FR2285861A1 - Composes diaryle soufres et diaryle oxygenes - Google Patents
Composes diaryle soufres et diaryle oxygenesInfo
- Publication number
- FR2285861A1 FR2285861A1 FR7528134A FR7528134A FR2285861A1 FR 2285861 A1 FR2285861 A1 FR 2285861A1 FR 7528134 A FR7528134 A FR 7528134A FR 7528134 A FR7528134 A FR 7528134A FR 2285861 A1 FR2285861 A1 FR 2285861A1
- Authority
- FR
- France
- Prior art keywords
- diaryl
- sulfur
- oxygen compounds
- compounds
- oxygen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 DIARYL OXYGEN COMPOUNDS Chemical class 0.000 title 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 title 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical compound C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 title 1
- 229910052717 sulfur Inorganic materials 0.000 title 1
- 239000011593 sulfur Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/12—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines
- C07C259/14—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines having carbon atoms of hydroxamidine groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
- C07C59/70—Ethers of hydroxy-acetic acid, e.g. substitutes on the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/22—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/205—Radicals derived from carbonic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4238774A GB1519147A (en) | 1974-09-30 | 1974-09-30 | Sulphur and oxygen-containing diaryl compounds |
| GB158775 | 1975-01-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2285861A1 true FR2285861A1 (fr) | 1976-04-23 |
| FR2285861B1 FR2285861B1 (enExample) | 1979-01-05 |
Family
ID=26236846
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR7528134A Granted FR2285861A1 (fr) | 1974-09-30 | 1975-09-12 | Composes diaryle soufres et diaryle oxygenes |
| FR7706632A Granted FR2340301A1 (fr) | 1974-09-30 | 1977-03-07 | Composes diaryle soufres et diaryle oxygenes |
| FR7706633A Granted FR2340306A1 (fr) | 1974-09-30 | 1977-03-07 | Composes diaryle soufres et diaryle oxygenes |
| FR7706631A Granted FR2340297A1 (fr) | 1974-09-30 | 1977-03-07 | Composes diaryle soufres et diaryle oxygenes |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR7706632A Granted FR2340301A1 (fr) | 1974-09-30 | 1977-03-07 | Composes diaryle soufres et diaryle oxygenes |
| FR7706633A Granted FR2340306A1 (fr) | 1974-09-30 | 1977-03-07 | Composes diaryle soufres et diaryle oxygenes |
| FR7706631A Granted FR2340297A1 (fr) | 1974-09-30 | 1977-03-07 | Composes diaryle soufres et diaryle oxygenes |
Country Status (2)
| Country | Link |
|---|---|
| FR (4) | FR2285861A1 (enExample) |
| GB (1) | GB1519147A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2346329A1 (fr) * | 1976-03-31 | 1977-10-28 | Hoechst Ag | Derives d'acides phenoxy-phenoxy-alcanoiques et composes apparentes, utilisables dans des produits herbicides |
| FR2362816A1 (fr) * | 1976-08-25 | 1978-03-24 | Hoechst Ag | Derives du (phenoxy-4 phenoxy)-2 pentane, leur preparation et leur application comme herbicides. |
| FR2387940A1 (fr) * | 1977-04-07 | 1978-11-17 | Lafon Labor | Derives de 4-(4-(4-chlorophenoxy)-phenoxy)-phenol, utiles notamment en therapeutique, et leur procede de preparation |
| EP0000351A1 (de) * | 1977-07-07 | 1979-01-24 | Ciba-Geigy Ag | Phenoxy-phenylthio-alkancarbonsäurederivate, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und als Pflanzenwachstumsregulierungsmittel |
| EP0000359A1 (de) * | 1977-07-07 | 1979-01-24 | Ciba-Geigy Ag | Phenoxy-phenylsulfinyl- und -sulfonyl-alkancarbonsäure-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und als Pflanzenwachstumsregulierungsmittel. |
| FR2483232A1 (fr) * | 1980-02-07 | 1981-12-04 | Richardson Merrell Inc | Nouveaux agents anti-rhinovirus et leur procede de preparation |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0226855D0 (en) | 2002-11-18 | 2002-12-24 | Queen Mary & Westfield College | Histone deacetylase inhibitors |
| GB0620823D0 (en) | 2006-10-19 | 2006-11-29 | Univ London | Histone deacetylase inhibitors |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1497506A (fr) * | 1965-05-27 | 1967-10-13 | Merck & Co Inc | Acides 4-phénoxy-alcanoïques substitués et leur procédé de fabrication |
| FR2000174A1 (enExample) * | 1968-01-11 | 1969-08-29 | Hoechst Ag | |
| FR2147138A1 (enExample) * | 1971-07-23 | 1973-03-09 | Hoechst Ag | |
| FR2184906A1 (enExample) * | 1972-05-17 | 1973-12-28 | Hoechst Ag | |
