FI61318C - Foerfarande foer framstaellning av vattenloesliga i huvudsak kedjeformiga polymerer - Google Patents
Foerfarande foer framstaellning av vattenloesliga i huvudsak kedjeformiga polymerer Download PDFInfo
- Publication number
- FI61318C FI61318C FI753396A FI753396A FI61318C FI 61318 C FI61318 C FI 61318C FI 753396 A FI753396 A FI 753396A FI 753396 A FI753396 A FI 753396A FI 61318 C FI61318 C FI 61318C
- Authority
- FI
- Finland
- Prior art keywords
- polymer
- water
- radiation
- monomer
- solution
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 25
- 229920000642 polymer Polymers 0.000 claims description 120
- 239000000178 monomer Substances 0.000 claims description 98
- 239000000243 solution Substances 0.000 claims description 87
- 230000005855 radiation Effects 0.000 claims description 77
- 238000006116 polymerization reaction Methods 0.000 claims description 53
- 238000006243 chemical reaction Methods 0.000 claims description 40
- 239000003999 initiator Substances 0.000 claims description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- 239000000126 substance Substances 0.000 claims description 29
- 239000007864 aqueous solution Substances 0.000 claims description 15
- 229920003169 water-soluble polymer Polymers 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000001450 anions Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 238000010494 dissociation reaction Methods 0.000 claims description 4
- 230000005593 dissociations Effects 0.000 claims description 4
- 229920003176 water-insoluble polymer Polymers 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims 1
- 229910052753 mercury Inorganic materials 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 45
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- 239000000047 product Substances 0.000 description 28
- 150000003254 radicals Chemical class 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 15
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 14
- 235000015110 jellies Nutrition 0.000 description 13
- 239000008274 jelly Substances 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 11
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 11
- -1 peroxide compounds Chemical class 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 9
- 239000008367 deionised water Substances 0.000 description 8
- 229910021641 deionized water Inorganic materials 0.000 description 8
- 239000012467 final product Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- PQUXFUBNSYCQAL-UHFFFAOYSA-N 1-(2,3-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(F)=C1F PQUXFUBNSYCQAL-UHFFFAOYSA-N 0.000 description 5
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 description 5
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 5
- VFXXTYGQYWRHJP-UHFFFAOYSA-N 4,4'-azobis(4-cyanopentanoic acid) Chemical compound OC(=O)CCC(C)(C#N)N=NC(C)(CCC(O)=O)C#N VFXXTYGQYWRHJP-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 229940047670 sodium acrylate Drugs 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 230000009969 flowable effect Effects 0.000 description 4
- 229920006158 high molecular weight polymer Polymers 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical group C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229920006317 cationic polymer Polymers 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 230000005865 ionizing radiation Effects 0.000 description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 229920006318 anionic polymer Polymers 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- DTGWMJJKPLJKQD-UHFFFAOYSA-N butyl 2,2-dimethylpropaneperoxoate Chemical group CCCCOOC(=O)C(C)(C)C DTGWMJJKPLJKQD-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- SPSNALDHELHFIJ-UHFFFAOYSA-N 2-[(1-cyano-1-cyclopropylethyl)diazenyl]-2-cyclopropylpropanenitrile Chemical compound C1CC1C(C)(C#N)N=NC(C)(C#N)C1CC1 SPSNALDHELHFIJ-UHFFFAOYSA-N 0.000 description 1
- NHJSXWHZNJAINC-UHFFFAOYSA-N 2-butoxy-2-oxoethaneperoxoic acid Chemical compound C(CCC)OC(C(=O)OO)=O NHJSXWHZNJAINC-UHFFFAOYSA-N 0.000 description 1
- KUVTXOLSUBBXPH-UHFFFAOYSA-N 2-tert-butylperoxy-2-methylpropane;2,2-dimethylpropanoic acid Chemical compound CC(C)(C)C(O)=O.CC(C)(C)OOC(C)(C)C KUVTXOLSUBBXPH-UHFFFAOYSA-N 0.000 description 1
