FI66902C - Stabila detergentsuspensioner i vaetskeform - Google Patents
Stabila detergentsuspensioner i vaetskeform Download PDFInfo
- Publication number
- FI66902C FI66902C FI813156A FI813156A FI66902C FI 66902 C FI66902 C FI 66902C FI 813156 A FI813156 A FI 813156A FI 813156 A FI813156 A FI 813156A FI 66902 C FI66902 C FI 66902C
- Authority
- FI
- Finland
- Prior art keywords
- weight
- liquid
- liquid medium
- hectorite
- detergent
- Prior art date
Links
- 239000007788 liquid Substances 0.000 claims description 43
- 239000000203 mixture Substances 0.000 claims description 41
- 239000003599 detergent Substances 0.000 claims description 25
- 239000002609 medium Substances 0.000 claims description 20
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 claims description 17
- 229910000271 hectorite Inorganic materials 0.000 claims description 17
- 239000004927 clay Substances 0.000 claims description 15
- 239000003792 electrolyte Substances 0.000 claims description 8
- 239000012736 aqueous medium Substances 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 4
- 239000003082 abrasive agent Substances 0.000 claims description 3
- 229940094522 laponite Drugs 0.000 description 10
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 10
- 238000009472 formulation Methods 0.000 description 9
- 239000013618 particulate matter Substances 0.000 description 9
- 229910021532 Calcite Inorganic materials 0.000 description 8
- 239000000725 suspension Substances 0.000 description 7
- 238000004140 cleaning Methods 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 239000000375 suspending agent Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- -1 Macaloid Chemical compound 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002304 perfume Substances 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- AZJYLVAUMGUUBL-UHFFFAOYSA-A u1qj22mc8e Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O=[Si]=O.O=[Si]=O.O=[Si]=O.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 AZJYLVAUMGUUBL-UHFFFAOYSA-A 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229910018068 Li 2 O Inorganic materials 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 210000000941 bile Anatomy 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 229910002016 Aerosil® 200 Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0013—Liquid compositions with insoluble particles in suspension
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/1253—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite
- C11D3/1266—Layer silicates, e.g. talcum, kaolin, clay, bentonite, smectite, montmorillonite, hectorite or attapulgite in liquid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8033467 | 1980-10-16 | ||
| GB8033467 | 1980-10-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI813156L FI813156L (fi) | 1982-04-17 |
| FI66902B FI66902B (fi) | 1984-08-31 |
| FI66902C true FI66902C (fi) | 1984-12-10 |
Family
ID=10516724
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI813156A FI66902C (fi) | 1980-10-16 | 1981-10-12 | Stabila detergentsuspensioner i vaetskeform |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4397755A (show.php) |
| EP (1) | EP0050887B1 (show.php) |
| JP (1) | JPS6019957B2 (show.php) |
| AR (1) | AR225974A1 (show.php) |
| AT (1) | ATE7307T1 (show.php) |
| AU (1) | AU545841B2 (show.php) |
| BR (1) | BR8106661A (show.php) |
| CA (1) | CA1157340A (show.php) |
| DE (1) | DE3163411D1 (show.php) |
| DK (1) | DK457681A (show.php) |
| ES (1) | ES506280A0 (show.php) |
| FI (1) | FI66902C (show.php) |
| GR (1) | GR75380B (show.php) |
| NO (1) | NO813478L (show.php) |
| NZ (1) | NZ198609A (show.php) |
| PT (1) | PT73830B (show.php) |
| ZA (1) | ZA817103B (show.php) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3264940D1 (en) * | 1981-11-13 | 1985-08-29 | Unilever Nv | Stable liquid detergent suspensions |
| US4512908A (en) * | 1983-07-05 | 1985-04-23 | Economics Laboratory, Inc. | Highly alkaline liquid warewashing emulsion stabilized by clay thickener |
| GB8328076D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| GB8328078D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| GB8328075D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| GB8328991D0 (en) * | 1983-10-31 | 1983-11-30 | Unilever Plc | Liquid scouring compositions |
