FI61594C - Digitaliskt synkroniseringssystem - Google Patents
Digitaliskt synkroniseringssystem Download PDFInfo
- Publication number
- FI61594C FI61594C FI2961/74A FI296174A FI61594C FI 61594 C FI61594 C FI 61594C FI 2961/74 A FI2961/74 A FI 2961/74A FI 296174 A FI296174 A FI 296174A FI 61594 C FI61594 C FI 61594C
- Authority
- FI
- Finland
- Prior art keywords
- synchronization
- counter
- switch terminal
- pulses
- pulse
- Prior art date
Links
- 238000010586 diagram Methods 0.000 description 3
- 238000004804 winding Methods 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- 230000036039 immunity Effects 0.000 description 2
- SBUYBNIDQXQZSZ-UHFFFAOYSA-N p-aminophenylphosphocholine Chemical compound C[N+](C)(C)CCOP([O-])(=O)OC1=CC=C(N)C=C1 SBUYBNIDQXQZSZ-UHFFFAOYSA-N 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 230000008054 signal transmission Effects 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/04—Synchronising
- H04N5/12—Devices in which the synchronising signals are only operative if a phase difference occurs between synchronising and synchronised scanning devices, e.g. flywheel synchronising
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Synchronizing For Television (AREA)
- Details Of Television Scanning (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US40770073 | 1973-10-18 | ||
| US407700A US3878336A (en) | 1973-10-18 | 1973-10-18 | Digital synchronizing system |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI296174A7 FI296174A7 (esLanguage) | 1975-04-19 |
| FI61594B FI61594B (fi) | 1982-04-30 |
| FI61594C true FI61594C (fi) | 1982-08-10 |
Family
ID=23613176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI2961/74A FI61594C (fi) | 1973-10-18 | 1974-10-11 | Digitaliskt synkroniseringssystem |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3878336A (esLanguage) |
| JP (1) | JPS5241162B2 (esLanguage) |
| AR (1) | AR208525A1 (esLanguage) |
| AT (1) | AT345359B (esLanguage) |
| BE (1) | BE821101A (esLanguage) |
| CA (1) | CA1040300A (esLanguage) |
| DE (1) | DE2449535C3 (esLanguage) |
| DK (1) | DK146899C (esLanguage) |
| ES (1) | ES431141A1 (esLanguage) |
| FI (1) | FI61594C (esLanguage) |
| FR (1) | FR2248660B1 (esLanguage) |
| GB (1) | GB1474816A (esLanguage) |
| IT (1) | IT1022776B (esLanguage) |
| NL (1) | NL181544C (esLanguage) |
| PL (1) | PL92976B1 (esLanguage) |
| SE (1) | SE391266B (esLanguage) |
| TR (1) | TR18144A (esLanguage) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1562732A (en) * | 1976-02-10 | 1980-03-12 | Allen & Hanburys Ltd | Device for dispensing medicaments |
| US4025952A (en) * | 1976-06-09 | 1977-05-24 | Gte Sylvania Incorporated | Vertical synchronizing circuit |
| US4025951A (en) * | 1976-06-09 | 1977-05-24 | Gte Sylvania Incorporated | Vertical synchronizing circuit having adjustable sync pulse window |
| JPS6043709B2 (ja) * | 1977-07-13 | 1985-09-30 | 日本電気株式会社 | 垂直同期装置 |
| DE2737749C2 (de) * | 1977-08-22 | 1987-04-30 | Siemens AG, 1000 Berlin und 8000 München | Schaltungsanordnung zum Unterdrücken von Störimpulsen, die während der Synchronimpulse ein Videogerät erreichen |
| US4250525A (en) * | 1979-05-09 | 1981-02-10 | Rca Corporation | Television horizontal AFPC with phase detector driven at twice the horizontal frequency |
| FR2568434B1 (fr) * | 1979-05-09 | 1989-10-13 | Rca Corp | Dispositif de synchronisation d'une boucle verrouillee en phase pour synchroniser un oscillateur dans un recepteur de television |
| JPS5752266A (en) * | 1980-09-12 | 1982-03-27 | Sanyo Electric Co Ltd | Picture stabilizing circuit of television set |
| FR2493085A1 (fr) * | 1980-10-24 | 1982-04-30 | Thomson Brandt | Circuit de synchronisation-trame numerique pour recepteur de television |
| JPS5986967A (ja) * | 1982-11-11 | 1984-05-19 | Seiko Epson Corp | 垂直同期制御回路及びテレビジョン受像機 |
| DE3512755A1 (de) * | 1985-04-10 | 1986-10-16 | Institut für Rundfunktechnik GmbH, 8000 München | Verfahren zum feststellen der zeitlichen lage der vertikalsynchronimpulse in einem fbas- oder bas-signal |
| KR930005185B1 (ko) * | 1986-07-18 | 1993-06-16 | 상요덴기 가부시기가이샤 | 동기 주파수 자동 조절장치 |
| US5140421A (en) * | 1986-09-11 | 1992-08-18 | Kabushiki Kaisha Toshiba | Video signal processing pulse producing circuit |
| US4868659A (en) * | 1987-04-30 | 1989-09-19 | Rca Licensing Corporation | Deflection circuit for non-standard signal source |
| EP0936807A4 (en) * | 1997-08-29 | 2007-05-02 | Matsushita Electric Industrial Co Ltd | SYNCHRONIZATION SIGNAL GENERATOR |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3311701A (en) * | 1963-10-30 | 1967-03-28 | Gen Electric | Vertical synchronization system for use in a television receiver |