| FR2205337A1 (en) * | 1972-11-07 | 1974-05-31 | Erba Carlo Spa | Para-phenyl thio phenoxy alkylcarboxylic acid derivs - as hypolipidaemic agents |
| FR2258846A1 (en) * | 1974-01-25 | 1975-08-22 | Lafon Labor | Bis((N-hydroxy alkyl)-amino alkyl thio)alkane and derivs - as agents preventing blood platelet aggregation |
-
1974
- 1974-09-30 GB GB4238774A patent/GB1519147A/en not_active Expired
-
1975
- 1975-09-12 FR FR7528134A patent/FR2285861A1/fr active Granted
-
1977
- 1977-03-07 FR FR7706632A patent/FR2340301A1/fr active Granted
- 1977-03-07 FR FR7706633A patent/FR2340306A1/fr active Granted
- 1977-03-07 FR FR7706631A patent/FR2340297A1/fr active Granted
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1497506A (fr) * | 1965-05-27 | 1967-10-13 | Merck & Co Inc | Acides 4-phénoxy-alcanoïques substitués et leur procédé de fabrication |
| FR2000174A1 (enExample) * | 1968-01-11 | 1969-08-29 | Hoechst Ag | |
| FR2147138A1 (enExample) * | 1971-07-23 | 1973-03-09 | Hoechst Ag | |
| FR2184906A1 (enExample) * | 1972-05-17 | 1973-12-28 | Hoechst Ag | |
| FR2205337A1 (en) * | 1972-11-07 | 1974-05-31 | Erba Carlo Spa | Para-phenyl thio phenoxy alkylcarboxylic acid derivs - as hypolipidaemic agents |
| FR2258846A1 (en) * | 1974-01-25 | 1975-08-22 | Lafon Labor | Bis((N-hydroxy alkyl)-amino alkyl thio)alkane and derivs - as agents preventing blood platelet aggregation |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2346329A1 (fr) * | 1976-03-31 | 1977-10-28 | Hoechst Ag | Derives d'acides phenoxy-phenoxy-alcanoiques et composes apparentes, utilisables dans des produits herbicides |
| FR2362816A1 (fr) * | 1976-08-25 | 1978-03-24 | Hoechst Ag | Derives du (phenoxy-4 phenoxy)-2 pentane, leur preparation et leur application comme herbicides. |
| FR2387940A1 (fr) * | 1977-04-07 | 1978-11-17 | Lafon Labor | Derives de 4-(4-(4-chlorophenoxy)-phenoxy)-phenol, utiles notamment en therapeutique, et leur procede de preparation |
| EP0000351A1 (de) * | 1977-07-07 | 1979-01-24 | Ciba-Geigy Ag | Phenoxy-phenylthio-alkancarbonsäurederivate, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und als Pflanzenwachstumsregulierungsmittel |
| EP0000359A1 (de) * | 1977-07-07 | 1979-01-24 | Ciba-Geigy Ag | Phenoxy-phenylsulfinyl- und -sulfonyl-alkancarbonsäure-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Herbizide und als Pflanzenwachstumsregulierungsmittel. |
| FR2483232A1 (fr) * | 1980-02-07 | 1981-12-04 | Richardson Merrell Inc | Nouveaux agents anti-rhinovirus et leur procede de preparation |
| FR2494264A1 (fr) * | 1980-02-07 | 1982-05-21 | Merrell Dow Pharma | Nouveaux composes appartenant a la famille des ethers et thioethers de biphenyle, benzylphenyle, benzyloxyphenyle, benzylthiophenyle d'a,o-glycols et hydroxythiols |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2340301A1 (fr) | 1977-09-02 |
| FR2285861B1 (enExample) | 1979-01-05 |
| FR2340297B1 (enExample) | 1983-08-19 |
| FR2340297A1 (fr) | 1977-09-02 |
| FR2340301B1 (enExample) | 1983-08-19 |
| FR2340306A1 (fr) | 1977-09-02 |
| FR2340306B1 (enExample) | 1978-11-10 |
| GB1519147A (en) | 1978-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE833843A (fr) | Composes diaryle soufres et diaryle oxygenes | |
| AT347888B (de) | Windelverschluss | |
| AT347889B (de) | Windelverschluss | |
| SE7512628L (sv) | Tennorganisk forening innehallande svavel | |
| AT346167B (de) | Endlos-briefumschlag | |
| SE7512995L (sv) | Respirator | |
| AT347374B (de) | Windelverschluss | |
| AT347375B (de) | Windelverschluss | |
| AT347377B (de) | Windelverschluss | |
| AT352045B (de) | Windelverschluss | |
| BR7504538A (pt) | Fecho eclair | |
| AT351385B (de) | Verschluss | |
| TR19318A (tr) | 4-metiltio-2-triflorometilmetansulfonanilid ve tuerevleri | |
| IT1033817B (it) | Registratore o riproduttore | |
| GB1541525A (en) | Reduction of sulphur dioxide | |
| FR2285861A1 (fr) | Composes diaryle soufres et diaryle oxygenes | |
| FR2293204A1 (fr) | 6-methylergolines 8,8-disubstituees et composes apparentes | |
| SE7507088L (sv) | Apovinkamin- och desoxivinkaminsyraamider | |
| AT347376B (de) | Windelverschluss | |
| JPS5126197A (ja) | Ryudoseizairyoyohosotai | |
| SE7511546L (sv) | Tetningsmedel och forfarande for framstellning derav | |
| BE853235R (fr) | Composes diaryle soufres et diaryle oxygenes | |
| BR7500370A (pt) | Composicao de resina estabilizada e composicao estabilizadora | |
| JPS5145581A (en) | Kankyoyo so2 keikobunsekikei | |
| DK240375A (da) | Skriveformularmateriale |