| US4599186A (en) * | 1984-04-20 | 1986-07-08 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4657692A (en) * | 1984-04-20 | 1987-04-14 | The Clorox Company | Thickened aqueous abrasive scouring cleanser |
| US4695394A (en) * | 1984-04-20 | 1987-09-22 | The Clorox Company | Thickened aqueous cleanser |
| DE3430637A1 (de) * | 1984-08-21 | 1986-03-06 | Mandelcosmetic Wien Gmbh | Reinigungsmittel zur koerperpflege |
| US4670171A (en) * | 1985-02-26 | 1987-06-02 | Pennzoil Company | Surface cleaner composition |
| US4846992A (en) * | 1987-06-17 | 1989-07-11 | Colgate-Palmolive Company | Built thickened stable non-aqueous cleaning composition and method of use, and package therefor |
| US4786432A (en) * | 1986-05-05 | 1988-11-22 | Go-Jo Industries, Inc. | Integral dry abrasive soap powders |
| US4786369A (en) * | 1986-05-05 | 1988-11-22 | Go-Jo Industries, Inc. | Integral dry abrasive soap powders |
| US4704222A (en) * | 1986-09-05 | 1987-11-03 | Noxell Corporation | Gelled abrasive detergent composition |
| DE3713962A1 (de) * | 1987-04-25 | 1988-11-10 | Henkel Kgaa | Waeschevorbehandlungsmittel fuer oel- und fettanschmutzungen |
| GB8711059D0 (en) * | 1987-05-11 | 1987-06-17 | Unilever Plc | Detergent liquid |
| GB8711060D0 (en) * | 1987-05-11 | 1987-06-17 | Unilever Plc | Detergent liquid processing |
| US5004556A (en) * | 1987-06-17 | 1991-04-02 | Colgate-Palmolive Company | Built thickened stable non-aqueous cleaning composition and method of use |
| US5160448A (en) * | 1987-12-30 | 1992-11-03 | Lever Brothers Company, Division Of Conopco, Inc. | Gel detergent compositions containing a clay and a cross-linked polycarboxylic polymer |
| US4842757A (en) * | 1988-01-21 | 1989-06-27 | The Clorox Company | Thickened liquid, improved stability abrasive cleanser |
| US4943429A (en) * | 1988-05-23 | 1990-07-24 | Church & Dwight Co., Inc. | Dentifrice gels containing sodium bicarbonate |
| GB8816112D0 (en) * | 1988-07-06 | 1988-08-10 | Unilever Plc | Detergent compositions |
| GB2228740A (en) * | 1989-03-03 | 1990-09-05 | Unilever Plc | Cleaning composition |
| JPH03158746A (ja) * | 1989-11-16 | 1991-07-08 | Nec Corp | 壜胴欠陥検査装置 |
| CA2096505C (en) * | 1992-05-21 | 1999-09-21 | Robert Stanley Lee | Exfoliant composition |
| JP3187622B2 (ja) * | 1993-10-07 | 2001-07-11 | カネボウ株式会社 | リポソーム |
| WO1996000276A1 (en) * | 1994-06-27 | 1996-01-04 | Unilever N.V. | Detergent composition |
| TW294720B (show.php) * | 1994-09-30 | 1997-01-01 | Unilever Nv | |
| US5679877A (en) * | 1996-06-14 | 1997-10-21 | Colgate-Palmolive Co. | Thickened liquid cleaning composition containing an abrasive |
| GB2361929A (en) * | 2000-05-05 | 2001-11-07 | Procter & Gamble | Liquid detergent compositions |
| DE10061897A1 (de) * | 2000-12-12 | 2002-06-13 | Clariant Gmbh | Wasch- und Reinigungsmittel, enthaltend mikrodisperse silikathaltige Partikel |
| US8518001B2 (en) | 2007-06-13 | 2013-08-27 | The Procter & Gamble Company | Skin treatment device |
| GB201108912D0 (en) * | 2011-05-27 | 2011-07-13 | Reckitt Benckiser Nv | Composition |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3522186A (en) * | 1966-12-12 | 1970-07-28 | Procter & Gamble | Abrasive liquid detergent compositions |
| GB1471278A (en) * | 1973-07-06 | 1977-04-21 | Colgate Palmolive Co | Liquid abrasive compositions |
| US4005027A (en) * | 1973-07-10 | 1977-01-25 | The Procter & Gamble Company | Scouring compositions |
| US3884826A (en) * | 1973-07-20 | 1975-05-20 | Barnes Hind Pharm Inc | Thixotropic cleaning agent for hard contact lenses |
| GB1495549A (en) * | 1974-04-17 | 1977-12-21 | Procter & Gamble | Scouring compositions |
| US4129527A (en) * | 1974-11-07 | 1978-12-12 | The Clorox Company | Liquid abrasive detergent composition and method for preparing same |
| US4116849A (en) * | 1977-03-14 | 1978-09-26 | The Procter & Gamble Company | Thickened bleach compositions for treating hard-to-remove soils |
| GB1534680A (en) * | 1977-10-14 | 1978-12-06 | Colgate Palmolive Co | Cleaning compositions |
| US4235732A (en) * | 1978-02-08 | 1980-11-25 | The Procter & Gamble Company | Liquid bleaching compositions |