- HPUSHAOHRBOVMT-UHFFFAOYSA-N 4-(trityldiazenyl)phenol Chemical compound OC1=CC=C(C=C1)N=NC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 HPUSHAOHRBOVMT-UHFFFAOYSA-N 0.000 description 1
- PUSFAMYRLVUKIK-UHFFFAOYSA-N CC1(NC=CN1C=C)C Chemical group CC1(NC=CN1C=C)C PUSFAMYRLVUKIK-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229940048053 acrylate Drugs 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- YFMFSCRSAWIWOP-UHFFFAOYSA-N phenyl(trityl)diazene Chemical compound C1=CC=CC=C1N=NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 YFMFSCRSAWIWOP-UHFFFAOYSA-N 0.000 description 1
- 229920005594 polymer fiber Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Landscapes
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI753396A FI61318C (fi) | 1975-12-02 | 1975-12-02 | Foerfarande foer framstaellning av vattenloesliga i huvudsak kedjeformiga polymerer |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI753396 | 1975-12-02 | ||
| FI753396A FI61318C (fi) | 1975-12-02 | 1975-12-02 | Foerfarande foer framstaellning av vattenloesliga i huvudsak kedjeformiga polymerer |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI753396A7 FI753396A7 (OSRAM) | 1977-06-03 |
| FI61318B FI61318B (fi) | 1982-03-31 |
| FI61318C true FI61318C (fi) | 1982-07-12 |
Family
ID=8509586
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI753396A FI61318C (fi) | 1975-12-02 | 1975-12-02 | Foerfarande foer framstaellning av vattenloesliga i huvudsak kedjeformiga polymerer |
Country Status (1)
| Country | Link |
|---|---|
| FI (1) | FI61318C (OSRAM) |
-
1975
- 1975-12-02 FI FI753396A patent/FI61318C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI753396A7 (OSRAM) | 1977-06-03 |
| FI61318B (fi) | 1982-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4024040A (en) | Polymerization of unsaturated monomers with radiation in the presence of salts | |
| US3948740A (en) | Polymerization of water soluble monomers with radiation and chemical initiator | |
| Dainton et al. | Polymerization of methacrylamide in aqueous solution. Part 1.—Hydrogen-peroxide photosensitized reaction | |
| US2982762A (en) | Continuous polymerization of n-vinyl lactams | |
| RU2007144484A (ru) | Способы радикальной полимеризации для получения галогенированных полимеров, галогенированные полимеры и изделия из них | |
| US4121986A (en) | Process for the polymerization of polyallylamines in the presence of a mineral acid solution | |
| US5185385A (en) | Polymerization process | |
| US3022279A (en) | Process for making hydrolyzed polyacrylamide | |
| US3509114A (en) | Process for polymerization of water-soluble acrylic monomers | |
| US3738972A (en) | Process for production of styrene/acrylonitrile copolymers | |
| FI61318C (fi) | Foerfarande foer framstaellning av vattenloesliga i huvudsak kedjeformiga polymerer | |
| US3969329A (en) | Process for producing high molecular weight acrylamide water-soluble polymers by controlling the viscosity of the polymerization reaction medium with a water-miscible organic solvent | |
| US3990958A (en) | Radiation polymerization of triallylamines using a non-polar, non-hydroxylic solvent | |
| SU1242000A3 (ru) | Способ разработки нефт ных залежей | |
| US4066524A (en) | Imidazole polymers and preparation thereof with radiation and chemical initiator | |
| US3585118A (en) | Process for the bulk photocopolymerization of polyaminesulfones | |
| US3681215A (en) | Manufacture of acrylamide-based polymers in liquid ammonia | |
| RU2446178C1 (ru) | Способ получения полиметилметакрилата | |
| US3803104A (en) | High molecular weight and low viscosity vinylpyrrolidone polymer flocculants and catalyst and process producing the same | |
| US2877216A (en) | Production of poly-n vinylcarbazole | |
| US6818677B1 (en) | Process for producing water-soluble polymer | |
| Kubota et al. | Photopolymerization synthesis of poly (N‐isopropylacrylamide) hydrogels | |
| Fanood et al. | Aqueous solution polymerization of acrylamide at low conversions: 1. Kinetics and transfer studies | |
| JP4449247B2 (ja) | 水溶性重合体の製造方法 | |
| Nayak et al. | Grafting vinyl monomers onto wool fibers IV. Graft copolymerization of methyl methacrylate onto wool using peroxydisulfate catalysed by silver ions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: HERCULES INCORPORATED |