| US3530238A (en) * | 1967-12-04 | 1970-09-22 | Gen Telephone & Elect | Digital synchronizing system for television receivers |
| DE1929332C3 (de) * | 1969-06-10 | 1972-01-13 | Grundig Emv | Synchronisierschaltung fuer die bildablenkung in fernseh empfaengern |
| US3688037A (en) * | 1970-09-30 | 1972-08-29 | Rca Corp | Synchronizing system |
| US3691297A (en) * | 1971-05-06 | 1972-09-12 | Zenith Radio Corp | Synchronization phase-lock system for a digital vertical synchronization system |
| US3751588A (en) * | 1972-06-02 | 1973-08-07 | Gte Sylvania Inc | Vertical synchronizing circuitry |
-
1973
- 1973-10-18 US US407700A patent/US3878336A/en not_active Expired - Lifetime
-
1974
- 1974-10-09 SE SE7412700A patent/SE391266B/xx not_active IP Right Cessation
- 1974-10-10 IT IT28300/74A patent/IT1022776B/it active
- 1974-10-10 GB GB4392874A patent/GB1474816A/en not_active Expired
- 1974-10-11 FI FI2961/74A patent/FI61594C/fi active
- 1974-10-14 FR FR7434432A patent/FR2248660B1/fr not_active Expired
- 1974-10-15 BE BE149560A patent/BE821101A/xx not_active IP Right Cessation
- 1974-10-15 CA CA211,428A patent/CA1040300A/en not_active Expired
- 1974-10-16 TR TR18144A patent/TR18144A/xx unknown
- 1974-10-16 AR AR256137A patent/AR208525A1/es active
- 1974-10-17 AT AT836774A patent/AT345359B/de not_active IP Right Cessation
- 1974-10-17 DE DE2449535A patent/DE2449535C3/de not_active Expired
- 1974-10-17 NL NLAANVRAGE7413651,A patent/NL181544C/xx not_active IP Right Cessation
- 1974-10-17 JP JP49120210A patent/JPS5241162B2/ja not_active Expired
- 1974-10-17 DK DK544474A patent/DK146899C/da not_active IP Right Cessation
- 1974-10-18 PL PL1974174920A patent/PL92976B1/pl unknown
- 1974-10-18 ES ES431141A patent/ES431141A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5241162B2 (esLanguage) | 1977-10-17 |
| SE7412700L (esLanguage) | 1975-04-21 |
| FR2248660B1 (esLanguage) | 1978-11-24 |
| JPS5068612A (esLanguage) | 1975-06-09 |
| PL92976B1 (esLanguage) | 1977-04-30 |
| ATA836774A (de) | 1978-01-15 |
| DK146899B (da) | 1984-01-30 |
| DE2449535A1 (de) | 1975-04-30 |
| AU7427074A (en) | 1976-04-15 |
| AR208525A1 (es) | 1977-02-15 |
| NL181544B (nl) | 1987-04-01 |
| DK544474A (esLanguage) | 1975-06-30 |
| FI296174A7 (esLanguage) | 1975-04-19 |
| SE391266B (sv) | 1977-02-07 |
| AT345359B (de) | 1978-09-11 |
| ES431141A1 (es) | 1976-11-01 |
| BE821101A (fr) | 1975-02-03 |
| FR2248660A1 (esLanguage) | 1975-05-16 |
| CA1040300A (en) | 1978-10-10 |
| IT1022776B (it) | 1978-04-20 |
| US3878336A (en) | 1975-04-15 |
| GB1474816A (en) | 1977-05-25 |
| DE2449535B2 (de) | 1978-08-03 |
| NL181544C (nl) | 1987-09-01 |
| DK146899C (da) | 1984-07-09 |
| TR18144A (tr) | 1976-10-11 |
| DE2449535C3 (de) | 1982-03-25 |
| NL7413651A (nl) | 1975-04-22 |
| FI61594B (fi) | 1982-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI61594C (fi) | Digitaliskt synkroniseringssystem | |
| US4096528A (en) | Standard/nonstandard internal vertical sync producing apparatus | |
| DK143728B (da) | Lodret synkroniseringskredsloeb for fjernsynsmodtagere | |
| US3899635A (en) | Dual mode deflection synchronizing system | |
| US4504862A (en) | Digital circuit for generating a binary signal on the occurrence of a given frequency ratio of two signals | |
| US3978285A (en) | Frame synchronizing device | |
| US4684988A (en) | Circuit arrangement for detecting the vertical blanking periods in a picture signal | |
| FI61596B (fi) | Krets foer automatisk foerstaerkningsreglering foer televisionsapparater | |
| FI78590C (fi) | Styrkrets foer bildroer. | |
| US3689688A (en) | Communications secrecy system | |
| US4224639A (en) | Digital synchronizing circuit | |
| US4198659A (en) | Vertical synchronizing signal detector for television video signal reception | |
| US3735027A (en) | Decoding scrambled television | |
| US3991270A (en) | Circuit arrangement for line synchronization in a television receiver | |
| GB1156104A (en) | Frame Synchronising Circuit for a Time Division Multiplex Communication System. | |
| KR100272734B1 (ko) | 비디오 신호의 큰 위상 시프트에 영향을 받지 않는 수평 라인 카운터 | |
| US5835154A (en) | Circuit arrangement for deriving pulses of horizontal and vertical frequency | |
| EP0819352A1 (en) | Vertical synchronisation signal detector | |
| SU1427597A1 (ru) | Устройство формировани гас щего импульса | |
| SU1238124A1 (ru) | Устройство дл счета числа частиц | |
| EP0040275A1 (en) | Comparison circuit adaptable for utilization in a television receiver or the like | |
| GB775931A (en) | Colour television synchronizing circuits | |
| JPS6357992B2 (esLanguage) | ||
| JPH07135664A (ja) | 映像信号判定回路 | |
| KR800000118B1 (ko) | 이중 모우드 편향 동기장치 |