| US4178254A (en) * | 1978-03-13 | 1979-12-11 | The Procter & Gamble Company | Fabric care compositions containing smectite clay and starch |
| US4352678A (en) * | 1978-10-02 | 1982-10-05 | Lever Brothers Company | Thickened abrasive bleaching compositions |
| US4248728A (en) * | 1979-02-28 | 1981-02-03 | Chemed Corporation | Liquid scouring cleanser |
-
1981
- 1981-10-07 DE DE8181201115T patent/DE3163411D1/de not_active Expired
- 1981-10-07 EP EP81201115A patent/EP0050887B1/en not_active Expired
- 1981-10-07 AT AT81201115T patent/ATE7307T1/de active
- 1981-10-12 NZ NZ198609A patent/NZ198609A/en unknown
- 1981-10-12 FI FI813156A patent/FI66902C/fi not_active IP Right Cessation
- 1981-10-13 GR GR66272A patent/GR75380B/el unknown
- 1981-10-13 AU AU76295/81A patent/AU545841B2/en not_active Ceased
- 1981-10-14 ZA ZA817103A patent/ZA817103B/xx unknown
- 1981-10-15 PT PT73830A patent/PT73830B/pt unknown
- 1981-10-15 BR BR8106661A patent/BR8106661A/pt unknown
- 1981-10-15 DK DK457681A patent/DK457681A/da not_active Application Discontinuation
- 1981-10-15 NO NO813478A patent/NO813478L/no unknown
- 1981-10-15 US US06/311,498 patent/US4397755A/en not_active Expired - Fee Related
- 1981-10-15 AR AR287097A patent/AR225974A1/es active
- 1981-10-15 CA CA000388031A patent/CA1157340A/en not_active Expired
- 1981-10-15 ES ES506280A patent/ES506280A0/es active Granted
- 1981-10-16 JP JP56164356A patent/JPS6019957B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6019957B2 (ja) | 1985-05-18 |
| BR8106661A (pt) | 1982-06-29 |
| CA1157340A (en) | 1983-11-22 |
| FI813156L (fi) | 1982-04-17 |
| AU545841B2 (en) | 1985-08-01 |
| US4397755A (en) | 1983-08-09 |
| ATE7307T1 (de) | 1984-05-15 |
| NZ198609A (en) | 1984-10-19 |
| FI66902B (fi) | 1984-08-31 |
| AR225974A1 (es) | 1982-05-14 |
| AU7629581A (en) | 1983-04-21 |
| ES8302083A1 (es) | 1983-01-01 |
| DE3163411D1 (en) | 1984-06-07 |
| ES506280A0 (es) | 1983-01-01 |
| EP0050887A1 (en) | 1982-05-05 |
| NO813478L (no) | 1982-04-19 |
| EP0050887B1 (en) | 1984-05-02 |
| GR75380B (show.php) | 1984-07-13 |
| ZA817103B (en) | 1983-05-25 |
| JPS5796097A (en) | 1982-06-15 |
| PT73830A (en) | 1981-11-01 |
| PT73830B (en) | 1983-11-07 |
| DK457681A (da) | 1982-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66902C (fi) | Stabila detergentsuspensioner i vaetskeform | |
| US4657692A (en) | Thickened aqueous abrasive scouring cleanser | |
| CA1041307A (en) | Scouring compositions | |
| US4599186A (en) | Thickened aqueous abrasive scouring cleanser | |
| EP0160342B2 (en) | Liquid bleaching compositions | |
| CA1222426A (en) | Thixotropic automatic dishwasher composition with chlorine bleach | |
| US5338528A (en) | Alkali metal silicate composition with sodium carbonate additive | |
| FI90253B (fi) | Astianpesukoneissa käytettävä vesipitoinen, tiksotrooppinen koostumus sekä menetelmä sen stabiilisuuden parantamiseksi | |
| US5346641A (en) | Thickened aqueous abrasive cleanser with improved colloidal stability | |
| GB1590744A (en) | Cleansing compositions | |
| US4136051A (en) | Pourable washing compositions containing a luminosilicates and non-ionics and method for their preparation | |
| JPS61291698A (ja) | 物理的安定性が改善されたチキソトロピ−性液体自動皿洗い機用洗剤組成物 | |
| US4248728A (en) | Liquid scouring cleanser | |
| CA1336670C (en) | Thickened pourable aqueous cleaner | |
| US3214380A (en) | Liquid scouring cleanser for removing organic stains from hard surfaces | |
| US4530775A (en) | Stable liquid detergent suspensions | |
| CA1318214C (en) | Thixotropic aqueous liquid automatic dishwashing detergent composition | |
| US5298181A (en) | Thickened pourable aqueous abrasive cleanser | |
| TW323303B (show.php) | ||
| US5120465A (en) | Detergent or cleansing composition and additive for imparting thixotropic properties thereto | |
| JPH0323119B2 (show.php) | ||
| CA1211675A (en) | Liquid detergent composition | |
| GB2138039A (en) | Bleaching and laundering composition free of water-soluble silicates | |
| KR100207895B1 (ko) | 콜로이달 안정성을 갖는 농축 수성 연마 세정제 | |
| JPH11302686A (ja) | 粒状ノニオン洗剤組成物及びその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: UNILEVER N.V. |