT708965A patent/AT282815B/de not_active IP Right Cessation
- 1965-08-02 SE SE10102/65A patent/SE314769B/xx unknown
- 1965-08-04 ES ES0316139A patent/ES316139A1/es not_active Expired
- 1965-08-05 DK DK402365AA patent/DK120908B/da unknown
- 1965-08-05 FI FI651892A patent/FI46324C/fi active
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2323368A1 (fr) * | 1975-09-11 | 1977-04-08 | Kimberly Clark Co | Dispositifs d'introduction de tampons periodiques |
| EP0159629A3 (en) * | 1984-04-23 | 1986-10-15 | Kimberley-Clark Corporation | Reverse folded convolutely wound tampon tube |
| US5346468A (en) * | 1992-01-13 | 1994-09-13 | Tambrands Inc. | Tampon applicator |
| US5558631A (en) * | 1992-01-13 | 1996-09-24 | Tambrands Inc. | Tampon applicator |
| AU673812B2 (en) * | 1992-01-13 | 1996-11-28 | Tambrands, Inc. | Tampon applicator |
| US5800377A (en) * | 1992-01-13 | 1998-09-01 | The Procter & Gamble Company | Tampon applicator |
| US5433912A (en) * | 1994-03-03 | 1995-07-18 | Kimberly-Clark Corporation | Process for injection molding arcuately-shaped hollow articles |
| RU2166525C2 (ru) * | 1995-02-17 | 2001-05-10 | МакНЕЙЛ-ППС, ИНК. | Термосклеиваемое разлагающееся полотно, впитывающее изделие, тампон и аппликатор для тампона |
| US5690884A (en) * | 1995-05-04 | 1997-11-25 | Kimberly-Clark Worldwide, Inc. | Method of injection molding a thin walled article |
| US6572577B1 (en) | 2000-06-23 | 2003-06-03 | Mcneil-Ppc, Inc. | Applicator for catamenial device having improved gripper end |
| US6648846B2 (en) | 2000-06-23 | 2003-11-18 | Mcneil-Ppc, Inc. | Applicator for catamenial device having improved gripper end |
| US6423025B1 (en) | 2000-06-30 | 2002-07-23 | Herve Buzot | Catamenial applicator having a fingergrip |
| US6673032B2 (en) | 2001-03-30 | 2004-01-06 | Mcneil-Ppc, Inc. | Applicator having improved gripper end |
| CN104888295A (zh) * | 2015-05-07 | 2015-09-09 | 广东美捷威通生物科技有限公司 | 一种阴道冲洗液输送器 |
Also Published As
| Publication number | Publication date |
|---|---|
| NL149380B (nl) | 1976-05-17 |
| US3347234A (en) | 1967-10-17 |
| DK120908B (da) | 1971-08-02 |
| DE1491859A1 (de) | 1969-05-22 |
| FI46324C (fi) | 1973-03-12 |
| BE667613A (enExample) | 1966-01-31 |
| SE314769B (enExample) | 1969-09-15 |
| AT282815B (de) | 1970-07-10 |
| CH437655A (fr) | 1967-06-15 |
| BR6571729D0 (pt) | 1973-08-02 |
| FI46324B (enExample) | 1972-11-30 |
| ES316139A1 (es) | 1965-11-01 |
| NL6509800A (enExample) | 1966-02-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1108291A (en) | Improved hygienic devices | |
| US6500140B1 (en) | Flexible applicator for inserting an article into a mammalian body cavity | |
| US3575169A (en) | Hygienic medium applicator | |
| US4412833A (en) | Tampon applicator | |
| GB1179707A (en) | Improved Hygienic Applicator and Methods of Making the same | |
| US4610659A (en) | Tampon pack | |
| GB1272863A (en) | Laminated tube structure | |
| US3206104A (en) | Self-stick carrying handle | |
| US4235341A (en) | Spirally wound container with strippable layer | |
| US3499447A (en) | Tampon applicator | |
| US5599293A (en) | Environmentally friendly catamenial tampon assembly and method of construction | |
| US5601530A (en) | Paper applicator containing a water-insoluble coating | |
| GB1333095A (en) | Applicator tubes for suppositories | |
| GB1024184A (en) | Device for introducing objects into body cavities | |
| JPH0634797B2 (ja) | タンポンチューブ形成用平面紙 | |
| NZ245671A (en) | Tampon applicator; holder and plunger have outer paper layer covered with a polymer film layer | |
| GB1503258A (en) | Champion international corp laminate foils and the production of packages | |
| EP0966941B1 (en) | Method of making a coated tampon applicator | |
| US3429312A (en) | Tampon applicator | |
| EP1877020A1 (en) | Novel tampon applicator | |
| EP0800374B2 (en) | An applicator for holding and dispensing a substance | |
| SE466646B (sv) | Hoptryckbar behaallare bildad av laminat innehaallande skikt av en fluorpolymer och ett metallfolieskikt | |
| US4622030A (en) | Reverse folded convolutely wound tampon tube | |
| CA2221042A1 (en) | Apparatus and method of making a paper applicator containing a water-insoluble coating and the applicator itself | |
| GB2006914A (en) | Laminated Tube |